From dad9f027e3c4c00ae7b53c72501cf5af8641b8f4 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Wed, 22 Apr 2020 15:46:54 -0700 Subject: [PATCH 001/126] minor tweak --- tests/pytest/simpletest_no_sudo.sh | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/tests/pytest/simpletest_no_sudo.sh b/tests/pytest/simpletest_no_sudo.sh index 61faf3df52..135a7d8814 100755 --- a/tests/pytest/simpletest_no_sudo.sh +++ b/tests/pytest/simpletest_no_sudo.sh @@ -10,4 +10,5 @@ export PYTHONPATH=$(pwd)/../../src/connector/python/linux/python3 export LD_LIBRARY_PATH=$LD_LIBRARY_PATH:$(pwd)/../../build/build/lib # Now we are all let, and let's run our cases! -python3 ./test.py -m 127.0.0.1 -f insert/basic.py +# python3 ./test.py -m 127.0.0.1 -f insert/basic.py +./random_walk.py From 741ba77cb2ed46fa9618328f307fa667aa6bcda0 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Thu, 23 Apr 2020 01:15:14 -0700 Subject: [PATCH 002/126] Now using deterministic dice --- .gitignore | 2 + tests/pytest/random_walk.py | 344 ++++++++++++++++++++++++++++++++++++ 2 files changed, 346 insertions(+) create mode 100755 tests/pytest/random_walk.py diff --git a/.gitignore b/.gitignore index e91d6739a5..8520c50b98 100644 --- a/.gitignore +++ b/.gitignore @@ -34,3 +34,5 @@ Target/ *.sql sim/ +# Doxygen Generated files +html/ diff --git a/tests/pytest/random_walk.py b/tests/pytest/random_walk.py new file mode 100755 index 0000000000..5866351a99 --- /dev/null +++ b/tests/pytest/random_walk.py @@ -0,0 +1,344 @@ +#!/usr/bin/python3 +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- +import sys +import getopt + +import threading +import random +import logging + +from util.log import * +from util.dnodes import * +from util.cases import * +from util.sql import * + +import taos + +# Constants +LOGGING_LEVEL = logging.DEBUG + +def runThread(workerThread): + logger.info("Running Thread: {}".format(workerThread.tid)) + workerThread.run() + +class WorkerThread: + def __init__(self, pool, tid): # note: main thread context! + self.curStep = -1 + self.pool = pool + self.tid = tid + # self.threadIdent = threading.get_ident() + self.thread = threading.Thread(target=runThread, args=(self,)) + self.stepGate = threading.Condition() + + def start(self): + self.thread.start() # AFTER the thread is recorded + + def run(self): + # initialization after thread starts, in the thread context + self.isSleeping = False + + while self.curStep < self.pool.maxSteps: + # stepNo = self.pool.waitForStep() # Step to run + self.crossStepGate() # self.curStep will get incremented + self.doWork() + + def verifyThreadSelf(self): # ensure we are called by this own thread + if ( threading.get_ident() != self.thread.ident ): + raise RuntimeError("Unexpectly called from other threads") + + def verifyThreadMain(self): # ensure we are called by the main thread + if ( threading.get_ident() != threading.main_thread().ident ): + raise RuntimeError("Unexpectly called from other threads") + + def verifyThreadAlive(self): + if ( not self.thread.is_alive() ): + raise RuntimeError("Unexpected dead thread") + + def verifyIsSleeping(self, isSleeping): + if ( isSleeping != self.isSleeping ): + raise RuntimeError("Unexpected thread sleep status") + + def crossStepGate(self): + self.verifyThreadAlive() + self.verifyThreadSelf() # only allowed by ourselves + self.verifyIsSleeping(False) # has to be awake + + logger.debug("Worker thread {} going to sleep".format(self.tid)) + self.isSleeping = True # TODO: maybe too early? + self.pool.reportThreadWaiting() # TODO: this triggers the main thread, TOO early + + # Actually going to sleep + self.stepGate.acquire() # acquire lock immediately + self.stepGate.wait() # release and then acquire + self.stepGate.release() # release + + logger.debug("Worker thread {} woke up".format(self.tid)) + # Someone will wake us up here + self.curStep += 1 # off to a new step... + + def tapStepGate(self): # give it a tap, release the thread waiting there + self.verifyThreadAlive() + self.verifyThreadMain() # only allowed for main thread + self.verifyIsSleeping(True) # has to be sleeping + + logger.debug("Tapping worker thread {}".format(self.tid)) + self.stepGate.acquire() + # logger.debug("Tapping worker thread {}, lock acquired".format(self.tid)) + self.stepGate.notify() # wake up! + # logger.debug("Tapping worker thread {}, notified!".format(self.tid)) + self.isSleeping = False # No race condition for sure + self.stepGate.release() # this finishes before .wait() can return + # logger.debug("Tapping worker thread {}, lock released".format(self.tid)) + time.sleep(0) # let the released thread run a bit, IMPORTANT, do it after release + + def doWork(self): + logger.info(" Step {}, thread {}: ".format(self.curStep, self.tid)) + self.pool.dispatcher.doWork() + + +# We define a class to run a number of threads in locking steps. +class SteppingThreadPool: + def __init__(self, numThreads, maxSteps, funcSequencer): + self.numThreads = numThreads + self.maxSteps = maxSteps + self.funcSequencer = funcSequencer + # Internal class variables + self.dispatcher = WorkDispatcher(self) + self.curStep = 0 + self.threadList = [] + # self.stepGate = threading.Condition() # Gate to hold/sync all threads + self.numWaitingThreads = 0 + + # Thread coordination + self.lock = threading.Lock() # for critical section execution + self.mainGate = threading.Condition() + + # starting to run all the threads, in locking steps + def run(self): + # Create the threads + for tid in range(0, self.numThreads): + workerThread = WorkerThread(self, tid) + self.threadList.append(workerThread) + workerThread.start() # start, but should block immediately before step 0 + + # Coordinate all threads step by step + self.curStep = -1 # not started yet + while(self.curStep < self.maxSteps): + logger.debug("Main thread going to sleep") + self.mainGate.acquire() + self.mainGate.wait() # start snoozing + self.mainGate.release + logger.debug("Main thread woke up") # Now not all threads had time to go to sleep + time.sleep(0.01) # This is like forever + + self.curStep += 1 # starts with 0 + self.tapAllThreads() + + # The threads will run through many steps + for workerThread in self.threadList: + workerThread.thread.join() # slight hack, accessing members + + logger.info("All threads finished") + + def reportThreadWaiting(self): + allThreadWaiting = False + with self.lock: + self.numWaitingThreads += 1 + if ( self.numWaitingThreads == self.numThreads ): + allThreadWaiting = True + + if (allThreadWaiting): # aha, pass the baton to the main thread + logger.debug("All threads are now waiting") + self.numWaitingThreads = 0 # do this 1st to avoid race condition + # time.sleep(0.001) # thread yield, so main thread can be ready + self.mainGate.acquire() + self.mainGate.notify() # main thread would now start to run + self.mainGate.release() + time.sleep(0) # yield, maybe main thread can run for just a bit + + # def waitForStep(self): + # shouldWait = True; + # with self.lock: + # # if ( self.numWaitingThreads == 0 ): # first one here + # # self.stepGate.acquire() # acquire the underlying lock + + # self.numWaitingThreads += 1 + # # if ( self.numWaitingThreads < self.numThreads ): + # # do nothing, we should wait + # if ( self.numWaitingThreads == self.numThreads ): + # shouldWait = False # we should now wake up + # elif ( self.numWaitingThreads > self.numThreads ): + # raise RuntimeError("Corrupt state") + + # self.stepGate.acquire() + # if (shouldWait): + # self.stepGate.wait() + # else: + # self.numWaitingThreads = 0 # fresh start + # self.curStep += 1 # do this before letting all threads loose + # print("--> Starting step {}".format(self.curStep), end="\r\n") # before notify_all + # # self.stepGate.notify_all() + # self.wakeUpAll() + # self.stepGate.release() + # return self.curStep + + def tapAllThreads(self): # in a deterministic manner + wakeSeq = [] + for i in range(self.numThreads): # generate a random sequence + if Dice.throw(2) == 1 : + wakeSeq.append(i) + else: + wakeSeq.insert(0, i) + logger.info("Waking up threads: {}".format(str(wakeSeq))) + for i in wakeSeq: + self.threadList[i].tapStepGate() + time.sleep(0) # yield + +# A queue of continguous POSITIVE integers +class LinearQueue(): + def __init__(self): + self.firstIndex = 1 + self.lastIndex = 0 + + def push(self): # Push to the tail (largest) + if ( self.firstIndex > self.lastIndex ): # impossible, meaning it's empty + self.lastIndex = self.firstIndex + return self.firstIndex + # Otherwise we have something + self.lastIndex += 1 + return self.lastIndex + + def pop(self): + if ( self.firstIndex > self.lastIndex ): # empty + return 0 + index = self.firstIndex + self.firstIndex += 1 + return index + + +# State of the database as we believe it to be +class DbState(): + def __init__(self): + self.tableNumQueue = LinearQueue() + self.openDbServerConnection() + + def openDbServerConnection(self): + cfgPath = "../../build/test/cfg" # was: tdDnodes.getSimCfgPath() + conn = taos.connect(host="127.0.0.1", config=cfgPath) # TODO: make configurable + + tdSql.init(conn.cursor()) + tdSql.prepare() # Recreate database, etc. + # tdSql.execute('show databases') + + def closeDbServerConnection(self): + tdSql.close() + tdLog.info("Disconnecting from database server") + + def getTableNameToCreate(self): + tblNum = self.tableNumQueue.push() + return "table_{}".format(tblNum) + + def getTableNameToDelete(self): + tblNum = self.tableNumQueue.pop() + if( tblNum==0 ) : + return False + return "table_{}".format(tblNum) + +class Task(): + def execute(self): + raise RuntimeError("Must be overriden by child class") + +class CreateTableTask(Task): + def execute(self): + tableName = dbState.getTableNameToCreate() + logger.info(" Creating a table {} ...".format(tableName)) + tdSql.execute("create table {} (ts timestamp, speed int)".format(tableName)) + +class DropTableTask(Task): + def execute(self): + tableName = dbState.getTableNameToDelete() + if ( not tableName ): # May be "False" + logger.info("Cannot generate a table to delete, skipping...") + return + logger.info(" Dropping a table {} ...".format(tableName)) + tdSql.execute("drop table {}".format(tableName)) + +class AddDataTask(Task): + def execute(self): + logger.info(" Adding some data...") + +# Deterministic random number generator +class Dice(): + seeded = False # static, uninitialized + + @classmethod + def seed(cls, s): # static + if (cls.seeded): + raise RuntimeError("Cannot seed the random generator more than once") + cls.verifyRNG() + random.seed(s) + cls.seeded = True # TODO: protect against multi-threading + + @classmethod + def verifyRNG(cls): # Verify that the RNG is determinstic + random.seed(0) + x1 = random.randrange(0, 1000) + x2 = random.randrange(0, 1000) + x3 = random.randrange(0, 1000) + if ( x1 != 864 or x2!=394 or x3!=776 ): + raise RuntimeError("System RNG is not deterministic") + + @classmethod + def throw(cls, max): # get 0 to max-1 + return cls.throwRange(0, max) + + @classmethod + def throwRange(cls, min, max): # up to max-1 + if ( not cls.seeded ): + raise RuntimeError("Cannot throw dice before seeding it") + return random.randrange(min, max) + + +# Anyone needing to carry out work should simply come here +class WorkDispatcher(): + def __init__(self, pool): + self.pool = pool + self.totalNumMethods = 2 + self.tasks = [ + CreateTableTask(), + DropTableTask(), + AddDataTask(), + ] + + def throwDice(self): + return random.randint(0, len(self.tasks) - 1) + + def doWork(self): + dice = self.throwDice() + task = self.tasks[dice] + task.execute() + +if __name__ == "__main__": + logger = logging.getLogger('myApp') + logger.setLevel(LOGGING_LEVEL) + ch = logging.StreamHandler() + logger.addHandler(ch) + + Dice.seed(0) # initial seeding of dice + dbState = DbState() + threadPool = SteppingThreadPool(3, 5, 0) + threadPool.run() + logger.info("Finished running thread pool") + dbState.closeDbServerConnection() + From 73bdaae15ca2459241dee16dc9ce31c84ad437d7 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Mon, 27 Apr 2020 01:52:23 -0700 Subject: [PATCH 003/126] Now using Python barriers and events to sync threads --- tests/pytest/random_walk.py | 234 ++++++++++++++++++++++++++---------- 1 file changed, 170 insertions(+), 64 deletions(-) diff --git a/tests/pytest/random_walk.py b/tests/pytest/random_walk.py index 5866351a99..146066431d 100755 --- a/tests/pytest/random_walk.py +++ b/tests/pytest/random_walk.py @@ -17,6 +17,7 @@ import getopt import threading import random import logging +import datetime from util.log import * from util.dnodes import * @@ -32,6 +33,34 @@ def runThread(workerThread): logger.info("Running Thread: {}".format(workerThread.tid)) workerThread.run() +# Used by one process to block till another is ready +# class Baton: +# def __init__(self): +# self._lock = threading.Lock() # control access to object +# self._baton = threading.Condition() # let thread block +# self._hasGiver = False +# self._hasTaker = False + +# def give(self): +# with self._lock: +# if ( self._hasGiver ): # already? +# raise RuntimeError("Cannot double-give a baton") +# self._hasGiver = True + +# self._settle() # may block, OUTSIDE self lock + +# def take(self): +# with self._lock: +# if ( self._hasTaker): +# raise RuntimeError("Cannot double-take a baton") +# self._hasTaker = True + +# self._settle() + +# def _settle(self): + + + class WorkerThread: def __init__(self, pool, tid): # note: main thread context! self.curStep = -1 @@ -39,14 +68,14 @@ class WorkerThread: self.tid = tid # self.threadIdent = threading.get_ident() self.thread = threading.Thread(target=runThread, args=(self,)) - self.stepGate = threading.Condition() + self.stepGate = threading.Event() def start(self): self.thread.start() # AFTER the thread is recorded def run(self): # initialization after thread starts, in the thread context - self.isSleeping = False + # self.isSleeping = False while self.curStep < self.pool.maxSteps: # stepNo = self.pool.waitForStep() # Step to run @@ -65,23 +94,26 @@ class WorkerThread: if ( not self.thread.is_alive() ): raise RuntimeError("Unexpected dead thread") - def verifyIsSleeping(self, isSleeping): - if ( isSleeping != self.isSleeping ): - raise RuntimeError("Unexpected thread sleep status") + # def verifyIsSleeping(self, isSleeping): + # if ( isSleeping != self.isSleeping ): + # raise RuntimeError("Unexpected thread sleep status") + # A gate is different from a barrier in that a thread needs to be "tapped" def crossStepGate(self): self.verifyThreadAlive() self.verifyThreadSelf() # only allowed by ourselves - self.verifyIsSleeping(False) # has to be awake + # self.verifyIsSleeping(False) # has to be awake - logger.debug("Worker thread {} going to sleep".format(self.tid)) - self.isSleeping = True # TODO: maybe too early? - self.pool.reportThreadWaiting() # TODO: this triggers the main thread, TOO early + logger.debug("Worker thread {} about to cross pool barrier".format(self.tid)) + # self.isSleeping = True # TODO: maybe too early? + self.pool.crossPoolBarrier() # wait for all other threads - # Actually going to sleep - self.stepGate.acquire() # acquire lock immediately - self.stepGate.wait() # release and then acquire - self.stepGate.release() # release + # Wait again at the "gate", waiting to be "tapped" + logger.debug("Worker thread {} about to cross the step gate".format(self.tid)) + # self.stepGate.acquire() # acquire lock immediately + self.stepGate.wait() + self.stepGate.clear() + # self.stepGate.release() # release logger.debug("Worker thread {} woke up".format(self.tid)) # Someone will wake us up here @@ -90,15 +122,15 @@ class WorkerThread: def tapStepGate(self): # give it a tap, release the thread waiting there self.verifyThreadAlive() self.verifyThreadMain() # only allowed for main thread - self.verifyIsSleeping(True) # has to be sleeping + # self.verifyIsSleeping(True) # has to be sleeping logger.debug("Tapping worker thread {}".format(self.tid)) - self.stepGate.acquire() + # self.stepGate.acquire() # logger.debug("Tapping worker thread {}, lock acquired".format(self.tid)) - self.stepGate.notify() # wake up! + self.stepGate.set() # wake up! # logger.debug("Tapping worker thread {}, notified!".format(self.tid)) - self.isSleeping = False # No race condition for sure - self.stepGate.release() # this finishes before .wait() can return + # self.isSleeping = False # No race condition for sure + # self.stepGate.release() # this finishes before .wait() can return # logger.debug("Tapping worker thread {}, lock released".format(self.tid)) time.sleep(0) # let the released thread run a bit, IMPORTANT, do it after release @@ -109,20 +141,21 @@ class WorkerThread: # We define a class to run a number of threads in locking steps. class SteppingThreadPool: - def __init__(self, numThreads, maxSteps, funcSequencer): + def __init__(self, dbState, numThreads, maxSteps, funcSequencer): self.numThreads = numThreads self.maxSteps = maxSteps self.funcSequencer = funcSequencer # Internal class variables - self.dispatcher = WorkDispatcher(self) + self.dispatcher = WorkDispatcher(self, dbState) self.curStep = 0 self.threadList = [] # self.stepGate = threading.Condition() # Gate to hold/sync all threads - self.numWaitingThreads = 0 - + # self.numWaitingThreads = 0 + # Thread coordination - self.lock = threading.Lock() # for critical section execution - self.mainGate = threading.Condition() + self.barrier = threading.Barrier(numThreads + 1) # plus main thread + # self.lock = threading.Lock() # for critical section execution + # self.mainGate = threading.Condition() # starting to run all the threads, in locking steps def run(self): @@ -136,13 +169,15 @@ class SteppingThreadPool: self.curStep = -1 # not started yet while(self.curStep < self.maxSteps): logger.debug("Main thread going to sleep") - self.mainGate.acquire() - self.mainGate.wait() # start snoozing - self.mainGate.release - logger.debug("Main thread woke up") # Now not all threads had time to go to sleep - time.sleep(0.01) # This is like forever + # self.mainGate.acquire() + # self.mainGate.wait() # start snoozing + # self.mainGate.release + self.crossPoolBarrier() + self.barrier.reset() # Other worker threads should now be at the "gate" + + logger.debug("Main thread waking up, tapping worker threads".format(self.curStep)) # Now not all threads had time to go to sleep + # time.sleep(0.01) # This is like forever - self.curStep += 1 # starts with 0 self.tapAllThreads() # The threads will run through many steps @@ -151,21 +186,29 @@ class SteppingThreadPool: logger.info("All threads finished") - def reportThreadWaiting(self): - allThreadWaiting = False - with self.lock: - self.numWaitingThreads += 1 - if ( self.numWaitingThreads == self.numThreads ): - allThreadWaiting = True + def crossPoolBarrier(self): + if ( self.barrier.n_waiting == self.numThreads ): # everyone else is waiting, inc main thread + logger.info("<-- Step {} finished".format(self.curStep)) + self.curStep += 1 # we are about to get into next step. TODO: race condition here! + logger.debug(" ") # line break + logger.debug("--> Step {} starts with main thread waking up".format(self.curStep)) # Now not all threads had time to go to sleep + - if (allThreadWaiting): # aha, pass the baton to the main thread - logger.debug("All threads are now waiting") - self.numWaitingThreads = 0 # do this 1st to avoid race condition - # time.sleep(0.001) # thread yield, so main thread can be ready - self.mainGate.acquire() - self.mainGate.notify() # main thread would now start to run - self.mainGate.release() - time.sleep(0) # yield, maybe main thread can run for just a bit + self.barrier.wait() + # allThreadWaiting = False + # with self.lock: + # self.numWaitingThreads += 1 + # if ( self.numWaitingThreads == self.numThreads ): + # allThreadWaiting = True + + # if (allThreadWaiting): # aha, pass the baton to the main thread + # logger.debug("All threads are now waiting") + # self.numWaitingThreads = 0 # do this 1st to avoid race condition + # # time.sleep(0.001) # thread yield, so main thread can be ready + # self.mainGate.acquire() + # self.mainGate.notify() # main thread would now start to run + # self.mainGate.release() + # time.sleep(0) # yield, maybe main thread can run for just a bit # def waitForStep(self): # shouldWait = True; @@ -201,6 +244,7 @@ class SteppingThreadPool: else: wakeSeq.insert(0, i) logger.info("Waking up threads: {}".format(str(wakeSeq))) + # TODO: set dice seed to a deterministic value for i in wakeSeq: self.threadList[i].tapStepGate() time.sleep(0) # yield @@ -208,30 +252,86 @@ class SteppingThreadPool: # A queue of continguous POSITIVE integers class LinearQueue(): def __init__(self): - self.firstIndex = 1 + self.firstIndex = 1 # 1st ever element self.lastIndex = 0 + self.lock = threading.RLock() # our functions may call each other + self.inUse = set() # the indexes that are in use right now def push(self): # Push to the tail (largest) - if ( self.firstIndex > self.lastIndex ): # impossible, meaning it's empty - self.lastIndex = self.firstIndex - return self.firstIndex - # Otherwise we have something - self.lastIndex += 1 - return self.lastIndex + with self.lock: + if ( self.firstIndex > self.lastIndex ): # impossible, meaning it's empty + self.lastIndex = self.firstIndex + return self.firstIndex + # Otherwise we have something + self.lastIndex += 1 + return self.lastIndex def pop(self): - if ( self.firstIndex > self.lastIndex ): # empty - return 0 - index = self.firstIndex - self.firstIndex += 1 - return index + with self.lock: + if ( self.isEmpty() ): + raise RuntimeError("Cannot pop an empty queue") + index = self.firstIndex + self.firstIndex += 1 + return index + + def isEmpty(self): + return self.firstIndex > self.lastIndex + + def popIfNotEmpty(self): + with self.lock: + if (self.isEmpty()): + return 0 + return self.pop() + + def use(self, i): + with self.lock: + if ( i in self.inUse ): + raise RuntimeError("Cannot re-use same index in queue: {}".format(i)) + self.inUse.add(i) + + def unUse(self, i): + with self.lock: + self.inUse.remove(i) # KeyError possible + + def size(self): + return self.lastIndex + 1 - self.firstIndex + + def allocate(self): + with self.lock: + cnt = 0 # counting the interations + while True: + cnt += 1 + if ( cnt > self.size()*10 ): # 10x iteration already + raise RuntimeError("Failed to allocate LinearQueue element") + ret = Dice.throwRange(self.firstIndex, self.lastIndex+1) + if ( not ret in self.inUse ): + return self.use(ret) # State of the database as we believe it to be class DbState(): def __init__(self): self.tableNumQueue = LinearQueue() + self.tick = datetime.datetime(2019, 1, 1) # initial date time tick + self.int = 0 # initial integer self.openDbServerConnection() + self.lock = threading.RLock() + + def pickTable(self): # pick any table, and "use" it + return self.tableNumQueue.allocate() + + def getNextTick(self): + with self.lock: # prevent duplicate tick + self.tick += datetime.timedelta(0, 1) # add one second to it + return self.tick + + def getNextInt(self): + with self.lock: + self.int += 1 + return self.int + + def unuseTable(self, i): # return the table back, so others can use it + self.tableNumQueue.unUse(i) def openDbServerConnection(self): cfgPath = "../../build/test/cfg" # was: tdDnodes.getSimCfgPath() @@ -250,12 +350,15 @@ class DbState(): return "table_{}".format(tblNum) def getTableNameToDelete(self): - tblNum = self.tableNumQueue.pop() - if( tblNum==0 ) : + if self.tableNumQueue.isEmpty: return False + tblNum = self.tableNumQueue.pop() # TODO: race condition! return "table_{}".format(tblNum) class Task(): + def __init__(self, dbState): + self.dbState = dbState + def execute(self): raise RuntimeError("Must be overriden by child class") @@ -277,6 +380,9 @@ class DropTableTask(Task): class AddDataTask(Task): def execute(self): logger.info(" Adding some data...") + # ds = self.dbState + # tIndex = self.dbState.pickTable() + # tdSql.execute("insert into table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt())) # Deterministic random number generator class Dice(): @@ -312,13 +418,13 @@ class Dice(): # Anyone needing to carry out work should simply come here class WorkDispatcher(): - def __init__(self, pool): + def __init__(self, pool, dbState): self.pool = pool - self.totalNumMethods = 2 + # self.totalNumMethods = 2 self.tasks = [ - CreateTableTask(), - DropTableTask(), - AddDataTask(), + CreateTableTask(dbState), + DropTableTask(dbState), + # AddDataTask(dbState), ] def throwDice(self): @@ -337,7 +443,7 @@ if __name__ == "__main__": Dice.seed(0) # initial seeding of dice dbState = DbState() - threadPool = SteppingThreadPool(3, 5, 0) + threadPool = SteppingThreadPool(dbState, 3, 5, 0) threadPool.run() logger.info("Finished running thread pool") dbState.closeDbServerConnection() From dc2b3437bdf7c2d78cfec2e03bc0770bc015d866 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Mon, 27 Apr 2020 01:58:05 -0700 Subject: [PATCH 004/126] Recreated the tscServer.c:312 crash --- tests/pytest/random_walk.py | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/tests/pytest/random_walk.py b/tests/pytest/random_walk.py index 146066431d..bf714ba694 100755 --- a/tests/pytest/random_walk.py +++ b/tests/pytest/random_walk.py @@ -350,7 +350,7 @@ class DbState(): return "table_{}".format(tblNum) def getTableNameToDelete(self): - if self.tableNumQueue.isEmpty: + if self.tableNumQueue.isEmpty(): return False tblNum = self.tableNumQueue.pop() # TODO: race condition! return "table_{}".format(tblNum) From 884e7fe6352405dd7e36c1c850d6e8b517f0628e Mon Sep 17 00:00:00 2001 From: Steven Li Date: Mon, 27 Apr 2020 02:03:11 -0700 Subject: [PATCH 005/126] Recreated the tscServer.c:312 crash --- tests/pytest/random_walk.py | 32 +++++++++++++++++--------------- 1 file changed, 17 insertions(+), 15 deletions(-) diff --git a/tests/pytest/random_walk.py b/tests/pytest/random_walk.py index bf714ba694..6c4b5c8eec 100755 --- a/tests/pytest/random_walk.py +++ b/tests/pytest/random_walk.py @@ -283,20 +283,20 @@ class LinearQueue(): return 0 return self.pop() - def use(self, i): + def allocate(self, i): with self.lock: if ( i in self.inUse ): raise RuntimeError("Cannot re-use same index in queue: {}".format(i)) self.inUse.add(i) - def unUse(self, i): + def release(self, i): with self.lock: self.inUse.remove(i) # KeyError possible def size(self): return self.lastIndex + 1 - self.firstIndex - def allocate(self): + def pickAndAllocate(self): with self.lock: cnt = 0 # counting the interations while True: @@ -305,7 +305,7 @@ class LinearQueue(): raise RuntimeError("Failed to allocate LinearQueue element") ret = Dice.throwRange(self.firstIndex, self.lastIndex+1) if ( not ret in self.inUse ): - return self.use(ret) + return self.allocate(ret) # State of the database as we believe it to be @@ -317,8 +317,12 @@ class DbState(): self.openDbServerConnection() self.lock = threading.RLock() - def pickTable(self): # pick any table, and "use" it - return self.tableNumQueue.allocate() + def pickAndAllocateTable(self): # pick any table, and "use" it + return self.tableNumQueue.pickAndAllocate() + + def releaseTable(self, i): # return the table back, so others can use it + self.tableNumQueue.release(i) + def getNextTick(self): with self.lock: # prevent duplicate tick @@ -330,9 +334,6 @@ class DbState(): self.int += 1 return self.int - def unuseTable(self, i): # return the table back, so others can use it - self.tableNumQueue.unUse(i) - def openDbServerConnection(self): cfgPath = "../../build/test/cfg" # was: tdDnodes.getSimCfgPath() conn = taos.connect(host="127.0.0.1", config=cfgPath) # TODO: make configurable @@ -380,9 +381,10 @@ class DropTableTask(Task): class AddDataTask(Task): def execute(self): logger.info(" Adding some data...") - # ds = self.dbState - # tIndex = self.dbState.pickTable() - # tdSql.execute("insert into table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt())) + ds = self.dbState + tIndex = ds.pickTable() + tdSql.execute("insert into table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt())) + ds.r # Deterministic random number generator class Dice(): @@ -423,8 +425,8 @@ class WorkDispatcher(): # self.totalNumMethods = 2 self.tasks = [ CreateTableTask(dbState), - DropTableTask(dbState), - # AddDataTask(dbState), + # DropTableTask(dbState), + AddDataTask(dbState), ] def throwDice(self): @@ -443,7 +445,7 @@ if __name__ == "__main__": Dice.seed(0) # initial seeding of dice dbState = DbState() - threadPool = SteppingThreadPool(dbState, 3, 5, 0) + threadPool = SteppingThreadPool(dbState, 1, 5, 0) threadPool.run() logger.info("Finished running thread pool") dbState.closeDbServerConnection() From 6768ae81a68b0bc4b1c5829f557efc29fc9d93dc Mon Sep 17 00:00:00 2001 From: Steven Li Date: Tue, 28 Apr 2020 00:12:53 -0700 Subject: [PATCH 006/126] Now each WorkerThread provides its own SQL execution, but still using a shared db connection --- .../python/linux/python3/taos/cursor.py | 9 + tests/pytest/random_walk.py | 245 ++++++++++-------- 2 files changed, 141 insertions(+), 113 deletions(-) diff --git a/src/connector/python/linux/python3/taos/cursor.py b/src/connector/python/linux/python3/taos/cursor.py index 7a0ae767bc..eee03770ca 100644 --- a/src/connector/python/linux/python3/taos/cursor.py +++ b/src/connector/python/linux/python3/taos/cursor.py @@ -1,6 +1,8 @@ from .cinterface import CTaosInterface from .error import * +querySeqNum = 0 + class TDengineCursor(object): """Database cursor which is used to manage the context of a fetch operation. @@ -109,7 +111,14 @@ class TDengineCursor(object): if params is not None: pass + + # global querySeqNum + # querySeqNum += 1 + # localSeqNum = querySeqNum # avoid raice condition + # print(" >> Exec Query ({}): {}".format(localSeqNum, str(stmt))) res = CTaosInterface.query(self._connection._conn, stmt) + # print(" << Query ({}) Exec Done".format(localSeqNum)) + if res == 0: if CTaosInterface.fieldsCount(self._connection._conn) == 0: self._affected_rows += CTaosInterface.affectedRows(self._connection._conn) diff --git a/tests/pytest/random_walk.py b/tests/pytest/random_walk.py index 6c4b5c8eec..5125d28ec0 100755 --- a/tests/pytest/random_walk.py +++ b/tests/pytest/random_walk.py @@ -62,26 +62,35 @@ def runThread(workerThread): class WorkerThread: - def __init__(self, pool, tid): # note: main thread context! + def __init__(self, pool, tid, dbState): # note: main thread context! self.curStep = -1 self.pool = pool self.tid = tid + self.dbState = dbState # self.threadIdent = threading.get_ident() self.thread = threading.Thread(target=runThread, args=(self,)) self.stepGate = threading.Event() + # Let us have a DB connection of our own + self._dbConn = DbConn() + + def start(self): self.thread.start() # AFTER the thread is recorded def run(self): # initialization after thread starts, in the thread context # self.isSleeping = False + self._dbConn.open() while self.curStep < self.pool.maxSteps: # stepNo = self.pool.waitForStep() # Step to run self.crossStepGate() # self.curStep will get incremented self.doWork() + # clean up + self._dbConn.close() + def verifyThreadSelf(self): # ensure we are called by this own thread if ( threading.get_ident() != self.thread.ident ): raise RuntimeError("Unexpectly called from other threads") @@ -136,7 +145,10 @@ class WorkerThread: def doWork(self): logger.info(" Step {}, thread {}: ".format(self.curStep, self.tid)) - self.pool.dispatcher.doWork() + self.pool.dispatcher.doWork(self) + + def execSql(self, sql): + return self.dbState.execSql(sql) # We define a class to run a number of threads in locking steps. @@ -158,10 +170,9 @@ class SteppingThreadPool: # self.mainGate = threading.Condition() # starting to run all the threads, in locking steps - def run(self): - # Create the threads - for tid in range(0, self.numThreads): - workerThread = WorkerThread(self, tid) + def run(self): + for tid in range(0, self.numThreads): # Create the threads + workerThread = WorkerThread(self, tid, dbState) self.threadList.append(workerThread) workerThread.start() # start, but should block immediately before step 0 @@ -169,15 +180,10 @@ class SteppingThreadPool: self.curStep = -1 # not started yet while(self.curStep < self.maxSteps): logger.debug("Main thread going to sleep") - # self.mainGate.acquire() - # self.mainGate.wait() # start snoozing - # self.mainGate.release self.crossPoolBarrier() - self.barrier.reset() # Other worker threads should now be at the "gate" - + self.barrier.reset() # Other worker threads should now be at the "gate" + logger.debug("Main thread waking up, tapping worker threads".format(self.curStep)) # Now not all threads had time to go to sleep - # time.sleep(0.01) # This is like forever - self.tapAllThreads() # The threads will run through many steps @@ -192,49 +198,8 @@ class SteppingThreadPool: self.curStep += 1 # we are about to get into next step. TODO: race condition here! logger.debug(" ") # line break logger.debug("--> Step {} starts with main thread waking up".format(self.curStep)) # Now not all threads had time to go to sleep - self.barrier.wait() - # allThreadWaiting = False - # with self.lock: - # self.numWaitingThreads += 1 - # if ( self.numWaitingThreads == self.numThreads ): - # allThreadWaiting = True - - # if (allThreadWaiting): # aha, pass the baton to the main thread - # logger.debug("All threads are now waiting") - # self.numWaitingThreads = 0 # do this 1st to avoid race condition - # # time.sleep(0.001) # thread yield, so main thread can be ready - # self.mainGate.acquire() - # self.mainGate.notify() # main thread would now start to run - # self.mainGate.release() - # time.sleep(0) # yield, maybe main thread can run for just a bit - - # def waitForStep(self): - # shouldWait = True; - # with self.lock: - # # if ( self.numWaitingThreads == 0 ): # first one here - # # self.stepGate.acquire() # acquire the underlying lock - - # self.numWaitingThreads += 1 - # # if ( self.numWaitingThreads < self.numThreads ): - # # do nothing, we should wait - # if ( self.numWaitingThreads == self.numThreads ): - # shouldWait = False # we should now wake up - # elif ( self.numWaitingThreads > self.numThreads ): - # raise RuntimeError("Corrupt state") - - # self.stepGate.acquire() - # if (shouldWait): - # self.stepGate.wait() - # else: - # self.numWaitingThreads = 0 # fresh start - # self.curStep += 1 # do this before letting all threads loose - # print("--> Starting step {}".format(self.curStep), end="\r\n") # before notify_all - # # self.stepGate.notify_all() - # self.wakeUpAll() - # self.stepGate.release() - # return self.curStep def tapAllThreads(self): # in a deterministic manner wakeSeq = [] @@ -254,23 +219,32 @@ class LinearQueue(): def __init__(self): self.firstIndex = 1 # 1st ever element self.lastIndex = 0 - self.lock = threading.RLock() # our functions may call each other + self._lock = threading.RLock() # our functions may call each other self.inUse = set() # the indexes that are in use right now - def push(self): # Push to the tail (largest) - with self.lock: - if ( self.firstIndex > self.lastIndex ): # impossible, meaning it's empty - self.lastIndex = self.firstIndex - return self.firstIndex + def toText(self): + return "[{}..{}], in use: {}".format(self.firstIndex, self.lastIndex, self.inUse) + + # Push (add new element, largest) to the tail, and mark it in use + def push(self): + with self._lock: + # if ( self.isEmpty() ): + # self.lastIndex = self.firstIndex + # return self.firstIndex # Otherwise we have something self.lastIndex += 1 + self.allocate(self.lastIndex) + # self.inUse.add(self.lastIndex) # mark it in use immediately return self.lastIndex def pop(self): - with self.lock: + with self._lock: if ( self.isEmpty() ): raise RuntimeError("Cannot pop an empty queue") index = self.firstIndex + if ( index in self.inUse ): + self.inUse.remove(index) # TODO: what about discard? + self.firstIndex += 1 return index @@ -278,113 +252,155 @@ class LinearQueue(): return self.firstIndex > self.lastIndex def popIfNotEmpty(self): - with self.lock: + with self._lock: if (self.isEmpty()): return 0 return self.pop() def allocate(self, i): - with self.lock: + with self._lock: if ( i in self.inUse ): raise RuntimeError("Cannot re-use same index in queue: {}".format(i)) self.inUse.add(i) def release(self, i): - with self.lock: + with self._lock: self.inUse.remove(i) # KeyError possible def size(self): return self.lastIndex + 1 - self.firstIndex def pickAndAllocate(self): - with self.lock: + if ( self.isEmpty() ): + return None + with self._lock: cnt = 0 # counting the interations while True: cnt += 1 if ( cnt > self.size()*10 ): # 10x iteration already - raise RuntimeError("Failed to allocate LinearQueue element") + # raise RuntimeError("Failed to allocate LinearQueue element") + return None ret = Dice.throwRange(self.firstIndex, self.lastIndex+1) if ( not ret in self.inUse ): - return self.allocate(ret) + self.allocate(ret) + return ret +class DbConn: + def __init__(self): + self.isOpen = False + + def open(self): # Open connection + if ( self.isOpen ): + raise RuntimeError("Cannot re-open an existing DB connection") + + cfgPath = "../../build/test/cfg" + conn = taos.connect(host="127.0.0.1", config=cfgPath) # TODO: make configurable + + self._tdSql = TDSql() + self._tdSql.init(conn.cursor()) + self.isOpen = True + + def resetDb(self): # reset the whole database, etc. + if ( not self.isOpen ): + raise RuntimeError("Cannot reset database until connection is open") + self._tdSql.prepare() # Recreate database, etc. + # tdSql.execute('show databases') + + def close(self): + if ( not self.isOpen ): + raise RuntimeError("Cannot clean up database until connection is open") + self._tdSql.close() + self.isOpen = False + + def execSql(self, sql): + return self._tdSql.execute(sql) # State of the database as we believe it to be class DbState(): def __init__(self): self.tableNumQueue = LinearQueue() - self.tick = datetime.datetime(2019, 1, 1) # initial date time tick - self.int = 0 # initial integer - self.openDbServerConnection() - self.lock = threading.RLock() + self._lastTick = datetime.datetime(2019, 1, 1) # initial date time tick + self._lastInt = 0 # next one is initial integer + self._lock = threading.RLock() + + # self.openDbServerConnection() + self._dbConn = DbConn() + self._dbConn.open() + self._dbConn.resetDb() # drop and recreate DB def pickAndAllocateTable(self): # pick any table, and "use" it return self.tableNumQueue.pickAndAllocate() + def addTable(self): + with self._lock: + tIndex = self.tableNumQueue.push() + return tIndex + def releaseTable(self, i): # return the table back, so others can use it self.tableNumQueue.release(i) - def getNextTick(self): - with self.lock: # prevent duplicate tick - self.tick += datetime.timedelta(0, 1) # add one second to it - return self.tick + with self._lock: # prevent duplicate tick + self._lastTick += datetime.timedelta(0, 1) # add one second to it + return self._lastTick def getNextInt(self): - with self.lock: - self.int += 1 - return self.int - - def openDbServerConnection(self): - cfgPath = "../../build/test/cfg" # was: tdDnodes.getSimCfgPath() - conn = taos.connect(host="127.0.0.1", config=cfgPath) # TODO: make configurable - - tdSql.init(conn.cursor()) - tdSql.prepare() # Recreate database, etc. - # tdSql.execute('show databases') - - def closeDbServerConnection(self): - tdSql.close() - tdLog.info("Disconnecting from database server") - - def getTableNameToCreate(self): - tblNum = self.tableNumQueue.push() - return "table_{}".format(tblNum) - + with self._lock: + self._lastInt += 1 + return self._lastInt + def getTableNameToDelete(self): if self.tableNumQueue.isEmpty(): return False tblNum = self.tableNumQueue.pop() # TODO: race condition! return "table_{}".format(tblNum) + def execSql(self, sql): # using the main DB connection + return self._dbConn.execSql(sql) + + def cleanUp(self): + self._dbConn.close() + class Task(): def __init__(self, dbState): self.dbState = dbState - def execute(self): + def execute(self, workerThread): raise RuntimeError("Must be overriden by child class") + def execSql(self, sql): + return self.dbState.execute(sql) + class CreateTableTask(Task): - def execute(self): - tableName = dbState.getTableNameToCreate() - logger.info(" Creating a table {} ...".format(tableName)) - tdSql.execute("create table {} (ts timestamp, speed int)".format(tableName)) + def execute(self, wt): + tIndex = dbState.addTable() + logger.debug(" Creating a table {} ...".format(tIndex)) + wt.execSql("create table table_{} (ts timestamp, speed int)".format(tIndex)) + logger.debug(" Table {} created.".format(tIndex)) + dbState.releaseTable(tIndex) class DropTableTask(Task): - def execute(self): + def execute(self, wt): tableName = dbState.getTableNameToDelete() if ( not tableName ): # May be "False" - logger.info("Cannot generate a table to delete, skipping...") + logger.info(" Cannot generate a table to delete, skipping...") return logger.info(" Dropping a table {} ...".format(tableName)) - tdSql.execute("drop table {}".format(tableName)) + wt.execSql("drop table {}".format(tableName)) class AddDataTask(Task): - def execute(self): - logger.info(" Adding some data...") + def execute(self, wt): ds = self.dbState - tIndex = ds.pickTable() - tdSql.execute("insert into table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt())) - ds.r + logger.info(" Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) + tIndex = ds.pickAndAllocateTable() + if ( tIndex == None ): + logger.info(" No table found to add data, skipping...") + return + sql = "insert into table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt()) + logger.debug(" Executing SQL: {}".format(sql)) + wt.execSql(sql) + ds.releaseTable(tIndex) + logger.debug(" Finished adding data") # Deterministic random number generator class Dice(): @@ -430,12 +446,15 @@ class WorkDispatcher(): ] def throwDice(self): - return random.randint(0, len(self.tasks) - 1) + max = len(self.tasks) - 1 + dRes = random.randint(0, max) + # logger.debug("Threw the dice in range [{},{}], and got: {}".format(0,max,dRes)) + return dRes - def doWork(self): + def doWork(self, workerThread): dice = self.throwDice() task = self.tasks[dice] - task.execute() + task.execute(workerThread) if __name__ == "__main__": logger = logging.getLogger('myApp') @@ -445,8 +464,8 @@ if __name__ == "__main__": Dice.seed(0) # initial seeding of dice dbState = DbState() - threadPool = SteppingThreadPool(dbState, 1, 5, 0) + threadPool = SteppingThreadPool(dbState, 3, 5, 0) threadPool.run() logger.info("Finished running thread pool") - dbState.closeDbServerConnection() + dbState.cleanUp() From 8c64960e4c4c0f6d605c390748c4a2ff5c5fe0e8 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Fri, 1 May 2020 00:01:34 -0700 Subject: [PATCH 007/126] Minor adjustments before sharing with Jeff --- src/connector/python/linux/python3/taos/cursor.py | 2 +- tests/pytest/{random_walk.py => crash_gen.py} | 0 tests/pytest/simpletest_no_sudo.sh | 3 +-- 3 files changed, 2 insertions(+), 3 deletions(-) rename tests/pytest/{random_walk.py => crash_gen.py} (100%) diff --git a/src/connector/python/linux/python3/taos/cursor.py b/src/connector/python/linux/python3/taos/cursor.py index eee03770ca..dfbb0f2064 100644 --- a/src/connector/python/linux/python3/taos/cursor.py +++ b/src/connector/python/linux/python3/taos/cursor.py @@ -1,7 +1,7 @@ from .cinterface import CTaosInterface from .error import * -querySeqNum = 0 +# querySeqNum = 0 class TDengineCursor(object): """Database cursor which is used to manage the context of a fetch operation. diff --git a/tests/pytest/random_walk.py b/tests/pytest/crash_gen.py similarity index 100% rename from tests/pytest/random_walk.py rename to tests/pytest/crash_gen.py diff --git a/tests/pytest/simpletest_no_sudo.sh b/tests/pytest/simpletest_no_sudo.sh index 135a7d8814..61faf3df52 100755 --- a/tests/pytest/simpletest_no_sudo.sh +++ b/tests/pytest/simpletest_no_sudo.sh @@ -10,5 +10,4 @@ export PYTHONPATH=$(pwd)/../../src/connector/python/linux/python3 export LD_LIBRARY_PATH=$LD_LIBRARY_PATH:$(pwd)/../../build/build/lib # Now we are all let, and let's run our cases! -# python3 ./test.py -m 127.0.0.1 -f insert/basic.py -./random_walk.py +python3 ./test.py -m 127.0.0.1 -f insert/basic.py From 897cfafcf4b5b4aada883b30ee0caab152045f20 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Fri, 1 May 2020 00:12:36 -0700 Subject: [PATCH 008/126] added a missing file --- tests/pytest/crash_gen.sh | 40 +++++++++++++++++++++++++++++++++++++++ 1 file changed, 40 insertions(+) create mode 100755 tests/pytest/crash_gen.sh diff --git a/tests/pytest/crash_gen.sh b/tests/pytest/crash_gen.sh new file mode 100755 index 0000000000..4db751f997 --- /dev/null +++ b/tests/pytest/crash_gen.sh @@ -0,0 +1,40 @@ +#!/bin/bash + +# This is the script for us to try to cause the TDengine server or client to crash +# +# PREPARATION +# +# 1. Build an compile the TDengine source code that comes with this script, in the same directory tree +# 2. Please follow the direction in our README.md, and build TDengine in the build/ directory +# 3. Adjust the configuration file if needed under build/test/cfg/taos.cfg +# 4. Run the TDengine server instance: cd build; ./build/bin/taosd -c test/cfg +# 5. Make sure you have a working Python3 environment: run /usr/bin/python3 --version, and you should get 3.6 or above +# +# RUNNING THIS SCRIPT +# +# This script assumes the source code directory is intact, and that the binaries has been built in the +# build/ directory, as such, will will load the Python libraries in the directory tree, and also load +# the TDengine client shared library (so) file, in the build/directory, as evidenced in the env +# variables below. +# +# Running the script is simple, no parameter is needed (for now, but will change in the future). +# +# Happy Crashing... + + +# Due to the heavy path name assumptions/usage, let us require that the user be in the current directory +EXEC_DIR=`dirname "$0"` +if [[ $EXEC_DIR != "." ]] +then + echo "ERROR: Please execute `basename "$0"` in its own directory (for now anyway, pardon the dust)" + exit -1 +fi + +# First we need to set up a path for Python to find our own TAOS modules, so that "import" can work. +export PYTHONPATH=$(pwd)/../../src/connector/python/linux/python3 + +# Then let us set up the library path so that our compiled SO file can be loaded by Python +export LD_LIBRARY_PATH=$LD_LIBRARY_PATH:$(pwd)/../../build/build/lib + +# Now we are all let, and let's see if we can find a crash. +./crash_gen.py From 2d76c46756140da83f4d42a9766d35e1c31742fd Mon Sep 17 00:00:00 2001 From: Steven Li Date: Sun, 3 May 2020 17:28:18 -0700 Subject: [PATCH 009/126] Added per-thread-db-connection option, after getting Python argparse --- tests/pytest/crash_gen.py | 140 +++++++++++++++++++++++++------------- tests/pytest/crash_gen.sh | 5 +- 2 files changed, 96 insertions(+), 49 deletions(-) diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index 5125d28ec0..c525a59d7e 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -13,6 +13,7 @@ # -*- coding: utf-8 -*- import sys import getopt +import argparse import threading import random @@ -26,11 +27,11 @@ from util.sql import * import taos -# Constants -LOGGING_LEVEL = logging.DEBUG -def runThread(workerThread): - logger.info("Running Thread: {}".format(workerThread.tid)) +# Command-line/Environment Configurations +gConfig = None # will set a bit later + +def runThread(workerThread): workerThread.run() # Used by one process to block till another is ready @@ -63,36 +64,42 @@ def runThread(workerThread): class WorkerThread: def __init__(self, pool, tid, dbState): # note: main thread context! - self.curStep = -1 - self.pool = pool - self.tid = tid - self.dbState = dbState + self._curStep = -1 + self._pool = pool + self._tid = tid + self._dbState = dbState # self.threadIdent = threading.get_ident() - self.thread = threading.Thread(target=runThread, args=(self,)) - self.stepGate = threading.Event() + self._thread = threading.Thread(target=runThread, args=(self,)) + self._stepGate = threading.Event() # Let us have a DB connection of our own - self._dbConn = DbConn() + if ( gConfig.per_thread_db_connection ): + self._dbConn = DbConn() def start(self): - self.thread.start() # AFTER the thread is recorded + self._thread.start() # AFTER the thread is recorded def run(self): # initialization after thread starts, in the thread context # self.isSleeping = False - self._dbConn.open() + logger.info("Starting to run thread: {}".format(self._tid)) - while self.curStep < self.pool.maxSteps: + if ( gConfig.per_thread_db_connection ): + self._dbConn.open() + # self._dbConn.resetDb() + + while self._curStep < self._pool.maxSteps: # stepNo = self.pool.waitForStep() # Step to run self.crossStepGate() # self.curStep will get incremented self.doWork() # clean up - self._dbConn.close() + if ( gConfig.per_thread_db_connection ): + self._dbConn.close() def verifyThreadSelf(self): # ensure we are called by this own thread - if ( threading.get_ident() != self.thread.ident ): + if ( threading.get_ident() != self._thread.ident ): raise RuntimeError("Unexpectly called from other threads") def verifyThreadMain(self): # ensure we are called by the main thread @@ -100,7 +107,7 @@ class WorkerThread: raise RuntimeError("Unexpectly called from other threads") def verifyThreadAlive(self): - if ( not self.thread.is_alive() ): + if ( not self._thread.is_alive() ): raise RuntimeError("Unexpected dead thread") # def verifyIsSleeping(self, isSleeping): @@ -113,30 +120,30 @@ class WorkerThread: self.verifyThreadSelf() # only allowed by ourselves # self.verifyIsSleeping(False) # has to be awake - logger.debug("Worker thread {} about to cross pool barrier".format(self.tid)) + logger.debug("Worker thread {} about to cross pool barrier".format(self._tid)) # self.isSleeping = True # TODO: maybe too early? - self.pool.crossPoolBarrier() # wait for all other threads + self._pool.crossPoolBarrier() # wait for all other threads # Wait again at the "gate", waiting to be "tapped" - logger.debug("Worker thread {} about to cross the step gate".format(self.tid)) + logger.debug("Worker thread {} about to cross the step gate".format(self._tid)) # self.stepGate.acquire() # acquire lock immediately - self.stepGate.wait() - self.stepGate.clear() + self._stepGate.wait() + self._stepGate.clear() # self.stepGate.release() # release - logger.debug("Worker thread {} woke up".format(self.tid)) + logger.debug("Worker thread {} woke up".format(self._tid)) # Someone will wake us up here - self.curStep += 1 # off to a new step... + self._curStep += 1 # off to a new step... def tapStepGate(self): # give it a tap, release the thread waiting there self.verifyThreadAlive() self.verifyThreadMain() # only allowed for main thread # self.verifyIsSleeping(True) # has to be sleeping - logger.debug("Tapping worker thread {}".format(self.tid)) + logger.debug("Tapping worker thread {}".format(self._tid)) # self.stepGate.acquire() # logger.debug("Tapping worker thread {}, lock acquired".format(self.tid)) - self.stepGate.set() # wake up! + self._stepGate.set() # wake up! # logger.debug("Tapping worker thread {}, notified!".format(self.tid)) # self.isSleeping = False # No race condition for sure # self.stepGate.release() # this finishes before .wait() can return @@ -144,12 +151,15 @@ class WorkerThread: time.sleep(0) # let the released thread run a bit, IMPORTANT, do it after release def doWork(self): - logger.info(" Step {}, thread {}: ".format(self.curStep, self.tid)) - self.pool.dispatcher.doWork(self) + logger.info(" Step {}, thread {}: ".format(self._curStep, self._tid)) + self._pool.dispatcher.doWork(self) def execSql(self, sql): - return self.dbState.execSql(sql) - + if ( gConfig.per_thread_db_connection ): + return self._dbConn.execSql(sql) + else: + return self._dbState.getDbConn().execSql(sql) + # We define a class to run a number of threads in locking steps. class SteppingThreadPool: @@ -188,7 +198,7 @@ class SteppingThreadPool: # The threads will run through many steps for workerThread in self.threadList: - workerThread.thread.join() # slight hack, accessing members + workerThread._thread.join() # slight hack, accessing members logger.info("All threads finished") @@ -240,10 +250,15 @@ class LinearQueue(): def pop(self): with self._lock: if ( self.isEmpty() ): - raise RuntimeError("Cannot pop an empty queue") + # raise RuntimeError("Cannot pop an empty queue") + return False # TODO: None? + index = self.firstIndex if ( index in self.inUse ): - self.inUse.remove(index) # TODO: what about discard? + return False + + # if ( index in self.inUse ): + # self.inUse.remove(index) # TODO: what about discard? self.firstIndex += 1 return index @@ -259,13 +274,15 @@ class LinearQueue(): def allocate(self, i): with self._lock: + # logger.debug("LQ allocating item {}".format(i)) if ( i in self.inUse ): raise RuntimeError("Cannot re-use same index in queue: {}".format(i)) self.inUse.add(i) def release(self, i): with self._lock: - self.inUse.remove(i) # KeyError possible + # logger.debug("LQ releasing item {}".format(i)) + self.inUse.remove(i) # KeyError possible, TODO: why? def size(self): return self.lastIndex + 1 - self.firstIndex @@ -287,6 +304,8 @@ class LinearQueue(): class DbConn: def __init__(self): + self._conn = None + self._cursor = None self.isOpen = False def open(self): # Open connection @@ -294,16 +313,27 @@ class DbConn: raise RuntimeError("Cannot re-open an existing DB connection") cfgPath = "../../build/test/cfg" - conn = taos.connect(host="127.0.0.1", config=cfgPath) # TODO: make configurable + self._conn = taos.connect(host="127.0.0.1", config=cfgPath) # TODO: make configurable + self._cursor = self._conn.cursor() + # Get the connection/cursor ready + self._cursor.execute('reset query cache') + # self._cursor.execute('use db') + + # Open connection self._tdSql = TDSql() - self._tdSql.init(conn.cursor()) + self._tdSql.init(self._cursor) self.isOpen = True def resetDb(self): # reset the whole database, etc. if ( not self.isOpen ): raise RuntimeError("Cannot reset database until connection is open") - self._tdSql.prepare() # Recreate database, etc. + # self._tdSql.prepare() # Recreate database, etc. + + self._cursor.execute('drop database if exists db') + self._cursor.execute('create database db') + # self._cursor.execute('use db') + # tdSql.execute('show databases') def close(self): @@ -312,7 +342,9 @@ class DbConn: self._tdSql.close() self.isOpen = False - def execSql(self, sql): + def execSql(self, sql): + if ( not self.isOpen ): + raise RuntimeError("Cannot query database until connection is open") return self._tdSql.execute(sql) # State of the database as we believe it to be @@ -328,6 +360,9 @@ class DbState(): self._dbConn.open() self._dbConn.resetDb() # drop and recreate DB + def getDbConn(self): + return self._dbConn + def pickAndAllocateTable(self): # pick any table, and "use" it return self.tableNumQueue.pickAndAllocate() @@ -350,9 +385,10 @@ class DbState(): return self._lastInt def getTableNameToDelete(self): - if self.tableNumQueue.isEmpty(): - return False tblNum = self.tableNumQueue.pop() # TODO: race condition! + if ( not tblNum ): # maybe false + return False + return "table_{}".format(tblNum) def execSql(self, sql): # using the main DB connection @@ -375,7 +411,7 @@ class CreateTableTask(Task): def execute(self, wt): tIndex = dbState.addTable() logger.debug(" Creating a table {} ...".format(tIndex)) - wt.execSql("create table table_{} (ts timestamp, speed int)".format(tIndex)) + wt.execSql("create table db.table_{} (ts timestamp, speed int)".format(tIndex)) logger.debug(" Table {} created.".format(tIndex)) dbState.releaseTable(tIndex) @@ -385,8 +421,8 @@ class DropTableTask(Task): if ( not tableName ): # May be "False" logger.info(" Cannot generate a table to delete, skipping...") return - logger.info(" Dropping a table {} ...".format(tableName)) - wt.execSql("drop table {}".format(tableName)) + logger.info(" Dropping a table db.{} ...".format(tableName)) + wt.execSql("drop table db.{}".format(tableName)) class AddDataTask(Task): def execute(self, wt): @@ -396,7 +432,7 @@ class AddDataTask(Task): if ( tIndex == None ): logger.info(" No table found to add data, skipping...") return - sql = "insert into table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt()) + sql = "insert into db.table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt()) logger.debug(" Executing SQL: {}".format(sql)) wt.execSql(sql) ds.releaseTable(tIndex) @@ -441,7 +477,7 @@ class WorkDispatcher(): # self.totalNumMethods = 2 self.tasks = [ CreateTableTask(dbState), - # DropTableTask(dbState), + DropTableTask(dbState), AddDataTask(dbState), ] @@ -457,14 +493,24 @@ class WorkDispatcher(): task.execute(workerThread) if __name__ == "__main__": + # Super cool Python argument library: https://docs.python.org/3/library/argparse.html + parser = argparse.ArgumentParser(description='TDengine Auto Crash Generator') + parser.add_argument('-p', '--per-thread-db-connection', action='store_true', + help='Use a single shared db connection (default: false)') + parser.add_argument('-d', '--debug', action='store_true', + help='Turn on DEBUG mode for more logging (default: false)') + + gConfig = parser.parse_args() + logger = logging.getLogger('myApp') - logger.setLevel(LOGGING_LEVEL) + if ( gConfig.debug ): + logger.setLevel(logging.DEBUG) # default seems to be INFO ch = logging.StreamHandler() logger.addHandler(ch) Dice.seed(0) # initial seeding of dice dbState = DbState() - threadPool = SteppingThreadPool(dbState, 3, 5, 0) + threadPool = SteppingThreadPool(dbState, 5, 10, 0) threadPool.run() logger.info("Finished running thread pool") dbState.cleanUp() diff --git a/tests/pytest/crash_gen.sh b/tests/pytest/crash_gen.sh index 4db751f997..c845b39764 100755 --- a/tests/pytest/crash_gen.sh +++ b/tests/pytest/crash_gen.sh @@ -9,6 +9,7 @@ # 3. Adjust the configuration file if needed under build/test/cfg/taos.cfg # 4. Run the TDengine server instance: cd build; ./build/bin/taosd -c test/cfg # 5. Make sure you have a working Python3 environment: run /usr/bin/python3 --version, and you should get 3.6 or above +# 6. Make sure you have the proper Python packages: # sudo apt install python3-setuptools python3-pip python3-distutils # # RUNNING THIS SCRIPT # @@ -36,5 +37,5 @@ export PYTHONPATH=$(pwd)/../../src/connector/python/linux/python3 # Then let us set up the library path so that our compiled SO file can be loaded by Python export LD_LIBRARY_PATH=$LD_LIBRARY_PATH:$(pwd)/../../build/build/lib -# Now we are all let, and let's see if we can find a crash. -./crash_gen.py +# Now we are all let, and let's see if we can find a crash. Note we pass all params +./crash_gen.py $@ From cc93971b67494938595f2dfa2f43882bbf397fac Mon Sep 17 00:00:00 2001 From: Steven Li Date: Sun, 3 May 2020 19:08:03 -0700 Subject: [PATCH 010/126] Fixed a barrier problem, now main/worker thread sync correctly --- tests/pytest/crash_gen.py | 80 ++++++++++++++++++++++----------------- 1 file changed, 46 insertions(+), 34 deletions(-) diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index c525a59d7e..ee4a68eee5 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -74,8 +74,7 @@ class WorkerThread: # Let us have a DB connection of our own if ( gConfig.per_thread_db_connection ): - self._dbConn = DbConn() - + self._dbConn = DbConn() def start(self): self._thread.start() # AFTER the thread is recorded @@ -120,18 +119,16 @@ class WorkerThread: self.verifyThreadSelf() # only allowed by ourselves # self.verifyIsSleeping(False) # has to be awake - logger.debug("Worker thread {} about to cross pool barrier".format(self._tid)) + # logger.debug("Worker thread {} about to cross pool barrier".format(self._tid)) # self.isSleeping = True # TODO: maybe too early? self._pool.crossPoolBarrier() # wait for all other threads # Wait again at the "gate", waiting to be "tapped" - logger.debug("Worker thread {} about to cross the step gate".format(self._tid)) - # self.stepGate.acquire() # acquire lock immediately + # logger.debug("Worker thread {} about to cross the step gate".format(self._tid)) self._stepGate.wait() self._stepGate.clear() - # self.stepGate.release() # release - logger.debug("Worker thread {} woke up".format(self._tid)) + # logger.debug("Worker thread {} woke up".format(self._tid)) # Someone will wake us up here self._curStep += 1 # off to a new step... @@ -151,9 +148,15 @@ class WorkerThread: time.sleep(0) # let the released thread run a bit, IMPORTANT, do it after release def doWork(self): - logger.info(" Step {}, thread {}: ".format(self._curStep, self._tid)) + self.logInfo("Thread starting an execution") self._pool.dispatcher.doWork(self) + def logInfo(self, msg): + logger.info(" T[{}.{}]: ".format(self._curStep, self._tid) + msg) + + def logDebug(self, msg): + logger.debug(" T[{}.{}]: ".format(self._curStep, self._tid) + msg) + def execSql(self, sql): if ( gConfig.per_thread_db_connection ): return self._dbConn.execSql(sql) @@ -175,9 +178,8 @@ class SteppingThreadPool: # self.numWaitingThreads = 0 # Thread coordination - self.barrier = threading.Barrier(numThreads + 1) # plus main thread - # self.lock = threading.Lock() # for critical section execution - # self.mainGate = threading.Condition() + self._lock = threading.RLock() # lock to control access (e.g. even reading it is dangerous) + self._poolBarrier = threading.Barrier(numThreads + 1) # do nothing before crossing this, except main thread # starting to run all the threads, in locking steps def run(self): @@ -189,11 +191,20 @@ class SteppingThreadPool: # Coordinate all threads step by step self.curStep = -1 # not started yet while(self.curStep < self.maxSteps): + print(".", end="", flush=True) logger.debug("Main thread going to sleep") - self.crossPoolBarrier() - self.barrier.reset() # Other worker threads should now be at the "gate" - logger.debug("Main thread waking up, tapping worker threads".format(self.curStep)) # Now not all threads had time to go to sleep + # Now ready to enter a step + self.crossPoolBarrier() # let other threads go past the pool barrier, but wait at the thread gate + self._poolBarrier.reset() # Other worker threads should now be at the "gate" + + # Rare chance, when all threads should be blocked at the "step gate" for each thread + logger.info("<-- Step {} finished".format(self.curStep)) + self.curStep += 1 # we are about to get into next step. TODO: race condition here! + logger.debug(" ") # line break + logger.debug("--> Step {} starts with main thread waking up".format(self.curStep)) # Now not all threads had time to go to sleep + + logger.debug("Main thread waking up at step {}, tapping worker threads".format(self.curStep)) # Now not all threads had time to go to sleep self.tapAllThreads() # The threads will run through many steps @@ -201,15 +212,11 @@ class SteppingThreadPool: workerThread._thread.join() # slight hack, accessing members logger.info("All threads finished") + print("") + print("Finished") def crossPoolBarrier(self): - if ( self.barrier.n_waiting == self.numThreads ): # everyone else is waiting, inc main thread - logger.info("<-- Step {} finished".format(self.curStep)) - self.curStep += 1 # we are about to get into next step. TODO: race condition here! - logger.debug(" ") # line break - logger.debug("--> Step {} starts with main thread waking up".format(self.curStep)) # Now not all threads had time to go to sleep - - self.barrier.wait() + self._poolBarrier.wait() def tapAllThreads(self): # in a deterministic manner wakeSeq = [] @@ -397,46 +404,51 @@ class DbState(): def cleanUp(self): self._dbConn.close() +# A task is a long-living entity, carrying out short-lived "executions" for threads class Task(): def __init__(self, dbState): self.dbState = dbState + def _executeInternal(self, wt): + raise RuntimeError("To be implemeted by child classes") + def execute(self, workerThread): - raise RuntimeError("Must be overriden by child class") + self._executeInternal(workerThread) # TODO: no return value? + workerThread.logDebug("[X] task execution completed") def execSql(self, sql): return self.dbState.execute(sql) class CreateTableTask(Task): - def execute(self, wt): + def _executeInternal(self, wt): tIndex = dbState.addTable() - logger.debug(" Creating a table {} ...".format(tIndex)) + wt.logDebug("Creating a table {} ...".format(tIndex)) wt.execSql("create table db.table_{} (ts timestamp, speed int)".format(tIndex)) - logger.debug(" Table {} created.".format(tIndex)) + wt.logDebug("Table {} created.".format(tIndex)) dbState.releaseTable(tIndex) class DropTableTask(Task): - def execute(self, wt): + def _executeInternal(self, wt): tableName = dbState.getTableNameToDelete() if ( not tableName ): # May be "False" - logger.info(" Cannot generate a table to delete, skipping...") + wt.logInfo("Cannot generate a table to delete, skipping...") return - logger.info(" Dropping a table db.{} ...".format(tableName)) + wt.logInfo("Dropping a table db.{} ...".format(tableName)) wt.execSql("drop table db.{}".format(tableName)) class AddDataTask(Task): - def execute(self, wt): + def _executeInternal(self, wt): ds = self.dbState - logger.info(" Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) + wt.logInfo("Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) tIndex = ds.pickAndAllocateTable() if ( tIndex == None ): - logger.info(" No table found to add data, skipping...") + wt.logInfo("No table found to add data, skipping...") return sql = "insert into db.table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt()) - logger.debug(" Executing SQL: {}".format(sql)) + wt.logDebug("Executing SQL: {}".format(sql)) wt.execSql(sql) ds.releaseTable(tIndex) - logger.debug(" Finished adding data") + wt.logDebug("Finished adding data") # Deterministic random number generator class Dice(): @@ -510,7 +522,7 @@ if __name__ == "__main__": Dice.seed(0) # initial seeding of dice dbState = DbState() - threadPool = SteppingThreadPool(dbState, 5, 10, 0) + threadPool = SteppingThreadPool(dbState, 5, 500, 0) threadPool.run() logger.info("Finished running thread pool") dbState.cleanUp() From 5d14a745283226b00da32558131349524fb652c4 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Mon, 4 May 2020 22:23:27 -0700 Subject: [PATCH 011/126] Refactored to use ThreadCoordinator and TaskExecutor, added command line parameters --- tests/pytest/crash_gen.py | 340 +++++++++++++++++++++----------------- 1 file changed, 184 insertions(+), 156 deletions(-) diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index ee4a68eee5..a5baf8577b 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -1,4 +1,4 @@ -#!/usr/bin/python3 +#!/usr/bin/python3.7 ################################################################### # Copyright (c) 2016 by TAOS Technologies, Inc. # All rights reserved. @@ -11,7 +11,13 @@ ################################################################### # -*- coding: utf-8 -*- +from __future__ import annotations # For type hinting before definition, ref: https://stackoverflow.com/questions/33533148/how-do-i-specify-that-the-return-type-of-a-method-is-the-same-as-the-class-itsel + import sys +# Require Python 3 +if sys.version_info[0] < 3: + raise Exception("Must be using Python 3") + import getopt import argparse @@ -25,78 +31,68 @@ from util.dnodes import * from util.cases import * from util.sql import * +import crash_gen import taos +# Global variables, tried to keep a small number. +gConfig = None # Command-line/Environment Configurations, will set a bit later +logger = None -# Command-line/Environment Configurations -gConfig = None # will set a bit later - -def runThread(workerThread): - workerThread.run() - -# Used by one process to block till another is ready -# class Baton: -# def __init__(self): -# self._lock = threading.Lock() # control access to object -# self._baton = threading.Condition() # let thread block -# self._hasGiver = False -# self._hasTaker = False - -# def give(self): -# with self._lock: -# if ( self._hasGiver ): # already? -# raise RuntimeError("Cannot double-give a baton") -# self._hasGiver = True - -# self._settle() # may block, OUTSIDE self lock - -# def take(self): -# with self._lock: -# if ( self._hasTaker): -# raise RuntimeError("Cannot double-take a baton") -# self._hasTaker = True - -# self._settle() - -# def _settle(self): - - +def runThread(wt: WorkerThread): + wt.run() class WorkerThread: - def __init__(self, pool, tid, dbState): # note: main thread context! - self._curStep = -1 + def __init__(self, pool: SteppingThreadPool, tid, dbState, + tc: ThreadCoordinator, + # te: TaskExecutor, + ): # note: main thread context! + # self._curStep = -1 self._pool = pool self._tid = tid self._dbState = dbState + self._tc = tc # self.threadIdent = threading.get_ident() self._thread = threading.Thread(target=runThread, args=(self,)) self._stepGate = threading.Event() # Let us have a DB connection of our own - if ( gConfig.per_thread_db_connection ): - self._dbConn = DbConn() + if ( gConfig.per_thread_db_connection ): # type: ignore + self._dbConn = DbConn() + + def getTaskExecutor(self): + return self._tc.getTaskExecutor() def start(self): self._thread.start() # AFTER the thread is recorded - def run(self): + def run(self): # initialization after thread starts, in the thread context # self.isSleeping = False logger.info("Starting to run thread: {}".format(self._tid)) - if ( gConfig.per_thread_db_connection ): + if ( gConfig.per_thread_db_connection ): # type: ignore self._dbConn.open() - # self._dbConn.resetDb() - - while self._curStep < self._pool.maxSteps: - # stepNo = self.pool.waitForStep() # Step to run - self.crossStepGate() # self.curStep will get incremented - self.doWork() + self._doTaskLoop() + # clean up - if ( gConfig.per_thread_db_connection ): + if ( gConfig.per_thread_db_connection ): # type: ignore self._dbConn.close() + def _doTaskLoop(self) : + # while self._curStep < self._pool.maxSteps: + # tc = ThreadCoordinator(None) + while True: + self._tc.crossStepBarrier() # shared barrier first, INCLUDING the last one + logger.debug("Thread task loop exited barrier...") + self.crossStepGate() # then per-thread gate, after being tapped + logger.debug("Thread task loop exited step gate...") + if not self._tc.isRunning(): + break + + task = self._tc.fetchTask() + task.execute(self) + def verifyThreadSelf(self): # ensure we are called by this own thread if ( threading.get_ident() != self._thread.ident ): raise RuntimeError("Unexpectly called from other threads") @@ -109,53 +105,25 @@ class WorkerThread: if ( not self._thread.is_alive() ): raise RuntimeError("Unexpected dead thread") - # def verifyIsSleeping(self, isSleeping): - # if ( isSleeping != self.isSleeping ): - # raise RuntimeError("Unexpected thread sleep status") - # A gate is different from a barrier in that a thread needs to be "tapped" def crossStepGate(self): self.verifyThreadAlive() self.verifyThreadSelf() # only allowed by ourselves - # self.verifyIsSleeping(False) # has to be awake - - # logger.debug("Worker thread {} about to cross pool barrier".format(self._tid)) - # self.isSleeping = True # TODO: maybe too early? - self._pool.crossPoolBarrier() # wait for all other threads # Wait again at the "gate", waiting to be "tapped" # logger.debug("Worker thread {} about to cross the step gate".format(self._tid)) self._stepGate.wait() self._stepGate.clear() - # logger.debug("Worker thread {} woke up".format(self._tid)) - # Someone will wake us up here - self._curStep += 1 # off to a new step... + # self._curStep += 1 # off to a new step... def tapStepGate(self): # give it a tap, release the thread waiting there self.verifyThreadAlive() self.verifyThreadMain() # only allowed for main thread - # self.verifyIsSleeping(True) # has to be sleeping - + logger.debug("Tapping worker thread {}".format(self._tid)) - # self.stepGate.acquire() - # logger.debug("Tapping worker thread {}, lock acquired".format(self.tid)) - self._stepGate.set() # wake up! - # logger.debug("Tapping worker thread {}, notified!".format(self.tid)) - # self.isSleeping = False # No race condition for sure - # self.stepGate.release() # this finishes before .wait() can return - # logger.debug("Tapping worker thread {}, lock released".format(self.tid)) - time.sleep(0) # let the released thread run a bit, IMPORTANT, do it after release - - def doWork(self): - self.logInfo("Thread starting an execution") - self._pool.dispatcher.doWork(self) - - def logInfo(self, msg): - logger.info(" T[{}.{}]: ".format(self._curStep, self._tid) + msg) - - def logDebug(self, msg): - logger.debug(" T[{}.{}]: ".format(self._curStep, self._tid) + msg) + self._stepGate.set() # wake up! + time.sleep(0) # let the released thread run a bit def execSql(self, sql): if ( gConfig.per_thread_db_connection ): @@ -163,6 +131,78 @@ class WorkerThread: else: return self._dbState.getDbConn().execSql(sql) +class ThreadCoordinator: + def __init__(self, pool, wd: WorkDispatcher): + self._curStep = -1 # first step is 0 + self._pool = pool + self._wd = wd + self._te = None # prepare for every new step + + self._stepBarrier = threading.Barrier(self._pool.numThreads + 1) # one barrier for all threads + + def getTaskExecutor(self): + return self._te + + def crossStepBarrier(self): + self._stepBarrier.wait() + + def run(self, dbState): + self._pool.createAndStartThreads(dbState, self) + + # Coordinate all threads step by step + self._curStep = -1 # not started yet + maxSteps = gConfig.max_steps # type: ignore + while(self._curStep < maxSteps): + print(".", end="", flush=True) + logger.debug("Main thread going to sleep") + + # Now ready to enter a step + self.crossStepBarrier() # let other threads go past the pool barrier, but wait at the thread gate + self._stepBarrier.reset() # Other worker threads should now be at the "gate" + + # At this point, all threads should be pass the overall "barrier" and before the per-thread "gate" + logger.info("<-- Step {} finished".format(self._curStep)) + self._curStep += 1 # we are about to get into next step. TODO: race condition here! + logger.debug("\r\n--> Step {} starts with main thread waking up".format(self._curStep)) # Now not all threads had time to go to sleep + + self._te = TaskExecutor(self._curStep) + + logger.debug("Main thread waking up at step {}, tapping worker threads".format(self._curStep)) # Now not all threads had time to go to sleep + self.tapAllThreads() + + logger.debug("Main thread ready to finish up...") + self.crossStepBarrier() # Cross it one last time, after all threads finish + self._stepBarrier.reset() + logger.debug("Main thread in exclusive zone...") + self._te = None # No more executor, time to end + logger.debug("Main thread tapping all threads one last time...") + self.tapAllThreads() # Let the threads run one last time + logger.debug("Main thread joining all threads") + self._pool.joinAll() # Get all threads to finish + + logger.info("All threads finished") + print("\r\nFinished") + + def tapAllThreads(self): # in a deterministic manner + wakeSeq = [] + for i in range(self._pool.numThreads): # generate a random sequence + if Dice.throw(2) == 1 : + wakeSeq.append(i) + else: + wakeSeq.insert(0, i) + logger.info("Waking up threads: {}".format(str(wakeSeq))) + # TODO: set dice seed to a deterministic value + for i in wakeSeq: + self._pool.threadList[i].tapStepGate() # TODO: maybe a bit too deep?! + time.sleep(0) # yield + + def isRunning(self): + return self._te != None + + def fetchTask(self) -> Task : + if ( not self.isRunning() ): # no task + raise RuntimeError("Cannot fetch task when not running") + return self._wd.pickTask() # We define a class to run a number of threads in locking steps. class SteppingThreadPool: @@ -171,65 +211,24 @@ class SteppingThreadPool: self.maxSteps = maxSteps self.funcSequencer = funcSequencer # Internal class variables - self.dispatcher = WorkDispatcher(self, dbState) + self.dispatcher = WorkDispatcher(dbState) self.curStep = 0 self.threadList = [] # self.stepGate = threading.Condition() # Gate to hold/sync all threads # self.numWaitingThreads = 0 - # Thread coordination - self._lock = threading.RLock() # lock to control access (e.g. even reading it is dangerous) - self._poolBarrier = threading.Barrier(numThreads + 1) # do nothing before crossing this, except main thread - + # starting to run all the threads, in locking steps - def run(self): + def createAndStartThreads(self, dbState, tc: ThreadCoordinator): for tid in range(0, self.numThreads): # Create the threads - workerThread = WorkerThread(self, tid, dbState) + workerThread = WorkerThread(self, tid, dbState, tc) self.threadList.append(workerThread) workerThread.start() # start, but should block immediately before step 0 - # Coordinate all threads step by step - self.curStep = -1 # not started yet - while(self.curStep < self.maxSteps): - print(".", end="", flush=True) - logger.debug("Main thread going to sleep") - - # Now ready to enter a step - self.crossPoolBarrier() # let other threads go past the pool barrier, but wait at the thread gate - self._poolBarrier.reset() # Other worker threads should now be at the "gate" - - # Rare chance, when all threads should be blocked at the "step gate" for each thread - logger.info("<-- Step {} finished".format(self.curStep)) - self.curStep += 1 # we are about to get into next step. TODO: race condition here! - logger.debug(" ") # line break - logger.debug("--> Step {} starts with main thread waking up".format(self.curStep)) # Now not all threads had time to go to sleep - - logger.debug("Main thread waking up at step {}, tapping worker threads".format(self.curStep)) # Now not all threads had time to go to sleep - self.tapAllThreads() - - # The threads will run through many steps + def joinAll(self): for workerThread in self.threadList: - workerThread._thread.join() # slight hack, accessing members - - logger.info("All threads finished") - print("") - print("Finished") - - def crossPoolBarrier(self): - self._poolBarrier.wait() - - def tapAllThreads(self): # in a deterministic manner - wakeSeq = [] - for i in range(self.numThreads): # generate a random sequence - if Dice.throw(2) == 1 : - wakeSeq.append(i) - else: - wakeSeq.insert(0, i) - logger.info("Waking up threads: {}".format(str(wakeSeq))) - # TODO: set dice seed to a deterministic value - for i in wakeSeq: - self.threadList[i].tapStepGate() - time.sleep(0) # yield + logger.debug("Joining thread...") + workerThread._thread.join() # A queue of continguous POSITIVE integers class LinearQueue(): @@ -404,51 +403,67 @@ class DbState(): def cleanUp(self): self._dbConn.close() -# A task is a long-living entity, carrying out short-lived "executions" for threads +class TaskExecutor(): + def __init__(self, curStep): + self._curStep = curStep + + def execute(self, task, wt: WorkerThread): # execute a task on a thread + task.execute(self, wt) + + def logInfo(self, msg): + logger.info(" T[{}.x]: ".format(self._curStep) + msg) + + def logDebug(self, msg): + logger.debug(" T[{}.x]: ".format(self._curStep) + msg) + + class Task(): def __init__(self, dbState): self.dbState = dbState - def _executeInternal(self, wt): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): raise RuntimeError("To be implemeted by child classes") - def execute(self, workerThread): - self._executeInternal(workerThread) # TODO: no return value? - workerThread.logDebug("[X] task execution completed") + def execute(self, wt: WorkerThread): + wt.verifyThreadSelf() + + te = wt.getTaskExecutor() + self._executeInternal(te, wt) # TODO: no return value? + te.logDebug("[X] task execution completed") def execSql(self, sql): return self.dbState.execute(sql) class CreateTableTask(Task): - def _executeInternal(self, wt): - tIndex = dbState.addTable() - wt.logDebug("Creating a table {} ...".format(tIndex)) + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tIndex = self.dbState.addTable() + te.logDebug("Creating a table {} ...".format(tIndex)) wt.execSql("create table db.table_{} (ts timestamp, speed int)".format(tIndex)) - wt.logDebug("Table {} created.".format(tIndex)) - dbState.releaseTable(tIndex) + te.logDebug("Table {} created.".format(tIndex)) + self.dbState.releaseTable(tIndex) class DropTableTask(Task): - def _executeInternal(self, wt): - tableName = dbState.getTableNameToDelete() + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tableName = self.dbState.getTableNameToDelete() if ( not tableName ): # May be "False" - wt.logInfo("Cannot generate a table to delete, skipping...") + te.logInfo("Cannot generate a table to delete, skipping...") return - wt.logInfo("Dropping a table db.{} ...".format(tableName)) + te.logInfo("Dropping a table db.{} ...".format(tableName)) wt.execSql("drop table db.{}".format(tableName)) class AddDataTask(Task): - def _executeInternal(self, wt): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): ds = self.dbState - wt.logInfo("Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) + te.logInfo("Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) tIndex = ds.pickAndAllocateTable() if ( tIndex == None ): - wt.logInfo("No table found to add data, skipping...") + te.logInfo("No table found to add data, skipping...") return sql = "insert into db.table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt()) - wt.logDebug("Executing SQL: {}".format(sql)) + te.logDebug("Executing SQL: {}".format(sql)) wt.execSql(sql) ds.releaseTable(tIndex) - wt.logDebug("Finished adding data") + te.logDebug("Finished adding data") # Deterministic random number generator class Dice(): @@ -484,8 +499,7 @@ class Dice(): # Anyone needing to carry out work should simply come here class WorkDispatcher(): - def __init__(self, pool, dbState): - self.pool = pool + def __init__(self, dbState): # self.totalNumMethods = 2 self.tasks = [ CreateTableTask(dbState), @@ -499,31 +513,45 @@ class WorkDispatcher(): # logger.debug("Threw the dice in range [{},{}], and got: {}".format(0,max,dRes)) return dRes - def doWork(self, workerThread): + def pickTask(self): dice = self.throwDice() - task = self.tasks[dice] + return self.tasks[dice] + + def doWork(self, workerThread): + task = self.pickTask() task.execute(workerThread) -if __name__ == "__main__": +def main(): # Super cool Python argument library: https://docs.python.org/3/library/argparse.html parser = argparse.ArgumentParser(description='TDengine Auto Crash Generator') parser.add_argument('-p', '--per-thread-db-connection', action='store_true', help='Use a single shared db connection (default: false)') parser.add_argument('-d', '--debug', action='store_true', help='Turn on DEBUG mode for more logging (default: false)') + parser.add_argument('-s', '--max-steps', action='store', default=100, type=int, + help='Maximum number of steps to run (default: 100)') + parser.add_argument('-t', '--num-threads', action='store', default=10, type=int, + help='Number of threads to run (default: 10)') + global gConfig gConfig = parser.parse_args() + global logger logger = logging.getLogger('myApp') if ( gConfig.debug ): logger.setLevel(logging.DEBUG) # default seems to be INFO ch = logging.StreamHandler() logger.addHandler(ch) - Dice.seed(0) # initial seeding of dice dbState = DbState() - threadPool = SteppingThreadPool(dbState, 5, 500, 0) - threadPool.run() - logger.info("Finished running thread pool") + Dice.seed(0) # initial seeding of dice + tc = ThreadCoordinator( + SteppingThreadPool(dbState, gConfig.num_threads, gConfig.max_steps, 0), + WorkDispatcher(dbState) + ) + tc.run(dbState) dbState.cleanUp() - + logger.info("Finished running thread pool") + +if __name__ == "__main__": + main() From f08e9b082d3eb4f8198f8f0ac83a3364b63e559d Mon Sep 17 00:00:00 2001 From: Steven Li Date: Tue, 5 May 2020 00:20:29 -0700 Subject: [PATCH 012/126] now able to fan out conflicting tasks, and detect incorrect results --- tests/pytest/crash_gen.py | 166 ++++++++++++++++++++++++++++++-------- 1 file changed, 134 insertions(+), 32 deletions(-) diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index a5baf8577b..b0a13b943b 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -20,12 +20,15 @@ if sys.version_info[0] < 3: import getopt import argparse +import copy import threading import random import logging import datetime +from typing import List + from util.log import * from util.dnodes import * from util.cases import * @@ -42,14 +45,13 @@ def runThread(wt: WorkerThread): wt.run() class WorkerThread: - def __init__(self, pool: SteppingThreadPool, tid, dbState, + def __init__(self, pool: ThreadPool, tid, tc: ThreadCoordinator, # te: TaskExecutor, ): # note: main thread context! # self._curStep = -1 self._pool = pool - self._tid = tid - self._dbState = dbState + self._tid = tid self._tc = tc # self.threadIdent = threading.get_ident() self._thread = threading.Thread(target=runThread, args=(self,)) @@ -82,16 +84,18 @@ class WorkerThread: def _doTaskLoop(self) : # while self._curStep < self._pool.maxSteps: # tc = ThreadCoordinator(None) - while True: - self._tc.crossStepBarrier() # shared barrier first, INCLUDING the last one + while True: + tc = self._tc # Thread Coordinator, the overall master + tc.crossStepBarrier() # shared barrier first, INCLUDING the last one logger.debug("Thread task loop exited barrier...") self.crossStepGate() # then per-thread gate, after being tapped logger.debug("Thread task loop exited step gate...") if not self._tc.isRunning(): break - task = self._tc.fetchTask() + task = tc.fetchTask() task.execute(self) + tc.saveExecutedTask(task) def verifyThreadSelf(self): # ensure we are called by this own thread if ( threading.get_ident() != self._thread.ident ): @@ -129,25 +133,31 @@ class WorkerThread: if ( gConfig.per_thread_db_connection ): return self._dbConn.execSql(sql) else: - return self._dbState.getDbConn().execSql(sql) + return self._tc.getDbState.getDbConn().execSql(sql) class ThreadCoordinator: - def __init__(self, pool, wd: WorkDispatcher): + def __init__(self, pool, wd: WorkDispatcher, dbState): self._curStep = -1 # first step is 0 self._pool = pool self._wd = wd self._te = None # prepare for every new step + self._dbState = dbState + self._executedTasks: List[Task] = [] # in a given step + self._lock = threading.RLock() # sync access for a few things self._stepBarrier = threading.Barrier(self._pool.numThreads + 1) # one barrier for all threads def getTaskExecutor(self): return self._te + def getDbState(self) -> DbState : + return self._dbState + def crossStepBarrier(self): self._stepBarrier.wait() - def run(self, dbState): - self._pool.createAndStartThreads(dbState, self) + def run(self): + self._pool.createAndStartThreads(self) # Coordinate all threads step by step self._curStep = -1 # not started yet @@ -161,10 +171,14 @@ class ThreadCoordinator: self._stepBarrier.reset() # Other worker threads should now be at the "gate" # At this point, all threads should be pass the overall "barrier" and before the per-thread "gate" + self._dbState.transition(self._executedTasks) # at end of step, transiton the DB state + + # Get ready for next step logger.info("<-- Step {} finished".format(self._curStep)) self._curStep += 1 # we are about to get into next step. TODO: race condition here! logger.debug("\r\n--> Step {} starts with main thread waking up".format(self._curStep)) # Now not all threads had time to go to sleep + # A new TE for the new step self._te = TaskExecutor(self._curStep) logger.debug("Main thread waking up at step {}, tapping worker threads".format(self._curStep)) # Now not all threads had time to go to sleep @@ -202,10 +216,19 @@ class ThreadCoordinator: def fetchTask(self) -> Task : if ( not self.isRunning() ): # no task raise RuntimeError("Cannot fetch task when not running") - return self._wd.pickTask() + # return self._wd.pickTask() + # Alternatively, let's ask the DbState for the appropriate task + dbState = self.getDbState() + tasks = dbState.getTasksAtState() + i = Dice.throw(len(tasks)) + return copy.copy(tasks[i]) # Needs a fresh copy, to save execution results, etc. + + def saveExecutedTask(self, task): + with self._lock: + self._executedTasks.append(task) # We define a class to run a number of threads in locking steps. -class SteppingThreadPool: +class ThreadPool: def __init__(self, dbState, numThreads, maxSteps, funcSequencer): self.numThreads = numThreads self.maxSteps = maxSteps @@ -215,13 +238,12 @@ class SteppingThreadPool: self.curStep = 0 self.threadList = [] # self.stepGate = threading.Condition() # Gate to hold/sync all threads - # self.numWaitingThreads = 0 - + # self.numWaitingThreads = 0 # starting to run all the threads, in locking steps - def createAndStartThreads(self, dbState, tc: ThreadCoordinator): + def createAndStartThreads(self, tc: ThreadCoordinator): for tid in range(0, self.numThreads): # Create the threads - workerThread = WorkerThread(self, tid, dbState, tc) + workerThread = WorkerThread(self, tid, tc) self.threadList.append(workerThread) workerThread.start() # start, but should block immediately before step 0 @@ -263,9 +285,6 @@ class LinearQueue(): if ( index in self.inUse ): return False - # if ( index in self.inUse ): - # self.inUse.remove(index) # TODO: what about discard? - self.firstIndex += 1 return index @@ -337,7 +356,8 @@ class DbConn: # self._tdSql.prepare() # Recreate database, etc. self._cursor.execute('drop database if exists db') - self._cursor.execute('create database db') + logger.debug("Resetting DB, dropped database") + # self._cursor.execute('create database db') # self._cursor.execute('use db') # tdSql.execute('show databases') @@ -355,16 +375,24 @@ class DbConn: # State of the database as we believe it to be class DbState(): + STATE_INVALID = -1 + STATE_EMPTY = 1 # nothing there, no even a DB + STATE_DB_ONLY = 2 # we have a DB, but nothing else + STATE_TABLE_ONLY = 3 # we have a table, but totally empty + STATE_HAS_DATA = 4 # we have some data in the table + def __init__(self): self.tableNumQueue = LinearQueue() self._lastTick = datetime.datetime(2019, 1, 1) # initial date time tick self._lastInt = 0 # next one is initial integer self._lock = threading.RLock() - + self._state = self.STATE_INVALID + # self.openDbServerConnection() self._dbConn = DbConn() self._dbConn.open() self._dbConn.resetDb() # drop and recreate DB + self._state = self.STATE_EMPTY # initial state, the result of above def getDbConn(self): return self._dbConn @@ -403,12 +431,63 @@ class DbState(): def cleanUp(self): self._dbConn.close() + def getTasksAtState(self): + if ( self._state == self.STATE_EMPTY ): + return [CreateDbTask(self), CreateTableTask(self)] + elif ( self._state == self.STATE_DB_ONLY ): + return [DeleteDbTask(self), CreateTableTask(self), AddDataTask(self)] + else: + raise RuntimeError("Unexpected DbState state: {}".format(self._state)) + + def transition(self, tasks): + if ( len(tasks) == 0 ): # before 1st step, or otherwise empty + return # do nothing + if ( self._state == self.STATE_EMPTY ): + self.assertAtMostOneSuccess(tasks, CreateDbTask) # param is class + self.assertIfExistThenSuccess(tasks, CreateDbTask) + self.assertAtMostOneSuccess(tasks, CreateTableTask) + if ( self.hasSuccess(tasks, CreateDbTask) ): + self._state = self.STATE_DB_ONLY + if ( self.hasSuccess(tasks, CreateTableTask) ): + self._state = self.STATE_TABLE_ONLY + else: + raise RuntimeError("Unexpected DbState state: {}".format(self._state)) + logger.debug("New DB state is: {}".format(self._state)) + + def assertAtMostOneSuccess(self, tasks, cls): + sCnt = 0 + for task in tasks : + if not isinstance(task, cls): + continue + if task.isSuccess(): + sCnt += 1 + if ( sCnt >= 2 ): + raise RuntimeError("Unexpected more than 1 success with task: {}".format(cls)) + + def assertIfExistThenSuccess(self, tasks, cls): + sCnt = 0 + for task in tasks : + if not isinstance(task, cls): + continue + if task.isSuccess(): + sCnt += 1 + if ( sCnt <= 0 ): + raise RuntimeError("Unexpected zero success for task: {}".format(cls)) + + def hasSuccess(self, tasks, cls): + for task in tasks : + if not isinstance(task, cls): + continue + if task.isSuccess(): + return True + return False + class TaskExecutor(): def __init__(self, curStep): self._curStep = curStep - def execute(self, task, wt: WorkerThread): # execute a task on a thread - task.execute(self, wt) + def execute(self, task: Task, wt: WorkerThread): # execute a task on a thread + task.execute(wt) def logInfo(self, msg): logger.info(" T[{}.x]: ".format(self._curStep) + msg) @@ -416,10 +495,13 @@ class TaskExecutor(): def logDebug(self, msg): logger.debug(" T[{}.x]: ".format(self._curStep) + msg) - class Task(): def __init__(self, dbState): self.dbState = dbState + self._err = None + + def isSuccess(self): + return self._err == None def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): raise RuntimeError("To be implemeted by child classes") @@ -428,12 +510,31 @@ class Task(): wt.verifyThreadSelf() te = wt.getTaskExecutor() - self._executeInternal(te, wt) # TODO: no return value? + te.logDebug("[-] executing task {}...".format(self.__class__.__name__)) + + self._err = None + try: + self._executeInternal(te, wt) # TODO: no return value? + except taos.error.ProgrammingError as err: + te.logDebug("[=]Taos Execution exception: {0}".format(err)) + self._err = err + except: + te.logDebug("[=]Unexpected exception") + raise + te.logDebug("[X] task execution completed") def execSql(self, sql): return self.dbState.execute(sql) +class CreateDbTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + wt.execSql("create database db") + +class DeleteDbTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + wt.execSql("drop database db") + class CreateTableTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): tIndex = self.dbState.addTable() @@ -487,14 +588,14 @@ class Dice(): raise RuntimeError("System RNG is not deterministic") @classmethod - def throw(cls, max): # get 0 to max-1 - return cls.throwRange(0, max) + def throw(cls, stop): # get 0 to stop-1 + return cls.throwRange(0, stop) @classmethod - def throwRange(cls, min, max): # up to max-1 + def throwRange(cls, start, stop): # up to stop-1 if ( not cls.seeded ): raise RuntimeError("Cannot throw dice before seeding it") - return random.randrange(min, max) + return random.randrange(start, stop) # Anyone needing to carry out work should simply come here @@ -546,10 +647,11 @@ def main(): dbState = DbState() Dice.seed(0) # initial seeding of dice tc = ThreadCoordinator( - SteppingThreadPool(dbState, gConfig.num_threads, gConfig.max_steps, 0), - WorkDispatcher(dbState) + ThreadPool(dbState, gConfig.num_threads, gConfig.max_steps, 0), + WorkDispatcher(dbState), + dbState ) - tc.run(dbState) + tc.run() dbState.cleanUp() logger.info("Finished running thread pool") From a3671929fb6b14a0846688363400ac379dec99e4 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Fri, 8 May 2020 00:36:00 -0700 Subject: [PATCH 013/126] successfully discovered TD-250 crash bug, with params: -p -d -s 3 -t 3 --- tests/pytest/crash_gen.py | 117 ++++++++++++++++++++++++++++++++------ 1 file changed, 99 insertions(+), 18 deletions(-) diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index b0a13b943b..ccc90708d3 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -405,6 +405,9 @@ class DbState(): tIndex = self.tableNumQueue.push() return tIndex + def getFixedTableName(self): + return "fixed_table" + def releaseTable(self, i): # return the table back, so others can use it self.tableNumQueue.release(i) @@ -433,9 +436,13 @@ class DbState(): def getTasksAtState(self): if ( self._state == self.STATE_EMPTY ): - return [CreateDbTask(self), CreateTableTask(self)] + return [CreateDbTask(self), CreateFixedTableTask(self)] elif ( self._state == self.STATE_DB_ONLY ): - return [DeleteDbTask(self), CreateTableTask(self), AddDataTask(self)] + return [DropDbTask(self), CreateFixedTableTask(self), AddFixedDataTask(self)] + elif ( self._state == self.STATE_TABLE_ONLY ): + return [DropFixedTableTask(self), AddFixedDataTask(self)] + elif ( self._state == self.STATE_HAS_DATA ) : # same as above. TODO: adjust + return [DropFixedTableTask(self), AddFixedDataTask(self)] else: raise RuntimeError("Unexpected DbState state: {}".format(self._state)) @@ -443,13 +450,58 @@ class DbState(): if ( len(tasks) == 0 ): # before 1st step, or otherwise empty return # do nothing if ( self._state == self.STATE_EMPTY ): - self.assertAtMostOneSuccess(tasks, CreateDbTask) # param is class - self.assertIfExistThenSuccess(tasks, CreateDbTask) - self.assertAtMostOneSuccess(tasks, CreateTableTask) if ( self.hasSuccess(tasks, CreateDbTask) ): + self.assertAtMostOneSuccess(tasks, CreateDbTask) # param is class self._state = self.STATE_DB_ONLY - if ( self.hasSuccess(tasks, CreateTableTask) ): - self._state = self.STATE_TABLE_ONLY + if ( self.hasSuccess(tasks, CreateFixedTableTask )): + self._state = self.STATE_TABLE_ONLY + # else: # no successful table creation, not much we can say, as it is step 2 + else: # did not create db + self.assertNoTask(tasks, CreateDbTask) # because we did not have such task + # self.assertNoSuccess(tasks, CreateDbTask) # not necessary, since we just verified no such task + self.assertNoSuccess(tasks, CreateFixedTableTask) + + elif ( self._state == self.STATE_DB_ONLY ): + self.assertAtMostOneSuccess(tasks, DropDbTask) + self.assertIfExistThenSuccess(tasks, DropDbTask) + self.assertAtMostOneSuccess(tasks, CreateFixedTableTask) + # Nothing to be said about adding data task + if ( self.hasSuccess(tasks, DropDbTask) ): # dropped the DB + # self.assertHasTask(tasks, DropDbTask) # implied by hasSuccess + self.assertAtMostOneSuccess(tasks, DropDbTask) + self._state = self.STATE_EMPTY + elif ( self.hasSuccess(tasks, CreateFixedTableTask) ): # did not drop db, create table success + # self.assertHasTask(tasks, CreateFixedTableTask) # tried to create table + self.assertAtMostOneSuccess(tasks, CreateFixedTableTask) # at most 1 attempt is successful + self.assertNoTask(tasks, DropDbTask) # should have have tried + if ( not self.hasSuccess(tasks, AddFixedDataTask) ): # just created table, no data yet + # can't say there's add-data attempts, since they may all fail + self._state = self.STATE_TABLE_ONLY + else: + self._state = self.STATE_HAS_DATA + else: # no success in dropping db tasks, no success in create fixed table, not acceptable + raise RuntimeError("Unexpected no-success scenario") + + elif ( self._state == self.STATE_TABLE_ONLY ): + if ( self.hasSuccess(tasks, DropFixedTableTask) ): + self.assertAtMostOneSuccess(tasks, DropFixedTableTask) + self._state = self.STATE_DB_ONLY + elif ( self.hasSuccess(tasks, AddFixedDataTask) ): # no success dropping the table + self.assertNoTask(tasks, DropFixedTableTask) + self._state = self.STATE_HAS_DATA + else: # did not drop table, did not insert data, that is impossible + raise RuntimeError("Unexpected no-success scenarios") + + elif ( self._state == self.STATE_TABLE_ONLY ): # Same as above, TODO: adjust + if ( self.hasSuccess(tasks, DropFixedTableTask) ): + self.assertAtMostOneSuccess(tasks, DropFixedTableTask) + self._state = self.STATE_DB_ONLY + elif ( self.hasSuccess(tasks, AddFixedDataTask) ): # no success dropping the table + self.assertNoTask(tasks, DropFixedTableTask) + self._state = self.STATE_HAS_DATA + else: # did not drop table, did not insert data, that is impossible + raise RuntimeError("Unexpected no-success scenarios") + else: raise RuntimeError("Unexpected DbState state: {}".format(self._state)) logger.debug("New DB state is: {}".format(self._state)) @@ -466,14 +518,27 @@ class DbState(): def assertIfExistThenSuccess(self, tasks, cls): sCnt = 0 + exists = False for task in tasks : if not isinstance(task, cls): continue + exists = True # we have a valid instance if task.isSuccess(): sCnt += 1 - if ( sCnt <= 0 ): + if ( exists and sCnt <= 0 ): raise RuntimeError("Unexpected zero success for task: {}".format(cls)) + def assertNoTask(self, tasks, cls): + for task in tasks : + if isinstance(task, cls): + raise RuntimeError("Unexpected task: {}".format(cls)) + + def assertNoSuccess(self, tasks, cls): + for task in tasks : + if isinstance(task, cls): + if task.isSuccess(): + raise RuntimeError("Unexpected successful task: {}".format(cls)) + def hasSuccess(self, tasks, cls): for task in tasks : if not isinstance(task, cls): @@ -496,15 +561,15 @@ class TaskExecutor(): logger.debug(" T[{}.x]: ".format(self._curStep) + msg) class Task(): - def __init__(self, dbState): - self.dbState = dbState + def __init__(self, dbState: DbState): + self._dbState = dbState self._err = None def isSuccess(self): return self._err == None def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): - raise RuntimeError("To be implemeted by child classes") + raise RuntimeError("To be implemeted by child classes, class name: {}".format(self.__class__.__name__)) def execute(self, wt: WorkerThread): wt.verifyThreadSelf() @@ -522,39 +587,49 @@ class Task(): te.logDebug("[=]Unexpected exception") raise - te.logDebug("[X] task execution completed") + te.logDebug("[X] task execution completed, status: {}".format(self.isSuccess())) def execSql(self, sql): - return self.dbState.execute(sql) + return self._dbState.execute(sql) class CreateDbTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): wt.execSql("create database db") -class DeleteDbTask(Task): +class DropDbTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): wt.execSql("drop database db") class CreateTableTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): - tIndex = self.dbState.addTable() + tIndex = self._dbState.addTable() te.logDebug("Creating a table {} ...".format(tIndex)) wt.execSql("create table db.table_{} (ts timestamp, speed int)".format(tIndex)) te.logDebug("Table {} created.".format(tIndex)) - self.dbState.releaseTable(tIndex) + self._dbState.releaseTable(tIndex) + +class CreateFixedTableTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tblName = self._dbState.getFixedTableName() + wt.execSql("create table db.{} (ts timestamp, speed int)".format(tblName)) class DropTableTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): - tableName = self.dbState.getTableNameToDelete() + tableName = self._dbState.getTableNameToDelete() if ( not tableName ): # May be "False" te.logInfo("Cannot generate a table to delete, skipping...") return te.logInfo("Dropping a table db.{} ...".format(tableName)) wt.execSql("drop table db.{}".format(tableName)) + +class DropFixedTableTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tblName = self._dbState.getFixedTableName() + wt.execSql("drop table db.{}".format(tblName)) class AddDataTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): - ds = self.dbState + ds = self._dbState te.logInfo("Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) tIndex = ds.pickAndAllocateTable() if ( tIndex == None ): @@ -566,6 +641,12 @@ class AddDataTask(Task): ds.releaseTable(tIndex) te.logDebug("Finished adding data") +class AddFixedDataTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + ds = self._dbState + sql = "insert into db.table_{} values ('{}', {});".format(ds.getFixedTableName(), ds.getNextTick(), ds.getNextInt()) + wt.execSql(sql) + # Deterministic random number generator class Dice(): seeded = False # static, uninitialized From 6623cb6395209d023d8633678408288ebe0bf2d4 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Fri, 8 May 2020 16:46:34 -0700 Subject: [PATCH 014/126] Discovered TD-255 crash with params: -p -s 50 -t 10 --- .gitignore | 1 + tests/pytest/crash_gen.py | 74 ++++++++++++++++++++++++++++++--------- 2 files changed, 58 insertions(+), 17 deletions(-) diff --git a/.gitignore b/.gitignore index 806663987a..9772284ef1 100644 --- a/.gitignore +++ b/.gitignore @@ -11,6 +11,7 @@ debs/ rpms/ mac/ *.pyc +.mypy_cache *.tmp *.swp src/connector/nodejs/node_modules/ diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index ccc90708d3..431de7c56a 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -61,6 +61,13 @@ class WorkerThread: if ( gConfig.per_thread_db_connection ): # type: ignore self._dbConn = DbConn() + def logDebug(self, msg): + logger.info(" t[{}] {}".format(self._tid, msg)) + + def logInfo(self, msg): + logger.info(" t[{}] {}".format(self._tid, msg)) + + def getTaskExecutor(self): return self._tc.getTaskExecutor() @@ -172,6 +179,7 @@ class ThreadCoordinator: # At this point, all threads should be pass the overall "barrier" and before the per-thread "gate" self._dbState.transition(self._executedTasks) # at end of step, transiton the DB state + self.resetExecutedTasks() # clear the tasks after we are done # Get ready for next step logger.info("<-- Step {} finished".format(self._curStep)) @@ -221,7 +229,11 @@ class ThreadCoordinator: dbState = self.getDbState() tasks = dbState.getTasksAtState() i = Dice.throw(len(tasks)) - return copy.copy(tasks[i]) # Needs a fresh copy, to save execution results, etc. + # return copy.copy(tasks[i]) # Needs a fresh copy, to save execution results, etc. + return tasks[i].clone() + + def resetExecutedTasks(self): + self._executedTasks = [] # should be under single thread def saveExecutedTask(self, task): with self._lock: @@ -512,6 +524,7 @@ class DbState(): if not isinstance(task, cls): continue if task.isSuccess(): + task.logDebug("Task success found") sCnt += 1 if ( sCnt >= 2 ): raise RuntimeError("Unexpected more than 1 success with task: {}".format(cls)) @@ -551,43 +564,70 @@ class TaskExecutor(): def __init__(self, curStep): self._curStep = curStep + def getCurStep(self): + return self._curStep + def execute(self, task: Task, wt: WorkerThread): # execute a task on a thread task.execute(wt) - def logInfo(self, msg): - logger.info(" T[{}.x]: ".format(self._curStep) + msg) + # def logInfo(self, msg): + # logger.info(" T[{}.x]: ".format(self._curStep) + msg) - def logDebug(self, msg): - logger.debug(" T[{}.x]: ".format(self._curStep) + msg) + # def logDebug(self, msg): + # logger.debug(" T[{}.x]: ".format(self._curStep) + msg) class Task(): + taskSn = 100 + + @classmethod + def allocTaskNum(cls): + cls.taskSn += 1 + return cls.taskSn + def __init__(self, dbState: DbState): self._dbState = dbState + self._workerThread = None self._err = None + self._curStep = None + + # Assign an incremental task serial number + self._taskNum = self.allocTaskNum() def isSuccess(self): return self._err == None + def clone(self): + newTask = self.__class__(self._dbState) + return newTask + + def logDebug(self, msg): + self._workerThread.logDebug("s[{}.{}] {}".format(self._curStep, self._taskNum, msg)) + + def logInfo(self, msg): + self._workerThread.logInfo("s[{}.{}] {}".format(self._curStep, self._taskNum, msg)) + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): raise RuntimeError("To be implemeted by child classes, class name: {}".format(self.__class__.__name__)) def execute(self, wt: WorkerThread): wt.verifyThreadSelf() + self._workerThread = wt # type: ignore te = wt.getTaskExecutor() - te.logDebug("[-] executing task {}...".format(self.__class__.__name__)) + self._curStep = te.getCurStep() + self.logDebug("[-] executing task {}...".format(self.__class__.__name__)) self._err = None try: self._executeInternal(te, wt) # TODO: no return value? except taos.error.ProgrammingError as err: - te.logDebug("[=]Taos Execution exception: {0}".format(err)) + self.logDebug("[=]Taos Execution exception: {0}".format(err)) self._err = err except: - te.logDebug("[=]Unexpected exception") + self.logDebug("[=]Unexpected exception") raise - te.logDebug("[X] task execution completed, status: {}".format(self.isSuccess())) + self.logDebug("[X] task execution completed, {}, status: {}".format(self.__class__.__name__, "Success" if self.isSuccess() else "Failure")) def execSql(self, sql): return self._dbState.execute(sql) @@ -603,9 +643,9 @@ class DropDbTask(Task): class CreateTableTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): tIndex = self._dbState.addTable() - te.logDebug("Creating a table {} ...".format(tIndex)) + self.logDebug("Creating a table {} ...".format(tIndex)) wt.execSql("create table db.table_{} (ts timestamp, speed int)".format(tIndex)) - te.logDebug("Table {} created.".format(tIndex)) + self.logDebug("Table {} created.".format(tIndex)) self._dbState.releaseTable(tIndex) class CreateFixedTableTask(Task): @@ -617,9 +657,9 @@ class DropTableTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): tableName = self._dbState.getTableNameToDelete() if ( not tableName ): # May be "False" - te.logInfo("Cannot generate a table to delete, skipping...") + self.logInfo("Cannot generate a table to delete, skipping...") return - te.logInfo("Dropping a table db.{} ...".format(tableName)) + self.logInfo("Dropping a table db.{} ...".format(tableName)) wt.execSql("drop table db.{}".format(tableName)) class DropFixedTableTask(Task): @@ -630,16 +670,16 @@ class DropFixedTableTask(Task): class AddDataTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): ds = self._dbState - te.logInfo("Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) + self.logInfo("Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) tIndex = ds.pickAndAllocateTable() if ( tIndex == None ): - te.logInfo("No table found to add data, skipping...") + self.logInfo("No table found to add data, skipping...") return sql = "insert into db.table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt()) - te.logDebug("Executing SQL: {}".format(sql)) + self.logDebug("Executing SQL: {}".format(sql)) wt.execSql(sql) ds.releaseTable(tIndex) - te.logDebug("Finished adding data") + self.logDebug("Finished adding data") class AddFixedDataTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): From dcb1155481a5c28bfc40ea14ccae450c2e78e17e Mon Sep 17 00:00:00 2001 From: Steven Li Date: Fri, 8 May 2020 17:40:43 -0700 Subject: [PATCH 015/126] Discovered TD-256 with params: -p -d -t 10 -s 20 --- tests/pytest/crash_gen.py | 50 ++++++++++++++++++++++++++++++--------- 1 file changed, 39 insertions(+), 11 deletions(-) diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index 431de7c56a..6a724709e2 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -136,11 +136,17 @@ class WorkerThread: self._stepGate.set() # wake up! time.sleep(0) # let the released thread run a bit - def execSql(self, sql): + def execSql(self, sql): # not "execute", since we are out side the DB context if ( gConfig.per_thread_db_connection ): - return self._dbConn.execSql(sql) + return self._dbConn.execute(sql) else: - return self._tc.getDbState.getDbConn().execSql(sql) + return self._tc.getDbState.getDbConn().execute(sql) + + def querySql(self, sql): # not "execute", since we are out side the DB context + if ( gConfig.per_thread_db_connection ): + return self._dbConn.query(sql) + else: + return self._tc.getDbState.getDbConn().query(sql) class ThreadCoordinator: def __init__(self, pool, wd: WorkDispatcher, dbState): @@ -380,10 +386,16 @@ class DbConn: self._tdSql.close() self.isOpen = False - def execSql(self, sql): + def execute(self, sql): + if ( not self.isOpen ): + raise RuntimeError("Cannot execute database commands until connection is open") + return self._tdSql.execute(sql) + + def query(self, sql) -> int : # return number of rows retrieved if ( not self.isOpen ): raise RuntimeError("Cannot query database until connection is open") - return self._tdSql.execute(sql) + return self._tdSql.query(sql) + # State of the database as we believe it to be class DbState(): @@ -441,27 +453,36 @@ class DbState(): return "table_{}".format(tblNum) def execSql(self, sql): # using the main DB connection - return self._dbConn.execSql(sql) + return self._dbConn.execute(sql) def cleanUp(self): self._dbConn.close() def getTasksAtState(self): + tasks = [] + tasks.append(ReadFixedDataTask(self)) # always if ( self._state == self.STATE_EMPTY ): - return [CreateDbTask(self), CreateFixedTableTask(self)] + tasks.append(CreateDbTask(self)) + tasks.append(CreateFixedTableTask(self)) elif ( self._state == self.STATE_DB_ONLY ): - return [DropDbTask(self), CreateFixedTableTask(self), AddFixedDataTask(self)] + tasks.append(DropDbTask(self)) + tasks.append(CreateFixedTableTask(self)) + tasks.append(AddFixedDataTask(self)) elif ( self._state == self.STATE_TABLE_ONLY ): - return [DropFixedTableTask(self), AddFixedDataTask(self)] + tasks.append(DropFixedTableTask(self)) + tasks.append(AddFixedDataTask(self)) elif ( self._state == self.STATE_HAS_DATA ) : # same as above. TODO: adjust - return [DropFixedTableTask(self), AddFixedDataTask(self)] + tasks.append(DropFixedTableTask(self)) + tasks.append(AddFixedDataTask(self)) else: raise RuntimeError("Unexpected DbState state: {}".format(self._state)) + return tasks def transition(self, tasks): if ( len(tasks) == 0 ): # before 1st step, or otherwise empty return # do nothing if ( self._state == self.STATE_EMPTY ): + # self.assertNoSuccess(tasks, ReadFixedDataTask) # some read may be successful, since we might be creating a table if ( self.hasSuccess(tasks, CreateDbTask) ): self.assertAtMostOneSuccess(tasks, CreateDbTask) # param is class self._state = self.STATE_DB_ONLY @@ -504,7 +525,7 @@ class DbState(): else: # did not drop table, did not insert data, that is impossible raise RuntimeError("Unexpected no-success scenarios") - elif ( self._state == self.STATE_TABLE_ONLY ): # Same as above, TODO: adjust + elif ( self._state == self.STATE_HAS_DATA ): # Same as above, TODO: adjust if ( self.hasSuccess(tasks, DropFixedTableTask) ): self.assertAtMostOneSuccess(tasks, DropFixedTableTask) self._state = self.STATE_DB_ONLY @@ -589,6 +610,7 @@ class Task(): self._workerThread = None self._err = None self._curStep = None + self._numRows = None # Number of rows affected # Assign an incremental task serial number self._taskNum = self.allocTaskNum() @@ -653,6 +675,12 @@ class CreateFixedTableTask(Task): tblName = self._dbState.getFixedTableName() wt.execSql("create table db.{} (ts timestamp, speed int)".format(tblName)) +class ReadFixedDataTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tblName = self._dbState.getFixedTableName() + self._numRows = wt.querySql("select * from db.{}".format(tblName)) # save the result for later + # tdSql.query(" cars where tbname in ('carzero', 'carone')") + class DropTableTask(Task): def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): tableName = self._dbState.getTableNameToDelete() From c815a1b20d3c908b8f1a1d4430a467a281f51b1b Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Mon, 11 May 2020 21:25:48 +0800 Subject: [PATCH 016/126] add tag and alter-table cases. [TD-280] --- tests/pytest/alter/__init__.py | 0 tests/pytest/alter/alter_replica.py | 129 ++++++++++++++++++++++++++ tests/pytest/alter/alter_stable.py | 138 ++++++++++++++++++++++++++++ tests/pytest/alter/alter_table.py | 138 ++++++++++++++++++++++++++++ tests/pytest/alter/file_corrupt.py | 77 ++++++++++++++++ tests/pytest/tag_lite/__init__.py | 0 tests/pytest/tag_lite/datatype.py | 135 +++++++++++++++++++++++++++ 7 files changed, 617 insertions(+) create mode 100644 tests/pytest/alter/__init__.py create mode 100644 tests/pytest/alter/alter_replica.py create mode 100644 tests/pytest/alter/alter_stable.py create mode 100644 tests/pytest/alter/alter_table.py create mode 100644 tests/pytest/alter/file_corrupt.py create mode 100644 tests/pytest/tag_lite/__init__.py create mode 100644 tests/pytest/tag_lite/datatype.py diff --git a/tests/pytest/alter/__init__.py b/tests/pytest/alter/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/tests/pytest/alter/alter_replica.py b/tests/pytest/alter/alter_replica.py new file mode 100644 index 0000000000..6cf0f65825 --- /dev/null +++ b/tests/pytest/alter/alter_replica.py @@ -0,0 +1,129 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class TDTestCase: + def init(self): + tdLog.debug("start to execute %s" % __file__) + tdLog.info("prepare cluster") + tdDnodes.stopAll() + tdDnodes.deploy(1) + tdDnodes.start(1) + + self.conn = taos.connect(config=tdDnodes.getSimCfgPath()) + tdSql.init(self.conn.cursor()) + tdSql.execute('reset query cache') + tdSql.execute('create dnode 192.168.0.2') + tdDnodes.deploy(2) + tdDnodes.start(2) + + self.conn = taos.connect(config=tdDnodes.getSimCfgPath()) + tdSql.init(self.conn.cursor()) + tdSql.execute('reset query cache') + tdSql.execute('create dnode 192.168.0.3') + tdDnodes.deploy(3) + tdDnodes.start(3) + + def run(self): + tdSql.execute('create database db replica 3 days 7') + tdSql.execute('use db') + for tid in range(1, 11): + tdSql.execute('create table tb%d(ts timestamp, i int)' % tid) + tdLog.sleep(10) + + tdLog.info("================= step1") + startTime = 1520000010000 + for rid in range(1, 11): + for tid in range(1, 11): + tdSql.execute( + 'insert into tb%d values(%ld, %d)' % + (tid, startTime, rid)) + startTime += 1 + tdSql.query('select * from tb1') + tdSql.checkRows(10) + tdLog.sleep(5) + + tdLog.info("================= step2") + tdSql.execute('alter database db replica 2') + tdLog.sleep(10) + + tdLog.info("================= step3") + for rid in range(1, 11): + for tid in range(1, 11): + tdSql.execute( + 'insert into tb%d values(%ld, %d)' % + (tid, startTime, rid)) + startTime += 1 + tdSql.query('select * from tb1') + tdSql.checkRows(20) + tdLog.sleep(5) + + tdLog.info("================= step4") + tdSql.execute('alter database db replica 1') + tdLog.sleep(10) + + tdLog.info("================= step5") + for rid in range(1, 11): + for tid in range(1, 11): + tdSql.execute( + 'insert into tb%d values(%ld, %d)' % + (tid, startTime, rid)) + startTime += 1 + tdSql.query('select * from tb1') + tdSql.checkRows(30) + tdLog.sleep(5) + + tdLog.info("================= step6") + tdSql.execute('alter database db replica 2') + tdLog.sleep(10) + + tdLog.info("================= step7") + for rid in range(1, 11): + for tid in range(1, 11): + tdSql.execute( + 'insert into tb%d values(%ld, %d)' % + (tid, startTime, rid)) + startTime += 1 + tdSql.query('select * from tb1') + tdSql.checkRows(40) + tdLog.sleep(5) + + tdLog.info("================= step8") + tdSql.execute('alter database db replica 3') + tdLog.sleep(10) + + tdLog.info("================= step9") + for rid in range(1, 11): + for tid in range(1, 11): + tdSql.execute( + 'insert into tb%d values(%ld, %d)' % + (tid, startTime, rid)) + startTime += 1 + tdSql.query('select * from tb1') + tdSql.checkRows(50) + tdLog.sleep(5) + + def stop(self): + tdSql.close() + self.conn.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addCluster(__file__, TDTestCase()) diff --git a/tests/pytest/alter/alter_stable.py b/tests/pytest/alter/alter_stable.py new file mode 100644 index 0000000000..5772edcf7f --- /dev/null +++ b/tests/pytest/alter/alter_stable.py @@ -0,0 +1,138 @@ +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + self.types = [ + "int", + "bigint", + "float", + "double", + "smallint", + "tinyint", + "binary(10)", + "nchar(10)", + "timestamp"] + self.rowNum = 300 + self.ts = 1537146000000 + self.step = 1000 + self.sqlHead = "select count(*), count(c1) " + self.sqlTail = " from stb" + + def addColumnAndCount(self): + for colIdx in range(len(self.types)): + tdSql.execute( + "alter table stb add column c%d %s" % + (colIdx + 2, self.types[colIdx])) + self.sqlHead = self.sqlHead + ",count(c%d) " % (colIdx + 2) + tdSql.query(self.sqlHead + self.sqlTail) + + # count non-NULL values in each column + tdSql.checkData(0, 0, self.rowNum * (colIdx + 1)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 1)) + for i in range(2, colIdx + 2): + print("check1: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 2)) + + # insert more rows + for k in range(self.rowNum): + self.ts += self.step + sql = "insert into tb values (%d, %d" % (self.ts, colIdx + 2) + for j in range(colIdx + 1): + sql += ", %d" % (colIdx + 2) + sql += ")" + tdSql.execute(sql) + + # count non-NULL values in each column + tdSql.query(self.sqlHead + self.sqlTail) + tdSql.checkData(0, 0, self.rowNum * (colIdx + 2)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 2)) + for i in range(2, colIdx + 2): + print("check2: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 3)) + + def dropColumnAndCount(self): + tdSql.query(self.sqlHead + self.sqlTail) + res = [] + for i in range(len(self.types)): + res.append(tdSql.getData(0, i + 2)) + + print(res) + + for colIdx in range(len(self.types), 0, -1): + tdSql.execute("alter table stb drop column c%d" % (colIdx + 2)) + # self.sqlHead = self.sqlHead + ",count(c%d) " %(colIdx + 2) + tdSql.query(self.sqlHead + self.sqlTail) + + # count non-NULL values in each column + tdSql.checkData(0, 0, self.rowNum * (colIdx + 1)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 1)) + for i in range(2, colIdx + 2): + print("check1: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 2)) + + # insert more rows + for k in range(self.rowNum): + self.ts += self.step + sql = "insert into tb values (%d, %d" % (self.ts, colIdx + 2) + for j in range(colIdx + 1): + sql += ", %d" % (colIdx + 2) + sql += ")" + tdSql.execute(sql) + + # count non-NULL values in each column + tdSql.query(self.sqlHead + self.sqlTail) + tdSql.checkData(0, 0, self.rowNum * (colIdx + 2)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 2)) + for i in range(2, colIdx + 2): + print("check2: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 3)) + + def run(self): + # Setup params + db = "db" + + # Create db + tdSql.execute("drop database if exists %s" % (db)) + tdSql.execute("reset query cache") + tdSql.execute("create database %s maxrows 200 maxtables 4" % (db)) + tdSql.execute("use %s" % (db)) + + # Create a table with one colunm of int type and insert 300 rows + tdLog.info("Create stb and tb") + tdSql.execute("create table stb (ts timestamp, c1 int) tags (tg1 int)") + tdSql.execute("create table tb using stb tags (0)") + tdLog.info("Insert %d rows into tb" % (self.rowNum)) + for k in range(1, self.rowNum + 1): + self.ts += self.step + tdSql.execute("insert into tb values (%d, 1)" % (self.ts)) + + # Alter tb and add a column of smallint type, then query tb to see if + # all added column are NULL + self.addColumnAndCount() + tdDnodes.stop(1) + time.sleep(5) + tdDnodes.start(1) + time.sleep(5) + tdSql.query(self.sqlHead + self.sqlTail) + for i in range(2, len(self.types) + 2): + tdSql.checkData(0, i, self.rowNum * (len(self.types) + 2 - i)) + + self.dropColumnAndCount() + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +#tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/alter/alter_table.py b/tests/pytest/alter/alter_table.py new file mode 100644 index 0000000000..6e0c591da6 --- /dev/null +++ b/tests/pytest/alter/alter_table.py @@ -0,0 +1,138 @@ +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + self.types = [ + "int", + "bigint", + "float", + "double", + "smallint", + "tinyint", + "binary(10)", + "nchar(10)", + "timestamp"] + self.rowNum = 300 + self.ts = 1537146000000 + self.step = 1000 + self.sqlHead = "select count(*), count(c1) " + self.sqlTail = " from tb" + + def addColumnAndCount(self): + for colIdx in range(len(self.types)): + tdSql.execute( + "alter table tb add column c%d %s" % + (colIdx + 2, self.types[colIdx])) + self.sqlHead = self.sqlHead + ",count(c%d) " % (colIdx + 2) + tdSql.query(self.sqlHead + self.sqlTail) + + # count non-NULL values in each column + tdSql.checkData(0, 0, self.rowNum * (colIdx + 1)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 1)) + for i in range(2, colIdx + 2): + print("check1: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 2)) + + # insert more rows + for k in range(self.rowNum): + self.ts += self.step + sql = "insert into tb values (%d, %d" % (self.ts, colIdx + 2) + for j in range(colIdx + 1): + sql += ", %d" % (colIdx + 2) + sql += ")" + tdSql.execute(sql) + + # count non-NULL values in each column + tdSql.query(self.sqlHead + self.sqlTail) + tdSql.checkData(0, 0, self.rowNum * (colIdx + 2)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 2)) + for i in range(2, colIdx + 2): + print("check2: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 3)) + + def dropColumnAndCount(self): + + tdSql.query(self.sqlHead + self.sqlTail) + res = [] + for i in range(len(self.types)): + res[i] = tdSql.getData(0, i + 2) + + print(res.join) + + for colIdx in range(len(self.types), 0, -1): + tdSql.execute("alter table tb drop column c%d" % (colIdx + 2)) + # self.sqlHead = self.sqlHead + ",count(c%d) " %(colIdx + 2) + tdSql.query(self.sqlHead + self.sqlTail) + + # count non-NULL values in each column + tdSql.checkData(0, 0, self.rowNum * (colIdx + 1)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 1)) + for i in range(2, colIdx + 2): + print("check1: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 2)) + + # insert more rows + for k in range(self.rowNum): + self.ts += self.step + sql = "insert into tb values (%d, %d" % (self.ts, colIdx + 2) + for j in range(colIdx + 1): + sql += ", %d" % (colIdx + 2) + sql += ")" + tdSql.execute(sql) + + # count non-NULL values in each column + tdSql.query(self.sqlHead + self.sqlTail) + tdSql.checkData(0, 0, self.rowNum * (colIdx + 2)) + tdSql.checkData(0, 1, self.rowNum * (colIdx + 2)) + for i in range(2, colIdx + 2): + print("check2: i=%d colIdx=%d" % (i, colIdx)) + tdSql.checkData(0, i, self.rowNum * (colIdx - i + 3)) + + def run(self): + # Setup params + db = "db" + + # Create db + tdSql.execute("drop database if exists %s" % (db)) + tdSql.execute("reset query cache") + tdSql.execute("create database %s maxrows 200 maxtables 4" % (db)) + tdSql.execute("use %s" % (db)) + + # Create a table with one colunm of int type and insert 300 rows + tdLog.info("Create table tb") + tdSql.execute("create table tb (ts timestamp, c1 int)") + tdLog.info("Insert %d rows into tb" % (self.rowNum)) + for k in range(1, self.rowNum + 1): + self.ts += self.step + tdSql.execute("insert into tb values (%d, 1)" % (self.ts)) + + # Alter tb and add a column of smallint type, then query tb to see if + # all added column are NULL + self.addColumnAndCount() + tdDnodes.stop(1) + time.sleep(5) + tdDnodes.start(1) + time.sleep(5) + tdSql.query(self.sqlHead + self.sqlTail) + for i in range(2, len(self.types) + 2): + tdSql.checkData(0, i, self.rowNum * (len(self.types) + 2 - i)) + + self.dropColumnAndCount() + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +#tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/alter/file_corrupt.py b/tests/pytest/alter/file_corrupt.py new file mode 100644 index 0000000000..51ea882270 --- /dev/null +++ b/tests/pytest/alter/file_corrupt.py @@ -0,0 +1,77 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + tdSql.execute( + 'create table st (ts timestamp, v1 int, v2 int, v3 int, v4 int, v5 int) tags (t int)') + + totalTables = 100 + batchSize = 500 + totalBatch = 60 + + tdLog.info( + "create %d tables, insert %d rows per table" % + (totalTables, batchSize * totalBatch)) + + for t in range(0, totalTables): + tdSql.execute('create table t%d using st tags(%d)' % (t, t)) + # 2019-06-10 00:00:00 + beginTs = 1560096000000 + interval = 10000 + for r in range(0, totalBatch): + sql = 'insert into t%d values ' % (t) + for b in range(0, batchSize): + ts = beginTs + (r * batchSize + b) * interval + sql += '(%d, 1, 2, 3, 4, 5)' % (ts) + tdSql.execute(sql) + + tdLog.info("insert data finished") + tdSql.execute('alter table st add column v6 int') + tdLog.sleep(5) + tdLog.info("alter table finished") + + tdSql.query("select count(*) from t50") + tdSql.checkData(0, 0, (int)(batchSize * totalBatch)) + + tdLog.info("insert") + tdSql.execute( + "insert into t50 values ('2019-06-13 07:59:55.000', 1, 2, 3, 4, 5, 6)") + + tdLog.info("import") + tdSql.execute( + "import into t50 values ('2019-06-13 07:59:55.000', 1, 2, 3, 4, 5, 6)") + + tdLog.info("query") + tdSql.query("select count(*) from t50") + tdSql.checkData(0, 0, batchSize * totalBatch + 1) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/tag_lite/__init__.py b/tests/pytest/tag_lite/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/tests/pytest/tag_lite/datatype.py b/tests/pytest/tag_lite/datatype.py new file mode 100644 index 0000000000..1fcf7ce19e --- /dev/null +++ b/tests/pytest/tag_lite/datatype.py @@ -0,0 +1,135 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + self.ntables = 10 + self.rowsPerTable = 10 + self.startTime = 1520000010000 + + tdDnodes.stop(1) + tdDnodes.deploy(1) + tdDnodes.start(1) + + tdLog.info("================= step0") + tdSql.execute('reset query cache') + tdLog.info("drop database db if exits") + tdSql.execute('drop database if exists db') + tdLog.info("================= step1") + tdSql.execute('create database db maxtables 4') + tdLog.sleep(5) + tdSql.execute('use db') + + tdLog.info("================= step1") + tdLog.info("create 1 super table") + tdSql.execute('create table stb (ts timestamp, i int) \ + tags (tin int, tfl float, tbg bigint, tdo double, tbi binary(10), tbl bool)') + + tdLog.info("================= step2") + tdLog.info("create %d tables" % self.ntables) + for tid in range(1, self.ntables + 1): + tdSql.execute( + 'create table tb%d using stb tags(%d,%f,%ld,%f,\'%s\',%d)' % + (tid, + tid % + 3, + 1.2 * + tid, + self.startTime + + tid, + 1.22 * + tid, + 't' + + str(tid), + tid % + 2)) + tdLog.sleep(5) + + tdLog.info("================= step3") + tdLog.info( + "insert %d data in to each %d tables" % + (self.rowsPerTable, self.ntables)) + for rid in range(1, self.rowsPerTable + 1): + sqlcmd = ['insert into'] + for tid in range(1, self.ntables + 1): + sqlcmd.append( + 'tb%d values(%ld,%d)' % + (tid, self.startTime + rid, rid)) + tdSql.execute(" ".join(sqlcmd)) + tdSql.query('select count(*) from stb') + tdSql.checkData(0, 0, self.rowsPerTable * self.ntables) + + tdLog.info("================= step4") + tdLog.info("drop one tag") + tdSql.execute('alter table stb drop tag tbi') + tdLog.info("insert %d data in to each %d tables" % (2, self.ntables)) + for rid in range(self.rowsPerTable + 1, self.rowsPerTable + 3): + sqlcmd = ['insert into'] + for tid in range(1, self.ntables + 1): + sqlcmd.append( + 'tb%d values(%ld,%d)' % + (tid, self.startTime + rid, rid)) + tdSql.execute(" ".join(sqlcmd)) + self.rowsPerTable += 2 + tdSql.query('select count(*) from stb') + tdSql.checkData(0, 0, self.rowsPerTable * self.ntables) + tdSql.query('describe tb1') + tdSql.checkRows(2 + 5) + + tdLog.info("================= step5") + tdLog.info("add one tag") + tdSql.execute('alter table stb add tag tnc nchar(10)') + for tid in range(1, self.ntables + 1): + tdSql.execute('alter table tb%d set tag tnc=\"%s\"' % + (tid, str(tid * 1.2))) + tdLog.info("insert %d data in to each %d tables" % (2, self.ntables)) + for rid in range(self.rowsPerTable + 1, self.rowsPerTable + 3): + sqlcmd = ['insert into'] + for tid in range(1, self.ntables + 1): + sqlcmd.append( + 'tb%d values(%ld,%d)' % + (tid, self.startTime + rid, rid)) + tdSql.execute(" ".join(sqlcmd)) + self.rowsPerTable += 2 + tdSql.query('select count(*) from stb') + tdSql.checkData(0, 0, self.rowsPerTable * self.ntables) + tdSql.query('describe tb1') + tdSql.checkRows(2 + 6) + + tdLog.info("================= step6") + tdLog.info("group and filter by tag1 int") + tdSql.query('select max(i) from stb where tbl=0 group by tin') + tdSql.checkRows(3) + tdSql.execute('reset query cache') + tdSql.query('select max(i) from stb where tbl=true group by tin') + tdSql.checkData(2, 0, self.rowsPerTable) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) From 8cb168a3343e5d123ff255102617e5969e18a9d8 Mon Sep 17 00:00:00 2001 From: changshuaiqiang Date: Tue, 12 May 2020 18:20:05 +0800 Subject: [PATCH 017/126] test: add db cases --- tests/script/basicSuite.sim | 16 +++++++++++++++- tests/script/general/connection/connection.sim | 2 +- tests/script/general/db/vnodes.sim | 2 ++ 3 files changed, 18 insertions(+), 2 deletions(-) diff --git a/tests/script/basicSuite.sim b/tests/script/basicSuite.sim index d0bb58ec20..7dbe51ff38 100644 --- a/tests/script/basicSuite.sim +++ b/tests/script/basicSuite.sim @@ -19,4 +19,18 @@ run general/user/basic1.sim run general/user/pass_alter.sim run general/vector/single.sim run general/connection/connection.sim -run general/user/authority.sim +run general/user/testSuite.sim +run general/db/basic.sim +run general/db/basic1.sim +run general/db/basic2.sim +run general/db/basic3.sim +run general/db/basic4.sim +run general/db/basic5.sim +run general/db/delete_reuse1.sim +run general/db/delete_reuse2.sim +run general/db/delete_reusevnode.sim +run general/db/delete_writing1.sim +run general/db/delete_writing2.sim +run general/db/len.sim +run general/db/repeat.sim +run general/db/tables.sim diff --git a/tests/script/general/connection/connection.sim b/tests/script/general/connection/connection.sim index 71db20b285..abebbacbd9 100644 --- a/tests/script/general/connection/connection.sim +++ b/tests/script/general/connection/connection.sim @@ -16,6 +16,6 @@ sql connect print ============= step3 sql close -sql connect write +sql connect system sh/exec.sh -n dnode1 -s stop -x SIGINT \ No newline at end of file diff --git a/tests/script/general/db/vnodes.sim b/tests/script/general/db/vnodes.sim index 684910884b..54d8aa77c3 100644 --- a/tests/script/general/db/vnodes.sim +++ b/tests/script/general/db/vnodes.sim @@ -33,6 +33,8 @@ endw print ========== step2 sql select * from mt +print $rows +print $totalRows if $rows != $totalRows then return -1 endi From 196d4f1340127e5efd7d858c5226ef11c386ce2e Mon Sep 17 00:00:00 2001 From: changshuaiqiang Date: Tue, 12 May 2020 18:47:55 +0800 Subject: [PATCH 018/126] test: del basic --- tests/script/basicSuite.sim | 16 ---------------- 1 file changed, 16 deletions(-) diff --git a/tests/script/basicSuite.sim b/tests/script/basicSuite.sim index 7dbe51ff38..a99edfd93d 100644 --- a/tests/script/basicSuite.sim +++ b/tests/script/basicSuite.sim @@ -18,19 +18,3 @@ run general/table/vgroup.sim run general/user/basic1.sim run general/user/pass_alter.sim run general/vector/single.sim -run general/connection/connection.sim -run general/user/testSuite.sim -run general/db/basic.sim -run general/db/basic1.sim -run general/db/basic2.sim -run general/db/basic3.sim -run general/db/basic4.sim -run general/db/basic5.sim -run general/db/delete_reuse1.sim -run general/db/delete_reuse2.sim -run general/db/delete_reusevnode.sim -run general/db/delete_writing1.sim -run general/db/delete_writing2.sim -run general/db/len.sim -run general/db/repeat.sim -run general/db/tables.sim From 932604173a30b6cfd94a6c4db740914dcc4f5af0 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 10:23:56 +0800 Subject: [PATCH 019/126] [TD-149] change hash imp in sdb --- src/mnode/src/mgmtSdb.c | 79 +++++++++++++++++++++++++-------------- src/mnode/src/mgmtTable.c | 3 ++ 2 files changed, 54 insertions(+), 28 deletions(-) diff --git a/src/mnode/src/mgmtSdb.c b/src/mnode/src/mgmtSdb.c index c25f4457a9..3116ad39f3 100644 --- a/src/mnode/src/mgmtSdb.c +++ b/src/mnode/src/mgmtSdb.c @@ -16,6 +16,7 @@ #define _DEFAULT_SOURCE #include "os.h" #include "taoserror.h" +#include "hash.h" #include "trpc.h" #include "tutil.h" #include "tbalance.h" @@ -83,12 +84,6 @@ typedef struct { } SSdbRow; static SSdbObject tsSdbObj = {0}; -static void *(*sdbInitIndexFp[])(int32_t maxRows, int32_t dataSize) = {sdbOpenStrHash, sdbOpenIntHash, sdbOpenIntHash}; -static void *(*sdbAddIndexFp[])(void *handle, void *key, void *data) = {sdbAddStrHash, sdbAddIntHash, sdbAddIntHash}; -static void (*sdbDeleteIndexFp[])(void *handle, void *key) = {sdbDeleteStrHash, sdbDeleteIntHash, sdbDeleteIntHash}; -static void *(*sdbGetIndexFp[])(void *handle, void *key) = {sdbGetStrHashData, sdbGetIntHashData, sdbGetIntHashData}; -static void (*sdbCleanUpIndexFp[])(void *handle) = {sdbCloseStrHash, sdbCloseIntHash, sdbCloseIntHash}; -static void *(*sdbFetchRowFp[])(void *handle, void *ptr, void **ppRow) = {sdbFetchStrHashData, sdbFetchIntHashData, sdbFetchIntHashData}; static int sdbWrite(void *param, void *data, int type); int32_t sdbGetId(void *handle) { @@ -375,7 +370,11 @@ static SSdbRow *sdbGetRowMeta(void *handle, void *key) { if (handle == NULL) return NULL; - pMeta = (*sdbGetIndexFp[pTable->keyType])(pTable->iHandle, key); + int32_t keySize = sizeof(int32_t); + if (pTable->keyType == SDB_KEY_STRING) { + keySize = strlen((char *)key); + } + pMeta = taosHashGet(pTable->iHandle, key, keySize); return pMeta; } @@ -387,13 +386,17 @@ void *sdbGetRow(void *handle, void *key) { if (handle == NULL) return NULL; pthread_mutex_lock(&pTable->mutex); - pMeta = (*sdbGetIndexFp[pTable->keyType])(pTable->iHandle, key); + + int32_t keySize = sizeof(int32_t); + if (pTable->keyType == SDB_KEY_STRING) { + keySize = strlen((char *)key); + } + pMeta = taosHashGet(pTable->iHandle, key, keySize); + if (pMeta) sdbIncRef(pTable, pMeta->row); pthread_mutex_unlock(&pTable->mutex); - if (pMeta == NULL) { - return NULL; - } + if (pMeta == NULL) return NULL; return pMeta->row; } @@ -404,7 +407,13 @@ static int32_t sdbInsertHash(SSdbTable *pTable, SSdbOper *pOper) { rowMeta.row = pOper->pObj; pthread_mutex_lock(&pTable->mutex); - (*sdbAddIndexFp[pTable->keyType])(pTable->iHandle, pOper->pObj, &rowMeta); + + int32_t keySize = sizeof(int32_t); + if (pTable->keyType == SDB_KEY_STRING) { + keySize = strlen((char *)pOper->pObj); + } + taosHashPut(pTable->iHandle, pOper->pObj, keySize, &rowMeta, sizeof(SSdbRow)); + sdbIncRef(pTable, pOper->pObj); pTable->numOfRows++; @@ -427,7 +436,13 @@ static int32_t sdbDeleteHash(SSdbTable *pTable, SSdbOper *pOper) { (*pTable->deleteFp)(pOper); pthread_mutex_lock(&pTable->mutex); - (*sdbDeleteIndexFp[pTable->keyType])(pTable->iHandle, pOper->pObj); + + int32_t keySize = sizeof(int32_t); + if (pTable->keyType == SDB_KEY_STRING) { + keySize = strlen((char *)pOper->pObj); + } + taosHashRemove(pTable->iHandle, pOper->pObj, keySize); + pTable->numOfRows--; pthread_mutex_unlock(&pTable->mutex); @@ -637,18 +652,26 @@ int32_t sdbUpdateRow(SSdbOper *pOper) { void *sdbFetchRow(void *handle, void *pNode, void **ppRow) { SSdbTable *pTable = (SSdbTable *)handle; - SSdbRow * pMeta; - *ppRow = NULL; if (pTable == NULL) return NULL; - pNode = (*sdbFetchRowFp[pTable->keyType])(pTable->iHandle, pNode, (void **)&pMeta); + SHashMutableIterator *pIter = pNode; + if (pIter == NULL) { + pIter = taosHashCreateIter(pTable->iHandle); + } + + if (!taosHashIterNext(pIter)) { + taosHashDestroyIter(pIter); + return NULL; + } + + SSdbRow *pMeta = taosHashIterGet(pIter); if (pMeta == NULL) return NULL; *ppRow = pMeta->row; sdbIncRef(handle, pMeta->row); - return pNode; + return pIter; } void *sdbOpenTable(SSdbTableDesc *pDesc) { @@ -669,10 +692,12 @@ void *sdbOpenTable(SSdbTableDesc *pDesc) { pTable->decodeFp = pDesc->decodeFp; pTable->destroyFp = pDesc->destroyFp; pTable->restoredFp = pDesc->restoredFp; - - if (sdbInitIndexFp[pTable->keyType] != NULL) { - pTable->iHandle = (*sdbInitIndexFp[pTable->keyType])(pTable->maxRowSize, sizeof(SSdbRow)); + + _hash_fn_t hashFp = taosGetDefaultHashFunction(TSDB_DATA_TYPE_INT); + if (pTable->keyType == SDB_KEY_STRING) { + hashFp = taosGetDefaultHashFunction(TSDB_DATA_TYPE_BINARY); } + pTable->iHandle = taosHashInit(pTable->hashSessions, hashFp, true); pthread_mutex_init(&pTable->mutex, NULL); @@ -688,11 +713,10 @@ void sdbCloseTable(void *handle) { tsSdbObj.numOfTables--; tsSdbObj.tableList[pTable->tableId] = NULL; - void *pNode = NULL; - while (1) { - SSdbRow *pMeta; - pNode = (*sdbFetchRowFp[pTable->keyType])(pTable->iHandle, pNode, (void **)&pMeta); - if (pMeta == NULL) break; + SHashMutableIterator *pIter = taosHashCreateIter(pTable->iHandle); + while (taosHashIterNext(pIter)) { + SSdbRow *pMeta = taosHashIterGet(pIter); + if (pMeta == NULL) continue; SSdbOper oper = { .pObj = pMeta->row, @@ -702,9 +726,8 @@ void sdbCloseTable(void *handle) { (*pTable->destroyFp)(&oper); } - if (sdbCleanUpIndexFp[pTable->keyType]) { - (*sdbCleanUpIndexFp[pTable->keyType])(pTable->iHandle); - } + taosHashDestroyIter(pIter); + taosHashCleanup(pTable->iHandle); pthread_mutex_destroy(&pTable->mutex); diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index 624833c6e4..affd7a1073 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -812,6 +812,7 @@ static void mgmtProcessDropSuperTableMsg(SQueuedMsg *pMsg) { dnodeSendMsgToDnode(&ipSet, &rpcMsg); mgmtDecVgroupRef(pVgroup); } + taosHashDestroyIter(pIter); mgmtDropAllChildTablesInStable(pStable); } @@ -1288,6 +1289,8 @@ static void mgmtProcessSuperTableVgroupMsg(SQueuedMsg *pMsg) { mgmtDecVgroupRef(pVgroup); } + taosHashDestroyIter(pIter); + pVgroupInfo->numOfVgroups = htonl(vgSize); // one table is done, try the next table From ff9bdcfdb0345e1fdf7171612db89be0d43a5d40 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 14:54:05 +0800 Subject: [PATCH 020/126] [TD-149] replace sdb hash --- src/mnode/inc/mgmtAcct.h | 2 +- src/mnode/inc/mgmtDb.h | 2 +- src/mnode/inc/mgmtDef.h | 2 +- src/mnode/inc/mgmtDnode.h | 2 +- src/mnode/inc/mgmtMnode.h | 2 +- src/mnode/inc/mgmtSdb.h | 3 +- src/mnode/inc/mgmtTable.h | 4 +- src/mnode/inc/mgmtUser.h | 2 +- src/mnode/inc/mgmtVgroup.h | 2 +- src/mnode/src/mgmtAcct.c | 4 +- src/mnode/src/mgmtBalance.c | 7 +++- src/mnode/src/mgmtDb.c | 17 ++++---- src/mnode/src/mgmtDnode.c | 33 ++++++++------- src/mnode/src/mgmtMnode.c | 21 ++++++---- src/mnode/src/mgmtProfile.c | 18 ++++---- src/mnode/src/mgmtSdb.c | 16 +++++-- src/mnode/src/mgmtShell.c | 13 ++++-- src/mnode/src/mgmtTable.c | 83 ++++++++++++++----------------------- src/mnode/src/mgmtUser.c | 15 ++++--- src/mnode/src/mgmtVgroup.c | 30 +++++++------- src/util/inc/tcache.h | 2 + src/util/src/tcache.c | 13 ++++-- 22 files changed, 155 insertions(+), 138 deletions(-) diff --git a/src/mnode/inc/mgmtAcct.h b/src/mnode/inc/mgmtAcct.h index 0c0bb8d05c..136c28f2ae 100644 --- a/src/mnode/inc/mgmtAcct.h +++ b/src/mnode/inc/mgmtAcct.h @@ -25,7 +25,7 @@ extern "C" { int32_t mgmtInitAccts(); void mgmtCleanUpAccts(); void * mgmtGetAcct(char *acctName); -void * mgmtGetNextAcct(void *pNode, SAcctObj **pAcct); +void * mgmtGetNextAcct(void *pIter, SAcctObj **pAcct); void mgmtIncAcctRef(SAcctObj *pAcct); void mgmtDecAcctRef(SAcctObj *pAcct); void mgmtAddDbToAcct(SAcctObj *pAcct, SDbObj *pDb); diff --git a/src/mnode/inc/mgmtDb.h b/src/mnode/inc/mgmtDb.h index b00a2bdf3d..4ad46eee7b 100644 --- a/src/mnode/inc/mgmtDb.h +++ b/src/mnode/inc/mgmtDb.h @@ -32,7 +32,7 @@ int32_t mgmtInitDbs(); void mgmtCleanUpDbs(); SDbObj *mgmtGetDb(char *db); SDbObj *mgmtGetDbByTableId(char *db); -void * mgmtGetNextDb(void *pNode, SDbObj **pDb); +void * mgmtGetNextDb(void *pIter, SDbObj **pDb); void mgmtIncDbRef(SDbObj *pDb); void mgmtDecDbRef(SDbObj *pDb); bool mgmtCheckIsMonitorDB(char *db, char *monitordb); diff --git a/src/mnode/inc/mgmtDef.h b/src/mnode/inc/mgmtDef.h index 3ac2efb83b..f33531583a 100644 --- a/src/mnode/inc/mgmtDef.h +++ b/src/mnode/inc/mgmtDef.h @@ -223,7 +223,7 @@ typedef struct SAcctObj { typedef struct { int8_t type; char db[TSDB_DB_NAME_LEN + 1]; - void * pNode; + void * pIter; int16_t numOfColumns; int32_t rowSize; int32_t numOfRows; diff --git a/src/mnode/inc/mgmtDnode.h b/src/mnode/inc/mgmtDnode.h index 1d7116c6c0..c9e062255b 100644 --- a/src/mnode/inc/mgmtDnode.h +++ b/src/mnode/inc/mgmtDnode.h @@ -34,7 +34,7 @@ char* mgmtGetDnodeStatusStr(int32_t dnodeStatus); void mgmtMonitorDnodeModule(); int32_t mgmtGetDnodesNum(); -void * mgmtGetNextDnode(void *pNode, SDnodeObj **pDnode); +void * mgmtGetNextDnode(void *pIter, SDnodeObj **pDnode); void mgmtIncDnodeRef(SDnodeObj *pDnode); void mgmtDecDnodeRef(SDnodeObj *pDnode); void * mgmtGetDnode(int32_t dnodeId); diff --git a/src/mnode/inc/mgmtMnode.h b/src/mnode/inc/mgmtMnode.h index cb1d009c8c..b9a135346d 100644 --- a/src/mnode/inc/mgmtMnode.h +++ b/src/mnode/inc/mgmtMnode.h @@ -37,7 +37,7 @@ void mgmtDropMnodeLocal(int32_t dnodeId); void * mgmtGetMnode(int32_t mnodeId); int32_t mgmtGetMnodesNum(); -void * mgmtGetNextMnode(void *pNode, struct SMnodeObj **pMnode); +void * mgmtGetNextMnode(void *pIter, struct SMnodeObj **pMnode); void mgmtIncMnodeRef(struct SMnodeObj *pMnode); void mgmtDecMnodeRef(struct SMnodeObj *pMnode); diff --git a/src/mnode/inc/mgmtSdb.h b/src/mnode/inc/mgmtSdb.h index 2b96eb4005..a97b1219a9 100644 --- a/src/mnode/inc/mgmtSdb.h +++ b/src/mnode/inc/mgmtSdb.h @@ -80,7 +80,8 @@ int32_t sdbDeleteRow(SSdbOper *pOper); int32_t sdbUpdateRow(SSdbOper *pOper); void *sdbGetRow(void *handle, void *key); -void *sdbFetchRow(void *handle, void *pNode, void **ppRow); +void *sdbFetchRow(void *handle, void *pIter, void **ppRow); +void sdbFreeIter(void *pIter); void sdbIncRef(void *thandle, void *pRow); void sdbDecRef(void *thandle, void *pRow); int64_t sdbGetNumOfRows(void *handle); diff --git a/src/mnode/inc/mgmtTable.h b/src/mnode/inc/mgmtTable.h index 9c4aa4a2a5..84220c9cf8 100644 --- a/src/mnode/inc/mgmtTable.h +++ b/src/mnode/inc/mgmtTable.h @@ -27,8 +27,8 @@ void mgmtCleanUpTables(); void * mgmtGetTable(char *tableId); void mgmtIncTableRef(void *pTable); void mgmtDecTableRef(void *pTable); -void * mgmtGetNextChildTable(void *pNode, SChildTableObj **pTable); -void * mgmtGetNextSuperTable(void *pNode, SSuperTableObj **pTable); +void * mgmtGetNextChildTable(void *pIter, SChildTableObj **pTable); +void * mgmtGetNextSuperTable(void *pIter, SSuperTableObj **pTable); void mgmtDropAllChildTables(SDbObj *pDropDb); void mgmtDropAllSuperTables(SDbObj *pDropDb); diff --git a/src/mnode/inc/mgmtUser.h b/src/mnode/inc/mgmtUser.h index 0a21b1f704..2edd71f3e7 100644 --- a/src/mnode/inc/mgmtUser.h +++ b/src/mnode/inc/mgmtUser.h @@ -24,7 +24,7 @@ extern "C" { int32_t mgmtInitUsers(); void mgmtCleanUpUsers(); SUserObj *mgmtGetUser(char *name); -void * mgmtGetNextUser(void *pNode, SUserObj **pUser); +void * mgmtGetNextUser(void *pIter, SUserObj **pUser); void mgmtIncUserRef(SUserObj *pUser); void mgmtDecUserRef(SUserObj *pUser); SUserObj *mgmtGetUserFromConn(void *pConn); diff --git a/src/mnode/inc/mgmtVgroup.h b/src/mnode/inc/mgmtVgroup.h index 21a2c9b896..7acf7112a4 100644 --- a/src/mnode/inc/mgmtVgroup.h +++ b/src/mnode/inc/mgmtVgroup.h @@ -35,7 +35,7 @@ void mgmtDecVgroupRef(SVgObj *pVgroup); void mgmtDropAllDbVgroups(SDbObj *pDropDb, bool sendMsg); void mgmtDropAllDnodeVgroups(SDnodeObj *pDropDnode); -void * mgmtGetNextVgroup(void *pNode, SVgObj **pVgroup); +void * mgmtGetNextVgroup(void *pIter, SVgObj **pVgroup); void mgmtUpdateVgroup(SVgObj *pVgroup); void mgmtUpdateVgroupStatus(SVgObj *pVgroup, SDnodeObj *dnodeId, SVnodeLoad *pVload); diff --git a/src/mnode/src/mgmtAcct.c b/src/mnode/src/mgmtAcct.c index 1cacec96ee..27beff8944 100644 --- a/src/mnode/src/mgmtAcct.c +++ b/src/mnode/src/mgmtAcct.c @@ -126,8 +126,8 @@ void *mgmtGetAcct(char *name) { return sdbGetRow(tsAcctSdb, name); } -void *mgmtGetNextAcct(void *pNode, SAcctObj **pAcct) { - return sdbFetchRow(tsAcctSdb, pNode, (void **)pAcct); +void *mgmtGetNextAcct(void *pIter, SAcctObj **pAcct) { + return sdbFetchRow(tsAcctSdb, pIter, (void **)pAcct); } void mgmtIncAcctRef(SAcctObj *pAcct) { diff --git a/src/mnode/src/mgmtBalance.c b/src/mnode/src/mgmtBalance.c index ff5b4008bb..f8410a207e 100644 --- a/src/mnode/src/mgmtBalance.c +++ b/src/mnode/src/mgmtBalance.c @@ -22,6 +22,7 @@ #include "mgmtInt.h" #include "mgmtMnode.h" #include "mgmtDnode.h" +#include "mgmtSdb.h" #include "mgmtVgroup.h" #ifndef _SYNC @@ -33,13 +34,13 @@ void balanceUpdateMgmt() {} void balanceReset() {} int32_t balanceAllocVnodes(SVgObj *pVgroup) { - void * pNode = NULL; + void * pIter = NULL; SDnodeObj *pDnode = NULL; SDnodeObj *pSelDnode = NULL; float vnodeUsage = 1000.0; while (1) { - pNode = mgmtGetNextDnode(pNode, &pDnode); + pIter = mgmtGetNextDnode(pIter, &pDnode); if (pDnode == NULL) break; if (pDnode->totalVnodes > 0 && pDnode->openVnodes < pDnode->totalVnodes) { @@ -55,6 +56,8 @@ int32_t balanceAllocVnodes(SVgObj *pVgroup) { mgmtDecDnodeRef(pDnode); } + sdbFreeIter(pIter); + if (pSelDnode == NULL) { mError("failed to alloc vnode to vgroup"); return TSDB_CODE_NO_ENOUGH_DNODES; diff --git a/src/mnode/src/mgmtDb.c b/src/mnode/src/mgmtDb.c index 2f17df92fa..3f43d4bf89 100644 --- a/src/mnode/src/mgmtDb.c +++ b/src/mnode/src/mgmtDb.c @@ -156,8 +156,8 @@ int32_t mgmtInitDbs() { return 0; } -void *mgmtGetNextDb(void *pNode, SDbObj **pDb) { - return sdbFetchRow(tsDbSdb, pNode, (void **)pDb); +void *mgmtGetNextDb(void *pIter, SDbObj **pDb) { + return sdbFetchRow(tsDbSdb, pIter, (void **)pDb); } SDbObj *mgmtGetDb(char *db) { @@ -583,7 +583,7 @@ static int32_t mgmtRetrieveDbs(SShowObj *pShow, char *data, int32_t rows, void * if (pUser == NULL) return 0; while (numOfRows < rows) { - pShow->pNode = mgmtGetNextDb(pShow->pNode, &pDb); + pShow->pIter = mgmtGetNextDb(pShow->pIter, &pDb); if (pDb == NULL) break; cols = 0; @@ -865,14 +865,15 @@ static int32_t mgmtAlterDb(SDbObj *pDb, SCMAlterDbMsg *pAlter) { } } - void *pNode = NULL; + void *pIter = NULL; while (1) { SVgObj *pVgroup = NULL; - pNode = mgmtGetNextVgroup(pNode, &pVgroup); + pIter = mgmtGetNextVgroup(pIter, &pVgroup); if (pVgroup == NULL) break; mgmtSendCreateVgroupMsg(pVgroup, NULL); mgmtDecVgroupRef(pVgroup); } + sdbFreeIter(pIter); if (oldReplica != pDb->cfg.replications) { balanceNotify(); @@ -983,12 +984,12 @@ static void mgmtProcessDropDbMsg(SQueuedMsg *pMsg) { void mgmtDropAllDbs(SAcctObj *pAcct) { int32_t numOfDbs = 0; SDbObj *pDb = NULL; - void * pNode = NULL; + void * pIter = NULL; mPrint("acct:%s, all dbs will be dropped from sdb", pAcct->user); while (1) { - pNode = mgmtGetNextDb(pNode, &pDb); + pIter = mgmtGetNextDb(pIter, &pDb); if (pDb == NULL) break; if (pDb->pAcct == pAcct) { @@ -1005,5 +1006,7 @@ void mgmtDropAllDbs(SAcctObj *pAcct) { mgmtDecDbRef(pDb); } + sdbFreeIter(pIter); + mPrint("acct:%s, all dbs:%d is dropped from sdb", pAcct->user, numOfDbs); } diff --git a/src/mnode/src/mgmtDnode.c b/src/mnode/src/mgmtDnode.c index d60dae32ae..463f5dde47 100644 --- a/src/mnode/src/mgmtDnode.c +++ b/src/mnode/src/mgmtDnode.c @@ -170,8 +170,8 @@ void mgmtCleanupDnodes() { sdbCloseTable(tsDnodeSdb); } -void *mgmtGetNextDnode(void *pNode, SDnodeObj **pDnode) { - return sdbFetchRow(tsDnodeSdb, pNode, (void **)pDnode); +void *mgmtGetNextDnode(void *pIter, SDnodeObj **pDnode) { + return sdbFetchRow(tsDnodeSdb, pIter, (void **)pDnode); } int32_t mgmtGetDnodesNum() { @@ -184,17 +184,20 @@ void *mgmtGetDnode(int32_t dnodeId) { void *mgmtGetDnodeByEp(char *ep) { SDnodeObj *pDnode = NULL; - void * pNode = NULL; + void * pIter = NULL; while (1) { - pNode = mgmtGetNextDnode(pNode, &pDnode); + pIter = mgmtGetNextDnode(pIter, &pDnode); if (pDnode == NULL) break; if (strcmp(ep, pDnode->dnodeEp) == 0) { + sdbFreeIter(pIter); return pDnode; } mgmtDecDnodeRef(pDnode); } + sdbFreeIter(pIter); + return NULL; } @@ -530,7 +533,7 @@ static int32_t mgmtGetDnodeMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pCo pShow->numOfRows = mgmtGetDnodesNum(); pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; - pShow->pNode = NULL; + pShow->pIter = NULL; mgmtDecUserRef(pUser); @@ -544,7 +547,7 @@ static int32_t mgmtRetrieveDnodes(SShowObj *pShow, char *data, int32_t rows, voi char *pWrite; while (numOfRows < rows) { - pShow->pNode = mgmtGetNextDnode(pShow->pNode, &pDnode); + pShow->pIter = mgmtGetNextDnode(pShow->pIter, &pDnode); if (pDnode == NULL) break; cols = 0; @@ -636,7 +639,7 @@ static int32_t mgmtGetModuleMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pC pShow->numOfRows = mgmtGetDnodesNum() * TSDB_MOD_MAX; pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; - pShow->pNode = NULL; + pShow->pIter = NULL; mgmtDecUserRef(pUser); return 0; @@ -648,7 +651,7 @@ int32_t mgmtRetrieveModules(SShowObj *pShow, char *data, int32_t rows, void *pCo while (numOfRows < rows) { SDnodeObj *pDnode = NULL; - pShow->pNode = mgmtGetNextDnode(pShow->pNode, (SDnodeObj **)&pDnode); + pShow->pIter = mgmtGetNextDnode(pShow->pIter, (SDnodeObj **)&pDnode); if (pDnode == NULL) break; for (int32_t moduleType = 0; moduleType < TSDB_MOD_MAX; ++moduleType) { @@ -738,7 +741,7 @@ static int32_t mgmtGetConfigMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pC } pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; - pShow->pNode = NULL; + pShow->pIter = NULL; mgmtDecUserRef(pUser); return 0; @@ -821,7 +824,8 @@ static int32_t mgmtGetVnodeMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pCo if (pShow->payloadLen > 0 ) { pDnode = mgmtGetDnodeByEp(pShow->payload); } else { - mgmtGetNextDnode(NULL, (SDnodeObj **)&pDnode); + void *pIter = mgmtGetNextDnode(NULL, (SDnodeObj **)&pDnode); + sdbFreeIter(pIter); } if (pDnode != NULL) { @@ -830,7 +834,7 @@ static int32_t mgmtGetVnodeMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pCo } pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; - pShow->pNode = pDnode; + pShow->pIter = pDnode; mgmtDecUserRef(pUser); return 0; @@ -844,12 +848,12 @@ static int32_t mgmtRetrieveVnodes(SShowObj *pShow, char *data, int32_t rows, voi if (0 == rows) return 0; - pDnode = (SDnodeObj *)(pShow->pNode); + pDnode = (SDnodeObj *)(pShow->pIter); if (pDnode != NULL) { - void *pNode = NULL; + void *pIter = NULL; SVgObj *pVgroup; while (1) { - pNode = mgmtGetNextVgroup(pNode, &pVgroup); + pIter = mgmtGetNextVgroup(pIter, &pVgroup); if (pVgroup == NULL) break; for (int32_t i = 0; i < pVgroup->numOfVnodes; ++i) { @@ -869,6 +873,7 @@ static int32_t mgmtRetrieveVnodes(SShowObj *pShow, char *data, int32_t rows, voi mgmtDecVgroupRef(pVgroup); } + sdbFreeIter(pIter); } else { numOfRows = 0; } diff --git a/src/mnode/src/mgmtMnode.c b/src/mnode/src/mgmtMnode.c index a78e5574c0..d9ddd465f6 100644 --- a/src/mnode/src/mgmtMnode.c +++ b/src/mnode/src/mgmtMnode.c @@ -95,11 +95,12 @@ static int32_t mgmtMnodeActionDecode(SSdbOper *pOper) { static int32_t mgmtMnodeActionRestored() { if (mgmtGetMnodesNum() == 1) { SMnodeObj *pMnode = NULL; - mgmtGetNextMnode(NULL, &pMnode); + void *pIter = mgmtGetNextMnode(NULL, &pMnode); if (pMnode != NULL) { pMnode->role = TAOS_SYNC_ROLE_MASTER; mgmtDecMnodeRef(pMnode); } + sdbFreeIter(pIter); } return TSDB_CODE_SUCCESS; } @@ -157,8 +158,8 @@ void mgmtDecMnodeRef(SMnodeObj *pMnode) { sdbDecRef(tsMnodeSdb, pMnode); } -void *mgmtGetNextMnode(void *pNode, SMnodeObj **pMnode) { - return sdbFetchRow(tsMnodeSdb, pNode, (void **)pMnode); +void *mgmtGetNextMnode(void *pIter, SMnodeObj **pMnode) { + return sdbFetchRow(tsMnodeSdb, pIter, (void **)pMnode); } char *mgmtGetMnodeRoleStr(int32_t role) { @@ -177,10 +178,10 @@ char *mgmtGetMnodeRoleStr(int32_t role) { } void mgmtGetMnodeIpSet(SRpcIpSet *ipSet) { - void *pNode = NULL; + void *pIter = NULL; while (1) { SMnodeObj *pMnode = NULL; - pNode = mgmtGetNextMnode(pNode, &pMnode); + pIter = mgmtGetNextMnode(pIter, &pMnode); if (pMnode == NULL) break; strcpy(ipSet->fqdn[ipSet->numOfIps], pMnode->pDnode->dnodeFqdn); @@ -194,6 +195,7 @@ void mgmtGetMnodeIpSet(SRpcIpSet *ipSet) { mgmtDecMnodeRef(pMnode); } + sdbFreeIter(pIter); } void mgmtGetMnodeInfos(void *param) { @@ -201,10 +203,10 @@ void mgmtGetMnodeInfos(void *param) { mnodes->inUse = 0; int32_t index = 0; - void *pNode = NULL; + void *pIter = NULL; while (1) { SMnodeObj *pMnode = NULL; - pNode = mgmtGetNextMnode(pNode, &pMnode); + pIter = mgmtGetNextMnode(pIter, &pMnode); if (pMnode == NULL) break; mnodes->nodeInfos[index].nodeId = htonl(pMnode->mnodeId); @@ -216,6 +218,7 @@ void mgmtGetMnodeInfos(void *param) { index++; mgmtDecMnodeRef(pMnode); } + sdbFreeIter(pIter); mnodes->nodeNum = index; } @@ -317,7 +320,7 @@ static int32_t mgmtGetMnodeMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pCo pShow->numOfRows = mgmtGetMnodesNum(); pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; - pShow->pNode = NULL; + pShow->pIter = NULL; mgmtDecUserRef(pUser); return 0; @@ -330,7 +333,7 @@ static int32_t mgmtRetrieveMnodes(SShowObj *pShow, char *data, int32_t rows, voi char *pWrite; while (numOfRows < rows) { - pShow->pNode = mgmtGetNextMnode(pShow->pNode, &pMnode); + pShow->pIter = mgmtGetNextMnode(pShow->pIter, &pMnode); if (pMnode == NULL) break; cols = 0; diff --git a/src/mnode/src/mgmtProfile.c b/src/mnode/src/mgmtProfile.c index 64ac8ed710..6667bff052 100644 --- a/src/mnode/src/mgmtProfile.c +++ b/src/mnode/src/mgmtProfile.c @@ -140,7 +140,7 @@ int32_t mgmtGetQueries(SShowObj *pShow, void *pConn) { // // // sorting based on useconds // -// pShow->pNode = pQueryShow; +// pShow->pIter = pQueryShow; return 0; } @@ -187,7 +187,7 @@ int32_t mgmtGetQueryMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pConn) { for (int32_t i = 1; i < cols; ++i) pShow->offset[i] = pShow->offset[i - 1] + pShow->bytes[i - 1]; pShow->numOfRows = 1000000; - pShow->pNode = NULL; + pShow->pIter = NULL; pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; mgmtGetQueries(pShow, pConn); @@ -252,7 +252,7 @@ int32_t mgmtRetrieveQueries(SShowObj *pShow, char *data, int32_t rows, void *pCo char *pWrite; int32_t cols = 0; - SQueryShow *pQueryShow = (SQueryShow *)pShow->pNode; + SQueryShow *pQueryShow = (SQueryShow *)pShow->pIter; if (rows > pQueryShow->numOfQueries - pQueryShow->index) rows = pQueryShow->numOfQueries - pQueryShow->index; @@ -339,7 +339,7 @@ int32_t mgmtGetStreams(SShowObj *pShow, void *pConn) { // // // sorting based on useconds // -// pShow->pNode = pStreamShow; +// pShow->pIter = pStreamShow; return 0; } @@ -397,7 +397,7 @@ int32_t mgmtGetStreamMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pConn) { for (int32_t i = 1; i < cols; ++i) pShow->offset[i] = pShow->offset[i - 1] + pShow->bytes[i - 1]; pShow->numOfRows = 1000000; - pShow->pNode = NULL; + pShow->pIter = NULL; pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; mgmtGetStreams(pShow, pConn); @@ -409,7 +409,7 @@ int32_t mgmtRetrieveStreams(SShowObj *pShow, char *data, int32_t rows, void *pCo char *pWrite; int32_t cols = 0; - SStreamShow *pStreamShow = (SStreamShow *)pShow->pNode; + SStreamShow *pStreamShow = (SStreamShow *)pShow->pIter; if (rows > pStreamShow->numOfStreams - pStreamShow->index) rows = pStreamShow->numOfStreams - pStreamShow->index; @@ -592,7 +592,7 @@ int mgmtGetConns(SShowObj *pShow, void *pConn) { // // // sorting based on useconds // - // pShow->pNode = pConnShow; + // pShow->pIter = pConnShow; return 0; } @@ -627,7 +627,7 @@ int32_t mgmtGetConnsMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pConn) { for (int i = 1; i < cols; ++i) pShow->offset[i] = pShow->offset[i - 1] + pShow->bytes[i - 1]; pShow->numOfRows = 1000000; - pShow->pNode = NULL; + pShow->pIter = NULL; pShow->rowSize = pShow->offset[cols - 1] + pShow->bytes[cols - 1]; mgmtGetConns(pShow, pConn); @@ -639,7 +639,7 @@ int32_t mgmtRetrieveConns(SShowObj *pShow, char *data, int32_t rows, void *pConn char *pWrite; int32_t cols = 0; - SConnShow *pConnShow = (SConnShow *)pShow->pNode; + SConnShow *pConnShow = (SConnShow *)pShow->pIter; if (rows > pConnShow->numOfConns - pConnShow->index) rows = pConnShow->numOfConns - pConnShow->index; diff --git a/src/mnode/src/mgmtSdb.c b/src/mnode/src/mgmtSdb.c index 3116ad39f3..3a9ef390f9 100644 --- a/src/mnode/src/mgmtSdb.c +++ b/src/mnode/src/mgmtSdb.c @@ -239,10 +239,10 @@ void sdbUpdateSync() { } if (index == 0) { - void *pNode = NULL; + void *pIter = NULL; while (1) { SMnodeObj *pMnode = NULL; - pNode = mgmtGetNextMnode(pNode, &pMnode); + pIter = mgmtGetNextMnode(pIter, &pMnode); if (pMnode == NULL) break; syncCfg.nodeInfo[index].nodeId = pMnode->mnodeId; @@ -252,6 +252,7 @@ void sdbUpdateSync() { mgmtDecMnodeRef(pMnode); } + sdbFreeIter(pIter); } syncCfg.replica = index; @@ -666,7 +667,10 @@ void *sdbFetchRow(void *handle, void *pNode, void **ppRow) { } SSdbRow *pMeta = taosHashIterGet(pIter); - if (pMeta == NULL) return NULL; + if (pMeta == NULL) { + taosHashDestroyIter(pIter); + return NULL; + } *ppRow = pMeta->row; sdbIncRef(handle, pMeta->row); @@ -674,6 +678,12 @@ void *sdbFetchRow(void *handle, void *pNode, void **ppRow) { return pIter; } +void sdbFreeIter(void *pIter) { + if (pIter != NULL) { + taosHashDestroyIter(pIter); + } +} + void *sdbOpenTable(SSdbTableDesc *pDesc) { SSdbTable *pTable = (SSdbTable *)calloc(1, sizeof(SSdbTable)); diff --git a/src/mnode/src/mgmtShell.c b/src/mnode/src/mgmtShell.c index c27dc66dd5..2e3ef7384a 100644 --- a/src/mnode/src/mgmtShell.c +++ b/src/mnode/src/mgmtShell.c @@ -48,6 +48,7 @@ static void mgmtProcessRetrieveMsg(SQueuedMsg *queuedMsg); static void mgmtProcessHeartBeatMsg(SQueuedMsg *queuedMsg); static void mgmtProcessConnectMsg(SQueuedMsg *queuedMsg); static void mgmtProcessUseMsg(SQueuedMsg *queuedMsg); +static void mgmtFreeShowObj(void *data); void *tsMgmtTmr; static void *tsMgmtTranQhandle = NULL; @@ -65,7 +66,7 @@ int32_t mgmtInitShell() { tsMgmtTmr = taosTmrInit((tsMaxShellConns) * 3, 200, 3600000, "MND"); tsMgmtTranQhandle = taosInitScheduler(tsMaxShellConns, 1, "mnodeT"); - tsQhandleCache = taosCacheInit(tsMgmtTmr, 10); + tsQhandleCache = taosCacheInitWithCb(tsMgmtTmr, 10, mgmtFreeShowObj); return 0; } @@ -479,7 +480,7 @@ bool mgmtCheckQhandle(uint64_t qhandle) { mTrace("qhandle:%p is retrived", qhandle); return true; } else { - mTrace("qhandle:%p is already freed", qhandle); + mTrace("qhandle:%p is already released", qhandle); return false; } } @@ -498,8 +499,14 @@ void* mgmtSaveQhandle(void *qhandle, int32_t size) { return NULL; } +static void mgmtFreeShowObj(void *data) { + SShowObj *pShow = data; + //sdbFreeIter(pShow->pIter); + mTrace("qhandle:%p is destroyed", pShow); +} + void mgmtFreeQhandle(void *qhandle, bool forceRemove) { - mTrace("qhandle:%p is freed", qhandle); + mTrace("qhandle:%p is released", qhandle); taosCacheRelease(tsQhandleCache, &qhandle, forceRemove); } diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index affd7a1073..ae2c4c1f6c 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -247,25 +247,19 @@ static int32_t mgmtChildTableActionDecode(SSdbOper *pOper) { } static int32_t mgmtChildTableActionRestored() { - void *pNode = NULL; - void *pLastNode = NULL; + void *pIter = NULL; SChildTableObj *pTable = NULL; while (1) { - pLastNode = pNode; mgmtDecTableRef(pTable); - pNode = mgmtGetNextChildTable(pNode, &pTable); + pIter = mgmtGetNextChildTable(pIter, &pTable); if (pTable == NULL) break; SDbObj *pDb = mgmtGetDbByTableId(pTable->info.tableId); if (pDb == NULL) { mError("ctable:%s, failed to get db, discard it", pTable->info.tableId); - SSdbOper desc = {0}; - desc.type = SDB_OPER_LOCAL; - desc.pObj = pTable; - desc.table = tsChildTableSdb; + SSdbOper desc = {.type = SDB_OPER_LOCAL, .pObj = pTable, .table = tsChildTableSdb}; sdbDeleteRow(&desc); - pNode = pLastNode; continue; } mgmtDecDbRef(pDb); @@ -274,12 +268,8 @@ static int32_t mgmtChildTableActionRestored() { if (pVgroup == NULL) { mError("ctable:%s, failed to get vgId:%d sid:%d, discard it", pTable->info.tableId, pTable->vgId, pTable->sid); pTable->vgId = 0; - SSdbOper desc = {0}; - desc.type = SDB_OPER_LOCAL; - desc.pObj = pTable; - desc.table = tsChildTableSdb; + SSdbOper desc = {.type = SDB_OPER_LOCAL, .pObj = pTable, .table = tsChildTableSdb}; sdbDeleteRow(&desc); - pNode = pLastNode; continue; } mgmtDecVgroupRef(pVgroup); @@ -288,24 +278,16 @@ static int32_t mgmtChildTableActionRestored() { mError("ctable:%s, db:%s not match with vgId:%d db:%s sid:%d, discard it", pTable->info.tableId, pDb->name, pTable->vgId, pVgroup->dbName, pTable->sid); pTable->vgId = 0; - SSdbOper desc = {0}; - desc.type = SDB_OPER_LOCAL; - desc.pObj = pTable; - desc.table = tsChildTableSdb; + SSdbOper desc = {.type = SDB_OPER_LOCAL, .pObj = pTable, .table = tsChildTableSdb}; sdbDeleteRow(&desc); - pNode = pLastNode; continue; } if (pVgroup->tableList == NULL) { mError("ctable:%s, vgId:%d tableList is null", pTable->info.tableId, pTable->vgId); pTable->vgId = 0; - SSdbOper desc = {0}; - desc.type = SDB_OPER_LOCAL; - desc.pObj = pTable; - desc.table = tsChildTableSdb; + SSdbOper desc = {.type = SDB_OPER_LOCAL, .pObj = pTable, .table = tsChildTableSdb}; sdbDeleteRow(&desc); - pNode = pLastNode; continue; } @@ -314,18 +296,16 @@ static int32_t mgmtChildTableActionRestored() { if (pSuperTable == NULL) { mError("ctable:%s, stable:%" PRIu64 " not exist", pTable->info.tableId, pTable->suid); pTable->vgId = 0; - SSdbOper desc = {0}; - desc.type = SDB_OPER_LOCAL; - desc.pObj = pTable; - desc.table = tsChildTableSdb; + SSdbOper desc = {.type = SDB_OPER_LOCAL, .pObj = pTable, .table = tsChildTableSdb}; sdbDeleteRow(&desc); - pNode = pLastNode; continue; } mgmtDecTableRef(pSuperTable); } } + sdbFreeIter(pIter); + return 0; } @@ -560,10 +540,10 @@ static void *mgmtGetSuperTable(char *tableId) { static void *mgmtGetSuperTableByUid(uint64_t uid) { SSuperTableObj *pStable = NULL; - void * pNode = NULL; + void *pIter = NULL; while (1) { - pNode = mgmtGetNextSuperTable(pNode, &pStable); + pIter = mgmtGetNextSuperTable(pIter, &pStable); if (pStable == NULL) break; if (pStable->uid == uid) { return pStable; @@ -571,6 +551,8 @@ static void *mgmtGetSuperTableByUid(uint64_t uid) { mgmtDecTableRef(pStable); } + sdbFreeIter(pIter); + return NULL; } @@ -588,12 +570,12 @@ void *mgmtGetTable(char *tableId) { return NULL; } -void *mgmtGetNextChildTable(void *pNode, SChildTableObj **pTable) { - return sdbFetchRow(tsChildTableSdb, pNode, (void **)pTable); +void *mgmtGetNextChildTable(void *pIter, SChildTableObj **pTable) { + return sdbFetchRow(tsChildTableSdb, pIter, (void **)pTable); } -void *mgmtGetNextSuperTable(void *pNode, SSuperTableObj **pTable) { - return sdbFetchRow(tsSuperTableSdb, pNode, (void **)pTable); +void *mgmtGetNextSuperTable(void *pIter, SSuperTableObj **pTable) { + return sdbFetchRow(tsSuperTableSdb, pIter, (void **)pTable); } void mgmtIncTableRef(void *p1) { @@ -1122,7 +1104,7 @@ int32_t mgmtRetrieveShowSuperTables(SShowObj *pShow, char *data, int32_t rows, v while (numOfRows < rows) { mgmtDecTableRef(pTable); - pShow->pNode = mgmtGetNextSuperTable(pShow->pNode, &pTable); + pShow->pIter = mgmtGetNextSuperTable(pShow->pIter, &pTable); if (pTable == NULL) break; if (strncmp(pTable->info.tableId, prefix, prefixLen)) { continue; @@ -1172,8 +1154,7 @@ int32_t mgmtRetrieveShowSuperTables(SShowObj *pShow, char *data, int32_t rows, v } void mgmtDropAllSuperTables(SDbObj *pDropDb) { - void *pNode = NULL; - void *pLastNode = NULL; + void * pIter= NULL; int32_t numOfTables = 0; int32_t dbNameLen = strlen(pDropDb->name); SSuperTableObj *pTable = NULL; @@ -1181,8 +1162,7 @@ void mgmtDropAllSuperTables(SDbObj *pDropDb) { mPrint("db:%s, all super tables will be dropped from sdb", pDropDb->name); while (1) { - pLastNode = pNode; - pNode = mgmtGetNextSuperTable(pNode, &pTable); + pIter = mgmtGetNextSuperTable(pIter, &pTable); if (pTable == NULL) break; if (strncmp(pDropDb->name, pTable->info.tableId, dbNameLen) == 0) { @@ -1192,13 +1172,14 @@ void mgmtDropAllSuperTables(SDbObj *pDropDb) { .pObj = pTable, }; sdbDeleteRow(&oper); - pNode = pLastNode; numOfTables ++; } mgmtDecTableRef(pTable); } + sdbFreeIter(pIter); + mPrint("db:%s, all super tables:%d is dropped from sdb", pDropDb->name, numOfTables); } @@ -1753,8 +1734,7 @@ static void mgmtGetChildTableMeta(SQueuedMsg *pMsg) { } void mgmtDropAllChildTables(SDbObj *pDropDb) { - void *pNode = NULL; - void *pLastNode = NULL; + void * pIter = NULL; int32_t numOfTables = 0; int32_t dbNameLen = strlen(pDropDb->name); SChildTableObj *pTable = NULL; @@ -1762,8 +1742,7 @@ void mgmtDropAllChildTables(SDbObj *pDropDb) { mPrint("db:%s, all child tables will be dropped from sdb", pDropDb->name); while (1) { - pLastNode = pNode; - pNode = mgmtGetNextChildTable(pNode, &pTable); + pIter = mgmtGetNextChildTable(pIter, &pTable); if (pTable == NULL) break; if (strncmp(pDropDb->name, pTable->info.tableId, dbNameLen) == 0) { @@ -1773,26 +1752,25 @@ void mgmtDropAllChildTables(SDbObj *pDropDb) { .pObj = pTable, }; sdbDeleteRow(&oper); - pNode = pLastNode; numOfTables++; } mgmtDecTableRef(pTable); } + sdbFreeIter(pIter); + mPrint("db:%s, all child tables:%d is dropped from sdb", pDropDb->name, numOfTables); } static void mgmtDropAllChildTablesInStable(SSuperTableObj *pStable) { - void *pNode = NULL; - void *pLastNode = NULL; + void * pIter = NULL; int32_t numOfTables = 0; SChildTableObj *pTable = NULL; mPrint("stable:%s, all child tables will dropped from sdb", pStable->info.tableId, numOfTables); while (1) { - pLastNode = pNode; - pNode = mgmtGetNextChildTable(pNode, &pTable); + pIter = mgmtGetNextChildTable(pIter, &pTable); if (pTable == NULL) break; if (pTable->superTable == pStable) { @@ -1802,13 +1780,14 @@ static void mgmtDropAllChildTablesInStable(SSuperTableObj *pStable) { .pObj = pTable, }; sdbDeleteRow(&oper); - pNode = pLastNode; numOfTables++; } mgmtDecTableRef(pTable); } + sdbFreeIter(pIter); + mPrint("stable:%s, all child tables:%d is dropped from sdb", pStable->info.tableId, numOfTables); } @@ -2079,7 +2058,7 @@ static int32_t mgmtRetrieveShowTables(SShowObj *pShow, char *data, int32_t rows, while (numOfRows < rows) { mgmtDecTableRef(pTable); - pShow->pNode = mgmtGetNextChildTable(pShow->pNode, &pTable); + pShow->pIter = mgmtGetNextChildTable(pShow->pIter, &pTable); if (pTable == NULL) break; // not belong to current db diff --git a/src/mnode/src/mgmtUser.c b/src/mnode/src/mgmtUser.c index 350367e0ae..cc22ed2169 100644 --- a/src/mnode/src/mgmtUser.c +++ b/src/mnode/src/mgmtUser.c @@ -155,8 +155,8 @@ SUserObj *mgmtGetUser(char *name) { return (SUserObj *)sdbGetRow(tsUserSdb, name); } -void *mgmtGetNextUser(void *pNode, SUserObj **pUser) { - return sdbFetchRow(tsUserSdb, pNode, (void **)pUser); +void *mgmtGetNextUser(void *pIter, SUserObj **pUser) { + return sdbFetchRow(tsUserSdb, pIter, (void **)pUser); } void mgmtIncUserRef(SUserObj *pUser) { @@ -300,7 +300,7 @@ static int32_t mgmtRetrieveUsers(SShowObj *pShow, char *data, int32_t rows, void char *pWrite; while (numOfRows < rows) { - pShow->pNode = mgmtGetNextUser(pShow->pNode, &pUser); + pShow->pIter = mgmtGetNextUser(pShow->pIter, &pUser); if (pUser == NULL) break; cols = 0; @@ -504,15 +504,13 @@ static void mgmtProcessDropUserMsg(SQueuedMsg *pMsg) { } void mgmtDropAllUsers(SAcctObj *pAcct) { - void * pNode = NULL; - void * pLastNode = NULL; + void * pIter = NULL; int32_t numOfUsers = 0; int32_t acctNameLen = strlen(pAcct->user); SUserObj *pUser = NULL; while (1) { - pLastNode = pNode; - pNode = mgmtGetNextUser(pNode, &pUser); + pIter = mgmtGetNextUser(pIter, &pUser); if (pUser == NULL) break; if (strncmp(pUser->acct, pAcct->user, acctNameLen) == 0) { @@ -522,13 +520,14 @@ void mgmtDropAllUsers(SAcctObj *pAcct) { .pObj = pUser, }; sdbDeleteRow(&oper); - pNode = pLastNode; numOfUsers++; } mgmtDecUserRef(pUser); } + sdbFreeIter(pIter); + mTrace("acct:%s, all users:%d is dropped from sdb", pAcct->user, numOfUsers); } diff --git a/src/mnode/src/mgmtVgroup.c b/src/mnode/src/mgmtVgroup.c index b87c6ad727..f8447a31fd 100644 --- a/src/mnode/src/mgmtVgroup.c +++ b/src/mnode/src/mgmtVgroup.c @@ -288,8 +288,8 @@ SVgObj *mgmtGetAvailableVgroup(SDbObj *pDb) { return pDb->pHead; } -void *mgmtGetNextVgroup(void *pNode, SVgObj **pVgroup) { - return sdbFetchRow(tsVgroupSdb, pNode, (void **)pVgroup); +void *mgmtGetNextVgroup(void *pIter, SVgObj **pVgroup) { + return sdbFetchRow(tsVgroupSdb, pIter, (void **)pVgroup); } void mgmtCreateVgroup(SQueuedMsg *pMsg, SDbObj *pDb) { @@ -429,10 +429,10 @@ int32_t mgmtGetVgroupMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pConn) { if (NULL == pTable) { pShow->numOfRows = pDb->numOfVgroups; - pShow->pNode = pDb->pHead; + pShow->pIter = pDb->pHead; } else { pShow->numOfRows = 1; - pShow->pNode = pVgroup; + pShow->pIter = pVgroup; } mgmtDecDbRef(pDb); @@ -457,9 +457,9 @@ int32_t mgmtRetrieveVgroups(SShowObj *pShow, char *data, int32_t rows, void *pCo } while (numOfRows < rows) { - pVgroup = (SVgObj *) pShow->pNode; + pVgroup = (SVgObj *) pShow->pIter; if (pVgroup == NULL) break; - pShow->pNode = (void *) pVgroup->next; + pShow->pIter = (void *) pVgroup->next; cols = 0; @@ -749,14 +749,12 @@ static void mgmtProcessVnodeCfgMsg(SRpcMsg *rpcMsg) { } void mgmtDropAllDnodeVgroups(SDnodeObj *pDropDnode) { - void * pNode = NULL; - void * pLastNode = NULL; + void * pIter = NULL; SVgObj *pVgroup = NULL; int32_t numOfVgroups = 0; while (1) { - pLastNode = pNode; - pNode = mgmtGetNextVgroup(pNode, &pVgroup); + pIter = mgmtGetNextVgroup(pIter, &pVgroup); if (pVgroup == NULL) break; if (pVgroup->vnodeGid[0].dnodeId == pDropDnode->dnodeId) { @@ -766,24 +764,23 @@ void mgmtDropAllDnodeVgroups(SDnodeObj *pDropDnode) { .pObj = pVgroup, }; sdbDeleteRow(&oper); - pNode = pLastNode; numOfVgroups++; continue; } mgmtDecVgroupRef(pVgroup); } + + sdbFreeIter(pIter); } void mgmtDropAllDbVgroups(SDbObj *pDropDb, bool sendMsg) { - void *pNode = NULL; - void *pLastNode = NULL; + void * pIter = NULL; int32_t numOfVgroups = 0; SVgObj *pVgroup = NULL; mPrint("db:%s, all vgroups will be dropped from sdb", pDropDb->name); while (1) { - pLastNode = pNode; - pNode = mgmtGetNextVgroup(pNode, &pVgroup); + pIter = mgmtGetNextVgroup(pIter, &pVgroup); if (pVgroup == NULL) break; if (pVgroup->pDb == pDropDb) { @@ -793,7 +790,6 @@ void mgmtDropAllDbVgroups(SDbObj *pDropDb, bool sendMsg) { .pObj = pVgroup, }; sdbDeleteRow(&oper); - pNode = pLastNode; numOfVgroups++; if (sendMsg) { @@ -804,5 +800,7 @@ void mgmtDropAllDbVgroups(SDbObj *pDropDb, bool sendMsg) { mgmtDecVgroupRef(pVgroup); } + sdbFreeIter(pIter); + mPrint("db:%s, all vgroups:%d is dropped from sdb", pDropDb->name, numOfVgroups); } diff --git a/src/util/inc/tcache.h b/src/util/inc/tcache.h index 2e26f8f0e3..6dd707b763 100644 --- a/src/util/inc/tcache.h +++ b/src/util/inc/tcache.h @@ -67,6 +67,7 @@ typedef struct { void * pTimer; SCacheStatis statistics; SHashObj * pHashTable; + _hash_free_fn_t freeFp; int numOfElemsInTrash; // number of element in trash int16_t deleting; // set the deleting flag to stop refreshing ASAP. T_REF_DECLARE() @@ -88,6 +89,7 @@ typedef struct { * @return */ SCacheObj *taosCacheInit(void *tmrCtrl, int64_t refreshTimeInSeconds); +SCacheObj *taosCacheInitWithCb(void *tmrCtrl, int64_t refreshTimeInSeconds, void (*freeCb)(void *data)); /** * add data into cache diff --git a/src/util/src/tcache.c b/src/util/src/tcache.c index 02a5b93141..7d8cb1faa4 100644 --- a/src/util/src/tcache.c +++ b/src/util/src/tcache.c @@ -149,6 +149,7 @@ static void taosRemoveFromTrash(SCacheObj *pCacheObj, STrashElem *pElem) { } pElem->pData->signature = 0; + if (pCacheObj->freeFp) pCacheObj->freeFp(pElem->pData->data); free(pElem->pData); free(pElem); } @@ -210,7 +211,8 @@ static FORCE_INLINE void taosCacheReleaseNode(SCacheObj *pCacheObj, SCacheDataNo int32_t size = pNode->size; taosHashRemove(pCacheObj->pHashTable, pNode->key, pNode->keySize); - uTrace("key:%s is removed from cache,total:%d,size:%ldbytes", pNode->key, pCacheObj->totalSize, size); + uTrace("key:%s is removed from cache,total:%d,size:%ldbytes", pNode->key, pCacheObj->totalSize, size); + if (pCacheObj->freeFp) pCacheObj->freeFp(pNode->data); free(pNode); } @@ -380,7 +382,7 @@ static void taosCacheRefresh(void *handle, void *tmrId) { } } -SCacheObj *taosCacheInit(void *tmrCtrl, int64_t refreshTime) { +SCacheObj *taosCacheInitWithCb(void *tmrCtrl, int64_t refreshTime, void (*freeCb)(void *data)) { if (tmrCtrl == NULL || refreshTime <= 0) { return NULL; } @@ -399,8 +401,9 @@ SCacheObj *taosCacheInit(void *tmrCtrl, int64_t refreshTime) { } // set free cache node callback function for hash table - taosHashSetFreecb(pCacheObj->pHashTable, taosFreeNode); + // taosHashSetFreecb(pCacheObj->pHashTable, taosFreeNode); + pCacheObj->freeFp = freeCb; pCacheObj->refreshTime = refreshTime * 1000; pCacheObj->tmrCtrl = tmrCtrl; @@ -419,6 +422,10 @@ SCacheObj *taosCacheInit(void *tmrCtrl, int64_t refreshTime) { return pCacheObj; } +SCacheObj *taosCacheInit(void *tmrCtrl, int64_t refreshTime) { + return taosCacheInitWithCb(tmrCtrl, refreshTime, NULL); +} + void *taosCachePut(SCacheObj *pCacheObj, const char *key, const void *pData, size_t dataSize, int duration) { SCacheDataNode *pNode; From 5b459cf8fee2366121082964c0462783386351cf Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 14:54:55 +0800 Subject: [PATCH 021/126] scripts --- tests/script/general/parser/auto_create_tb.sim | 9 +++++---- tests/script/unique/mnode/mgmt22.sim | 15 ++------------- 2 files changed, 7 insertions(+), 17 deletions(-) diff --git a/tests/script/general/parser/auto_create_tb.sim b/tests/script/general/parser/auto_create_tb.sim index a29d917244..ad65ea723f 100644 --- a/tests/script/general/parser/auto_create_tb.sim +++ b/tests/script/general/parser/auto_create_tb.sim @@ -149,16 +149,17 @@ sql drop table tb1 #### auto create multiple tables sql insert into tb1 using $stb tags(1) values ( $ts0 , 1, 1, 1, 1, 'bin1', 1, 1, 1, '涛思数据1') tb2 using $stb tags(2) values ( $ts0 , 2, 2, 2, 2, 'bin2', 2, 2, 2, '涛思数据2') tb3 using $stb tags(3) values ( $ts0 , 3, 3, 3, 3, 'bin3', 3, 3, 3, '涛思数据3') sql show tables +print $rows $data00 $data10 $data20 if $rows != 3 then return -1 endi -if $data00 != tb1 then +if $data00 != tb3 then return -1 endi if $data10 != tb2 then return -1 endi -if $data20 != tb3 then +if $data20 != tb1 then return -1 endi @@ -220,13 +221,13 @@ sql show tables if $rows != 3 then return -1 endi -if $data00 != tb1 then +if $data00 != tb3 then return -1 endi if $data10 != tb2 then return -1 endi -if $data20 != tb3 then +if $data20 != tb1 then return -1 endi diff --git a/tests/script/unique/mnode/mgmt22.sim b/tests/script/unique/mnode/mgmt22.sim index e4e1235e66..37e38fbf66 100644 --- a/tests/script/unique/mnode/mgmt22.sim +++ b/tests/script/unique/mnode/mgmt22.sim @@ -8,7 +8,7 @@ system sh/cfg.sh -n dnode2 -c numOfMPeers -v 2 system sh/cfg.sh -n dnode3 -c numOfMPeers -v 2 print ============== step1 -system sh/exec_up.sh -n dnode1 -s start -t +system sh/exec_up.sh -n dnode1 -s start sleep 3000 sql connect @@ -20,7 +20,7 @@ if $data2_1 != master then endi print ============== step2 -system sh/exec_up.sh -n dnode2 -s start -t +system sh/exec_up.sh -n dnode2 -s start sql create dnode $hostname2 $x = 0 @@ -41,17 +41,6 @@ if $data2_2 != slave then goto show2 endi -system sh/exec_up.sh -n dnode1 -s stop -x SIGINT -system sh/exec_up.sh -n dnode2 -s stop -x SIGINT -system sh/exec_up.sh -n dnode3 -s stop -x SIGINT -system sh/exec_up.sh -n dnode4 -s stop -x SIGINT -system sh/exec_up.sh -n dnode5 -s stop -x SIGINT -system sh/exec_up.sh -n dnode6 -s stop -x SIGINT -system sh/exec_up.sh -n dnode7 -s stop -x SIGINT -system sh/exec_up.sh -n dnode8 -s stop -x SIGINT - -return - print ============== step3 sql_error drop dnode $hostname1 -x error1 print should not drop master From f3b80c84e5c58e9a65c0cb0d5749990202087a45 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 15:22:49 +0800 Subject: [PATCH 022/126] [TD-149] add callback func to cache --- src/mnode/src/mgmtShell.c | 12 ++++++------ src/util/src/tcache.c | 2 +- 2 files changed, 7 insertions(+), 7 deletions(-) diff --git a/src/mnode/src/mgmtShell.c b/src/mnode/src/mgmtShell.c index 2e3ef7384a..804572b9ff 100644 --- a/src/mnode/src/mgmtShell.c +++ b/src/mnode/src/mgmtShell.c @@ -477,10 +477,10 @@ void mgmtSendSimpleResp(void *thandle, int32_t code) { bool mgmtCheckQhandle(uint64_t qhandle) { void *pSaved = taosCacheAcquireByData(tsQhandleCache, (void *)qhandle); if (pSaved == (void *)qhandle) { - mTrace("qhandle:%p is retrived", qhandle); + mTrace("show:%p, is retrieved", qhandle); return true; } else { - mTrace("qhandle:%p is already released", qhandle); + mTrace("show:%p, is already released", qhandle); return false; } } @@ -492,7 +492,7 @@ void* mgmtSaveQhandle(void *qhandle, int32_t size) { void *newQhandle = taosCachePut(tsQhandleCache, key, qhandle, size, 60); free(qhandle); - mTrace("qhandle:%p is saved", newQhandle); + mTrace("show:%p, is saved", newQhandle); return newQhandle; } @@ -501,12 +501,12 @@ void* mgmtSaveQhandle(void *qhandle, int32_t size) { static void mgmtFreeShowObj(void *data) { SShowObj *pShow = data; - //sdbFreeIter(pShow->pIter); - mTrace("qhandle:%p is destroyed", pShow); + sdbFreeIter(pShow->pIter); + mTrace("show:%p, is destroyed", pShow); } void mgmtFreeQhandle(void *qhandle, bool forceRemove) { - mTrace("qhandle:%p is released", qhandle); + mTrace("show:%p, is released, force:%s", qhandle, forceRemove ? "true" : "false"); taosCacheRelease(tsQhandleCache, &qhandle, forceRemove); } diff --git a/src/util/src/tcache.c b/src/util/src/tcache.c index 7d8cb1faa4..0c4978dc5c 100644 --- a/src/util/src/tcache.c +++ b/src/util/src/tcache.c @@ -401,7 +401,7 @@ SCacheObj *taosCacheInitWithCb(void *tmrCtrl, int64_t refreshTime, void (*freeCb } // set free cache node callback function for hash table - // taosHashSetFreecb(pCacheObj->pHashTable, taosFreeNode); + taosHashSetFreecb(pCacheObj->pHashTable, taosFreeNode); pCacheObj->freeFp = freeCb; pCacheObj->refreshTime = refreshTime * 1000; From 543415b8d5cb1e1ec22bbbc3916a22baef212d40 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Wed, 13 May 2020 16:27:23 +0800 Subject: [PATCH 023/126] support GCC 4.8 [TD-307] --- .travis.yml | 23 +++++++++++++++++++++++ src/client/src/tscPrepare.c | 2 +- src/client/src/tscSQLParser.c | 4 ++-- src/client/src/tscSubquery.c | 2 +- src/dnode/src/dnodeMain.c | 2 +- src/dnode/src/dnodeModule.c | 2 +- src/os/linux/inc/os.h | 11 +++++++++++ src/os/linux/src/linuxPlatform.c | 2 +- src/tsdb/src/tsdbMain.c | 4 ++-- src/util/src/exception.c | 5 +++-- src/util/src/tconfig.c | 2 +- src/util/src/tdes.c | 2 +- src/util/src/terror.c | 3 ++- 13 files changed, 50 insertions(+), 14 deletions(-) diff --git a/.travis.yml b/.travis.yml index 979b7588e5..41937853d6 100644 --- a/.travis.yml +++ b/.travis.yml @@ -203,6 +203,29 @@ matrix: ;; esac + - os: linux + dist: trusty + language: c + git: + - depth: 1 + + addons: + apt: + packages: + - build-essential + - cmake + env: + - DESC="trusty/gcc-4.8 build" + + before_script: + - cd ${TRAVIS_BUILD_DIR} + - mkdir debug + - cd debug + + script: + - cmake .. > /dev/null + - make > /dev/null + - os: linux language: c compiler: clang diff --git a/src/client/src/tscPrepare.c b/src/client/src/tscPrepare.c index 260649050b..2caa4ad436 100644 --- a/src/client/src/tscPrepare.c +++ b/src/client/src/tscPrepare.c @@ -194,7 +194,7 @@ static int normalStmtPrepare(STscStmt* stmt) { static char* normalStmtBuildSql(STscStmt* stmt) { SNormalStmt* normal = &stmt->normal; - SStringBuilder sb = {0}; + SStringBuilder sb; memset(&sb, 0, sizeof(sb)); if (taosStringBuilderSetJmp(&sb) != 0) { taosStringBuilderDestroy(&sb); diff --git a/src/client/src/tscSQLParser.c b/src/client/src/tscSQLParser.c index ebb081bb3a..551b0a0457 100644 --- a/src/client/src/tscSQLParser.c +++ b/src/client/src/tscSQLParser.c @@ -3558,7 +3558,7 @@ static int32_t setTableCondForSTableQuery(SQueryInfo* pQueryInfo, const char* ac return TSDB_CODE_SUCCESS; } - SStringBuilder sb1 = {0}; + SStringBuilder sb1; memset(&sb1, 0, sizeof(sb1)); taosStringBuilderAppendStringLen(&sb1, QUERY_COND_REL_PREFIX_IN, QUERY_COND_REL_PREFIX_IN_LEN); char db[TSDB_TABLE_ID_LEN] = {0}; @@ -3813,7 +3813,7 @@ int32_t parseWhereClause(SQueryInfo* pQueryInfo, tSQLExpr** pExpr, SSqlObj* pSql pQueryInfo->window.ekey = INT64_MAX; // tags query condition may be larger than 512bytes, therefore, we need to prepare enough large space - SStringBuilder sb = {0}; + SStringBuilder sb; memset(&sb, 0, sizeof(sb)); SCondExpr condExpr = {0}; if ((*pExpr)->pLeft == NULL || (*pExpr)->pRight == NULL) { diff --git a/src/client/src/tscSubquery.c b/src/client/src/tscSubquery.c index 02af71ee66..dea76968f6 100644 --- a/src/client/src/tscSubquery.c +++ b/src/client/src/tscSubquery.c @@ -488,7 +488,7 @@ void tscBuildVgroupTableInfo(STableMetaInfo* pTableMetaInfo, SArray* tables) { if( prev == NULL || tt->vgId != prev->vgId ) { SVgroupsInfo* pvg = pTableMetaInfo->vgroupList; - SVgroupTableInfo info = { 0 }; + SVgroupTableInfo info = {{ 0 }}; for( int32_t m = 0; m < pvg->numOfVgroups; ++m ) { if( tt->vgId == pvg->vgroups[m].vgId ) { info.vgInfo = pvg->vgroups[m]; diff --git a/src/dnode/src/dnodeMain.c b/src/dnode/src/dnodeMain.c index dc5f7d192f..7949a62966 100644 --- a/src/dnode/src/dnodeMain.c +++ b/src/dnode/src/dnodeMain.c @@ -84,7 +84,7 @@ int32_t main(int32_t argc, char *argv[]) { } /* Set termination handler. */ - struct sigaction act = {0}; + struct sigaction act = {{0}}; act.sa_flags = SA_SIGINFO; act.sa_sigaction = signal_handler; sigaction(SIGTERM, &act, NULL); diff --git a/src/dnode/src/dnodeModule.c b/src/dnode/src/dnodeModule.c index 2e081de2a8..86193fcebc 100644 --- a/src/dnode/src/dnodeModule.c +++ b/src/dnode/src/dnodeModule.c @@ -33,7 +33,7 @@ typedef struct { void (*stopFp)(); } SModule; -static SModule tsModule[TSDB_MOD_MAX] = {0}; +static SModule tsModule[TSDB_MOD_MAX] = {{0}}; static uint32_t tsModuleStatus = 0; static void dnodeSetModuleStatus(int32_t module) { diff --git a/src/os/linux/inc/os.h b/src/os/linux/inc/os.h index cab899753d..40fcf83431 100644 --- a/src/os/linux/inc/os.h +++ b/src/os/linux/inc/os.h @@ -253,6 +253,17 @@ void taosBlockSIGPIPE(); #define BUILDIN_CLZ(val) __builtin_clz(val) #define BUILDIN_CTZ(val) __builtin_ctz(val) +#undef threadlocal +#ifdef _ISOC11_SOURCE + #define threadlocal _Thread_local +#elif defined(__APPLE__) + #define threadlocal +#elif defined(__GNUC__) && !defined(threadlocal) + #define threadlocal __thread +#else + #define threadlocal +#endif + #ifdef __cplusplus } #endif diff --git a/src/os/linux/src/linuxPlatform.c b/src/os/linux/src/linuxPlatform.c index 72da97287f..73cccd020a 100644 --- a/src/os/linux/src/linuxPlatform.c +++ b/src/os/linux/src/linuxPlatform.c @@ -157,7 +157,7 @@ void *taosProcessAlarmSignal(void *tharg) { void (*callback)(int) = tharg; static timer_t timerId; - struct sigevent sevent = {0}; + struct sigevent sevent = {{0}}; #ifdef _ALPINE sevent.sigev_notify = SIGEV_THREAD; diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index f06230c16f..fb25e9dcd9 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -161,7 +161,7 @@ static int tsdbRestoreInfo(STsdbRepo *pRepo) { SFileGroup *pFGroup = NULL; SFileGroupIter iter; - SRWHelper rhelper = {0}; + SRWHelper rhelper = {{0}}; if (tsdbInitReadHelper(&rhelper, pRepo) < 0) goto _err; tsdbInitFileGroupIter(pFileH, &iter, TSDB_ORDER_ASC); @@ -948,7 +948,7 @@ static void *tsdbCommitData(void *arg) { STsdbCache *pCache = pRepo->tsdbCache; STsdbCfg * pCfg = &(pRepo->config); SDataCols * pDataCols = NULL; - SRWHelper whelper = {0}; + SRWHelper whelper = {{0}}; if (pCache->imem == NULL) return NULL; tsdbPrint("vgId: %d, starting to commit....", pRepo->config.tsdbId); diff --git a/src/util/src/exception.c b/src/util/src/exception.c index 3d2949c093..e1f6516fe7 100644 --- a/src/util/src/exception.c +++ b/src/util/src/exception.c @@ -1,7 +1,8 @@ +#include "os.h" #include "exception.h" -static _Thread_local SExceptionNode* expList; +static threadlocal SExceptionNode* expList; void exceptionPushNode( SExceptionNode* node ) { node->prev = expList; @@ -145,4 +146,4 @@ void cleanupExecuteTo( int32_t anchor, bool failed ) { void cleanupExecute( SExceptionNode* node, bool failed ) { doExecuteCleanup( node, 0, failed ); -} \ No newline at end of file +} diff --git a/src/util/src/tconfig.c b/src/util/src/tconfig.c index 61ae647bf4..32a3df844c 100644 --- a/src/util/src/tconfig.c +++ b/src/util/src/tconfig.c @@ -25,7 +25,7 @@ #include "tsystem.h" #include "tutil.h" -SGlobalCfg tsGlobalConfig[TSDB_CFG_MAX_NUM] = {0}; +SGlobalCfg tsGlobalConfig[TSDB_CFG_MAX_NUM] = {{0}}; int32_t tsGlobalConfigNum = 0; static char *tsGlobalUnit[] = { diff --git a/src/util/src/tdes.c b/src/util/src/tdes.c index 6f72dec574..00474e4ae2 100644 --- a/src/util/src/tdes.c +++ b/src/util/src/tdes.c @@ -32,7 +32,7 @@ char* taosDesImp(unsigned char* key, char* src, unsigned int len, int process_mo unsigned int number_of_blocks = len / 8; unsigned char data_block[9] = {0}; unsigned char processed_block[9] = {0}; - key_set key_sets[17] = {0}; + key_set key_sets[17]; memset(key_sets, 0, sizeof(key_sets)); char* dest = calloc(len + 1, 1); generate_sub_keys(key, key_sets); diff --git a/src/util/src/terror.c b/src/util/src/terror.c index 628f7a2d5c..c040a11362 100644 --- a/src/util/src/terror.c +++ b/src/util/src/terror.c @@ -27,10 +27,11 @@ typedef struct { } STaosError; +#include "os.h" #include "taoserror.h" -static _Thread_local int32_t tsErrno; +static threadlocal int32_t tsErrno; int32_t* taosGetErrno() { return &tsErrno; } From b320961643bb76016b2a831fde1d46d767d5a110 Mon Sep 17 00:00:00 2001 From: changshuaiqiang Date: Wed, 13 May 2020 17:03:38 +0800 Subject: [PATCH 024/126] test: add cases --- tests/pytest/insert/multi.py | 51 ++++++++++++++ tests/pytest/table/__init__.py | 0 tests/pytest/table/alter_column.py | 88 +++++++++++++++++++++++++ tests/pytest/table/del_stable.py | 14 +++- tests/script/general/user/authority.sim | 12 +--- 5 files changed, 154 insertions(+), 11 deletions(-) create mode 100644 tests/pytest/insert/multi.py create mode 100644 tests/pytest/table/__init__.py create mode 100644 tests/pytest/table/alter_column.py diff --git a/tests/pytest/insert/multi.py b/tests/pytest/insert/multi.py new file mode 100644 index 0000000000..7725ccd210 --- /dev/null +++ b/tests/pytest/insert/multi.py @@ -0,0 +1,51 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import tdLog +from util.cases import tdCases +from util.sql import tdSql + + +class TDTestCase: + + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + print("==============step1") + + tdLog.info("create table") + + tdSql.execute( + "create table if not exists st(ts timestamp, tagtype int) tags(dev nchar(50))") + tdSql.execute( + "CREATE TABLE if not exists dev_001 using st tags('dev_01')") + + print("==============step2") + tdLog.info("multiple inserts") + tdSql.execute( + "INSERT INTO dev_001 VALUES ('2020-05-13 10:00:00.000', 1),('2020-05-13 10:00:00.001', 1)") + tdSql.checkAffectedRows(2) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/table/__init__.py b/tests/pytest/table/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/tests/pytest/table/alter_column.py b/tests/pytest/table/alter_column.py new file mode 100644 index 0000000000..15bc9f7aa7 --- /dev/null +++ b/tests/pytest/table/alter_column.py @@ -0,0 +1,88 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, db_test.stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import tdLog +from util.cases import tdCases +from util.sql import tdSql + + +class TDTestCase: + + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + print("==============step1") + + tdLog.info("create database and table") + tdSql.execute("create database db_test") + tdSql.execute( + "create table if not exists db_test.st(ts timestamp, tagtype int) tags(dev nchar(50))") + tdSql.execute( + "CREATE TABLE if not exists db_test.dev_001 using db_test.st tags('dev_01')") + + print("==============step2") + tdLog.info("alter table add column") + tdSql.execute( + "ALTER TABLE db_test.st add COLUMN tag_version nchar(20)") + tdSql.query("describe db_test.st") + tdSql.checkRows(4) + + print("==============step3") + tdLog.info("alter table drop column") + tdSql.execute("ALTER TABLE db_test.st drop COLUMN tag_version") + tdSql.query("describe db_test.st") + tdSql.checkRows(3) + + print("==============step4") + tdLog.info("drop table") + tdSql.execute("drop table db_test.st") + tdSql.execute( + "create table if not exists db_test.st(ts timestamp, tagtype int) tags(dev nchar(50))") + tdSql.execute( + "CREATE TABLE if not exists db_test.dev_001 using db_test.st tags('dev_01')") + tdSql.execute( + "INSERT INTO db_test.dev_001 VALUES ('2020-05-13 10:00:00.000', 1)") + tdSql.query("select * from db_test.dev_001") + tdSql.checkRows(1) + + print("==============step5") + tdLog.info("alter table add column") + tdSql.execute( + "ALTER TABLE db_test.st add COLUMN tag_version nchar(20)") + tdSql.query("describe db_test.st") + tdSql.checkRows(4) + + tdSql.execute( + "INSERT INTO db_test.dev_001 VALUES ('2020-05-13 10:00:00.010', 1, '1.2.1')") + tdSql.query("select * from db_test.st") + tdSql.checkRows(2) + + print("==============step6") + tdLog.info("alter table drop column") + tdSql.execute("ALTER TABLE db_test.st drop COLUMN tag_version") + tdSql.query("describe db_test.st") + tdSql.checkRows(3) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/table/del_stable.py b/tests/pytest/table/del_stable.py index c81d598638..de30e6bdfe 100644 --- a/tests/pytest/table/del_stable.py +++ b/tests/pytest/table/del_stable.py @@ -38,8 +38,18 @@ class TDTestCase: tdSql.execute("drop table db.st") except Exception as e: tdLog.exit(e) - tdSql.execute("select * from db.st") - tdSql.checkRows(1) + + try: + tdSql.execute("select * from db.st") + except Exception as e: + if e.args[0] != 'invalid table name': + tdLog.exit(e) + + try: + tdSql.execute("select * from db.tb") + except Exception as e: + if e.args[0] != 'invalid table name': + tdLog.exit(e) def stop(self): tdSql.close() diff --git a/tests/script/general/user/authority.sim b/tests/script/general/user/authority.sim index 06f0467626..7ae8c6f1a4 100644 --- a/tests/script/general/user/authority.sim +++ b/tests/script/general/user/authority.sim @@ -30,7 +30,7 @@ sleep 2000 sql create database dwrite sql show databases -if $rows != 1 then +if $rows != 2 then return -1 endi @@ -48,25 +48,19 @@ print ============ step5 sql close sql connect read sleep 2000 - sql drop database dread -sql drop database dwrite -x step51 +sql drop database dwrite -step51: sql close sql connect sql show databases -if $rows != 1 then +if $rows != 0 then return -1 endi sql close sql connect sleep 2000 -sql drop database d1 -sql drop database d2 -sql drop database d3 -sql drop database d4 system sh/exec_up.sh -n dnode1 -s stop -x SIGINT \ No newline at end of file From a23b0b0cd8a9ff316acbb20b08c0741b605195ee Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 17:24:06 +0800 Subject: [PATCH 025/126] replace sdb func --- src/client/src/tscSub.c | 2 - src/dnode/src/dnodeMgmt.c | 2 +- src/inc/vnode.h | 1 + src/mnode/src/mgmtSdb.c | 2 - src/plugins/http/src/httpHandle.c | 1 - src/plugins/http/src/httpSession.c | 69 +++---- src/plugins/http/src/httpSystem.c | 1 - src/plugins/http/src/httpUtil.c | 1 - src/plugins/http/src/tgHandle.c | 1 - src/query/src/tvariant.c | 2 +- src/util/inc/hashint.h | 26 --- src/util/inc/hashstr.h | 26 --- src/util/inc/ihash.h | 47 ----- src/util/inc/shash.h | 51 ----- src/util/src/hashint.c | 201 ------------------- src/util/src/hashstr.c | 214 -------------------- src/util/src/ihash.c | 290 --------------------------- src/util/src/shash.c | 310 ----------------------------- src/vnode/src/vnodeMain.c | 55 ++--- 19 files changed, 69 insertions(+), 1233 deletions(-) delete mode 100644 src/util/inc/hashint.h delete mode 100644 src/util/inc/hashstr.h delete mode 100644 src/util/inc/ihash.h delete mode 100644 src/util/inc/shash.h delete mode 100644 src/util/src/hashint.c delete mode 100644 src/util/src/hashstr.c delete mode 100644 src/util/src/ihash.c delete mode 100644 src/util/src/shash.c diff --git a/src/client/src/tscSub.c b/src/client/src/tscSub.c index 856b678391..d003fa0a9d 100644 --- a/src/client/src/tscSub.c +++ b/src/client/src/tscSub.c @@ -14,8 +14,6 @@ */ #include "os.h" - -#include "shash.h" #include "taos.h" #include "trpc.h" #include "tsclient.h" diff --git a/src/dnode/src/dnodeMgmt.c b/src/dnode/src/dnodeMgmt.c index 36a7c98807..f34acdeae3 100644 --- a/src/dnode/src/dnodeMgmt.c +++ b/src/dnode/src/dnodeMgmt.c @@ -16,7 +16,6 @@ #define _DEFAULT_SOURCE #include "os.h" #include "cJSON.h" -#include "ihash.h" #include "taoserror.h" #include "taosmsg.h" #include "ttime.h" @@ -174,6 +173,7 @@ static int32_t dnodeOpenVnodes() { int32_t numOfVnodes; int32_t status; + vnodeInit(); status = dnodeGetVnodeList(vnodeList, &numOfVnodes); if (status != TSDB_CODE_SUCCESS) { diff --git a/src/inc/vnode.h b/src/inc/vnode.h index f4fb8060fe..7ca17cafcc 100644 --- a/src/inc/vnode.h +++ b/src/inc/vnode.h @@ -35,6 +35,7 @@ typedef struct { void *qhandle; //used by query and retrieve msg } SRspRet; +void vnodeInit(); int32_t vnodeCreate(SMDCreateVnodeMsg *pVnodeCfg); int32_t vnodeDrop(int32_t vgId); int32_t vnodeOpen(int32_t vgId, char *rootDir); diff --git a/src/mnode/src/mgmtSdb.c b/src/mnode/src/mgmtSdb.c index 3a9ef390f9..0520bf8493 100644 --- a/src/mnode/src/mgmtSdb.c +++ b/src/mnode/src/mgmtSdb.c @@ -24,8 +24,6 @@ #include "twal.h" #include "tsync.h" #include "tglobal.h" -#include "hashint.h" -#include "hashstr.h" #include "dnode.h" #include "mgmtDef.h" #include "mgmtInt.h" diff --git a/src/plugins/http/src/httpHandle.c b/src/plugins/http/src/httpHandle.c index 4eaff3660a..8323ef7f4e 100644 --- a/src/plugins/http/src/httpHandle.c +++ b/src/plugins/http/src/httpHandle.c @@ -19,7 +19,6 @@ #include "tglobal.h" #include "tsocket.h" #include "ttimer.h" -#include "shash.h" #include "http.h" #include "httpLog.h" #include "httpCode.h" diff --git a/src/plugins/http/src/httpSession.c b/src/plugins/http/src/httpSession.c index 4b095aeb77..e80d6f26b7 100644 --- a/src/plugins/http/src/httpSession.c +++ b/src/plugins/http/src/httpSession.c @@ -15,7 +15,7 @@ #define _DEFAULT_SOURCE #include "os.h" -#include "shash.h" +#include "hash.h" #include "taos.h" #include "ttime.h" #include "ttimer.h" @@ -25,7 +25,6 @@ #include "httpHandle.h" #include "httpResp.h" - void httpAccessSession(HttpContext *pContext) { HttpServer *server = pContext->pThread->pServer; pthread_mutex_lock(&server->serverMutex); @@ -50,8 +49,11 @@ void httpCreateSession(HttpContext *pContext, void *taos) { session.taos = taos; session.expire = (int)taosGetTimestampSec() + server->sessionExpire; session.access = 1; - snprintf(session.id, HTTP_SESSION_ID_LEN, "%s.%s", pContext->user, pContext->pass); - pContext->session = (HttpSession *)taosAddStrHash(server->pSessionHash, session.id, (char *)(&session)); + int sessionIdLen = snprintf(session.id, HTTP_SESSION_ID_LEN, "%s.%s", pContext->user, pContext->pass); + + taosHashPut(server->pSessionHash, session.id, sessionIdLen, (char *)(&session), sizeof(HttpSession)); + pContext->session = taosHashGet(server->pSessionHash, session.id, sessionIdLen); + if (pContext->session == NULL) { httpError("context:%p, fd:%d, ip:%s, user:%s, error:%s", pContext, pContext->fd, pContext->ipstr, pContext->user, httpMsg[HTTP_SESSION_FULL]); @@ -71,9 +73,9 @@ void httpFetchSessionImp(HttpContext *pContext) { pthread_mutex_lock(&server->serverMutex); char sessionId[HTTP_SESSION_ID_LEN]; - snprintf(sessionId, HTTP_SESSION_ID_LEN, "%s.%s", pContext->user, pContext->pass); + int sessonIdLen = snprintf(sessionId, HTTP_SESSION_ID_LEN, "%s.%s", pContext->user, pContext->pass); - pContext->session = (HttpSession *)taosGetStrHashData(server->pSessionHash, sessionId); + pContext->session = taosHashGet(server->pSessionHash, sessionId, sessonIdLen); if (pContext->session != NULL && pContext->session == pContext->session->signature) { pContext->session->access++; httpTrace("context:%p, fd:%d, ip:%s, user:%s, find an exist session:%p:%p, access:%d, expire:%d", @@ -120,8 +122,7 @@ void httpRestoreSession(HttpContext *pContext) { pthread_mutex_unlock(&server->serverMutex); } -void httpResetSession(char *session) { - HttpSession *pSession = (HttpSession *)session; +void httpResetSession(HttpSession *pSession) { httpTrace("close session:%p:%p", pSession, pSession->taos); if (pSession->taos != NULL) { taos_close(pSession->taos); @@ -131,15 +132,20 @@ void httpResetSession(char *session) { } void httpRemoveAllSessions(HttpServer *pServer) { - if (pServer->pSessionHash != NULL) { - taosCleanUpStrHashWithFp(pServer->pSessionHash, httpResetSession); - pServer->pSessionHash = NULL; + SHashMutableIterator *pIter = taosHashCreateIter(pServer->pSessionHash); + + while (taosHashIterNext(pIter)) { + HttpSession *pSession = taosHashIterGet(pIter); + if (pSession == NULL) continue; + httpResetSession(pSession); } + + taosHashDestroyIter(pIter); } bool httpInitAllSessions(HttpServer *pServer) { if (pServer->pSessionHash == NULL) { - pServer->pSessionHash = taosInitStrHash(100, sizeof(HttpSession), taosHashStringStep1); + pServer->pSessionHash = taosHashInit(10, taosGetDefaultHashFunction(TSDB_DATA_TYPE_BINARY), true); } if (pServer->pSessionHash == NULL) { httpError("http init session pool failed"); @@ -152,46 +158,41 @@ bool httpInitAllSessions(HttpServer *pServer) { return true; } -int httpSessionExpired(char *session) { - HttpSession *pSession = (HttpSession *)session; - time_t cur = taosGetTimestampSec(); +bool httpSessionExpired(HttpSession *pSession) { + time_t cur = taosGetTimestampSec(); if (pSession->taos != NULL) { if (pSession->expire > cur) { - return 0; // un-expired, so return false + return false; // un-expired, so return false } if (pSession->access > 0) { httpTrace("session:%p:%p is expired, but still access:%d", pSession, pSession->taos, pSession->access); - return 0; // still used, so return false + return false; // still used, so return false } httpTrace("need close session:%p:%p for it expired, cur:%d, expire:%d, invertal:%d", pSession, pSession->taos, cur, pSession->expire, cur - pSession->expire); } - return 1; + return true; } -void httpRemoveExpireSessions(HttpServer *pServer) { - int expiredNum = 0; - do { +void httpRemoveExpireSessions(HttpServer *pServer) { + SHashMutableIterator *pIter = taosHashCreateIter(pServer->pSessionHash); + + while (taosHashIterNext(pIter)) { + HttpSession *pSession = taosHashIterGet(pIter); + if (pSession == NULL) continue; + pthread_mutex_lock(&pServer->serverMutex); - - HttpSession *pSession = (HttpSession *)taosVisitStrHashWithFp(pServer->pSessionHash, httpSessionExpired); - if (pSession == NULL) { - pthread_mutex_unlock(&pServer->serverMutex); - break; + if (httpSessionExpired(pSession)) { + httpResetSession(pSession); + taosHashRemove(pServer->pSessionHash, pSession->id, strlen(pSession->id)); } - - httpResetSession((char *)pSession); - taosDeleteStrHashNode(pServer->pSessionHash, pSession->id, pSession); - pthread_mutex_unlock(&pServer->serverMutex); + } - if (++expiredNum > 10) { - break; - } - } while (true); + taosHashDestroyIter(pIter); } void httpProcessSessionExpire(void *handle, void *tmrId) { diff --git a/src/plugins/http/src/httpSystem.c b/src/plugins/http/src/httpSystem.c index 8b95077632..e7a5344be5 100644 --- a/src/plugins/http/src/httpSystem.c +++ b/src/plugins/http/src/httpSystem.c @@ -15,7 +15,6 @@ #define _DEFAULT_SOURCE #include "os.h" -#include "shash.h" #include "taos.h" #include "tglobal.h" #include "tsocket.h" diff --git a/src/plugins/http/src/httpUtil.c b/src/plugins/http/src/httpUtil.c index fc5f771c69..77fc399272 100644 --- a/src/plugins/http/src/httpUtil.c +++ b/src/plugins/http/src/httpUtil.c @@ -16,7 +16,6 @@ #define _DEFAULT_SOURCE #include "os.h" #include "tmd5.h" -#include "shash.h" #include "taos.h" #include "http.h" #include "httpLog.h" diff --git a/src/plugins/http/src/tgHandle.c b/src/plugins/http/src/tgHandle.c index c854e0adc3..1a55c325d5 100644 --- a/src/plugins/http/src/tgHandle.c +++ b/src/plugins/http/src/tgHandle.c @@ -16,7 +16,6 @@ #define _DEFAULT_SOURCE #include "os.h" #include "tglobal.h" -#include "shash.h" #include "taosdef.h" #include "taosmsg.h" #include "tgHandle.h" diff --git a/src/query/src/tvariant.c b/src/query/src/tvariant.c index 51d3286722..6f8d579936 100644 --- a/src/query/src/tvariant.c +++ b/src/query/src/tvariant.c @@ -17,7 +17,7 @@ #include "hash.h" #include "hashfunc.h" #include "os.h" -#include "shash.h" +#include "hash.h" #include "taos.h" #include "taosdef.h" #include "tstoken.h" diff --git a/src/util/inc/hashint.h b/src/util/inc/hashint.h deleted file mode 100644 index 052689f337..0000000000 --- a/src/util/inc/hashint.h +++ /dev/null @@ -1,26 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#ifndef _sdb_int_hash_header_ -#define _sdb_int_hash_header_ - -void *sdbOpenIntHash(int maxSessions, int dataSize); -void sdbCloseIntHash(void *handle); -void *sdbAddIntHash(void *handle, void *key, void *pData); -void sdbDeleteIntHash(void *handle, void *key); -void *sdbGetIntHashData(void *handle, void *key); -void *sdbFetchIntHashData(void *handle, void *ptr, void **ppMeta); - -#endif diff --git a/src/util/inc/hashstr.h b/src/util/inc/hashstr.h deleted file mode 100644 index 66f6e88857..0000000000 --- a/src/util/inc/hashstr.h +++ /dev/null @@ -1,26 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#ifndef _sdb_str_hash_header_ -#define _sdb_str_hash_header_ - -void *sdbOpenStrHash(int maxSessions, int dataSize); -void sdbCloseStrHash(void *handle); -void *sdbAddStrHash(void *handle, void *key, void *pData); -void sdbDeleteStrHash(void *handle, void *key); -void *sdbGetStrHashData(void *handle, void *key); -void *sdbFetchStrHashData(void *handle, void *ptr, void **ppMeta); - -#endif diff --git a/src/util/inc/ihash.h b/src/util/inc/ihash.h deleted file mode 100644 index f283abe737..0000000000 --- a/src/util/inc/ihash.h +++ /dev/null @@ -1,47 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#ifndef TDENGINE_IHASH_H -#define TDENGINE_IHASH_H - -#ifdef __cplusplus -extern "C" { -#endif - -#include - -void *taosInitIntHash(int32_t maxSessions, int32_t dataSize, int32_t (*fp)(void *, uint64_t)); - -void taosCleanUpIntHash(void *handle); - -char *taosGetIntHashData(void *handle, uint64_t key); - -void taosDeleteIntHash(void *handle, uint64_t key); - -char *taosAddIntHash(void *handle, uint64_t key, char *pData); - -int32_t taosHashInt(void *handle, uint64_t key); - -void taosCleanUpIntHashWithFp(void *handle, void (*fp)(char *)); - -void taosVisitIntHashWithFp(void *handle, void (*fp)(char *, void *), void *param); - -int32_t taosGetIntHashSize(void *handle); - -#ifdef __cplusplus -} -#endif - -#endif // TDENGINE_IHASH_H diff --git a/src/util/inc/shash.h b/src/util/inc/shash.h deleted file mode 100644 index 2651a6b349..0000000000 --- a/src/util/inc/shash.h +++ /dev/null @@ -1,51 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#ifndef TDENGINE_TSHASH_H -#define TDENGINE_TSHASH_H - -#ifdef __cplusplus -extern "C" { -#endif - -#include - -void *taosInitStrHash(uint32_t maxSessions, uint32_t dataSize, uint32_t (*fp)(void *, char *)); - -void taosCleanUpStrHash(void *handle); - -void *taosGetStrHashData(void *handle, char *string); - -void taosDeleteStrHash(void *handle, char *string); - -void taosDeleteStrHashNode(void *handle, char *string, void *pDeleteNode); - -void *taosAddStrHash(void *handle, char *string, char *pData); - -void *taosAddStrHashWithSize(void *handle, char *string, char *pData, int dataSize); - -uint32_t taosHashString(void *handle, char *string); - -uint32_t taosHashStringStep1(void *handle, char *string); - -char *taosVisitStrHashWithFp(void *handle, int (*fp)(char *)); - -void taosCleanUpStrHashWithFp(void *handle, void (*fp)(char *)); - -#ifdef __cplusplus -} -#endif - -#endif // TDENGINE_TSHASH_H diff --git a/src/util/src/hashint.c b/src/util/src/hashint.c deleted file mode 100644 index 87a6da4fa8..0000000000 --- a/src/util/src/hashint.c +++ /dev/null @@ -1,201 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#include -#include -#include -#include -#include -#include -#include - -#include "tmempool.h" -#include "taosdef.h" - -typedef struct _long_hash_t { - uint32_t key; - int hash; - struct _long_hash_t *prev; - struct _long_hash_t *next; - char data[]; -} SLongHash; - -typedef struct { - SLongHash **longHashList; - mpool_h longHashMemPool; - int maxSessions; - int dataSize; -} SHashObj; - -int sdbHashLong(void *handle, uint32_t ip) { - SHashObj *pObj = (SHashObj *)handle; - int hash = 0; - - hash = ip >> 16; - hash += (ip & 0xFFFF); - - hash = hash % pObj->maxSessions; - - return hash; -} - -void *sdbAddIntHash(void *handle, void *pKey, void *data) { - int hash; - SLongHash *pNode; - SHashObj * pObj; - uint32_t key = *((uint32_t *)pKey); - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = sdbHashLong(pObj, key); - pNode = (SLongHash *)taosMemPoolMalloc(pObj->longHashMemPool); - pNode->key = key; - memcpy(pNode->data, data, pObj->dataSize); - pNode->prev = 0; - pNode->next = pObj->longHashList[hash]; - pNode->hash = hash; - - if (pObj->longHashList[hash] != 0) (pObj->longHashList[hash])->prev = pNode; - pObj->longHashList[hash] = pNode; - - return pObj; -} - -void sdbDeleteIntHash(void *handle, void *pKey) { - int hash; - SLongHash *pNode; - SHashObj * pObj; - uint32_t key = *((uint32_t *)pKey); - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - hash = sdbHashLong(pObj, key); - - pNode = pObj->longHashList[hash]; - while (pNode) { - if (pNode->key == key) break; - - pNode = pNode->next; - } - - if (pNode) { - if (pNode->prev) { - pNode->prev->next = pNode->next; - } else { - pObj->longHashList[hash] = pNode->next; - } - - if (pNode->next) { - pNode->next->prev = pNode->prev; - } - - taosMemPoolFree(pObj->longHashMemPool, (char *)pNode); - } -} - -void *sdbGetIntHashData(void *handle, void *pKey) { - int hash; - SLongHash *pNode; - SHashObj * pObj; - uint32_t key = *((uint32_t *)pKey); - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = sdbHashLong(pObj, key); - pNode = pObj->longHashList[hash]; - - while (pNode) { - if (pNode->key == key) { - break; - } - pNode = pNode->next; - } - - if (pNode) return pNode->data; - - return NULL; -} - -void *sdbOpenIntHash(int maxSessions, int dataSize) { - SLongHash **longHashList; - mpool_h longHashMemPool; - SHashObj * pObj; - - longHashMemPool = taosMemPoolInit(maxSessions, sizeof(SLongHash) + dataSize); - if (longHashMemPool == 0) return NULL; - - longHashList = calloc(sizeof(SLongHash *), maxSessions); - if (longHashList == 0) { - taosMemPoolCleanUp(longHashMemPool); - return NULL; - } - - pObj = malloc(sizeof(SHashObj)); - if (pObj == NULL) { - taosMemPoolCleanUp(longHashMemPool); - free(longHashList); - return NULL; - } - - pObj->maxSessions = maxSessions; - pObj->longHashMemPool = longHashMemPool; - pObj->longHashList = longHashList; - pObj->dataSize = dataSize; - - return pObj; -} - -void sdbCloseIntHash(void *handle) { - SHashObj *pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - if (pObj->longHashMemPool) taosMemPoolCleanUp(pObj->longHashMemPool); - - if (pObj->longHashList) free(pObj->longHashList); - - memset(pObj, 0, sizeof(SHashObj)); - free(pObj); -} - -void *sdbFetchIntHashData(void *handle, void *ptr, void **ppMeta) { - SHashObj * pObj = (SHashObj *)handle; - SLongHash *pNode = (SLongHash *)ptr; - int hash = 0; - - *ppMeta = NULL; - if (pObj == NULL || pObj->maxSessions <= 0) return NULL; - if (pObj->longHashList == NULL) return NULL; - - if (pNode) { - hash = pNode->hash + 1; - pNode = pNode->next; - } - - if (pNode == NULL) { - for (int i = hash; i < pObj->maxSessions; ++i) { - pNode = pObj->longHashList[i]; - if (pNode) break; - } - } - - if (pNode) *ppMeta = pNode->data; - - return pNode; -} diff --git a/src/util/src/hashstr.c b/src/util/src/hashstr.c deleted file mode 100644 index d87e605176..0000000000 --- a/src/util/src/hashstr.c +++ /dev/null @@ -1,214 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#include "os.h" -#include "taosdef.h" - -#define MAX_STR_LEN 40 - -typedef struct _str_node_t { - char string[TSDB_TABLE_ID_LEN]; - int hash; - struct _str_node_t *prev; - struct _str_node_t *next; - char data[]; -} SHashNode; - -typedef struct { - SHashNode **hashList; - int maxSessions; - int dataSize; -} SHashObj; - -int sdbHashString(void *handle, char *string) { - SHashObj * pObj = (SHashObj *)handle; - unsigned int hash = 0, hashv; - char * c; - int len = strlen(string); - - c = string; - - while (len >= 4) { - hash += *((int *)c); - c += 4; - len -= 4; - } - - while (len > 0) { - hash += *c; - c++; - len--; - } - - hashv = hash / pObj->maxSessions; - hash = (hashv + hash % pObj->maxSessions) % pObj->maxSessions; - - return hash; -} - -void *sdbAddStrHash(void *handle, void *key, void *pData) { - int hash; - SHashNode *pNode; - SHashObj * pObj; - char * string = (char *)key; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = sdbHashString(pObj, string); - - int size = sizeof(SHashNode) + pObj->dataSize; - pNode = (SHashNode *)malloc(size); - memset(pNode, 0, size); - strcpy(pNode->string, string); - memcpy(pNode->data, pData, pObj->dataSize); - pNode->prev = 0; - pNode->next = pObj->hashList[hash]; - pNode->hash = hash; - - if (pObj->hashList[hash] != 0) (pObj->hashList[hash])->prev = pNode; - pObj->hashList[hash] = pNode; - - return pNode->data; -} - -void sdbDeleteStrHash(void *handle, void *key) { - int hash; - SHashNode *pNode; - SHashObj * pObj; - char * string = (char *)key; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - hash = sdbHashString(pObj, string); - pNode = pObj->hashList[hash]; - while (pNode) { - if (strcmp(pNode->string, string) == 0) break; - - pNode = pNode->next; - } - - if (pNode) { - if (pNode->prev) { - pNode->prev->next = pNode->next; - } else { - pObj->hashList[hash] = pNode->next; - } - - if (pNode->next) { - pNode->next->prev = pNode->prev; - } - - memset(pNode, 0, sizeof(SHashNode)); - free(pNode); - } -} - -void *sdbGetStrHashData(void *handle, void *key) { - int hash; - SHashNode *pNode; - SHashObj * pObj; - char * string = (char *)key; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = sdbHashString(pObj, string); - pNode = pObj->hashList[hash]; - - while (pNode) { - if (strcmp(pNode->string, string) == 0) { - break; - } - pNode = pNode->next; - } - - if (pNode) return pNode->data; - - return NULL; -} - -void *sdbOpenStrHash(int maxSessions, int dataSize) { - SHashObj *pObj; - - pObj = (SHashObj *)malloc(sizeof(SHashObj)); - if (pObj == NULL) { - return NULL; - } - - memset(pObj, 0, sizeof(SHashObj)); - pObj->maxSessions = maxSessions; - pObj->dataSize = dataSize; - - pObj->hashList = (SHashNode **)malloc(sizeof(SHashNode *) * maxSessions); - if (pObj->hashList == NULL) { - free(pObj); - return NULL; - } - memset(pObj->hashList, 0, sizeof(SHashNode *) * maxSessions); - - return (void *)pObj; -} - -void sdbCloseStrHash(void *handle) { - SHashObj *pObj; - SHashNode *pNode, *pNext; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions <= 0) return; - - if (pObj->hashList) { - for (int i = 0; i < pObj->maxSessions; ++i) { - pNode = pObj->hashList[i]; - while (pNode) { - pNext = pNode->next; - free(pNode); - pNode = pNext; - } - } - - free(pObj->hashList); - } - - memset(pObj, 0, sizeof(SHashObj)); - free(pObj); -} - -void *sdbFetchStrHashData(void *handle, void *ptr, void **ppMeta) { - SHashObj *pObj = (SHashObj *)handle; - SHashNode *pNode = (SHashNode *)ptr; - int hash = 0; - - *ppMeta = NULL; - if (pObj == NULL || pObj->maxSessions <= 0) return NULL; - if (pObj->hashList == NULL) return NULL; - - if (pNode) { - hash = pNode->hash + 1; - pNode = pNode->next; - } - - if (pNode == NULL) { - for (int i = hash; i < pObj->maxSessions; ++i) { - pNode = pObj->hashList[i]; - if (pNode) break; - } - } - - if (pNode) *ppMeta = pNode->data; - - return pNode; -} diff --git a/src/util/src/ihash.c b/src/util/src/ihash.c deleted file mode 100644 index 2cfadad964..0000000000 --- a/src/util/src/ihash.c +++ /dev/null @@ -1,290 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#include "os.h" - -typedef struct _str_node_t { - uint64_t key; - struct _str_node_t *prev; - struct _str_node_t *next; - char data[]; -} IHashNode; - -typedef struct { - IHashNode **hashList; - int64_t *lockedBy; - int32_t maxSessions; - int32_t dataSize; - int32_t (*hashFp)(void *, uint64_t key); -} IHashObj; - -int32_t taosHashInt(void *handle, uint64_t key) { - IHashObj *pObj = (IHashObj *)handle; - int32_t hash = key % pObj->maxSessions; - return hash; -} - -static void taosLockIntHash(IHashObj *pObj, int hash); -static void taosUnlockIntHash(IHashObj *pObj, int hash); - -char *taosAddIntHash(void *handle, uint64_t key, char *pData) { - int32_t hash; - IHashNode *pNode; - IHashObj * pObj; - - pObj = (IHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = (*pObj->hashFp)(pObj, key); - - pNode = (IHashNode *)malloc(sizeof(IHashNode) + (size_t)pObj->dataSize); - if (pNode == NULL) - return NULL; - - taosLockIntHash(pObj, hash); - - pNode->key = key; - if (pData != NULL) { - memcpy(pNode->data, pData, (size_t)pObj->dataSize); - } - pNode->prev = 0; - pNode->next = pObj->hashList[hash]; - - if (pObj->hashList[hash] != 0) (pObj->hashList[hash])->prev = pNode; - pObj->hashList[hash] = pNode; - - taosUnlockIntHash(pObj, hash); - - return (char *)pNode->data; -} - -void taosDeleteIntHash(void *handle, uint64_t key) { - int32_t hash; - IHashNode *pNode; - IHashObj * pObj; - - pObj = (IHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - hash = (*(pObj->hashFp))(pObj, key); - - taosLockIntHash(pObj, hash); - - pNode = pObj->hashList[hash]; - while (pNode) { - if (pNode->key == key) break; - - pNode = pNode->next; - } - - if (pNode) { - if (pNode->prev) { - pNode->prev->next = pNode->next; - } else { - pObj->hashList[hash] = pNode->next; - } - - if (pNode->next) { - pNode->next->prev = pNode->prev; - } - - free(pNode); - } - - taosUnlockIntHash(pObj, hash); -} - -char *taosGetIntHashData(void *handle, uint64_t key) { - int32_t hash; - IHashNode *pNode; - IHashObj * pObj; - - pObj = (IHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = (*pObj->hashFp)(pObj, key); - - taosLockIntHash(pObj, hash); - - pNode = pObj->hashList[hash]; - - while (pNode) { - if (pNode->key == key) { - break; - } - - pNode = pNode->next; - } - - taosUnlockIntHash(pObj, hash); - - if (pNode) return pNode->data; - - return NULL; -} - -void *taosInitIntHash(int32_t maxSessions, int32_t dataSize, int32_t (*fp)(void *, uint64_t)) { - IHashObj *pObj; - - pObj = (IHashObj *)malloc(sizeof(IHashObj)); - if (pObj == NULL) { - return NULL; - } - - memset(pObj, 0, sizeof(IHashObj)); - pObj->maxSessions = maxSessions; - pObj->dataSize = dataSize; - pObj->hashFp = fp; - - pObj->hashList = (IHashNode **)malloc(sizeof(IHashNode *) * (size_t)maxSessions); - if (pObj->hashList == NULL) { - free(pObj); - return NULL; - } - memset(pObj->hashList, 0, sizeof(IHashNode *) * (size_t)maxSessions); - - pObj->lockedBy = (int64_t *)calloc(sizeof(int64_t), maxSessions); - if (pObj->lockedBy == NULL) { - free(pObj); - free(pObj->hashList); - pObj = NULL; - } - - return pObj; -} - -void taosCleanUpIntHash(void *handle) { - IHashObj * pObj; - IHashNode *pNode, *pNext; - - pObj = (IHashObj *)handle; - if (pObj == NULL || pObj->maxSessions <= 0) return; - - if (pObj->hashList) { - for (int32_t i = 0; i < pObj->maxSessions; ++i) { - taosLockIntHash(pObj, i); - - pNode = pObj->hashList[i]; - while (pNode) { - pNext = pNode->next; - free(pNode); - pNode = pNext; - } - - taosUnlockIntHash(pObj, i); - } - - free(pObj->hashList); - } - - free(pObj->lockedBy); - free(pObj); -} - -void taosCleanUpIntHashWithFp(void *handle, void (*fp)(char *)) { - IHashObj * pObj; - IHashNode *pNode, *pNext; - - pObj = (IHashObj *)handle; - if (pObj == NULL || pObj->maxSessions <= 0) return; - - if (pObj->hashList) { - for (int i = 0; i < pObj->maxSessions; ++i) { - taosLockIntHash(pObj, i); - - pNode = pObj->hashList[i]; - while (pNode) { - pNext = pNode->next; - if (fp != NULL) (*fp)(pNode->data); - free(pNode); - pNode = pNext; - } - - taosUnlockIntHash(pObj, i); - } - - free(pObj->hashList); - } - - memset(pObj, 0, sizeof(IHashObj)); - free(pObj); -} - -void taosVisitIntHashWithFp(void *handle, int (*fp)(char *, void *), void *param) { - IHashObj * pObj; - IHashNode *pNode, *pNext; - - pObj = (IHashObj *)handle; - if (pObj == NULL || pObj->maxSessions <= 0) return; - - if (pObj->hashList) { - for (int i = 0; i < pObj->maxSessions; ++i) { - taosLockIntHash(pObj, i); - - pNode = pObj->hashList[i]; - while (pNode) { - pNext = pNode->next; - (*fp)(pNode->data, param); - pNode = pNext; - } - - taosUnlockIntHash(pObj, i); - } - } -} - -int32_t taosGetIntHashSize(void *handle) { - IHashObj * pObj; - IHashNode *pNode, *pNext; - int32_t num = 0; - - pObj = (IHashObj *)handle; - if (pObj == NULL || pObj->maxSessions <= 0) return 0; - - if (pObj->hashList) { - for (int i = 0; i < pObj->maxSessions; ++i) { - taosLockIntHash(pObj, i); - - pNode = pObj->hashList[i]; - while (pNode) { - pNext = pNode->next; - num++; - pNode = pNext; - } - - taosUnlockIntHash(pObj, i); - } - } - - return num; -} - -static void taosLockIntHash(IHashObj *pObj, int hash) { - int64_t tid = taosGetPthreadId(); - int i = 0; - while (atomic_val_compare_exchange_64(&(pObj->lockedBy[hash]), 0, tid) != 0) { - if (++i % 1000 == 0) { - sched_yield(); - } - } -} - -static void taosUnlockIntHash(IHashObj *pObj, int hash) { - int64_t tid = taosGetPthreadId(); - if (atomic_val_compare_exchange_64(&(pObj->lockedBy[hash]), tid, 0) != tid) { - assert(false); - } -} - diff --git a/src/util/src/shash.c b/src/util/src/shash.c deleted file mode 100644 index 807ba58951..0000000000 --- a/src/util/src/shash.c +++ /dev/null @@ -1,310 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#define _DEFAULT_SOURCE -#include "os.h" -#include "shash.h" -#include "tulog.h" - -typedef struct _str_node_t { - char * string; - struct _str_node_t *prev; - struct _str_node_t *next; - char data[]; -} SHashNode; - -typedef struct { - SHashNode **hashList; - uint32_t maxSessions; - uint32_t dataSize; - uint32_t (*hashFp)(void *, char *string); - pthread_mutex_t mutex; -} SHashObj; - -uint32_t taosHashString(void *handle, char *string) { - SHashObj *pObj = (SHashObj *)handle; - uint32_t hash = 0, hashv; - char * c; - - c = string; - while (*c) { - hash += *((int *)c); - c += 4; - } - - hashv = hash / pObj->maxSessions; - hash = (hashv + hash % pObj->maxSessions) % pObj->maxSessions; - - return hash; -} - -uint32_t taosHashStringStep1(void *handle, char *string) { - SHashObj *pObj = (SHashObj *)handle; - uint32_t hash = 0, hashv; - char * c; - - c = string; - while (*c) { - hash += *c; - c++; - } - - hashv = hash / pObj->maxSessions; - hash = (hashv + hash % pObj->maxSessions) % pObj->maxSessions; - - return hash; -} - -void *taosAddStrHashWithSize(void *handle, char *string, char *pData, int dataSize) { - uint32_t hash; - SHashNode *pNode; - SHashObj * pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - if (string == NULL || string[0] == 0) return NULL; - - hash = (*pObj->hashFp)(pObj, string); - - pthread_mutex_lock(&pObj->mutex); - - pNode = (SHashNode *)malloc(sizeof(SHashNode) + (size_t)dataSize + strlen(string) + 1); - memcpy(pNode->data, pData, (size_t)dataSize); - pNode->prev = 0; - pNode->next = pObj->hashList[hash]; - pNode->string = pNode->data + dataSize; - strcpy(pNode->string, string); - - if (pObj->hashList[hash] != 0) (pObj->hashList[hash])->prev = pNode; - pObj->hashList[hash] = pNode; - - pthread_mutex_unlock(&pObj->mutex); - - uTrace("hash:%d:%s is added", hash, string); - - return pNode->data; -} - -void *taosAddStrHash(void *handle, char *string, char *pData) { - if (string == NULL || string[0] == 0) return NULL; - - SHashObj *pObj = (SHashObj *)handle; - return taosAddStrHashWithSize(handle, string, pData, pObj->dataSize); -} - -void taosDeleteStrHashNode(void *handle, char *string, void *pDeleteNode) { - uint32_t hash; - SHashNode *pNode; - SHashObj * pObj; - bool find = false; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - if (string == NULL || string[0] == 0) return; - - hash = (*(pObj->hashFp))(pObj, string); - - pthread_mutex_lock(&pObj->mutex); - - pNode = pObj->hashList[hash]; - - while (pNode) { - if (strcmp(pNode->string, string) != 0) continue; - if (pNode->data == pDeleteNode) { - find = true; - break; - } - - pNode = pNode->next; - } - - if (find) { - if (pNode->prev) { - pNode->prev->next = pNode->next; - } else { - pObj->hashList[hash] = pNode->next; - } - - if (pNode->next) { - pNode->next->prev = pNode->prev; - } - - uTrace("hash:%d:%s:%p is removed", hash, string, pNode); - - free(pNode); - } - - pthread_mutex_unlock(&pObj->mutex); -} - -void taosDeleteStrHash(void *handle, char *string) { - uint32_t hash; - SHashNode *pNode; - SHashObj * pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - if (string == NULL || string[0] == 0) return; - - hash = (*(pObj->hashFp))(pObj, string); - - pthread_mutex_lock(&pObj->mutex); - - pNode = pObj->hashList[hash]; - while (pNode) { - if (strcmp(pNode->string, string) == 0) break; - - pNode = pNode->next; - } - - if (pNode) { - if (pNode->prev) { - pNode->prev->next = pNode->next; - } else { - pObj->hashList[hash] = pNode->next; - } - - if (pNode->next) { - pNode->next->prev = pNode->prev; - } - - uTrace("hash:%d:%s:%p is removed", hash, string, pNode); - - free(pNode); - } - - pthread_mutex_unlock(&pObj->mutex); -} - -void *taosGetStrHashData(void *handle, char *string) { - uint32_t hash; - SHashNode *pNode; - SHashObj * pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - if (string == NULL || string[0] == 0) return NULL; - - hash = (*pObj->hashFp)(pObj, string); - - pthread_mutex_lock(&pObj->mutex); - - pNode = pObj->hashList[hash]; - - while (pNode) { - if (strcmp(pNode->string, string) == 0) { - uTrace("hash:%d:%s is retrieved", hash, string); - break; - } - - pNode = pNode->next; - } - - pthread_mutex_unlock(&pObj->mutex); - - if (pNode) return pNode->data; - - return NULL; -} - -void *taosInitStrHash(uint32_t maxSessions, uint32_t dataSize, uint32_t (*fp)(void *, char *)) { - SHashObj *pObj; - - pObj = (SHashObj *)malloc(sizeof(SHashObj)); - if (pObj == NULL) { - return NULL; - } - - memset(pObj, 0, sizeof(SHashObj)); - pObj->maxSessions = maxSessions; - pObj->dataSize = dataSize; - pObj->hashFp = fp; - - pObj->hashList = (SHashNode **)malloc(sizeof(SHashNode *) * (size_t)maxSessions); - if (pObj->hashList == NULL) { - free(pObj); - return NULL; - } - memset(pObj->hashList, 0, sizeof(SHashNode *) * (size_t)maxSessions); - - pthread_mutex_init(&pObj->mutex, NULL); - - return pObj; -} - -void taosCleanUpStrHashWithFp(void *handle, void (*fp)(char *)) { - SHashObj * pObj; - SHashNode *pNode, *pNext; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions <= 0) return; - - pthread_mutex_lock(&pObj->mutex); - - if (pObj->hashList) { - for (int i = 0; i < pObj->maxSessions; ++i) { - pNode = pObj->hashList[i]; - while (pNode) { - pNext = pNode->next; - if (fp != NULL) fp(pNode->data); - free(pNode); - pNode = pNext; - } - } - - free(pObj->hashList); - } - - pthread_mutex_unlock(&pObj->mutex); - - pthread_mutex_destroy(&pObj->mutex); - - memset(pObj, 0, sizeof(SHashObj)); - free(pObj); -} - -void taosCleanUpStrHash(void *handle) { taosCleanUpStrHashWithFp(handle, NULL); } - -char *taosVisitStrHashWithFp(void *handle, int (*fp)(char *)) { - SHashObj * pObj; - SHashNode *pNode, *pNext; - char * pData = NULL; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions <= 0) return NULL; - - pthread_mutex_lock(&pObj->mutex); - - if (pObj->hashList) { - for (int i = 0; i < pObj->maxSessions; ++i) { - pNode = pObj->hashList[i]; - while (pNode) { - pNext = pNode->next; - int flag = fp(pNode->data); - if (flag) { - pData = pNode->data; - goto VisitEnd; - } - - pNode = pNext; - } - } - } - -VisitEnd: - - pthread_mutex_unlock(&pObj->mutex); - return pData; -} diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index 8d35be9640..20ec430916 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -15,7 +15,7 @@ #define _DEFAULT_SOURCE #include "os.h" -#include "ihash.h" +#include "hash.h" #include "taoserror.h" #include "taosmsg.h" #include "tutil.h" @@ -32,7 +32,6 @@ static int32_t tsOpennedVnodes; static void *tsDnodeVnodesHash; static void vnodeCleanUp(SVnodeObj *pVnode); -static void vnodeBuildVloadMsg(char *pNode, void * param); static int vnodeWalCallback(void *arg); static int32_t vnodeSaveCfg(SMDCreateVnodeMsg *pVnodeCfg); static int32_t vnodeReadCfg(SVnodeObj *pVnode); @@ -55,11 +54,11 @@ int syncGetNodesRole(tsync_h shandle, SNodesRole * cfg) { return 0; } void syncConfirmForward(tsync_h shandle, uint64_t version, int32_t code) {} #endif -static void vnodeInit() { +void vnodeInit() { vnodeInitWriteFp(); vnodeInitReadFp(); - tsDnodeVnodesHash = taosInitIntHash(TSDB_MAX_VNODES, sizeof(SVnodeObj *), taosHashInt); + tsDnodeVnodesHash = taosHashInit(TSDB_MAX_VNODES, taosGetDefaultHashFunction(TSDB_DATA_TYPE_INT), true); if (tsDnodeVnodesHash == NULL) { vError("failed to init vnode list"); } @@ -69,7 +68,7 @@ int32_t vnodeCreate(SMDCreateVnodeMsg *pVnodeCfg) { int32_t code; pthread_once(&vnodeModuleInit, vnodeInit); - SVnodeObj *pTemp = (SVnodeObj *)taosGetIntHashData(tsDnodeVnodesHash, pVnodeCfg->cfg.vgId); + SVnodeObj *pTemp = (SVnodeObj *)taosHashGet(tsDnodeVnodesHash, (const char *)&pVnodeCfg->cfg.vgId, sizeof(int32_t)); if (pTemp != NULL) { vPrint("vgId:%d, vnode already exist, pVnode:%p", pVnodeCfg->cfg.vgId, pTemp); return TSDB_CODE_SUCCESS; @@ -121,7 +120,7 @@ int32_t vnodeCreate(SMDCreateVnodeMsg *pVnodeCfg) { } int32_t vnodeDrop(int32_t vgId) { - SVnodeObj **ppVnode = (SVnodeObj **)taosGetIntHashData(tsDnodeVnodesHash, vgId); + SVnodeObj **ppVnode = (SVnodeObj **)taosHashGet(tsDnodeVnodesHash, (const char *)&vgId, sizeof(int32_t)); if (ppVnode == NULL || *ppVnode == NULL) { vTrace("vgId:%d, failed to drop, vgId not exist", vgId); return TSDB_CODE_INVALID_VGROUP_ID; @@ -148,7 +147,7 @@ int32_t vnodeAlter(void *param, SMDCreateVnodeMsg *pVnodeCfg) { code = vnodeReadCfg(pVnode); if (code != TSDB_CODE_SUCCESS) { vError("vgId:%d, failed to read cfg file", pVnode->vgId); - taosDeleteIntHash(tsDnodeVnodesHash, pVnode->vgId); + taosHashRemove(tsDnodeVnodesHash, (const char *)&pVnode->vgId, sizeof(int32_t)); return code; } @@ -183,12 +182,12 @@ int32_t vnodeOpen(int32_t vnode, char *rootDir) { pVnode->version = 0; pVnode->tsdbCfg.tsdbId = pVnode->vgId; pVnode->rootDir = strdup(rootDir); - taosAddIntHash(tsDnodeVnodesHash, pVnode->vgId, (char *)(&pVnode)); - + taosHashPut(tsDnodeVnodesHash, (const char *)&pVnode->vgId, sizeof(int32_t), (char *)(&pVnode), sizeof(SVnodeObj *)); + int32_t code = vnodeReadCfg(pVnode); if (code != TSDB_CODE_SUCCESS) { vError("vgId:%d, failed to read cfg file", pVnode->vgId); - taosDeleteIntHash(tsDnodeVnodesHash, pVnode->vgId); + taosHashRemove(tsDnodeVnodesHash, (const char *)&pVnode->vgId, sizeof(int32_t)); return code; } @@ -213,7 +212,7 @@ int32_t vnodeOpen(int32_t vnode, char *rootDir) { pVnode->tsdb = tsdbOpenRepo(temp, &appH); if (pVnode->tsdb == NULL) { vError("vgId:%d, failed to open tsdb at %s(%s)", pVnode->vgId, temp, tstrerror(terrno)); - taosDeleteIntHash(tsDnodeVnodesHash, pVnode->vgId); + taosHashRemove(tsDnodeVnodesHash, (const char *)&pVnode->vgId, sizeof(int32_t)); return terrno; } @@ -249,7 +248,7 @@ int32_t vnodeOpen(int32_t vnode, char *rootDir) { } int32_t vnodeClose(int32_t vgId) { - SVnodeObj **ppVnode = (SVnodeObj **)taosGetIntHashData(tsDnodeVnodesHash, vgId); + SVnodeObj **ppVnode = (SVnodeObj **)taosHashGet(tsDnodeVnodesHash, (const char *)&vgId, sizeof(int32_t)); if (ppVnode == NULL || *ppVnode == NULL) return 0; SVnodeObj *pVnode = *ppVnode; @@ -293,14 +292,14 @@ void vnodeRelease(void *pVnodeRaw) { vTrace("vgId:%d, vnode is released, vnodes:%d", vgId, count); if (count <= 0) { - taosCleanUpIntHash(tsDnodeVnodesHash); + taosHashCleanup(tsDnodeVnodesHash); vnodeModuleInit = PTHREAD_ONCE_INIT; tsDnodeVnodesHash = NULL; } } void *vnodeGetVnode(int32_t vgId) { - SVnodeObj **ppVnode = (SVnodeObj **)taosGetIntHashData(tsDnodeVnodesHash, vgId); + SVnodeObj **ppVnode = (SVnodeObj **)taosHashGet(tsDnodeVnodesHash, (const char *)&vgId, sizeof(int32_t)); if (ppVnode == NULL || *ppVnode == NULL) { terrno = TSDB_CODE_INVALID_VGROUP_ID; vPrint("vgId:%d, not exist", vgId); @@ -334,16 +333,8 @@ void *vnodeGetWal(void *pVnode) { return ((SVnodeObj *)pVnode)->wal; } -void vnodeBuildStatusMsg(void *param) { - SDMStatusMsg *pStatus = param; - taosVisitIntHashWithFp(tsDnodeVnodesHash, vnodeBuildVloadMsg, pStatus); -} - -static void vnodeBuildVloadMsg(char *pNode, void * param) { - SVnodeObj *pVnode = *(SVnodeObj **) pNode; +static void vnodeBuildVloadMsg(SVnodeObj *pVnode, SDMStatusMsg *pStatus) { if (pVnode->status == TAOS_VN_STATUS_DELETING) return; - - SDMStatusMsg *pStatus = param; if (pStatus->openVnodes >= TSDB_MAX_VNODES) return; SVnodeLoad *pLoad = &pStatus->load[pStatus->openVnodes++]; @@ -357,8 +348,24 @@ static void vnodeBuildVloadMsg(char *pNode, void * param) { pLoad->replica = pVnode->syncCfg.replica; } +void vnodeBuildStatusMsg(void *param) { + SDMStatusMsg *pStatus = param; + SHashMutableIterator *pIter = taosHashCreateIter(tsDnodeVnodesHash); + + while (taosHashIterNext(pIter)) { + SVnodeObj **pVnode = taosHashIterGet(pIter); + if (pVnode == NULL) continue; + if (*pVnode == NULL) continue; + + vnodeBuildVloadMsg(*pVnode, pStatus); + pStatus++; + } + + taosHashDestroyIter(pIter); +} + static void vnodeCleanUp(SVnodeObj *pVnode) { - taosDeleteIntHash(tsDnodeVnodesHash, pVnode->vgId); + taosHashRemove(tsDnodeVnodesHash, (const char *)&pVnode->vgId, sizeof(int32_t)); if (pVnode->sync) { syncStop(pVnode->sync); From 5f86564a1c9fe9aaec2e65167ded22e18ccd7bd0 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 17:46:15 +0800 Subject: [PATCH 026/126] [149] fix bug while replace sdb --- src/dnode/src/dnodeMgmt.c | 1 - src/inc/vnode.h | 1 - src/rpc/src/rpcUdp.c | 1 - src/util/inc/thash.h | 41 -------- src/util/src/thash.c | 192 -------------------------------------- src/vnode/src/vnodeMain.c | 4 +- 6 files changed, 3 insertions(+), 237 deletions(-) delete mode 100644 src/util/inc/thash.h delete mode 100644 src/util/src/thash.c diff --git a/src/dnode/src/dnodeMgmt.c b/src/dnode/src/dnodeMgmt.c index f34acdeae3..81d426b496 100644 --- a/src/dnode/src/dnodeMgmt.c +++ b/src/dnode/src/dnodeMgmt.c @@ -173,7 +173,6 @@ static int32_t dnodeOpenVnodes() { int32_t numOfVnodes; int32_t status; - vnodeInit(); status = dnodeGetVnodeList(vnodeList, &numOfVnodes); if (status != TSDB_CODE_SUCCESS) { diff --git a/src/inc/vnode.h b/src/inc/vnode.h index 7ca17cafcc..f4fb8060fe 100644 --- a/src/inc/vnode.h +++ b/src/inc/vnode.h @@ -35,7 +35,6 @@ typedef struct { void *qhandle; //used by query and retrieve msg } SRspRet; -void vnodeInit(); int32_t vnodeCreate(SMDCreateVnodeMsg *pVnodeCfg); int32_t vnodeDrop(int32_t vgId); int32_t vnodeOpen(int32_t vgId, char *rootDir); diff --git a/src/rpc/src/rpcUdp.c b/src/rpc/src/rpcUdp.c index 8d5721a437..c551f6b1db 100644 --- a/src/rpc/src/rpcUdp.c +++ b/src/rpc/src/rpcUdp.c @@ -18,7 +18,6 @@ #include "tsystem.h" #include "ttimer.h" #include "tutil.h" -#include "thash.h" #include "rpcLog.h" #include "rpcHaship.h" #include "rpcUdp.h" diff --git a/src/util/inc/thash.h b/src/util/inc/thash.h deleted file mode 100644 index 592db62fe5..0000000000 --- a/src/util/inc/thash.h +++ /dev/null @@ -1,41 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#ifndef TDENGINE_THASH_H -#define TDENGINE_THASH_H - -#ifdef __cplusplus -extern "C" { -#endif - -void *taosOpenHash(int maxSessions, int (*fp)(void *, uint64_t)); - -void taosCloseHash(void *handle); - -int taosAddHash(void *handle, uint64_t, uint32_t id); - -void taosDeleteHash(void *handle, uint64_t); - -int32_t taosGetIdFromHash(void *handle, uint64_t); - -int taosHashLong(void *, uint64_t ip); - -uint64_t taosHashUInt64(uint64_t handle); - -#ifdef __cplusplus -} -#endif - -#endif // TDENGINE_THASH_H diff --git a/src/util/src/thash.c b/src/util/src/thash.c deleted file mode 100644 index e3c6fe26b4..0000000000 --- a/src/util/src/thash.c +++ /dev/null @@ -1,192 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#include "os.h" -#include "tmempool.h" - -typedef struct _long_hash_t { - unsigned int id; - struct _long_hash_t *prev; - struct _long_hash_t *next; - uint64_t cont; -} SLongHash; - -typedef struct { - SLongHash **longHashList; - mpool_h longHashMemPool; - int (*hashFp)(void *, uint64_t); - int maxSessions; - pthread_mutex_t mutex; -} SHashObj; - -uint64_t taosHashUInt64(uint64_t handle) { - uint64_t hash = handle >> 16; - hash += handle & 0xFFFF; - return hash; -} - -int taosHashLong(void *handle, uint64_t ip) { - SHashObj *pObj = (SHashObj *)handle; - int hash = 0; - - hash = (int)(ip >> 16); - hash += (int)(ip & 0xFFFF); - - hash = hash % pObj->maxSessions; - - return hash; -} - -int taosAddHash(void *handle, uint64_t cont, unsigned int id) { - int hash; - SLongHash *pNode; - SHashObj * pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return -1; - - pthread_mutex_lock(&pObj->mutex); - - hash = (*pObj->hashFp)(pObj, cont); - - pNode = (SLongHash *)taosMemPoolMalloc(pObj->longHashMemPool); - pNode->cont = cont; - pNode->id = id; - pNode->prev = 0; - pNode->next = pObj->longHashList[hash]; - - if (pObj->longHashList[hash] != 0) (pObj->longHashList[hash])->prev = pNode; - pObj->longHashList[hash] = pNode; - - pthread_mutex_unlock(&pObj->mutex); - - return 0; -} - -void taosDeleteHash(void *handle, uint64_t cont) { - int hash; - SLongHash *pNode; - SHashObj * pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - hash = (*pObj->hashFp)(pObj, cont); - - pthread_mutex_lock(&pObj->mutex); - - pNode = pObj->longHashList[hash]; - while (pNode) { - if (pNode->cont == cont) break; - - pNode = pNode->next; - } - - if (pNode) { - if (pNode->prev) { - pNode->prev->next = pNode->next; - } else { - pObj->longHashList[hash] = pNode->next; - } - - if (pNode->next) { - pNode->next->prev = pNode->prev; - } - - taosMemPoolFree(pObj->longHashMemPool, (char *)pNode); - } - - pthread_mutex_unlock(&pObj->mutex); -} - -int32_t taosGetIdFromHash(void *handle, uint64_t cont) { - int hash; - SLongHash *pNode; - SHashObj * pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return -1; - - hash = (*pObj->hashFp)(pObj, cont); - - pthread_mutex_lock(&pObj->mutex); - - pNode = pObj->longHashList[hash]; - - while (pNode) { - if (pNode->cont == cont) { - break; - } - - pNode = pNode->next; - } - - pthread_mutex_unlock(&pObj->mutex); - - if (pNode) return (int32_t)pNode->id; - - return -1; -} - -void *taosOpenHash(int maxSessions, int (*fp)(void *, uint64_t)) { - SLongHash **longHashList; - mpool_h longHashMemPool; - SHashObj * pObj; - - longHashMemPool = taosMemPoolInit(maxSessions, sizeof(SLongHash)); - if (longHashMemPool == 0) return NULL; - - longHashList = calloc(sizeof(SLongHash *), (size_t)maxSessions); - if (longHashList == 0) { - taosMemPoolCleanUp(longHashMemPool); - return NULL; - } - - pObj = malloc(sizeof(SHashObj)); - if (pObj == NULL) { - taosMemPoolCleanUp(longHashMemPool); - free(longHashList); - return NULL; - } - - pObj->maxSessions = maxSessions; - pObj->longHashMemPool = longHashMemPool; - pObj->longHashList = longHashList; - pObj->hashFp = fp; - - pthread_mutex_init(&pObj->mutex, NULL); - - return pObj; -} - -void taosCloseHash(void *handle) { - SHashObj *pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - pthread_mutex_lock(&pObj->mutex); - - if (pObj->longHashMemPool) taosMemPoolCleanUp(pObj->longHashMemPool); - - if (pObj->longHashList) free(pObj->longHashList); - - pthread_mutex_unlock(&pObj->mutex); - - pthread_mutex_destroy(&pObj->mutex); - - memset(pObj, 0, sizeof(SHashObj)); - free(pObj); -} diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index 20ec430916..5b36fcba16 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -54,7 +54,7 @@ int syncGetNodesRole(tsync_h shandle, SNodesRole * cfg) { return 0; } void syncConfirmForward(tsync_h shandle, uint64_t version, int32_t code) {} #endif -void vnodeInit() { +static void vnodeInit() { vnodeInitWriteFp(); vnodeInitReadFp(); @@ -299,6 +299,8 @@ void vnodeRelease(void *pVnodeRaw) { } void *vnodeGetVnode(int32_t vgId) { + if (tsDnodeVnodesHash == NULL) return NULL; + SVnodeObj **ppVnode = (SVnodeObj **)taosHashGet(tsDnodeVnodesHash, (const char *)&vgId, sizeof(int32_t)); if (ppVnode == NULL || *ppVnode == NULL) { terrno = TSDB_CODE_INVALID_VGROUP_ID; From 580216c9538075cc6aaf8208e315a9a147ed7ffc Mon Sep 17 00:00:00 2001 From: slguan Date: Wed, 13 May 2020 17:56:11 +0800 Subject: [PATCH 027/126] [TD-149] fix compile error after merge develop --- src/vnode/src/vnodeMain.c | 1 - 1 file changed, 1 deletion(-) diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index e70e29a9a8..838b9d290f 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -32,7 +32,6 @@ static int32_t tsOpennedVnodes; static void *tsDnodeVnodesHash; static void vnodeCleanUp(SVnodeObj *pVnode); -static int vnodeWalCallback(void *arg); static int32_t vnodeSaveCfg(SMDCreateVnodeMsg *pVnodeCfg); static int32_t vnodeReadCfg(SVnodeObj *pVnode); static int32_t vnodeSaveVersion(SVnodeObj *pVnode); From cb75eed72979669a3d8e42adb53fc484ab79d264 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 18:31:20 +0800 Subject: [PATCH 028/126] scripts --- tests/script/jenkins/basic.txt | 30 +++++++++++++++--------------- 1 file changed, 15 insertions(+), 15 deletions(-) diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index 6b1902f590..44d7f1e8ea 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -15,7 +15,7 @@ cd ../../../debug; make ./test.sh -f general/cache/restart_metrics.sim ./test.sh -f general/cache/restart_table.sim -#hongze ./test.sh -f general/column/commit.sim +./test.sh -f general/column/commit.sim ./test.sh -f general/column/metrics.sim ./test.sh -f general/column/table.sim @@ -32,7 +32,7 @@ cd ../../../debug; make ./test.sh -f general/compute/first.sim # liao ./test.sh -f general/compute/interval.sim ./test.sh -f general/compute/last.sim -# liao ./test.sh -f general/compute/leastsquare.sim +./test.sh -f general/compute/leastsquare.sim ./test.sh -f general/compute/max.sim ./test.sh -f general/compute/min.sim ./test.sh -f general/compute/null.sim @@ -59,10 +59,10 @@ cd ../../../debug; make ./test.sh -f general/db/tables.sim ./test.sh -f general/field/2.sim -#liao ./test.sh -f general/field/3.sim -#liao? ./test.sh -f general/field/4.sim -#liao? ./test.sh -f general/field/5.sim -#liao? ./test.sh -f general/field/6.sim +./test.sh -f general/field/3.sim +./test.sh -f general/field/4.sim +./test.sh -f general/field/5.sim +./test.sh -f general/field/6.sim ./test.sh -f general/field/bigint.sim ./test.sh -f general/field/binary.sim ./test.sh -f general/field/bool.sim @@ -98,7 +98,7 @@ cd ../../../debug; make #unsupport ./test.sh -f general/parser/alter1.sim #unsupport ./test.sh -f general/parser/alter_stable.sim ./test.sh -f general/parser/auto_create_tb.sim -#slguan ./test.sh -f general/parser/auto_create_tb_drop_tb.sim +./test.sh -f general/parser/auto_create_tb_drop_tb.sim ./test.sh -f general/parser/col_arithmetic_operation.sim ./test.sh -f general/parser/columnValue.sim ./test.sh -f general/parser/commit.sim @@ -148,7 +148,7 @@ cd ../../../debug; make ./test.sh -f general/stable/disk.sim ./test.sh -f general/stable/metrics.sim -#liao? ./test.sh -f general/stable/values.sim +./test.sh -f general/stable/values.sim ./test.sh -f general/stable/vnode3.sim ./test.sh -f general/table/autocreate.sim @@ -179,10 +179,10 @@ cd ../../../debug; make ./test.sh -f general/table/tinyint.sim ./test.sh -f general/table/vgroup.sim -#liao ./test.sh -f general/tag/3.sim -#liao? ./test.sh -f general/tag/4.sim -#liao? ./test.sh -f general/tag/5.sim -#liao? ./test.sh -f general/tag/6.sim +./test.sh -f general/tag/3.sim +./test.sh -f general/tag/4.sim +./test.sh -f general/tag/5.sim +./test.sh -f general/tag/6.sim #unsupport ./test.sh -f general/tag/add.sim ./test.sh -f general/tag/bigint.sim ./test.sh -f general/tag/binary_binary.sim @@ -195,10 +195,10 @@ cd ../../../debug; make #unsupport ./test.sh -f general/tag/commit.sim ./test.sh -f general/tag/create.sim #unsupport ./test.sh -f general/tag/delete.sim -#./test.sh -f general/tag/double.sim +./test.sh -f general/tag/double.sim ./test.sh -f general/tag/filter.sim -#liao? ./test.sh -f general/tag/float.sim -#liao? ./test.sh -f general/tag/int_binary.sim +./test.sh -f general/tag/float.sim +./test.sh -f general/tag/int_binary.sim ./test.sh -f general/tag/int_float.sim ./test.sh -f general/tag/int.sim #unsupport ./test.sh -f general/tag/set.sim From 174f0354f018c02942d52380734bbbb4c41032c9 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Wed, 13 May 2020 18:36:42 +0800 Subject: [PATCH 029/126] scripts --- tests/script/jenkins/basic.txt | 3 +++ 1 file changed, 3 insertions(+) diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index 44d7f1e8ea..db7a3d6757 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -15,6 +15,8 @@ cd ../../../debug; make ./test.sh -f general/cache/restart_metrics.sim ./test.sh -f general/cache/restart_table.sim +./test.sh -f general/connection/connections.sim + ./test.sh -f general/column/commit.sim ./test.sh -f general/column/metrics.sim ./test.sh -f general/column/table.sim @@ -205,6 +207,7 @@ cd ../../../debug; make ./test.sh -f general/tag/smallint.sim ./test.sh -f general/tag/tinyint.sim +./test.sh -f general/user/authority.sim ./test.sh -f general/user/basic1.sim ./test.sh -f general/user/monitor.sim ./test.sh -f general/user/pass_alter.sim From f95f9ac8c0f58b32d196ad77deedad8bb3d7759a Mon Sep 17 00:00:00 2001 From: changshuaiqiang Date: Wed, 13 May 2020 18:52:46 +0800 Subject: [PATCH 030/126] test: add create table as select case --- tests/pytest/insert/multi.py | 10 +++++-- tests/pytest/table/create.py | 46 ++++++++++++++++++++++++++++++++ tests/pytest/table/del_stable.py | 2 -- 3 files changed, 54 insertions(+), 4 deletions(-) create mode 100644 tests/pytest/table/create.py diff --git a/tests/pytest/insert/multi.py b/tests/pytest/insert/multi.py index 7725ccd210..c14d7dc2e0 100644 --- a/tests/pytest/insert/multi.py +++ b/tests/pytest/insert/multi.py @@ -37,9 +37,15 @@ class TDTestCase: "CREATE TABLE if not exists dev_001 using st tags('dev_01')") print("==============step2") - tdLog.info("multiple inserts") + tdLog.info("multiple inserts by insert") tdSql.execute( - "INSERT INTO dev_001 VALUES ('2020-05-13 10:00:00.000', 1),('2020-05-13 10:00:00.001', 1)") + "insert INTO dev_001 VALUES ('2020-05-13 10:00:00.000', 1),('2020-05-13 10:00:00.001', 1)") + tdSql.checkAffectedRows(2) + + print("==============step3") + tdLog.info("multiple inserts by import") + tdSql.execute( + "import INTO dev_001 VALUES ('2020-05-13 10:00:00.000', 1),('2020-05-13 10:00:00.001', 1)") tdSql.checkAffectedRows(2) def stop(self): diff --git a/tests/pytest/table/create.py b/tests/pytest/table/create.py new file mode 100644 index 0000000000..ac65f1d9d9 --- /dev/null +++ b/tests/pytest/table/create.py @@ -0,0 +1,46 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import tdLog +from util.cases import tdCases +from util.sql import tdSql + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + print("==============step1") + tdSql.execute("create table db.st (ts timestamp, i int) tags(j int)") + tdSql.execute("create table db.tb using st tags(1)") + tdSql.execute("insert into db.tb values(now, 1)") + + print("==============step2") + try: + tdSql.execute("create table db.test as select * from db.st") + except Exception as e: + tdLog.exit(e) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/table/del_stable.py b/tests/pytest/table/del_stable.py index de30e6bdfe..3932f32536 100644 --- a/tests/pytest/table/del_stable.py +++ b/tests/pytest/table/del_stable.py @@ -26,9 +26,7 @@ class TDTestCase: def run(self): tdSql.prepare() - tdSql.execute("drop database if exists db") print("==============step1") - tdSql.execute("create database db") tdSql.execute("create table db.st (ts timestamp, i int) tags(j int)") tdSql.execute("create table db.tb using st tags(1)") tdSql.execute("insert into db.tb values(now, 1)") From 536a1ed4fae0d406ae7c6502f6c7f139952619ca Mon Sep 17 00:00:00 2001 From: changshuaiqiang Date: Wed, 13 May 2020 18:55:34 +0800 Subject: [PATCH 031/126] test: docs --- tests/pytest/table/create.py | 2 ++ 1 file changed, 2 insertions(+) diff --git a/tests/pytest/table/create.py b/tests/pytest/table/create.py index ac65f1d9d9..b456b444f4 100644 --- a/tests/pytest/table/create.py +++ b/tests/pytest/table/create.py @@ -27,11 +27,13 @@ class TDTestCase: tdSql.prepare() print("==============step1") + print("prepare data") tdSql.execute("create table db.st (ts timestamp, i int) tags(j int)") tdSql.execute("create table db.tb using st tags(1)") tdSql.execute("insert into db.tb values(now, 1)") print("==============step2") + print("create table as select") try: tdSql.execute("create table db.test as select * from db.st") except Exception as e: From b9ac23bcefa0eb63b733df58cce0ba97b1da0f6c Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Wed, 13 May 2020 13:55:57 +0000 Subject: [PATCH 032/126] refactor tsdb log format --- src/tsdb/src/tsdbCache.c | 4 ++-- src/tsdb/src/tsdbMain.c | 52 ++++++++++++++++++++-------------------- src/tsdb/src/tsdbMeta.c | 8 +++---- 3 files changed, 32 insertions(+), 32 deletions(-) diff --git a/src/tsdb/src/tsdbCache.c b/src/tsdb/src/tsdbCache.c index 08970eab3e..2761ed5e8e 100644 --- a/src/tsdb/src/tsdbCache.c +++ b/src/tsdb/src/tsdbCache.c @@ -154,7 +154,7 @@ int tsdbAlterCacheTotalBlocks(STsdbRepo *pRepo, int totalBlocks) { for (int i = 0; i < blocksToAdd; i++) { if (tsdbAddCacheBlockToPool(pCache) < 0) { tsdbUnLockRepo((TsdbRepoT *)pRepo); - tsdbError("tsdbId %d: failed to add cache block to cache pool", pRepo->config.tsdbId); + tsdbError("tsdbId:%d, failed to add cache block to cache pool", pRepo->config.tsdbId); return -1; } } @@ -164,7 +164,7 @@ int tsdbAlterCacheTotalBlocks(STsdbRepo *pRepo, int totalBlocks) { } tsdbUnLockRepo((TsdbRepoT *)pRepo); - tsdbTrace("vgId: %d tsdb total cache blocks changed from %d to %d", pRepo->config.tsdbId, oldNumOfBlocks, totalBlocks); + tsdbTrace("vgId:%d, tsdb total cache blocks changed from %d to %d", pRepo->config.tsdbId, oldNumOfBlocks, totalBlocks); return 0; } diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index fb25e9dcd9..c85f5cc838 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -91,7 +91,7 @@ void tsdbFreeCfg(STsdbCfg *pCfg) { int32_t tsdbCreateRepo(char *rootDir, STsdbCfg *pCfg, void *limiter /* TODO */) { if (mkdir(rootDir, 0755) != 0) { - tsdbError("id %d: failed to create rootDir! rootDir %s, reason %s", pCfg->tsdbId, rootDir, strerror(errno)); + tsdbError("vgId:%d, failed to create rootDir! rootDir:%s, reason:%s", pCfg->tsdbId, rootDir, strerror(errno)); if (errno == EACCES) { return TSDB_CODE_NO_DISK_PERMISSIONS; } else if (errno == ENOSPC) { @@ -150,7 +150,7 @@ int32_t tsdbDropRepo(TsdbRepoT *repo) { free(pRepo->rootDir); free(pRepo); - tsdbTrace("vgId: %d tsdb repository is dropped!", id); + tsdbTrace("vgId:%d, tsdb repository is dropped!", id); return 0; } @@ -242,7 +242,7 @@ TsdbRepoT *tsdbOpenRepo(char *tsdbDir, STsdbAppH *pAppH) { pRepo->state = TSDB_REPO_STATE_ACTIVE; - tsdbTrace("vgId: %d open tsdb repository successfully!", pRepo->config.tsdbId); + tsdbTrace("vgId:%d, open tsdb repository successfully!", pRepo->config.tsdbId); return (TsdbRepoT *)pRepo; } @@ -296,7 +296,7 @@ int32_t tsdbCloseRepo(TsdbRepoT *repo) { tfree(pRepo->rootDir); tfree(pRepo); - tsdbTrace("vgId: %d repository is closed!", id); + tsdbTrace("vgId:%d, repository is closed!", id); return 0; } @@ -358,7 +358,7 @@ int32_t tsdbTriggerCommit(TsdbRepoT *repo) { pthread_attr_init(&thattr); pthread_attr_setdetachstate(&thattr, PTHREAD_CREATE_DETACHED); pthread_create(&(pRepo->commitThread), &thattr, tsdbCommitData, (void *)repo); - tsdbTrace("vgId: %d start to commit!", pRepo->config.tsdbId); + tsdbTrace("vgId:%d, start to commit!", pRepo->config.tsdbId); return 0; } @@ -611,7 +611,7 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg) { pCfg->precision = TSDB_DEFAULT_PRECISION; } else { if (!IS_VALID_PRECISION(pCfg->precision)) { - tsdbError("id %d: invalid precision configuration! precision %d", pCfg->tsdbId, pCfg->precision); + tsdbError("vgId:%d, invalid precision configuration! precision:%d", pCfg->tsdbId, pCfg->precision); return -1; } } @@ -621,7 +621,7 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg) { pCfg->compression = TSDB_DEFAULT_COMPRESSION; } else { if (!IS_VALID_COMPRESSION(pCfg->compression)) { - tsdbError("id %d: invalid compression configuration! compression %d", pCfg->tsdbId, pCfg->precision); + tsdbError("vgId:%d: invalid compression configuration! compression:%d", pCfg->tsdbId, pCfg->precision); return -1; } } @@ -634,7 +634,7 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg) { pCfg->maxTables = TSDB_DEFAULT_TABLES; } else { if (pCfg->maxTables < TSDB_MIN_TABLES || pCfg->maxTables > TSDB_MAX_TABLES) { - tsdbError("id %d: invalid maxTables configuration! maxTables %d TSDB_MIN_TABLES %d TSDB_MAX_TABLES %d", + tsdbError("vgId:%d: invalid maxTables configuration! maxTables:%d TSDB_MIN_TABLES:%d TSDB_MAX_TABLES:%d", pCfg->tsdbId, pCfg->maxTables, TSDB_MIN_TABLES, TSDB_MAX_TABLES); return -1; } @@ -646,7 +646,7 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg) { } else { if (pCfg->daysPerFile < TSDB_MIN_DAYS_PER_FILE || pCfg->daysPerFile > TSDB_MAX_DAYS_PER_FILE) { tsdbError( - "id %d: invalid daysPerFile configuration! daysPerFile %d TSDB_MIN_DAYS_PER_FILE %d TSDB_MAX_DAYS_PER_FILE " + "vgId:%d, invalid daysPerFile configuration! daysPerFile:%d TSDB_MIN_DAYS_PER_FILE:%d TSDB_MAX_DAYS_PER_FILE:" "%d", pCfg->tsdbId, pCfg->daysPerFile, TSDB_MIN_DAYS_PER_FILE, TSDB_MAX_DAYS_PER_FILE); return -1; @@ -659,8 +659,8 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg) { } else { if (pCfg->minRowsPerFileBlock < TSDB_MIN_MIN_ROW_FBLOCK || pCfg->minRowsPerFileBlock > TSDB_MAX_MIN_ROW_FBLOCK) { tsdbError( - "id %d: invalid minRowsPerFileBlock configuration! minRowsPerFileBlock %d TSDB_MIN_MIN_ROW_FBLOCK %d " - "TSDB_MAX_MIN_ROW_FBLOCK %d", + "vgId:%d, invalid minRowsPerFileBlock configuration! minRowsPerFileBlock:%d TSDB_MIN_MIN_ROW_FBLOCK:%d " + "TSDB_MAX_MIN_ROW_FBLOCK:%d", pCfg->tsdbId, pCfg->minRowsPerFileBlock, TSDB_MIN_MIN_ROW_FBLOCK, TSDB_MAX_MIN_ROW_FBLOCK); return -1; } @@ -671,8 +671,8 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg) { } else { if (pCfg->maxRowsPerFileBlock < TSDB_MIN_MAX_ROW_FBLOCK || pCfg->maxRowsPerFileBlock > TSDB_MAX_MAX_ROW_FBLOCK) { tsdbError( - "id %d: invalid maxRowsPerFileBlock configuration! maxRowsPerFileBlock %d TSDB_MIN_MAX_ROW_FBLOCK %d " - "TSDB_MAX_MAX_ROW_FBLOCK %d", + "vgId:%d, invalid maxRowsPerFileBlock configuration! maxRowsPerFileBlock:%d TSDB_MIN_MAX_ROW_FBLOCK:%d " + "TSDB_MAX_MAX_ROW_FBLOCK:%d", pCfg->tsdbId, pCfg->maxRowsPerFileBlock, TSDB_MIN_MIN_ROW_FBLOCK, TSDB_MAX_MIN_ROW_FBLOCK); return -1; } @@ -686,8 +686,8 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg) { } else { if (pCfg->keep < TSDB_MIN_KEEP || pCfg->keep > TSDB_MAX_KEEP) { tsdbError( - "id %d: invalid keep configuration! keep %d TSDB_MIN_KEEP %d " - "TSDB_MAX_KEEP %d", + "vgId:%d, invalid keep configuration! keep:%d TSDB_MIN_KEEP:%d " + "TSDB_MAX_KEEP:%d", pCfg->tsdbId, pCfg->keep, TSDB_MIN_KEEP, TSDB_MAX_KEEP); return -1; } @@ -754,13 +754,13 @@ static int32_t tsdbSetRepoEnv(STsdbRepo *pRepo) { if (tsdbGetDataDirName(pRepo, dirName) < 0) return -1; if (mkdir(dirName, 0755) < 0) { - tsdbError("vgId: %d failed to create repository directory! reason %s", pRepo->config.tsdbId, strerror(errno)); + tsdbError("vgId:%d, failed to create repository directory! reason:%s", pRepo->config.tsdbId, strerror(errno)); return -1; } tsdbTrace( - "vgId: %d set up tsdb environment succeed! cacheBlockSize %d, totalBlocks %d, maxTables %d, daysPerFile %d, keep " - "%d, minRowsPerFileBlock %d, maxRowsPerFileBlock %d, precision %d, compression%d", + "vgId:%d, set up tsdb environment succeed! cacheBlockSize:%d, totalBlocks:%d, maxTables:%d, daysPerFile:%d, keep:" + "%d, minRowsPerFileBlock:%d, maxRowsPerFileBlock:%d, precision:%d, compression:%d", pRepo->config.tsdbId, pCfg->cacheBlockSize, pCfg->totalBlocks, pCfg->maxTables, pCfg->daysPerFile, pCfg->keep, pCfg->minRowsPerFileBlock, pCfg->maxRowsPerFileBlock, pCfg->precision, pCfg->compression); return 0; @@ -840,7 +840,7 @@ static int32_t tdInsertRowToTable(STsdbRepo *pRepo, SDataRow row, STable *pTable pTable->mem->numOfPoints = tSkipListGetSize(pTable->mem->pData); - tsdbTrace("vgId: %d, tid: %d, uid: " PRId64 "a row is inserted to table! key" PRId64, + tsdbTrace("vgId:%d, tid:%d, uid:" PRId64 ", a row is inserted to table! key:" PRId64, pRepo->config.tsdbId, pTable->tableId.tid, pTable->tableId.uid, dataRowKey(row)); return 0; @@ -852,7 +852,7 @@ static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY STableId tableId = {.uid = pBlock->uid, .tid = pBlock->tid}; STable *pTable = tsdbIsValidTableToInsert(pRepo->tsdbMeta, tableId); if (pTable == NULL) { - tsdbError("id %d: failed to get table for insert, uid:%" PRIu64 ", tid:%d", pRepo->config.tsdbId, pBlock->uid, + tsdbError("vgId:%d, failed to get table for insert, uid:" PRIu64 ", tid:%d", pRepo->config.tsdbId, pBlock->uid, pBlock->tid); return TSDB_CODE_INVALID_TABLE_ID; } @@ -866,9 +866,9 @@ static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY tsdbInitSubmitBlkIter(pBlock, &blkIter); while ((row = tsdbGetSubmitBlkNext(&blkIter)) != NULL) { if (dataRowKey(row) < minKey || dataRowKey(row) > maxKey) { - tsdbError( - "tsdbId: %d, table tid: %d, talbe uid: %ld timestamp is out of range. now: %ld maxKey: %ld, minKey: %ld", - pRepo->config.tsdbId, pTable->tableId.tid, pTable->tableId.uid, now, minKey, maxKey); + tsdbError("vgId:%d, table tid:%d, talbe uid:%ld timestamp is out of range. now:" PRId64 ", maxKey:" PRId64 + ", minKey:" PRId64, + pRepo->config.tsdbId, pTable->tableId.tid, pTable->tableId.uid, now, minKey, maxKey); return TSDB_CODE_TIMESTAMP_OUT_OF_RANGE; } @@ -1109,7 +1109,7 @@ static int tsdbHasDataToCommit(SSkipListIterator **iters, int nIters, TSKEY minK static void tsdbAlterCompression(STsdbRepo *pRepo, int8_t compression) { int8_t oldCompRession = pRepo->config.compression; pRepo->config.compression = compression; - tsdbTrace("vgId: %d tsdb compression is changed from %d to %d", oldCompRession, compression); + tsdbTrace("vgId:%d, tsdb compression is changed from %d to %d", oldCompRession, compression); } static void tsdbAlterKeep(STsdbRepo *pRepo, int32_t keep) { @@ -1126,13 +1126,13 @@ static void tsdbAlterKeep(STsdbRepo *pRepo, int32_t keep) { } pRepo->tsdbFileH->maxFGroups = maxFiles; } - tsdbTrace("vgId: %d keep is changed from %d to %d", pRepo->config.tsdbId, oldKeep, keep); + tsdbTrace("vgId:%d, keep is changed from %d to %d", pRepo->config.tsdbId, oldKeep, keep); } static void tsdbAlterMaxTables(STsdbRepo *pRepo, int32_t maxTables) { // TODO int oldMaxTables = pRepo->config.maxTables; - tsdbTrace("vgId: %d tsdb maxTables is changed from %d to %d!", pRepo->config.tsdbId, oldMaxTables, maxTables); + tsdbTrace("vgId:%d, tsdb maxTables is changed from %d to %d!", pRepo->config.tsdbId, oldMaxTables, maxTables); } uint32_t tsdbGetFileInfo(TsdbRepoT *repo, char *name, uint32_t *index, int32_t *size) { diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index d5ba605e1a..59d776c0ba 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -356,11 +356,11 @@ int tsdbCreateTable(TsdbRepoT *repo, STableCfg *pCfg) { // Register to meta if (newSuper) { tsdbAddTableToMeta(pMeta, super, true); - tsdbTrace("vgId: %d super table is created! uid " PRId64, pRepo->config.tsdbId, + tsdbTrace("vgId:%d, super table is created! uid:" PRId64, pRepo->config.tsdbId, super->tableId.uid); } tsdbAddTableToMeta(pMeta, table, true); - tsdbTrace("vgId: %d table is created! tid %d, uid " PRId64, pRepo->config.tsdbId, table->tableId.tid, + tsdbTrace("vgId:%d, table is created! tid:%d, uid:" PRId64, pRepo->config.tsdbId, table->tableId.tid, table->tableId.uid); // Write to meta file @@ -404,12 +404,12 @@ int tsdbDropTable(TsdbRepoT *repo, STableId tableId) { STable *pTable = tsdbGetTableByUid(pMeta, tableId.uid); if (pTable == NULL) { - tsdbError("vgId %d: failed to drop table since table not exists! tid %d, uid " PRId64, pRepo->config.tsdbId, + tsdbError("vgId:%d, failed to drop table since table not exists! tid:%d, uid:" PRId64, pRepo->config.tsdbId, tableId.tid, tableId.uid); return -1; } - tsdbTrace("vgId: %d table is dropped! tid %d, uid " PRId64, pRepo->config.tsdbId, tableId.tid, tableId.uid); + tsdbTrace("vgId:%d, table is dropped! tid:%d, uid:" PRId64, pRepo->config.tsdbId, tableId.tid, tableId.uid); if (tsdbRemoveTableFromMeta(pMeta, pTable) < 0) return -1; return 0; From 431998ee42c714175bd6a9053d9cc5d29cfa5fba Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Thu, 14 May 2020 05:32:41 +0000 Subject: [PATCH 033/126] add to commit option to tsdbCloseRepo --- src/inc/tsdb.h | 2 +- src/tsdb/src/tsdbMain.c | 29 ++++++++++++++++++++++------- src/vnode/src/vnodeMain.c | 4 ++-- 3 files changed, 25 insertions(+), 10 deletions(-) diff --git a/src/inc/tsdb.h b/src/inc/tsdb.h index 32e3541692..2c774922a5 100644 --- a/src/inc/tsdb.h +++ b/src/inc/tsdb.h @@ -72,7 +72,7 @@ typedef void TsdbRepoT; // use void to hide implementation details from outside int tsdbCreateRepo(char *rootDir, STsdbCfg *pCfg, void *limiter); int32_t tsdbDropRepo(TsdbRepoT *repo); TsdbRepoT *tsdbOpenRepo(char *tsdbDir, STsdbAppH *pAppH); -int32_t tsdbCloseRepo(TsdbRepoT *repo); +int32_t tsdbCloseRepo(TsdbRepoT *repo, int toCommit); int32_t tsdbConfigRepo(TsdbRepoT *repo, STsdbCfg *pCfg); // --------- TSDB TABLE DEFINITION diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index c85f5cc838..41837eab5f 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -258,7 +258,7 @@ TsdbRepoT *tsdbOpenRepo(char *tsdbDir, STsdbAppH *pAppH) { * * @return 0 for success, -1 for failure and the error number is set */ -int32_t tsdbCloseRepo(TsdbRepoT *repo) { +int32_t tsdbCloseRepo(TsdbRepoT *repo, int toCommit) { STsdbRepo *pRepo = (STsdbRepo *)repo; if (pRepo == NULL) return 0; int id = pRepo->config.tsdbId; @@ -285,7 +285,7 @@ int32_t tsdbCloseRepo(TsdbRepoT *repo) { tsdbUnLockRepo(repo); if (pRepo->appH.notifyStatus) pRepo->appH.notifyStatus(pRepo->appH.appH, TSDB_STATUS_COMMIT_START); - tsdbCommitData((void *)repo); + if (toCommit) tsdbCommitData((void *)repo); tsdbCloseFileH(pRepo->tsdbFileH); @@ -1018,10 +1018,16 @@ static int tsdbCommitToFile(STsdbRepo *pRepo, int fid, SSkipListIterator **iters // Create and open files for commit tsdbGetDataDirName(pRepo, dataDir); - if ((pGroup = tsdbCreateFGroup(pFileH, dataDir, fid, pCfg->maxTables)) == NULL) goto _err; + if ((pGroup = tsdbCreateFGroup(pFileH, dataDir, fid, pCfg->maxTables)) == NULL) { + tsdbError("vgId:%d, failed to create file group %d", pRepo->config.tsdbId, fid); + goto _err; + } // Open files for write/read - if (tsdbSetAndOpenHelperFile(pHelper, pGroup) < 0) goto _err; + if (tsdbSetAndOpenHelperFile(pHelper, pGroup) < 0) { + tsdbError("vgId:%d, failed to set helper file", pRepo->config.tsdbId); + goto _err; + } // Loop to commit data in each table for (int tid = 1; tid < pCfg->maxTables; tid++) { @@ -1058,13 +1064,22 @@ static int tsdbCommitToFile(STsdbRepo *pRepo, int fid, SSkipListIterator **iters ASSERT(pDataCols->numOfPoints == 0); // Move the last block to the new .l file if neccessary - if (tsdbMoveLastBlockIfNeccessary(pHelper) < 0) goto _err; + if (tsdbMoveLastBlockIfNeccessary(pHelper) < 0) { + tsdbError("vgId:%d, failed to move last block", pRepo->config.tsdbId); + goto _err; + } // Write the SCompBlock part - if (tsdbWriteCompInfo(pHelper) < 0) goto _err; + if (tsdbWriteCompInfo(pHelper) < 0) { + tsdbError("vgId:%d, failed to write compInfo part", pRepo->config.tsdbId); + goto _err; + } } - if (tsdbWriteCompIdx(pHelper) < 0) goto _err; + if (tsdbWriteCompIdx(pHelper) < 0) { + tsdbError("vgId:%d, failed to write compIdx part", pRepo->config.tsdbId); + goto _err; + } tsdbCloseHelperFile(pHelper, 0); // TODO: make it atomic with some methods diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index 838b9d290f..e9f0372752 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -376,7 +376,7 @@ static void vnodeCleanUp(SVnodeObj *pVnode) { cqClose(pVnode->cq); pVnode->cq = NULL; - tsdbCloseRepo(pVnode->tsdb); + tsdbCloseRepo(pVnode->tsdb, 1); pVnode->tsdb = NULL; walClose(pVnode->wal); @@ -427,7 +427,7 @@ static void vnodeNotifyFileSynced(void *ahandle) { char rootDir[128] = "\0"; sprintf(rootDir, "%s/tsdb", pVnode->rootDir); // clsoe tsdb, then open tsdb - tsdbCloseRepo(pVnode->tsdb); + tsdbCloseRepo(pVnode->tsdb, 0); STsdbAppH appH = {0}; appH.appH = (void *)pVnode; appH.notifyStatus = vnodeProcessTsdbStatus; From bc5abd0f2fe7f8640301d0aa0e114bebd35e2227 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Thu, 14 May 2020 14:42:35 +0800 Subject: [PATCH 034/126] add some test cases to test boundary which defined in inc/taosdef.h [TD-221] --- tests/pytest/insert/binary-boundary.py | 72 +++ tests/pytest/insert/nchar-boundary.py | 51 ++ tests/pytest/insert/nchar-unicode.py | 573 +++++++++++++++++++++++ tests/pytest/table/tablename-boundary.py | 36 ++ 4 files changed, 732 insertions(+) create mode 100644 tests/pytest/insert/binary-boundary.py create mode 100644 tests/pytest/insert/nchar-boundary.py create mode 100644 tests/pytest/insert/nchar-unicode.py create mode 100644 tests/pytest/table/tablename-boundary.py diff --git a/tests/pytest/insert/binary-boundary.py b/tests/pytest/insert/binary-boundary.py new file mode 100644 index 0000000000..9211c4ae89 --- /dev/null +++ b/tests/pytest/insert/binary-boundary.py @@ -0,0 +1,72 @@ +# -*- coding: utf-8 -*- + +import sys +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + tdLog.info('=============== step1') + tdLog.info('create table tb (ts timestamp, speed binary(4089))') + tdSql.error('create table tb (ts timestamp, speed binary(4089))') + tdLog.info('create table tb (ts timestamp, speed binary(4088))') + tdSql.error('create table tb (ts timestamp, speed binary(4088))') + tdLog.info('create table tb (ts timestamp, speed binary(4084))') + tdSql.execute('create table tb (ts timestamp, speed binary(4084))') + tdLog.info("insert into tb values (now, ) -x step1") + tdSql.error("insert into tb values (now, )") + + with open("../../README.md", "r") as inputFile: + data = inputFile.read(4084).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + + tdLog.info("insert %d length data: %s" % (len(data), data)) + + tdLog.info("insert into tb values (now+2a, data)") + tdSql.execute("insert into tb values (now+2a, '%s')" % data) + tdLog.info('select speed from tb order by ts desc') + tdSql.query('select speed from tb order by ts desc') + tdLog.info('tdSql.checkRow(1)') + tdSql.checkRows(1) + tdLog.info('==> $data01') + tdLog.info("tdSql.checkData(0, 1, '%s')" % data) + tdSql.checkData(0, 1, data) + + tdLog.info('create table tb2 (ts timestamp, speed binary(2040), temp binary(2044))') + tdSql.execute('create table tb2 (ts timestamp, speed binary(2040), temp binary(2044))') + speed = inputFile.read(2044).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + temp = inputFile.read(2040).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + tdLog.info("insert into tb values (now+3a, speed, temp)") + tdSql.error("insert into tb values (now+3a, '%s', '%s')" % (speed, temp)) + + speed = inputFile.read(2040).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + temp = inputFile.read(2044).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + tdLog.info("insert into tb values (now+4a, speed, temp)") + tdSql.error("insert into tb values (now+4a, '%s', '%s')" % (speed, temp)) + + tdLog.info('tdSql.checkRow(2)') + tdSql.checkRows(2) + tdLog.info('==> $data11') + tdLog.info("tdSql.checkData(1, 1, '%s')" % speed) + tdSql.checkData(1, 1, speed) + + tdLog.info('==> $data12') + tdLog.info("tdSql.checkData(1, 2, '%s')" % temp) + tdSql.checkData(1, 1, temp) + + inputFile.close() + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/insert/nchar-boundary.py b/tests/pytest/insert/nchar-boundary.py new file mode 100644 index 0000000000..33f7a5a30b --- /dev/null +++ b/tests/pytest/insert/nchar-boundary.py @@ -0,0 +1,51 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + tdSql.error('create table tb (ts timestamp, col nchar(1022))') + tdSql.execute('create table tb (ts timestamp, col nchar(1021))') + tdSql.execute("insert into tb values (now, 'taosdata')") + tdSql.query("select * from tb") + tdSql.checkRows(1) + tdSql.checkData(0, 1, 'taosdata') + + with open("../../README.md", "r") as inputFile: + data = inputFile.read(1021).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + + tdLog.info("insert %d length data: %s" % (len(data), data)) + + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(2) + tdSql.checkData(1, 1, data) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/insert/nchar-unicode.py b/tests/pytest/insert/nchar-unicode.py new file mode 100644 index 0000000000..8ddfd4e53a --- /dev/null +++ b/tests/pytest/insert/nchar-unicode.py @@ -0,0 +1,573 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + tdSql.error('create table tb (ts timestamp, col nchar(1022))') + tdSql.execute('create table tb (ts timestamp, col nchar(1021))') + tdSql.execute("insert into tb values (now, 'taosdata')") + tdSql.query("select * from tb") + tdSql.checkRows(1) + tdSql.checkData(0, 1, 'taosdata') + + with open("../../README.md", "r") as inputFile: + data = inputFile.read(1021).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + + tdLog.info("insert %d length data: %s" % (len(data), data)) + + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(2) + tdSql.checkData(1, 1, data) + + # https://www.ltg.ed.ac.uk/~richard/unicode-sample.html + # Basic Latin + data = '! # $ % & ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ? @ A B C D E F G H I J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _ ` a b c d e f g h i j k l m n o p q r s t u v w x y z { | } ~' + tdLog.info("insert Basic Latin %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(3) + tdSql.checkData(2, 1, data) + + # Latin-1 Supplement + data = ' ¡ ¢ £ ¤ ¥ ¦ § ¨ © ª « ¬ ­ ® ¯ ° ± ² ³ ´ µ ¶ · ¸ ¹ º » ¼ ½ ¾ ¿ À Á Â Ã Ä Å Æ Ç È É Ê Ë Ì Í Î Ï Ð Ñ Ò Ó Ô Õ Ö × Ø Ù Ú Û Ü Ý Þ ß à á â ã ä å æ ç è é ê ë ì í î ï ð ñ ò ó ô õ ö ÷ ø ù ú û ü ý þ ÿ' + tdLog.info("insert Latin-1 Supplement %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(4) + tdSql.checkData(3, 1, data) + + # Latin Extended-A + data = 'Ā ā Ă ă Ą ą Ć ć Ĉ ĉ Ċ ċ Č č Ď ď Đ đ Ē ē Ĕ ĕ Ė ė Ę ę Ě ě Ĝ ĝ Ğ ğ Ġ ġ Ģ ģ Ĥ ĥ Ħ ħ Ĩ ĩ Ī ī Ĭ ĭ Į į İ ı IJ ij Ĵ ĵ Ķ ķ ĸ Ĺ ĺ Ļ ļ Ľ ľ Ŀ ŀ Ł ł Ń ń Ņ ņ Ň ň ʼn Ŋ ŋ Ō ō Ŏ ŏ Ő ő Œ œ Ŕ ŕ Ŗ ŗ Ř ř Ś ś Ŝ ŝ Ş ş Š š Ţ ţ Ť ť Ŧ ŧ Ũ ũ Ū ū Ŭ ŭ Ů ů Ű ű Ų ų Ŵ ŵ Ŷ ŷ Ÿ Ź ź Ż ż Ž ž ſ' + tdLog.info("insert Latin Extended-A %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(5) + tdSql.checkData(4, 1, data) + + # Latin Extended-B + data = 'ƀ Ɓ Ƃ ƃ Ƅ ƅ Ɔ Ƈ ƈ Ɖ Ɗ Ƌ ƌ ƍ Ǝ Ə Ɛ Ƒ ƒ Ɠ Ɣ ƕ Ɩ Ɨ Ƙ ƙ ƚ ƛ Ɯ Ɲ ƞ Ɵ Ơ ơ Ƣ ƣ Ƥ ƥ Ʀ Ƨ ƨ Ʃ ƪ ƫ Ƭ ƭ Ʈ Ư ư Ʊ Ʋ Ƴ ƴ Ƶ ƶ Ʒ Ƹ ƹ ƺ ƻ Ƽ ƽ ƾ ƿ ǀ ǁ ǂ ǃ DŽ Dž dž LJ Lj lj NJ Nj nj Ǎ ǎ Ǐ ǐ Ǒ ǒ Ǔ ǔ Ǖ ǖ Ǘ ǘ Ǚ ǚ Ǜ ǜ ǝ Ǟ ǟ Ǡ ǡ Ǣ ǣ Ǥ ǥ Ǧ ǧ Ǩ ǩ Ǫ ǫ Ǭ ǭ Ǯ ǯ ǰ DZ Dz dz Ǵ ǵ Ǻ ǻ Ǽ ǽ Ǿ ǿ Ȁ ȁ Ȃ ȃ ...' + tdLog.info("insert Latin Extended-B %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(6) + tdSql.checkData(5, 1, data) + + # IPA Extensions + data = 'ɐ ɑ ɒ ɓ ɔ ɕ ɖ ɗ ɘ ə ɚ ɛ ɜ ɝ ɞ ɟ ɠ ɡ ɢ ɣ ɤ ɥ ɦ ɧ ɨ ɩ ɪ ɫ ɬ ɭ ɮ ɯ ɰ ɱ ɲ ɳ ɴ ɵ ɶ ɷ ɸ ɹ ɺ ɻ ɼ ɽ ɾ ɿ ʀ ʁ ʂ ʃ ʄ ʅ ʆ ʇ ʈ ʉ ʊ ʋ ʌ ʍ ʎ ʏ ʐ ʑ ʒ ʓ ʔ ʕ ʖ ʗ ʘ ʙ ʚ ʛ ʜ ʝ ʞ ʟ ʠ ʡ ʢ ʣ ʤ ʥ ʦ ʧ ʨ' + tdLog.info("insert IPA Extensions %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(7) + tdSql.checkData(6, 1, data) + + # Spacing Modifier Letters + data = 'ʰ ʱ ʲ ʳ ʴ ʵ ʶ ʷ ʸ ʹ ʺ ʻ ʼ ʽ ʾ ʿ ˀ ˁ ˂ ˃ ˄ ˅ ˆ ˇ ˈ ˉ ˊ ˋ ˌ ˍ ˎ ˏ ː ˑ ˒ ˓ ˔ ˕ ˖ ˗ ˘ ˙ ˚ ˛ ˜ ˝ ˞ ˠ ˡ ˢ ˣ ˤ ˥ ˦ ˧ ˨ ˩' + tdLog.info("insert Spacing Modifier Letters %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(8) + tdSql.checkData(7, 1, data) + + # Combining Diacritical Marks + data = '̀ ́ ̂ ̃ ̄ ̅ ̆ ̇ ̈ ̉ ̊ ̋ ̌ ̍ ̎ ̏ ̐ ̑ ̒ ̓ ̔ ̕ ̖ ̗ ̘ ̙ ̚ ̛ ̜ ̝ ̞ ̟ ̠ ̡ ̢ ̣ ̤ ̥ ̦ ̧ ̨ ̩ ̪ ̫ ̬ ̭ ̮ ̯ ̰ ̱ ̲ ̳ ̴ ̵ ̶ ̷ ̸ ̹ ̺ ̻ ̼ ̽ ̾ ̿ ̀ ́ ͂ ̓ ̈́ ͅ ͠ ͡' + tdLog.info("insert Combining Diacritical Marks %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(9) + tdSql.checkData(8, 1, data) + + # Greek + data = 'ʹ ͵ ͺ ; ΄ ΅ Ά · Έ Ή Ί Ό Ύ Ώ ΐ Α Β Γ Δ Ε Ζ Η Θ Ι Κ Λ Μ Ν Ξ Ο Π Ρ Σ Τ Υ Φ Χ Ψ Ω Ϊ Ϋ ά έ ή ί ΰ α β γ δ ε ζ η θ ι κ λ μ ν ξ ο π ρ ς σ τ υ φ χ ψ ω ϊ ϋ ό ύ ώ ϐ ϑ ϒ ϓ ϔ ϕ ϖ Ϛ Ϝ Ϟ Ϡ Ϣ ϣ Ϥ ϥ Ϧ ϧ Ϩ ϩ Ϫ ϫ Ϭ ϭ Ϯ ϯ ϰ ϱ ϲ ϳ' + tdLog.info("insert Greek %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(10) + tdSql.checkData(9, 1, data) + + # Cyrillic + data = 'Ё Ђ Ѓ Є Ѕ І Ї Ј Љ Њ Ћ Ќ Ў Џ А Б В Г Д Е Ж З И Й К Л М Н О П Р С Т У Ф Х Ц Ч Ш Щ Ъ Ы Ь Э Ю Я а б в г д е ж з и й к л м н о п р с т у ф х ц ч ш щ ъ ы ь э ю я ё ђ ѓ є ѕ і ї ј љ њ ћ ќ ў џ Ѡ ѡ Ѣ ѣ Ѥ ѥ Ѧ ѧ Ѩ ѩ Ѫ ѫ Ѭ ѭ Ѯ ѯ Ѱ ѱ Ѳ ѳ Ѵ ѵ Ѷ ѷ Ѹ ѹ Ѻ ѻ Ѽ ѽ Ѿ ѿ Ҁ ҁ ҂ ҃ ...' + tdLog.info("insert Cyrillic %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(11) + tdSql.checkData(10, 1, data) + + # Armenian + data = 'Ա Բ Գ Դ Ե Զ Է Ը Թ Ժ Ի Լ Խ Ծ Կ Հ Ձ Ղ Ճ Մ Յ Ն Շ Ո Չ Պ Ջ Ռ Ս Վ Տ Ր Ց Ւ Փ Ք Օ Ֆ ՙ ՚ ՛ ՜ ՝ ՞ ՟ ա բ գ դ ե զ է ը թ ժ ի լ խ ծ կ հ ձ ղ ճ մ յ ն շ ո չ պ ջ ռ ս վ տ ր ց ւ փ ք օ ֆ և ։' + tdLog.info("insert Armenian %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(12) + tdSql.checkData(11, 1, data) + + # Hebrew + data = ' ֒ ֓ ֔ ֕ ֖ ֗ ֘ ֙ ֚ ֛ ֜ ֝ ֞ ֟ ֠ ֡ ֣ ֤ ֥ ֦ ֧ ֨ ֩ ֪ ֫ ֬ ֭ ֮ ֯ ְ ֱ ֲ ֳ ִ ֵ ֶ ַ ָ ֹ ֻ ּ ֽ ־ ֿ ׀ ׁ ׂ ׃ ׄ א ב ג ד ה ו ז ח ט י ך כ ל ם מ ן נ ס ע ף פ ץ צ ק ר ש ת װ ױ ײ ׳ ״' + tdLog.info("insert Hebrew %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(13) + tdSql.checkData(12, 1, data) + + # Arabic + data = '، ؛ ؟ ء آ أ ؤ إ ئ ا ب ة ت ث ج ح خ د ذ ر ز س ش ص ض ط ظ ع غ ـ ف ق ك ل م ن ه و ى ي ً ٌ ٍ َ ُ ِ ّ ْ ٠ ١ ٢ ٣ ٤ ٥ ٦ ٧ ٨ ٩ ٪ ٫ ٬ ٭ ٰ ٱ ٲ ٳ ٴ ٵ ٶ ٷ ٸ ٹ ٺ ٻ ټ ٽ پ ٿ ڀ ځ ڂ ڃ ڄ څ چ ڇ ڈ ډ ڊ ڋ ڌ ڍ ڎ ڏ ڐ ڑ ڒ ړ ڔ ڕ ږ ڗ ژ ڙ ښ ڛ ڜ ڝ ڞ ڟ ڠ ڡ ڢ ڣ ڤ ڥ ڦ ڧ ڨ ک ڪ ګ ڬ ڭ ڮ گ ڰ ڱ ...' + tdLog.info("FAILED: insert Arabic %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(14) + tdSql.checkData(13, 1, data) + + # Devanagari + data = 'ँ ं ः अ आ इ ई उ ऊ ऋ ऌ ऍ ऎ ए ऐ ऑ ऒ ओ औ क ख ग घ ङ च छ ज झ ञ ट ठ ड ढ ण त थ द ध न ऩ प फ ब भ म य र ऱ ल ळ ऴ व श ष स ह ़ ऽ ा ि ी ु ू ृ ॄ ॅ ॆ े ै ॉ ॊ ो ौ ् ॐ ॑ ॒ ॓ ॔ क़ ख़ ग़ ज़ ड़ ढ़ फ़ य़ ॠ ॡ ॢ ॣ । ॥ ० १ २ ३ ४ ५ ६ ७ ८ ९ ॰' + tdLog.info("insert Devanagari %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(15) + tdSql.checkData(14, 1, data) + + # Bengali + data = 'ঁ ং ঃ অ আ ই ঈ উ ঊ ঋ ঌ এ ঐ ও ঔ ক খ গ ঘ ঙ চ ছ জ ঝ ঞ ট ঠ ড ঢ ণ ত থ দ ধ ন প ফ ব ভ ম য র ল শ ষ স হ ় া ি ী ু ূ ৃ ৄ ে ৈ ো ৌ ্ ৗ ড় ঢ় য় ৠ ৡ ৢ ৣ ০ ১ ২ ৩ ৪ ৫ ৬ ৭ ৮ ৯ ৰ ৱ ৲ ৳ ৴ ৵ ৶ ৷ ৸ ৹ ৺' + tdLog.info("insert Bengali %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(16) + tdSql.checkData(15, 1, data) + + # Gurmukhi + data = 'ਂ ਅ ਆ ਇ ਈ ਉ ਊ ਏ ਐ ਓ ਔ ਕ ਖ ਗ ਘ ਙ ਚ ਛ ਜ ਝ ਞ ਟ ਠ ਡ ਢ ਣ ਤ ਥ ਦ ਧ ਨ ਪ ਫ ਬ ਭ ਮ ਯ ਰ ਲ ਲ਼ ਵ ਸ਼ ਸ ਹ ਼ ਾ ਿ ੀ ੁ ੂ ੇ ੈ ੋ ੌ ੍ ਖ਼ ਗ਼ ਜ਼ ੜ ਫ਼ ੦ ੧ ੨ ੩ ੪ ੫ ੬ ੭ ੮ ੯ ੰ ੱ ੲ ੳ ੴ' + tdLog.info("insert Gurmukhi %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(17) + tdSql.checkData(16, 1, data) + + # Gujarati + data = 'ઁ ં ઃ અ આ ઇ ઈ ઉ ઊ ઋ ઍ એ ઐ ઑ ઓ ઔ ક ખ ગ ઘ ઙ ચ છ જ ઝ ઞ ટ ઠ ડ ઢ ણ ત થ દ ધ ન પ ફ બ ભ મ ય ર લ ળ વ શ ષ સ હ ઼ ઽ ા િ ી ુ ૂ ૃ ૄ ૅ ે ૈ ૉ ો ૌ ્ ૐ ૠ ૦ ૧ ૨ ૩ ૪ ૫ ૬ ૭ ૮ ૯' + tdLog.info("insert Gujarati %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(18) + tdSql.checkData(17, 1, data) + + # Oriya + data = 'ଁ ଂ ଃ ଅ ଆ ଇ ଈ ଉ ଊ ଋ ଌ ଏ ଐ ଓ ଔ କ ଖ ଗ ଘ ଙ ଚ ଛ ଜ ଝ ଞ ଟ ଠ ଡ ଢ ଣ ତ ଥ ଦ ଧ ନ ପ ଫ ବ ଭ ମ ଯ ର ଲ ଳ ଶ ଷ ସ ହ ଼ ଽ ା ି ୀ ୁ ୂ ୃ େ ୈ ୋ ୌ ୍ ୖ ୗ ଡ଼ ଢ଼ ୟ ୠ ୡ ୦ ୧ ୨ ୩ ୪ ୫ ୬ ୭ ୮ ୯ ୰' + tdLog.info("insert Oriya %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(19) + tdSql.checkData(18, 1, data) + + # Tamil + data = 'ஂ ஃ அ ஆ இ ஈ உ ஊ எ ஏ ஐ ஒ ஓ ஔ க ங ச ஜ ஞ ட ண த ந ன ப ம ய ர ற ல ள ழ வ ஷ ஸ ஹ ா ி ீ ு ூ ெ ே ை ொ ோ ௌ ் ௗ ௧ ௨ ௩ ௪ ௫ ௬ ௭ ௮ ௯ ௰ ௱ ௲' + tdLog.info("insert Tamil %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(20) + tdSql.checkData(19, 1, data) + + # Telugu + data = 'ఁ ం ః అ ఆ ఇ ఈ ఉ ఊ ఋ ఌ ఎ ఏ ఐ ఒ ఓ ఔ క ఖ గ ఘ ఙ చ ఛ జ ఝ ఞ ట ఠ డ ఢ ణ త థ ద ధ న ప ఫ బ భ మ య ర ఱ ల ళ వ శ ష స హ ా ి ీ ు ూ ృ ౄ ె ే ై ొ ో ౌ ్ ౕ ౖ ౠ ౡ ౦ ౧ ౨ ౩ ౪ ౫ ౬ ౭ ౮ ౯' + tdLog.info("insert Telugu %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(21) + tdSql.checkData(20, 1, data) + + # Kannada + data = 'ಂ ಃ ಅ ಆ ಇ ಈ ಉ ಊ ಋ ಌ ಎ ಏ ಐ ಒ ಓ ಔ ಕ ಖ ಗ ಘ ಙ ಚ ಛ ಜ ಝ ಞ ಟ ಠ ಡ ಢ ಣ ತ ಥ ದ ಧ ನ ಪ ಫ ಬ ಭ ಮ ಯ ರ ಱ ಲ ಳ ವ ಶ ಷ ಸ ಹ ಾ ಿ ೀ ು ೂ ೃ ೄ ೆ ೇ ೈ ೊ ೋ ೌ ್ ೕ ೖ ೞ ೠ ೡ ೦ ೧ ೨ ೩ ೪ ೫ ೬ ೭ ೮ ೯' + tdLog.info("insert Kannada %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(22) + tdSql.checkData(21, 1, data) + + # Malayalam + data = 'ം ഃ അ ആ ഇ ഈ ഉ ഊ ഋ ഌ എ ഏ ഐ ഒ ഓ ഔ ക ഖ ഗ ഘ ങ ച ഛ ജ ഝ ഞ ട ഠ ഡ ഢ ണ ത ഥ ദ ധ ന പ ഫ ബ ഭ മ യ ര റ ല ള ഴ വ ശ ഷ സ ഹ ാ ി ീ ു ൂ ൃ െ േ ൈ ൊ ോ ൌ ് ൗ ൠ ൡ ൦ ൧ ൨ ൩ ൪ ൫ ൬ ൭ ൮ ൯' + tdLog.info("insert Malayalam %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(23) + tdSql.checkData(22, 1, data) + + # Thai + data = 'ก ข ฃ ค ฅ ฆ ง จ ฉ ช ซ ฌ ญ ฎ ฏ ฐ ฑ ฒ ณ ด ต ถ ท ธ น บ ป ผ ฝ พ ฟ ภ ม ย ร ฤ ล ฦ ว ศ ษ ส ห ฬ อ ฮ ฯ ะ ั า ำ ิ ี ึ ื ุ ู ฺ ฿ เ แ โ ใ ไ ๅ ๆ ็ ่ ้ ๊ ๋ ์ ํ ๎ ๏ ๐ ๑ ๒ ๓ ๔ ๕ ๖ ๗ ๘ ๙ ๚ ๛' + tdLog.info("insert Thai %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(24) + tdSql.checkData(23, 1, data) + + # Thai + data = 'ก ข ฃ ค ฅ ฆ ง จ ฉ ช ซ ฌ ญ ฎ ฏ ฐ ฑ ฒ ณ ด ต ถ ท ธ น บ ป ผ ฝ พ ฟ ภ ม ย ร ฤ ล ฦ ว ศ ษ ส ห ฬ อ ฮ ฯ ะ ั า ำ ิ ี ึ ื ุ ู ฺ ฿ เ แ โ ใ ไ ๅ ๆ ็ ่ ้ ๊ ๋ ์ ํ ๎ ๏ ๐ ๑ ๒ ๓ ๔ ๕ ๖ ๗ ๘ ๙ ๚ ๛' + tdLog.info("insert Thai %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(25) + tdSql.checkData(24, 1, data) + + # Lao + data = 'ກ ຂ ຄ ງ ຈ ຊ ຍ ດ ຕ ຖ ທ ນ ບ ປ ຜ ຝ ພ ຟ ມ ຢ ຣ ລ ວ ສ ຫ ອ ຮ ຯ ະ ັ າ ຳ ິ ີ ຶ ື ຸ ູ ົ ຼ ຽ ເ ແ ໂ ໃ ໄ ໆ ່ ້ ໊ ໋ ໌ ໍ ໐ ໑ ໒ ໓ ໔ ໕ ໖ ໗ ໘ ໙ ໜ ໝ' + tdLog.info("insert Lao %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(26) + tdSql.checkData(25, 1, data) + + # Tibetan + data = 'ༀ ༁ ༂ ༃ ༄ ༅ ༆ ༇ ༈ ༉ ༊ ་ ༌ ། ༎ ༏ ༐ ༑ ༒ ༓ ༔ ༕ ༖ ༗ ༘ ༙ ༚ ༛ ༜ ༝ ༞ ༟ ༠ ༡ ༢ ༣ ༤ ༥ ༦ ༧ ༨ ༩ ༪ ༫ ༬ ༭ ༮ ༯ ༰ ༱ ༲ ༳ ༴ ༵ ༶ ༷ ༸ ༹ ༺ ༻ ༼ ༽ ༾ ༿ ཀ ཁ ག གྷ ང ཅ ཆ ཇ ཉ ཊ ཋ ཌ ཌྷ ཎ ཏ ཐ ད དྷ ན པ ཕ བ བྷ མ ཙ ཚ ཛ ཛྷ ཝ ཞ ཟ འ ཡ ར ལ ཤ ཥ ས ཧ ཨ ཀྵ ཱ ི ཱི ུ ཱུ ྲྀ ཷ ླྀ ཹ ེ ཻ ོ ཽ ཾ ཿ ྀ ཱྀ ྂ ྃ ྄ ྅ ྆ ྇ ...' + tdLog.info("insert Tibetan %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(27) + tdSql.checkData(26, 1, data) + + # Georgian + data = 'Ⴀ Ⴁ Ⴂ Ⴃ Ⴄ Ⴅ Ⴆ Ⴇ Ⴈ Ⴉ Ⴊ Ⴋ Ⴌ Ⴍ Ⴎ Ⴏ Ⴐ Ⴑ Ⴒ Ⴓ Ⴔ Ⴕ Ⴖ Ⴗ Ⴘ Ⴙ Ⴚ Ⴛ Ⴜ Ⴝ Ⴞ Ⴟ Ⴠ Ⴡ Ⴢ Ⴣ Ⴤ Ⴥ ა ბ გ დ ე ვ ზ თ ი კ ლ მ ნ ო პ ჟ რ ს ტ უ ფ ქ ღ ყ შ ჩ ც ძ წ ჭ ხ ჯ ჰ ჱ ჲ ჳ ჴ ჵ ჶ ჻' + tdLog.info("insert Georgian %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(28) + tdSql.checkData(27, 1, data) + + # Hangul Jamo + data = 'ᄀ ᄁ ᄂ ᄃ ᄄ ᄅ ᄆ ᄇ ᄈ ᄉ ᄊ ᄋ ᄌ ᄍ ᄎ ᄏ ᄐ ᄑ ᄒ ᄓ ᄔ ᄕ ᄖ ᄗ ᄘ ᄙ ᄚ ᄛ ᄜ ᄝ ᄞ ᄟ ᄠ ᄡ ᄢ ᄣ ᄤ ᄥ ᄦ ᄧ ᄨ ᄩ ᄪ ᄫ ᄬ ᄭ ᄮ ᄯ ᄰ ᄱ ᄲ ᄳ ᄴ ᄵ ᄶ ᄷ ᄸ ᄹ ᄺ ᄻ ᄼ ᄽ ᄾ ᄿ ᅀ ᅁ ᅂ ᅃ ᅄ ᅅ ᅆ ᅇ ᅈ ᅉ ᅊ ᅋ ᅌ ᅍ ᅎ ᅏ ᅐ ᅑ ᅒ ᅓ ᅔ ᅕ ᅖ ᅗ ᅘ ᅙ ᅟ ᅠ ᅡ ᅢ ᅣ ᅤ ᅥ ᅦ ᅧ ᅨ ᅩ ᅪ ᅫ ᅬ ᅭ ᅮ ᅯ ᅰ ᅱ ᅲ ᅳ ᅴ ᅵ ᅶ ᅷ ᅸ ᅹ ᅺ ᅻ ᅼ ᅽ ᅾ ᅿ ᆀ ᆁ ᆂ ᆃ ᆄ ...' + tdLog.info("insert Hangul Jamo %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(29) + tdSql.checkData(28, 1, data) + + # Latin Extended Additional + data = 'Ḁ ḁ Ḃ ḃ Ḅ ḅ Ḇ ḇ Ḉ ḉ Ḋ ḋ Ḍ ḍ Ḏ ḏ Ḑ ḑ Ḓ ḓ Ḕ ḕ Ḗ ḗ Ḙ ḙ Ḛ ḛ Ḝ ḝ Ḟ ḟ Ḡ ḡ Ḣ ḣ Ḥ ḥ Ḧ ḧ Ḩ ḩ Ḫ ḫ Ḭ ḭ Ḯ ḯ Ḱ ḱ Ḳ ḳ Ḵ ḵ Ḷ ḷ Ḹ ḹ Ḻ ḻ Ḽ ḽ Ḿ ḿ Ṁ ṁ Ṃ ṃ Ṅ ṅ Ṇ ṇ Ṉ ṉ Ṋ ṋ Ṍ ṍ Ṏ ṏ Ṑ ṑ Ṓ ṓ Ṕ ṕ Ṗ ṗ Ṙ ṙ Ṛ ṛ Ṝ ṝ Ṟ ṟ Ṡ ṡ Ṣ ṣ Ṥ ṥ Ṧ ṧ Ṩ ṩ Ṫ ṫ Ṭ ṭ Ṯ ṯ Ṱ ṱ Ṳ ṳ Ṵ ṵ Ṷ ṷ Ṹ ṹ Ṻ ṻ Ṽ ṽ Ṿ ṿ ...' + tdLog.info("insert Latin Extended Additional %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(30) + tdSql.checkData(29, 1, data) + + # Geek Extended + data = 'ἀ ἁ ἂ ἃ ἄ ἅ ἆ ἇ Ἀ Ἁ Ἂ Ἃ Ἄ Ἅ Ἆ Ἇ ἐ ἑ ἒ ἓ ἔ ἕ Ἐ Ἑ Ἒ Ἓ Ἔ Ἕ ἠ ἡ ἢ ἣ ἤ ἥ ἦ ἧ Ἠ Ἡ Ἢ Ἣ Ἤ Ἥ Ἦ Ἧ ἰ ἱ ἲ ἳ ἴ ἵ ἶ ἷ Ἰ Ἱ Ἲ Ἳ Ἴ Ἵ Ἶ Ἷ ὀ ὁ ὂ ὃ ὄ ὅ Ὀ Ὁ Ὂ Ὃ Ὄ Ὅ ὐ ὑ ὒ ὓ ὔ ὕ ὖ ὗ Ὑ Ὓ Ὕ Ὗ ὠ ὡ ὢ ὣ ὤ ὥ ὦ ὧ Ὠ Ὡ Ὢ Ὣ Ὤ Ὥ Ὦ Ὧ ὰ ά ὲ έ ὴ ή ὶ ί ὸ ό ὺ ύ ὼ ώ ᾀ ᾁ ᾂ ᾃ ᾄ ᾅ ᾆ ᾇ ᾈ ᾉ ᾊ ᾋ ᾌ ᾍ ...' + tdLog.info("insert Geek Extended %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(31) + tdSql.checkData(30, 1, data) + + # General Punctuation + data = '                      ‐ ‑ ‒ – — ― ‖ ‗ ‘ ’ ‚ ‛ “ ” „ ‟ † ‡ • ‣ ․ ‥ … ‧ 
 
 ' + tdLog.info("insert General Punctuation %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(32) + tdSql.checkData(31, 1, data) + + # Superscripts and Subscripts + data = '⁰ ⁴ ⁵ ⁶ ⁷ ⁸ ⁹ ⁺ ⁻ ⁼ ⁽ ⁾ ⁿ ₀ ₁ ₂ ₃ ₄ ₅ ₆ ₇ ₈ ₉ ₊ ₋ ₌ ₍ ₎' + tdLog.info("insert Superscripts and Subscripts %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(33) + tdSql.checkData(32, 1, data) + + # Currency Symbols + data = '₠ ₡ ₢ ₣ ₤ ₥ ₦ ₧ ₨ ₩ ₪ ₫' + tdLog.info("insert Currency Symbols %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(34) + tdSql.checkData(33, 1, data) + + # Combining Marks for Symbols + data = '⃐ ⃑ ⃒ ⃓ ⃔ ⃕ ⃖ ⃗ ⃘ ⃙ ⃚ ⃛ ⃜ ⃝ ⃞ ⃟ ⃠ ⃡' + tdLog.info("insert Combining Marks for Symbols %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(35) + tdSql.checkData(34, 1, data) + + # Letterlike Symbols + data = '℀ ℁ ℂ ℃ ℄ ℅ ℆ ℇ ℈ ℉ ℊ ℋ ℌ ℍ ℎ ℏ ℐ ℑ ℒ ℓ ℔ ℕ № ℗ ℘ ℙ ℚ ℛ ℜ ℝ ℞ ℟ ℠ ℡ ™ ℣ ℤ ℥ Ω ℧ ℨ ℩ K Å ℬ ℭ ℮ ℯ ℰ ℱ Ⅎ ℳ ℴ ℵ ℶ ℷ ℸ' + tdLog.info("insert Letterlike Symbols %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(36) + tdSql.checkData(35, 1, data) + + # Number Forms + data = '⅓ ⅔ ⅕ ⅖ ⅗ ⅘ ⅙ ⅚ ⅛ ⅜ ⅝ ⅞ ⅟ Ⅰ Ⅱ Ⅲ Ⅳ Ⅴ Ⅵ Ⅶ Ⅷ Ⅸ Ⅹ Ⅺ Ⅻ Ⅼ Ⅽ Ⅾ Ⅿ ⅰ ⅱ ⅲ ⅳ ⅴ ⅵ ⅶ ⅷ ⅸ ⅹ ⅺ ⅻ ⅼ ⅽ ⅾ ⅿ ↀ ↁ ↂ' + tdLog.info("insert Number Forms %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(37) + tdSql.checkData(36, 1, data) + + # Arrows + data = '← ↑ → ↓ ↔ ↕ ↖ ↗ ↘ ↙ ↚ ↛ ↜ ↝ ↞ ↟ ↠ ↡ ↢ ↣ ↤ ↥ ↦ ↧ ↨ ↩ ↪ ↫ ↬ ↭ ↮ ↯ ↰ ↱ ↲ ↳ ↴ ↵ ↶ ↷ ↸ ↹ ↺ ↻ ↼ ↽ ↾ ↿ ⇀ ⇁ ⇂ ⇃ ⇄ ⇅ ⇆ ⇇ ⇈ ⇉ ⇊ ⇋ ⇌ ⇍ ⇎ ⇏ ⇐ ⇑ ⇒ ⇓ ⇔ ⇕ ⇖ ⇗ ⇘ ⇙ ⇚ ⇛ ⇜ ⇝ ⇞ ⇟ ⇠ ⇡ ⇢ ⇣ ⇤ ⇥ ⇦ ⇧ ⇨ ⇩ ⇪' + tdLog.info("insert Arrows %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(38) + tdSql.checkData(37, 1, data) + + # Mathematical Operators + data = '∀ ∁ ∂ ∃ ∄ ∅ ∆ ∇ ∈ ∉ ∊ ∋ ∌ ∍ ∎ ∏ ∐ ∑ − ∓ ∔ ∕ ∖ ∗ ∘ ∙ √ ∛ ∜ ∝ ∞ ∟ ∠ ∡ ∢ ∣ ∤ ∥ ∦ ∧ ∨ ∩ ∪ ∫ ∬ ∭ ∮ ∯ ∰ ∱ ∲ ∳ ∴ ∵ ∶ ∷ ∸ ∹ ∺ ∻ ∼ ∽ ∾ ∿ ≀ ≁ ≂ ≃ ≄ ≅ ≆ ≇ ≈ ≉ ≊ ≋ ≌ ≍ ≎ ≏ ≐ ≑ ≒ ≓ ≔ ≕ ≖ ≗ ≘ ≙ ≚ ≛ ≜ ≝ ≞ ≟ ≠ ≡ ≢ ≣ ≤ ≥ ≦ ≧ ≨ ≩ ≪ ≫ ≬ ≭ ≮ ≯ ≰ ≱ ≲ ≳ ≴ ≵ ≶ ≷ ≸ ≹ ≺ ≻ ≼ ≽ ≾ ≿ ...' + tdLog.info("insert Mathematical Operators %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(39) + tdSql.checkData(38, 1, data) + + # Miscellaneous Technical + data = '⌀ ⌂ ⌃ ⌄ ⌅ ⌆ ⌇ ⌈ ⌉ ⌊ ⌋ ⌌ ⌍ ⌎ ⌏ ⌐ ⌑ ⌒ ⌓ ⌔ ⌕ ⌖ ⌗ ⌘ ⌙ ⌚ ⌛ ⌜ ⌝ ⌞ ⌟ ⌠ ⌡ ⌢ ⌣ ⌤ ⌥ ⌦ ⌧ ⌨ 〈 〉 ⌫ ⌬ ⌭ ⌮ ⌯ ⌰ ⌱ ⌲ ⌳ ⌴ ⌵ ⌶ ⌷ ⌸ ⌹ ⌺ ⌻ ⌼ ⌽ ⌾ ⌿ ⍀ ⍁ ⍂ ⍃ ⍄ ⍅ ⍆ ⍇ ⍈ ⍉ ⍊ ⍋ ⍌ ⍍ ⍎ ⍏ ⍐ ⍑ ⍒ ⍓ ⍔ ⍕ ⍖ ⍗ ⍘ ⍙ ⍚ ⍛ ⍜ ⍝ ⍞ ⍟ ⍠ ⍡ ⍢ ⍣ ⍤ ⍥ ⍦ ⍧ ⍨ ⍩ ⍪ ⍫ ⍬ ⍭ ⍮ ⍯ ⍰ ⍱ ⍲ ⍳ ⍴ ⍵ ⍶ ⍷ ⍸ ⍹ ⍺' + tdLog.info("insert Miscellaneous Technical %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(40) + tdSql.checkData(39, 1, data) + + # Control Pictures + data = '␀ ␁ ␂ ␃ ␄ ␅ ␆ ␇ ␈ ␉ ␊ ␋ ␌ ␍ ␎ ␏ ␐ ␑ ␒ ␓ ␔ ␕ ␖ ␗ ␘ ␙ ␚ ␛ ␜ ␝ ␞ ␟ ␠ ␡ ␢ ␣ ␤' + tdLog.info("insert Control Pictures %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(41) + tdSql.checkData(40, 1, data) + + # Optical Character Recognition + data = '⑀ ⑁ ⑂ ⑃ ⑄ ⑅ ⑆ ⑇ ⑈ ⑉ ⑊' + tdLog.info("insert Optical Character Recognition %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(42) + tdSql.checkData(41, 1, data) + + # Enclosed Alphanumerics + data = '① ② ③ ④ ⑤ ⑥ ⑦ ⑧ ⑨ ⑩ ⑪ ⑫ ⑬ ⑭ ⑮ ⑯ ⑰ ⑱ ⑲ ⑳ ⑴ ⑵ ⑶ ⑷ ⑸ ⑹ ⑺ ⑻ ⑼ ⑽ ⑾ ⑿ ⒀ ⒁ ⒂ ⒃ ⒄ ⒅ ⒆ ⒇ ⒈ ⒉ ⒊ ⒋ ⒌ ⒍ ⒎ ⒏ ⒐ ⒑ ⒒ ⒓ ⒔ ⒕ ⒖ ⒗ ⒘ ⒙ ⒚ ⒛ ⒜ ⒝ ⒞ ⒟ ⒠ ⒡ ⒢ ⒣ ⒤ ⒥ ⒦ ⒧ ⒨ ⒩ ⒪ ⒫ ⒬ ⒭ ⒮ ⒯ ⒰ ⒱ ⒲ ⒳ ⒴ ⒵ Ⓐ Ⓑ Ⓒ Ⓓ Ⓔ Ⓕ Ⓖ Ⓗ Ⓘ Ⓙ Ⓚ Ⓛ Ⓜ Ⓝ Ⓞ Ⓟ Ⓠ Ⓡ Ⓢ Ⓣ Ⓤ Ⓥ Ⓦ Ⓧ Ⓨ Ⓩ ⓐ ⓑ ⓒ ⓓ ⓔ ⓕ ⓖ ⓗ ⓘ ⓙ ⓚ ⓛ ⓜ ⓝ ⓞ ⓟ ...' + tdLog.info("insert Enclosed Alphanumerics %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(43) + tdSql.checkData(42, 1, data) + + # Box Drawing + data = '─ ━ │ ┃ ┄ ┅ ┆ ┇ ┈ ┉ ┊ ┋ ┌ ┍ ┎ ┏ ┐ ┑ ┒ ┓ └ ┕ ┖ ┗ ┘ ┙ ┚ ┛ ├ ┝ ┞ ┟ ┠ ┡ ┢ ┣ ┤ ┥ ┦ ┧ ┨ ┩ ┪ ┫ ┬ ┭ ┮ ┯ ┰ ┱ ┲ ┳ ┴ ┵ ┶ ┷ ┸ ┹ ┺ ┻ ┼ ┽ ┾ ┿ ╀ ╁ ╂ ╃ ╄ ╅ ╆ ╇ ╈ ╉ ╊ ╋ ╌ ╍ ╎ ╏ ═ ║ ╒ ╓ ╔ ╕ ╖ ╗ ╘ ╙ ╚ ╛ ╜ ╝ ╞ ╟ ╠ ╡ ╢ ╣ ╤ ╥ ╦ ╧ ╨ ╩ ╪ ╫ ╬ ╭ ╮ ╯ ╰ ╱ ╲ ╳ ╴ ╵ ╶ ╷ ╸ ╹ ╺ ╻ ╼ ╽ ╾ ╿' + tdLog.info("insert Box Drawing %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(44) + tdSql.checkData(43, 1, data) + + # Block Elements + data = '▀ ▁ ▂ ▃ ▄ ▅ ▆ ▇ █ ▉ ▊ ▋ ▌ ▍ ▎ ▏ ▐ ░ ▒ ▓ ▔ ▕' + tdLog.info("insert Block Elements %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(45) + tdSql.checkData(44, 1, data) + + # Geometric Shapes + data = '■ □ ▢ ▣ ▤ ▥ ▦ ▧ ▨ ▩ ▪ ▫ ▬ ▭ ▮ ▯ ▰ ▱ ▲ △ ▴ ▵ ▶ ▷ ▸ ▹ ► ▻ ▼ ▽ ▾ ▿ ◀ ◁ ◂ ◃ ◄ ◅ ◆ ◇ ◈ ◉ ◊ ○ ◌ ◍ ◎ ● ◐ ◑ ◒ ◓ ◔ ◕ ◖ ◗ ◘ ◙ ◚ ◛ ◜ ◝ ◞ ◟ ◠ ◡ ◢ ◣ ◤ ◥ ◦ ◧ ◨ ◩ ◪ ◫ ◬ ◭ ◮ ◯' + tdLog.info("insert Geometric Shapes %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(46) + tdSql.checkData(45, 1, data) + + # Miscellaneous Symbols + data = '☀ ☁ ☂ ☃ ☄ ★ ☆ ☇ ☈ ☉ ☊ ☋ ☌ ☍ ☎ ☏ ☐ ☑ ☒ ☓ ☚ ☛ ☜ ☝ ☞ ☟ ☠ ☡ ☢ ☣ ☤ ☥ ☦ ☧ ☨ ☩ ☪ ☫ ☬ ☭ ☮ ☯ ☰ ☱ ☲ ☳ ☴ ☵ ☶ ☷ ☸ ☹ ☺ ☻ ☼ ☽ ☾ ☿ ♀ ♁ ♂ ♃ ♄ ♅ ♆ ♇ ♈ ♉ ♊ ♋ ♌ ♍ ♎ ♏ ♐ ♑ ♒ ♓ ♔ ♕ ♖ ♗ ♘ ♙ ♚ ♛ ♜ ♝ ♞ ♟ ♠ ♡ ♢ ♣ ♤ ♥ ♦ ♧ ♨ ♩ ♪ ♫ ♬ ♭ ♮ ♯' + tdLog.info("insert Miscellaneous Symbols %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(47) + tdSql.checkData(46, 1, data) + + # Dingbats + data = '✁ ✂ ✃ ✄ ✆ ✇ ✈ ✉ ✌ ✍ ✎ ✏ ✐ ✑ ✒ ✓ ✔ ✕ ✖ ✗ ✘ ✙ ✚ ✛ ✜ ✝ ✞ ✟ ✠ ✡ ✢ ✣ ✤ ✥ ✦ ✧ ✩ ✪ ✫ ✬ ✭ ✮ ✯ ✰ ✱ ✲ ✳ ✴ ✵ ✶ ✷ ✸ ✹ ✺ ✻ ✼ ✽ ✾ ✿ ❀ ❁ ❂ ❃ ❄ ❅ ❆ ❇ ❈ ❉ ❊ ❋ ❍ ❏ ❐ ❑ ❒ ❖ ❘ ❙ ❚ ❛ ❜ ❝ ❞ ❡ ❢ ❣ ❤ ❥ ❦ ❧ ❶ ❷ ❸ ❹ ❺ ❻ ❼ ❽ ❾ ❿ ➀ ➁ ➂ ➃ ➄ ➅ ➆ ➇ ➈ ➉ ➊ ➋ ➌ ➍ ➎ ➏ ➐ ➑ ➒ ➓ ➔ ➘ ➙ ➚ ➛ ➜ ➝ ...' + tdLog.info("insert Dingbats %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(48) + tdSql.checkData(47, 1, data) + + # CJK Symbols and Punctuation + data = '、 。 〃 〄 々 〆 〇 〈 〉 《 》 「 」 『 』 【 】 〒 〓 〔 〕 〖 〗 〘 〙 〚 〛 〜 〝 〞 〟 〠 〡 〢 〣 〤 〥 〦 〧 〨 〩 〪 〫 〬 〭 〮 〯 〰 〱 〲 〳 〴 〵 〶 〷 〿' + tdLog.info("insert CJK Symbols and Punctuation %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(49) + tdSql.checkData(48, 1, data) + + # Hiragana + data = 'ぁ あ ぃ い ぅ う ぇ え ぉ お か が き ぎ く ぐ け げ こ ご さ ざ し じ す ず せ ぜ そ ぞ た だ ち ぢ っ つ づ て で と ど な に ぬ ね の は ば ぱ ひ び ぴ ふ ぶ ぷ へ べ ぺ ほ ぼ ぽ ま み む め も ゃ や ゅ ゆ ょ よ ら り る れ ろ ゎ わ ゐ ゑ を ん ゔ ゙ ゚ ゛ ゜ ゝ ゞ' + tdLog.info("insert Hiragana %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(50) + tdSql.checkData(49, 1, data) + + # Katakana + data = 'ァ ア ィ イ ゥ ウ ェ エ ォ オ カ ガ キ ギ ク グ ケ ゲ コ ゴ サ ザ シ ジ ス ズ セ ゼ ソ ゾ タ ダ チ ヂ ッ ツ ヅ テ デ ト ド ナ ニ ヌ ネ ノ ハ バ パ ヒ ビ ピ フ ブ プ ヘ ベ ペ ホ ボ ポ マ ミ ム メ モ ャ ヤ ュ ユ ョ ヨ ラ リ ル レ ロ ヮ ワ ヰ ヱ ヲ ン ヴ ヵ ヶ ヷ ヸ ヹ ヺ ・ ー ヽ ヾ' + tdLog.info("insert Katakana %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(51) + tdSql.checkData(50, 1, data) + + # Bopomofo + data = 'ㄅ ㄆ ㄇ ㄈ ㄉ ㄊ ㄋ ㄌ ㄍ ㄎ ㄏ ㄐ ㄑ ㄒ ㄓ ㄔ ㄕ ㄖ ㄗ ㄘ ㄙ ㄚ ㄛ ㄜ ㄝ ㄞ ㄟ ㄠ ㄡ ㄢ ㄣ ㄤ ㄥ ㄦ ㄧ ㄨ ㄩ ㄪ ㄫ ㄬ' + tdLog.info("insert Bopomofo %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(52) + tdSql.checkData(51, 1, data) + + # Hangul Compatibility Jamo + data = 'ㄱ ㄲ ㄳ ㄴ ㄵ ㄶ ㄷ ㄸ ㄹ ㄺ ㄻ ㄼ ㄽ ㄾ ㄿ ㅀ ㅁ ㅂ ㅃ ㅄ ㅅ ㅆ ㅇ ㅈ ㅉ ㅊ ㅋ ㅌ ㅍ ㅎ ㅏ ㅐ ㅑ ㅒ ㅓ ㅔ ㅕ ㅖ ㅗ ㅘ ㅙ ㅚ ㅛ ㅜ ㅝ ㅞ ㅟ ㅠ ㅡ ㅢ ㅣ ㅤ ㅥ ㅦ ㅧ ㅨ ㅩ ㅪ ㅫ ㅬ ㅭ ㅮ ㅯ ㅰ ㅱ ㅲ ㅳ ㅴ ㅵ ㅶ ㅷ ㅸ ㅹ ㅺ ㅻ ㅼ ㅽ ㅾ ㅿ ㆀ ㆁ ㆂ ㆃ ㆄ ㆅ ㆆ ㆇ ㆈ ㆉ ㆊ ㆋ ㆌ ㆍ ㆎ' + tdLog.info("insert Hangul Compatibility Jamo %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(53) + tdSql.checkData(52, 1, data) + + # Kanbun + data = '㆐ ㆑ ㆒ ㆓ ㆔ ㆕ ㆖ ㆗ ㆘ ㆙ ㆚ ㆛ ㆜ ㆝ ㆞ ㆟' + tdLog.info("insert Kanbun %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(54) + tdSql.checkData(53, 1, data) + + # Enclosed CJK Letters and Months + data = '㈀ ㈁ ㈂ ㈃ ㈄ ㈅ ㈆ ㈇ ㈈ ㈉ ㈊ ㈋ ㈌ ㈍ ㈎ ㈏ ㈐ ㈑ ㈒ ㈓ ㈔ ㈕ ㈖ ㈗ ㈘ ㈙ ㈚ ㈛ ㈜ ㈠ ㈡ ㈢ ㈣ ㈤ ㈥ ㈦ ㈧ ㈨ ㈩ ㈪ ㈫ ㈬ ㈭ ㈮ ㈯ ㈰ ㈱ ㈲ ㈳ ㈴ ㈵ ㈶ ㈷ ㈸ ㈹ ㈺ ㈻ ㈼ ㈽ ㈾ ㈿ ㉀ ㉁ ㉂ ㉃ ㉠ ㉡ ㉢ ㉣ ㉤ ㉥ ㉦ ㉧ ㉨ ㉩ ㉪ ㉫ ㉬ ㉭ ㉮ ㉯ ㉰ ㉱ ㉲ ㉳ ㉴ ㉵ ㉶ ㉷ ㉸ ㉹ ㉺ ㉻ ㉿ ㊀ ㊁ ㊂ ㊃ ㊄ ㊅ ㊆ ㊇ ㊈ ㊉ ㊊ ㊋ ㊌ ㊍ ㊎ ㊏ ㊐ ㊑ ㊒ ㊓ ㊔ ㊕ ㊖ ㊗ ㊘ ㊙ ㊚ ㊛ ㊜ ㊝ ㊞ ㊟ ㊠ ㊡ ...' + tdLog.info("insert Enclosed CJK Letters and Months %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(55) + tdSql.checkData(54, 1, data) + + # CJK Compatibility + data = '㌀ ㌁ ㌂ ㌃ ㌄ ㌅ ㌆ ㌇ ㌈ ㌉ ㌊ ㌋ ㌌ ㌍ ㌎ ㌏ ㌐ ㌑ ㌒ ㌓ ㌔ ㌕ ㌖ ㌗ ㌘ ㌙ ㌚ ㌛ ㌜ ㌝ ㌞ ㌟ ㌠ ㌡ ㌢ ㌣ ㌤ ㌥ ㌦ ㌧ ㌨ ㌩ ㌪ ㌫ ㌬ ㌭ ㌮ ㌯ ㌰ ㌱ ㌲ ㌳ ㌴ ㌵ ㌶ ㌷ ㌸ ㌹ ㌺ ㌻ ㌼ ㌽ ㌾ ㌿ ㍀ ㍁ ㍂ ㍃ ㍄ ㍅ ㍆ ㍇ ㍈ ㍉ ㍊ ㍋ ㍌ ㍍ ㍎ ㍏ ㍐ ㍑ ㍒ ㍓ ㍔ ㍕ ㍖ ㍗ ㍘ ㍙ ㍚ ㍛ ㍜ ㍝ ㍞ ㍟ ㍠ ㍡ ㍢ ㍣ ㍤ ㍥ ㍦ ㍧ ㍨ ㍩ ㍪ ㍫ ㍬ ㍭ ㍮ ㍯ ㍰ ㍱ ㍲ ㍳ ㍴ ㍵ ㍶ ㍻ ㍼ ㍽ ㍾ ㍿ ㎀ ㎁ ㎂ ㎃ ...' + tdLog.info("insert CJK Compatibility %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(56) + tdSql.checkData(55, 1, data) + + # CJK Unified Ideographs + data = '一 丁 丂 七 丄 丅 丆 万 丈 三 上 下 丌 不 与 丏 丐 丑 丒 专 且 丕 世 丗 丘 丙 业 丛 东 丝 丞 丟 丠 両 丢 丣 两 严 並 丧 丨 丩 个 丫 丬 中 丮 丯 丰 丱 串 丳 临 丵 丶 丷 丸 丹 为 主 丼 丽 举 丿 乀 乁 乂 乃 乄 久 乆 乇 么 义 乊 之 乌 乍 乎 乏 乐 乑 乒 乓 乔 乕 乖 乗 乘 乙 乚 乛 乜 九 乞 也 习 乡 乢 乣 乤 乥 书 乧 乨 乩 乪 乫 乬 乭 乮 乯 买 乱 乲 乳 乴 乵 乶 乷 乸 乹 乺 乻 乼 乽 乾 乿 ...' + tdLog.info("insert CJK Unified Ideographs %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(57) + tdSql.checkData(56, 1, data) + + # Hangul Syllables + data = '一 丁 丂 七 丄 丅 丆 万 丈 三 上 下 丌 不 与 丏 丐 丑 丒 专 且 丕 世 丗 丘 丙 业 丛 东 丝 丞 丟 丠 両 丢 丣 两 严 並 丧 丨 丩 个 丫 丬 中 丮 丯 丰 丱 串 丳 临 丵 丶 丷 丸 丹 为 主 丼 丽 举 丿 乀 乁 乂 乃 乄 久 乆 乇 么 义 乊 之 乌 乍 乎 乏 乐 乑 乒 乓 乔 乕 乖 乗 乘 乙 乚 乛 乜 九 乞 也 习 乡 乢 乣 乤 乥 书 乧 乨 乩 乪 乫 乬 乭 乮 乯 买 乱 乲 乳 乴 乵 乶 乷 乸 乹 乺 乻 乼 乽 乾 乿 ...' + tdLog.info("insert Hangul Syllables %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(58) + tdSql.checkData(57, 1, data) + + # Private Use + data = '                                                                                                                                ...' + tdLog.info("insert Private Use %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(59) + tdSql.checkData(58, 1, data) + + # CJK Compatibility Ideographs + data = '豈 更 車 賈 滑 串 句 龜 龜 契 金 喇 奈 懶 癩 羅 蘿 螺 裸 邏 樂 洛 烙 珞 落 酪 駱 亂 卵 欄 爛 蘭 鸞 嵐 濫 藍 襤 拉 臘 蠟 廊 朗 浪 狼 郎 來 冷 勞 擄 櫓 爐 盧 老 蘆 虜 路 露 魯 鷺 碌 祿 綠 菉 錄 鹿 論 壟 弄 籠 聾 牢 磊 賂 雷 壘 屢 樓 淚 漏 累 縷 陋 勒 肋 凜 凌 稜 綾 菱 陵 讀 拏 樂 諾 丹 寧 怒 率 異 北 磻 便 復 不 泌 數 索 參 塞 省 葉 說 殺 辰 沈 拾 若 掠 略 亮 兩 凉 梁 糧 良 諒 量 勵 ...' + tdLog.info("insert CJK Compatibility Ideographs %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(60) + tdSql.checkData(59, 1, data) + + # Alphabetic Presentation Forms + data = 'ff fi fl ffi ffl ſt st ﬓ ﬔ ﬕ ﬖ ﬗ ﬞ ײַ ﬠ ﬡ ﬢ ﬣ ﬤ ﬥ ﬦ ﬧ ﬨ ﬩ שׁ שׂ שּׁ שּׂ אַ אָ אּ בּ גּ דּ הּ וּ זּ טּ יּ ךּ כּ לּ מּ נּ סּ ףּ פּ צּ קּ רּ שּ תּ וֹ בֿ כֿ פֿ ﭏ' + tdLog.info("insert Alphabetic Presentation Forms %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(61) + tdSql.checkData(60, 1, data) + + # Arabic Presentation Forms-A + data = 'ﭐ ﭑ ﭒ ﭓ ﭔ ﭕ ﭖ ﭗ ﭘ ﭙ ﭚ ﭛ ﭜ ﭝ ﭞ ﭟ ﭠ ﭡ ﭢ ﭣ ﭤ ﭥ ﭦ ﭧ ﭨ ﭩ ﭪ ﭫ ﭬ ﭭ ﭮ ﭯ ﭰ ﭱ ﭲ ﭳ ﭴ ﭵ ﭶ ﭷ ﭸ ﭹ ﭺ ﭻ ﭼ ﭽ ﭾ ﭿ ﮀ ﮁ ﮂ ﮃ ﮄ ﮅ ﮆ ﮇ ﮈ ﮉ ﮊ ﮋ ﮌ ﮍ ﮎ ﮏ ﮐ ﮑ ﮒ ﮓ ﮔ ﮕ ﮖ ﮗ ﮘ ﮙ ﮚ ﮛ ﮜ ﮝ ﮞ ﮟ ﮠ ﮡ ﮢ ﮣ ﮤ ﮥ ﮦ ﮧ ﮨ ﮩ ﮪ ﮫ ﮬ ﮭ ﮮ ﮯ ﮰ ﮱ ﯓ ﯔ ﯕ ﯖ ﯗ ﯘ ﯙ ﯚ ﯛ ﯜ ﯝ ﯞ ﯟ ﯠ ﯡ ﯢ ﯣ ﯤ ﯥ ﯦ ﯧ ﯨ ﯩ ﯪ ﯫ ﯬ ﯭ ﯮ ﯯ ﯰ ...' + tdLog.info("insert Arabic Presentation Forms-A %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(62) + tdSql.checkData(61, 1, data) + + # Combining Half Marks + data = '︠ ︡ ︢ ︣' + tdLog.info("insert Combining Half Marks %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(63) + tdSql.checkData(62, 1, data) + + # CJK Compatibility Forms + data = '︰ ︱ ︲ ︳ ︴ ︵ ︶ ︷ ︸ ︹ ︺ ︻ ︼ ︽ ︾ ︿ ﹀ ﹁ ﹂ ﹃ ﹄ ﹉ ﹊ ﹋ ﹌ ﹍ ﹎ ﹏' + tdLog.info("insert CJK Compatibility Forms %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(64) + tdSql.checkData(63, 1, data) + + # Small Form Variants + data = '﹐ ﹑ ﹒ ﹔ ﹕ ﹖ ﹗ ﹘ ﹙ ﹚ ﹛ ﹜ ﹝ ﹞ ﹟ ﹠ ﹡ ﹢ ﹣ ﹤ ﹥ ﹦ ﹨ ﹩ ﹪ ﹫' + tdLog.info("insert Small Form Variants %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(65) + tdSql.checkData(64, 1, data) + + # Arabic Presentation Forms-B + data = 'ﹰ ﹱ ﹲ ﹴ ﹶ ﹷ ﹸ ﹹ ﹺ ﹻ ﹼ ﹽ ﹾ ﹿ ﺀ ﺁ ﺂ ﺃ ﺄ ﺅ ﺆ ﺇ ﺈ ﺉ ﺊ ﺋ ﺌ ﺍ ﺎ ﺏ ﺐ ﺑ ﺒ ﺓ ﺔ ﺕ ﺖ ﺗ ﺘ ﺙ ﺚ ﺛ ﺜ ﺝ ﺞ ﺟ ﺠ ﺡ ﺢ ﺣ ﺤ ﺥ ﺦ ﺧ ﺨ ﺩ ﺪ ﺫ ﺬ ﺭ ﺮ ﺯ ﺰ ﺱ ﺲ ﺳ ﺴ ﺵ ﺶ ﺷ ﺸ ﺹ ﺺ ﺻ ﺼ ﺽ ﺾ ﺿ ﻀ ﻁ ﻂ ﻃ ﻄ ﻅ ﻆ ﻇ ﻈ ﻉ ﻊ ﻋ ﻌ ﻍ ﻎ ﻏ ﻐ ﻑ ﻒ ﻓ ﻔ ﻕ ﻖ ﻗ ﻘ ﻙ ﻚ ﻛ ﻜ ﻝ ﻞ ﻟ ﻠ ﻡ ﻢ ﻣ ﻤ ﻥ ﻦ ﻧ ﻨ ﻩ ﻪ ﻫ ﻬ ﻭ ﻮ ﻯ ﻰ ﻱ ...' + tdLog.info("insert Arabic Presentation Forms-B %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(66) + tdSql.checkData(65, 1, data) + + # Halfwidth and Fullwidth Forms + data = '! " # $ % & ' ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ? @ A B C D E F G H I J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _ ` a b c d e f g h i j k l m n o p q r s t u v w x y z { | } ~ 。 「 」 、 ・ ヲ ァ ィ ゥ ェ ォ ャ ュ ョ ッ ー ア イ ウ エ オ カ キ ク ケ コ サ シ ス セ ソ タ チ ツ ...' + tdLog.info("insert Halfwidth and Fullwidth Forms %d length data: %s" % (len(data), data)) + tdSql.execute("insert into tb values (now, '%s')" % data) + tdSql.query("select * from tb") + tdSql.checkRows(67) + tdSql.checkData(66, 1, data) + + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/table/tablename-boundary.py b/tests/pytest/table/tablename-boundary.py new file mode 100644 index 0000000000..2a2ef997be --- /dev/null +++ b/tests/pytest/table/tablename-boundary.py @@ -0,0 +1,36 @@ +# -*- coding: utf-8 -*- + +import sys +import string +import random +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + chars = string.ascii_uppercase+string.ascii_lowercase + tb_name = ''.join(random.choices(chars, k=192)) + tdLog.info('tb_name length %d' % len(tb_name)) + tdLog.info('create table %s (ts timestamp, value int)' % tb_name) + tdSql.error('create table %s (ts timestamp, speed binary(4089))' % tb_name) + + tb_name = ''.join(random.choices(chars, k=191)) + tdLog.info('tb_name length %d' % len(tb_name)) + tdLog.info('create table %s (ts timestamp, value int)' % tb_name) + tdSql.execute('create table %s (ts timestamp, speed binary(4089))' % tb_name) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) From 0a5280ac9485fbea309206616a0ba2f096626720 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Thu, 14 May 2020 14:46:09 +0800 Subject: [PATCH 035/126] fix bug while build status msg --- src/vnode/src/vnodeMain.c | 12 +++++++++--- 1 file changed, 9 insertions(+), 3 deletions(-) diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index 838b9d290f..a194a93d2b 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -119,9 +119,14 @@ int32_t vnodeCreate(SMDCreateVnodeMsg *pVnodeCfg) { } int32_t vnodeDrop(int32_t vgId) { + if (tsDnodeVnodesHash == NULL) { + vTrace("vgId:%d, failed to drop, vgId not exist", vgId); + return TSDB_CODE_INVALID_VGROUP_ID; + } + SVnodeObj **ppVnode = (SVnodeObj **)taosHashGet(tsDnodeVnodesHash, (const char *)&vgId, sizeof(int32_t)); if (ppVnode == NULL || *ppVnode == NULL) { - vTrace("vgId:%d, failed to drop, vgId not exist", vgId); + vTrace("vgId:%d, failed to drop, vgId not find", vgId); return TSDB_CODE_INVALID_VGROUP_ID; } @@ -347,6 +352,7 @@ static void vnodeBuildVloadMsg(SVnodeObj *pVnode, SDMStatusMsg *pStatus) { pLoad->status = pVnode->status; pLoad->role = pVnode->role; pLoad->replica = pVnode->syncCfg.replica; + pStatus->openVnodes++; } void vnodeBuildStatusMsg(void *param) { @@ -359,7 +365,6 @@ void vnodeBuildStatusMsg(void *param) { if (*pVnode == NULL) continue; vnodeBuildVloadMsg(*pVnode, pStatus); - pStatus++; } taosHashDestroyIter(pIter); @@ -412,6 +417,7 @@ static int vnodeGetWalInfo(void *ahandle, char *name, uint32_t *index) { static void vnodeNotifyRole(void *ahandle, int8_t role) { SVnodeObj *pVnode = ahandle; + vPrint("vgId:%d, sync role changed from %d to %d", pVnode->vgId, pVnode->role, role); pVnode->role = role; if (pVnode->role == TAOS_SYNC_ROLE_MASTER) @@ -426,7 +432,7 @@ static void vnodeNotifyFileSynced(void *ahandle) { char rootDir[128] = "\0"; sprintf(rootDir, "%s/tsdb", pVnode->rootDir); - // clsoe tsdb, then open tsdb + // close tsdb, then open tsdb tsdbCloseRepo(pVnode->tsdb); STsdbAppH appH = {0}; appH.appH = (void *)pVnode; From c4c75fea02147d6e9de300f216ad069408dc986e Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Thu, 14 May 2020 15:03:49 +0800 Subject: [PATCH 036/126] scripts --- tests/script/jenkins/basic.txt | 13 +++---- tests/script/unique/dnode/remove1.sim | 22 +++++------ tests/script/unique/dnode/remove2.sim | 49 ++++++++++++++----------- tests/script/unique/http/opentsdb.sim | 18 +++++---- tests/script/unique/mnode/mgmtr2.sim | 11 +++--- tests/script/unique/mnode/secondIp.sim | 44 ---------------------- tests/script/unique/mnode/testSuite.sim | 3 +- 7 files changed, 60 insertions(+), 100 deletions(-) delete mode 100644 tests/script/unique/mnode/secondIp.sim diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index db7a3d6757..c9cb696016 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -15,7 +15,7 @@ cd ../../../debug; make ./test.sh -f general/cache/restart_metrics.sim ./test.sh -f general/cache/restart_table.sim -./test.sh -f general/connection/connections.sim +./test.sh -f general/connection/connection.sim ./test.sh -f general/column/commit.sim ./test.sh -f general/column/metrics.sim @@ -267,12 +267,12 @@ cd ../../../debug; make ##./test.sh -u -f unique/dnode/balancex.sim ##./test.sh -u -f unique/dnode/offline1.sim ##./test.sh -u -f unique/dnode/offline2.sim -#./test.sh -u -f unique/dnode/remove1.sim -#./test.sh -u -f unique/dnode/remove2.sim +./test.sh -u -f unique/dnode/remove1.sim +#hongze ./test.sh -u -f unique/dnode/remove2.sim #./test.sh -u -f unique/dnode/vnode_clean.sim -##./test.sh -u -f unique/http/admin.sim -##./test.sh -u -f unique/http/opentsdb.sim +./test.sh -u -f unique/http/admin.sim +./test.sh -u -f unique/http/opentsdb.sim #./test.sh -u -f unique/import/replica2.sim #./test.sh -u -f unique/import/replica3.sim @@ -293,8 +293,7 @@ cd ../../../debug; make ./test.sh -u -f unique/mnode/mgmt26.sim ./test.sh -u -f unique/mnode/mgmt33.sim ./test.sh -u -f unique/mnode/mgmt34.sim -#./test.sh -u -f unique/mnode/mgmtr2.sim -#./test.sh -u -f unique/mnode/secondIp.sim +./test.sh -u -f unique/mnode/mgmtr2.sim ##./test.sh -u -f unique/table/delete_part.sim diff --git a/tests/script/unique/dnode/remove1.sim b/tests/script/unique/dnode/remove1.sim index 545c28a4ea..6b23014b03 100644 --- a/tests/script/unique/dnode/remove1.sim +++ b/tests/script/unique/dnode/remove1.sim @@ -17,8 +17,8 @@ system sh/cfg.sh -n dnode4 -c wallevel -v 1 print ========== step1 system sh/exec_up.sh -n dnode1 -s start -sql connect sleep 3000 +sql connect sql create database d1 maxTables 4 sql create table d1.t1 (t timestamp, i int) @@ -59,17 +59,17 @@ $x = 0 show2: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes print dnode1 openVnodes $data2_1 print dnode2 openVnodes $data2_2 -if $data2_1 != 3 then +if $data2_1 != 1 then goto show2 endi -if $data2_2 != 1 then +if $data2_2 != 3 then goto show2 endi @@ -81,7 +81,7 @@ $x = 0 show3: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -97,7 +97,7 @@ $x = 0 show4: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -105,7 +105,7 @@ sql show dnodes print dnode1 openVnodes $data2_1 print dnode2 openVnodes $data2_2 print dnode3 openVnodes $data2_3 -if $data2_2 != NULL then +if $data2_2 != null then goto show4 endi @@ -118,8 +118,8 @@ system sh/exec_up.sh -n dnode4 -s start $x = 0 show5: $x = $x + 1 - sleep 3000 - if $x == 20 then + sleep 2000 + if $x == 10 then return -1 endi sql show dnodes @@ -127,10 +127,10 @@ print dnode1 openVnodes $data2_1 print dnode2 openVnodes $data2_2 print dnode3 openVnodes $data2_3 print dnode4 openVnodes $data2_4 -if $data2_1 != 4 then +if $data2_1 != 0 then goto show5 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show5 endi if $data2_3 != 2 then diff --git a/tests/script/unique/dnode/remove2.sim b/tests/script/unique/dnode/remove2.sim index 972b77a35d..77ec1fa630 100644 --- a/tests/script/unique/dnode/remove2.sim +++ b/tests/script/unique/dnode/remove2.sim @@ -10,15 +10,15 @@ system sh/cfg.sh -n dnode2 -c mgmtEqualVnodeNum -v 4 system sh/cfg.sh -n dnode3 -c mgmtEqualVnodeNum -v 4 system sh/cfg.sh -n dnode4 -c mgmtEqualVnodeNum -v 4 -system sh/cfg.sh -n dnode1 -c wallevel -v 1 -system sh/cfg.sh -n dnode2 -c wallevel -v 1 -system sh/cfg.sh -n dnode3 -c wallevel -v 1 -system sh/cfg.sh -n dnode4 -c wallevel -v 1 +system sh/cfg.sh -n dnode1 -c wallevel -v 2 +system sh/cfg.sh -n dnode2 -c wallevel -v 2 +system sh/cfg.sh -n dnode3 -c wallevel -v 2 +system sh/cfg.sh -n dnode4 -c wallevel -v 2 print ========== step1 system sh/exec_up.sh -n dnode1 -s start -sql connect sleep 3000 +sql connect sql create database d1 maxTables 4 sql create table d1.t1 (t timestamp, i int) @@ -59,46 +59,51 @@ $x = 0 show2: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes print dnode1 openVnodes $data2_1 print dnode2 openVnodes $data2_2 -if $data2_1 != 3 then +if $data2_1 != 1 then goto show2 endi -if $data2_2 != 1 then +if $data2_2 != 3 then goto show2 endi print ========== step3 system sh/exec_up.sh -n dnode2 -s stop -x SIGINT sql drop dnode $hostname2 -sleep 7001 +sleep 4000 -$x = 0 -show3: - $x = $x + 1 - sleep 2000 - if $x == 30 then - return -1 - endi - sql show dnodes print dnode1 openVnodes $data2_1 -print dnode2 openVnodes $data2_2 $data5_192.168.0.2 +print dnode2 openVnodes $data2_2 print ========== step4 sql create dnode $hostname3 system sh/exec_up.sh -n dnode3 -s start +sleep 5000 + +sql show dnodes +print dnode1 openVnodes $data2_1 +print dnode2 openVnodes $data2_2 +print dnode3 openVnodes $data2_3 +if $data2_3 != 0 then + return -1 +endi + +print ============ step 4.1 +system sh/exec_up.sh -n dnode2 -s start + $x = 0 show4: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -106,13 +111,13 @@ sql show dnodes print dnode1 openVnodes $data2_1 print dnode2 openVnodes $data2_2 print dnode3 openVnodes $data2_3 -if $data2_2 != NULL then +if $data2_2 != null then goto show4 endi -if $data2_1 != 3 then +if $data2_1 != 1 then goto show4 endi -if $data2_3 != 1 then +if $data2_3 != 3 then goto show4 endi diff --git a/tests/script/unique/http/opentsdb.sim b/tests/script/unique/http/opentsdb.sim index 914838361a..ad044e3984 100644 --- a/tests/script/unique/http/opentsdb.sim +++ b/tests/script/unique/http/opentsdb.sim @@ -1,7 +1,9 @@ system sh/stop_dnodes.sh system sh/deploy.sh -n dnode1 -i 1 +system sh/cfg.sh -n dnode1 -c http -v 1 system sh/cfg.sh -n dnode1 -c wallevel -v 0 +system sh/cfg.sh -n dnode1 -c httpDebugFlag -v 135 system sh/exec_up.sh -n dnode1 -s start sleep 3000 @@ -12,7 +14,7 @@ print ============================ dnode1 start print =============== step1 - parse system_content curl -u root:taosdata -d '[{"metric": "sys_cpu","timestamp": 1346846400,"value": 18,"tags": {"host": "web01","group1": "1","dc": "lga"}}]' 127.0.0.1:6020/opentsdb/ print $system_content -if $system_content != @{"status":"error","code":1057,"desc":"database name can not be NULL"}@ then +if $system_content != @{"status":"error","code":1057,"desc":"database name can not be null"}@ then return -1 endi @@ -24,7 +26,7 @@ endi system_content curl -H 'Authorization: Taosd /KfeAzX/f9na8qdtNZmtONryp201ma04bEl8LcvLUd7a8qdtNZmtONryp201ma04' -d '[{"metric": "sys_cpu","timestamp": 1346846400,"value": 18,"tags": {"host": "web01","group1": "1","dc": "lga"}}]' 127.0.0.1:6020/opentsdb/ print $system_content -if $system_content != @{"status":"error","code":1057,"desc":"database name can not be NULL"}@ then +if $system_content != @{"status":"error","code":1057,"desc":"database name can not be null"}@ then return -1 endi @@ -73,7 +75,7 @@ endi system_content curl -u root:taosdata -d '[{"metric": "ab1234567890123456789012345678ab1234567890123456789012345678","timestamp": 1346846400,"value": 18,"tags": {"host": "web01","group1": "1","dc": "lga"}}]' 127.0.0.1:6020/opentsdb/db/put print $system_content -if $system_content != @{"status":"error","code":1065,"desc":"metric name length can not more than 22"}@ then +if $system_content != @{"errors":[{"datapoint":{"metric":"ab1234567890123456789012345678ab1234567890123456789012345678","stable":"ab1234567890123456789012345678ab1234567890123456789012345678_d_bbb","table":"ab1234567890123456789012345678ab1234567890123456789012345678_d_bbb_lga_1_web01","timestamp":1346846400,"value":18.000000,"tags":{"dc":"lga","group1":"1","host":"web01"},"status":"error","code":-2147483389}}],"failed":1,"success":0,"affected_rows":0}@ then return -1 endi @@ -123,13 +125,13 @@ endi system_content curl -u root:taosdata -d '[{"metric": "sys_cpu","timestamp": 1346846400,"value": 18,"tags": {"host": "web01","group1": "1","group1": "1","group1": "1","group1": "1","group1": "1","dc": "lga"}}]' 127.0.0.1:6020/opentsdb/db/put print $system_content -if $system_content != @{"status":"error","code":1071,"desc":"tags size too long"}@ then +if $system_content != @{"errors":[{"datapoint":{"metric":"sys_cpu","stable":"sys_cpu_d_bbbbbbb","table":"sys_cpu_d_bbbbbbb_lga_1_1_1_1_1_web01","timestamp":1346846400,"value":18.000000,"tags":{"dc":"lga","group1":"1","group1":"1","group1":"1","group1":"1","group1":"1","host":"web01"},"status":"error","code":-2147483445}}],"failed":1,"success":0,"affected_rows":0}@ then return -1 endi system_content curl -u root:taosdata -d '[{"metric": "sys_cpu","timestamp": 1346846400,"value": 18,"tags": {"": "web01"}}]' 127.0.0.1:6020/opentsdb/db/put print $system_content -if $system_content != @{"status":"error","code":1073,"desc":"tag name is NULL"}@ then +if $system_content != @{"status":"error","code":1073,"desc":"tag name is null"}@ then return -1 endi @@ -147,7 +149,7 @@ endi system_content curl -u root:taosdata -d '[{"metric": "sys_cpu","timestamp": 1346846400,"value": 18,"tags": {"host": ""}}]' 127.0.0.1:6020/opentsdb/db/put print $system_content -if $system_content != @{"status":"error","code":1076,"desc":"tag value is NULL"}@ then +if $system_content != @{"status":"error","code":1076,"desc":"tag value is null"}@ then return -1 endi @@ -162,7 +164,7 @@ endi system_content curl -u root:taosdata -d '[{"metric": "sys_cpu","timestamp": 1346846400000,"value": 18,"tags": {"host": "web01","group1": "1","dc": "lga"}}]' 127.0.0.1:6020/opentsdb/db/put print $system_content -if $system_content != @{"errors":[{"datapoint":{"metric":"sys_cpu","stable":"sys_cpu_d_bbb","table":"sys_cpu_d_bbb_lga_1_web01","timestamp":1346846400000,"value":18.000000,"tags":{"dc":"lga","group1":"1","host":"web01"},"affected_rows":0,"status":"succ"}}],"failed":0,"success":1,"affected_rows":0}@ then +if $system_content != @{"errors":[{"datapoint":{"metric":"sys_cpu","stable":"sys_cpu_d_bbb","table":"sys_cpu_d_bbb_lga_1_web01","timestamp":1346846400000,"value":18.000000,"tags":{"dc":"lga","group1":"1","host":"web01"},"affected_rows":1,"status":"succ"}}],"failed":0,"success":1,"affected_rows":1}@ then return -1 endi @@ -202,7 +204,7 @@ system_content curl -u root:taosdata -d '[{"metric": "sys_mem","timestamp": 134 print $system_content -if $system_content != @{"failed":0,"success":2}@ then +if $system_content != @{"failed":1,"success":1}@ then return -1 endi diff --git a/tests/script/unique/mnode/mgmtr2.sim b/tests/script/unique/mnode/mgmtr2.sim index 56a4b30573..625e42a334 100644 --- a/tests/script/unique/mnode/mgmtr2.sim +++ b/tests/script/unique/mnode/mgmtr2.sim @@ -9,8 +9,8 @@ system sh/cfg.sh -n dnode3 -c numOfMPeers -v 2 print ============== step1 system sh/exec_up.sh -n dnode1 -s start -sql connect sleep 3000 +sql connect sql show mnodes $dnode1Role = $data2_1 @@ -23,16 +23,15 @@ print dnode3 ==> $dnode3Role if $dnode1Role != master then return -1 endi -if $dnode2Role != NULL then +if $dnode2Role != null then return -1 endi -if $dnode3Role != NULL then +if $dnode3Role != null then return -1 endi print ============== step2 sql create dnode $hostname2 -sleep 1700 sql create dnode $hostname3 print ============== step3 @@ -68,10 +67,10 @@ print dnode3 ==> $dnode3Role if $dnode1Role != master then return -1 endi -if $rows != 2 then +if $dnode2Role != slave then return -1 endi -if $dnode3Role != NULL then +if $dnode3Role != null then return -1 endi diff --git a/tests/script/unique/mnode/secondIp.sim b/tests/script/unique/mnode/secondIp.sim deleted file mode 100644 index cfe75ffc84..0000000000 --- a/tests/script/unique/mnode/secondIp.sim +++ /dev/null @@ -1,44 +0,0 @@ -system sh/stop_dnodes.sh -system sh/deploy.sh -n dnode1 -i 1 -system sh/deploy.sh -n dnode2 -i 2 - -print ========== step1 dnode2 start -system sh/exec_up.sh -n dnode2 -s start -sql connect - -print ========== step2 connect to dnode2 -sql create dnode $hostname1 -system sh/exec_up.sh -n dnode1 -s start -sleep 3000 - -print ========== step3 -sql show dnodes -print dnode1 openvnodes $data3_1 -print dnode2 openvnodes $data3_2 -print dnode1 totalvnodes $data4_1 -print dnode2 totalvnodes $data4_2 - -if $rows != 2 then - return -1 -endi -if $data3_1 != 0 then - return -1 -endi -if $data3_2 != 0 then - return -1 -endi -if $data4_1 != 4 then - return -1 -endi -if $data4_2 != 4 then - return -1 -endi - -system sh/exec_up.sh -n dnode1 -s stop -x SIGINT -system sh/exec_up.sh -n dnode2 -s stop -x SIGINT -system sh/exec_up.sh -n dnode3 -s stop -x SIGINT -system sh/exec_up.sh -n dnode4 -s stop -x SIGINT -system sh/exec_up.sh -n dnode5 -s stop -x SIGINT -system sh/exec_up.sh -n dnode6 -s stop -x SIGINT -system sh/exec_up.sh -n dnode7 -s stop -x SIGINT -system sh/exec_up.sh -n dnode8 -s stop -x SIGINT \ No newline at end of file diff --git a/tests/script/unique/mnode/testSuite.sim b/tests/script/unique/mnode/testSuite.sim index 34d3ce7e53..33df24b860 100644 --- a/tests/script/unique/mnode/testSuite.sim +++ b/tests/script/unique/mnode/testSuite.sim @@ -5,5 +5,4 @@ run unique/mnode/mgmt25.sim run unique/mnode/mgmt26.sim run unique/mnode/mgmt33.sim run unique/mnode/mgmt34.sim -#run unique/mnode/mgmtr2.sim -#run unique/mnode/secondIp.sim +run unique/mnode/mgmtr2.sim From 5ae9ed74e28a2ac1e89c2385fd8caa467cabfcbd Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Thu, 14 May 2020 07:09:42 +0000 Subject: [PATCH 037/126] TD-321 --- src/client/src/tscFunctionImpl.c | 293 ------------------------------- src/common/src/ttypes.c | 284 ++++++++++++++++++++++++++++-- src/inc/taosdef.h | 2 + src/tsdb/inc/tsdbMain.h | 7 + src/tsdb/src/tsdbRWHelper.c | 5 + 5 files changed, 287 insertions(+), 304 deletions(-) diff --git a/src/client/src/tscFunctionImpl.c b/src/client/src/tscFunctionImpl.c index 5675416e6b..c6e8499426 100644 --- a/src/client/src/tscFunctionImpl.c +++ b/src/client/src/tscFunctionImpl.c @@ -3620,299 +3620,6 @@ void spread_function_finalizer(SQLFunctionCtx *pCtx) { doFinalizer(pCtx); } -static void getStatics_i8(int64_t *primaryKey, int32_t type, int8_t *data, int32_t numOfRow, int64_t *min, int64_t *max, - int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int32_t *numOfNull) { - *min = INT64_MAX; - *max = INT64_MIN; - *minIndex = 0; - *maxIndex = 0; - - assert(numOfRow <= INT16_MAX); - - // int64_t lastKey = 0; - // int8_t lastVal = TSDB_DATA_TINYINT_NULL; - - for (int32_t i = 0; i < numOfRow; ++i) { - if (isNull((char *)&data[i], type)) { - (*numOfNull) += 1; - continue; - } - - *sum += data[i]; - if (*min > data[i]) { - *min = data[i]; - *minIndex = i; - } - - if (*max < data[i]) { - *max = data[i]; - *maxIndex = i; - } - - // if (type != TSDB_DATA_TYPE_BOOL) { // ignore the bool data type pre-calculation - // if (isNull((char *)&lastVal, type)) { - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } else { - // *wsum = lastVal * (primaryKey[i] - lastKey); - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } - // } - } -} - -static void getStatics_i16(int64_t *primaryKey, int16_t *data, int32_t numOfRow, int64_t *min, int64_t *max, - int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int32_t *numOfNull) { - *min = INT64_MAX; - *max = INT64_MIN; - *minIndex = 0; - *maxIndex = 0; - - assert(numOfRow <= INT16_MAX); - - // int64_t lastKey = 0; - // int16_t lastVal = TSDB_DATA_SMALLINT_NULL; - - for (int32_t i = 0; i < numOfRow; ++i) { - if (isNull((const char*) &data[i], TSDB_DATA_TYPE_SMALLINT)) { - (*numOfNull) += 1; - continue; - } - - *sum += data[i]; - if (*min > data[i]) { - *min = data[i]; - *minIndex = i; - } - - if (*max < data[i]) { - *max = data[i]; - *maxIndex = i; - } - - // if (isNull(&lastVal, TSDB_DATA_TYPE_SMALLINT)) { - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } else { - // *wsum = lastVal * (primaryKey[i] - lastKey); - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } - } -} - -static void getStatics_i32(int64_t *primaryKey, int32_t *data, int32_t numOfRow, int64_t *min, int64_t *max, - int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int32_t *numOfNull) { - *min = INT64_MAX; - *max = INT64_MIN; - *minIndex = 0; - *maxIndex = 0; - - assert(numOfRow <= INT16_MAX); - - // int64_t lastKey = 0; - // int32_t lastVal = TSDB_DATA_INT_NULL; - - for (int32_t i = 0; i < numOfRow; ++i) { - if (isNull((const char*) &data[i], TSDB_DATA_TYPE_INT)) { - (*numOfNull) += 1; - continue; - } - - *sum += data[i]; - if (*min > data[i]) { - *min = data[i]; - *minIndex = i; - } - - if (*max < data[i]) { - *max = data[i]; - *maxIndex = i; - } - - // if (isNull(&lastVal, TSDB_DATA_TYPE_INT)) { - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } else { - // *wsum = lastVal * (primaryKey[i] - lastKey); - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } - } -} - -static void getStatics_i64(int64_t *primaryKey, int64_t *data, int32_t numOfRow, int64_t *min, int64_t *max, - int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int32_t *numOfNull) { - *min = INT64_MAX; - *max = INT64_MIN; - *minIndex = 0; - *maxIndex = 0; - - assert(numOfRow <= INT16_MAX); - - for (int32_t i = 0; i < numOfRow; ++i) { - if (isNull((const char*) &data[i], TSDB_DATA_TYPE_BIGINT)) { - (*numOfNull) += 1; - continue; - } - - *sum += data[i]; - if (*min > data[i]) { - *min = data[i]; - *minIndex = i; - } - - if (*max < data[i]) { - *max = data[i]; - *maxIndex = i; - } - - // if (isNull(&lastVal, TSDB_DATA_TYPE_BIGINT)) { - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } else { - // *wsum = lastVal * (primaryKey[i] - lastKey); - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } - } -} - -static void getStatics_f(int64_t *primaryKey, float *data, int32_t numOfRow, double *min, double *max, double *sum, - int16_t *minIndex, int16_t *maxIndex, int32_t *numOfNull) { - float fmin = DBL_MAX; - float fmax = -DBL_MAX; - double dsum = 0; - *minIndex = 0; - *maxIndex = 0; - - assert(numOfRow <= INT16_MAX); - - for (int32_t i = 0; i < numOfRow; ++i) { - if (isNull((const char*) &data[i], TSDB_DATA_TYPE_FLOAT)) { - (*numOfNull) += 1; - continue; - } - - float fv = 0; - fv = GET_FLOAT_VAL(&(data[i])); - dsum += fv; - if (fmin > fv) { - fmin = fv; - *minIndex = i; - } - - if (fmax < fv) { - fmax = fv; - *maxIndex = i; - } - - // if (isNull(&lastVal, TSDB_DATA_TYPE_FLOAT)) { - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } else { - // *wsum = lastVal * (primaryKey[i] - lastKey); - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } - } - - double csum = 0; - csum = GET_DOUBLE_VAL(sum); - csum += dsum; -#ifdef _TD_ARM_32_ - SET_DOUBLE_VAL_ALIGN(sum, &csum); - SET_DOUBLE_VAL_ALIGN(max, &fmax); - SET_DOUBLE_VAL_ALIGN(min, &fmin); -#else - *sum = csum; - *max = fmax; - *min = fmin; -#endif -} - -static void getStatics_d(int64_t *primaryKey, double *data, int32_t numOfRow, double *min, double *max, double *sum, - int16_t *minIndex, int16_t *maxIndex, int32_t *numOfNull) { - double dmin = DBL_MAX; - double dmax = -DBL_MAX; - double dsum = 0; - *minIndex = 0; - *maxIndex = 0; - - assert(numOfRow <= INT16_MAX); - - for (int32_t i = 0; i < numOfRow; ++i) { - if (isNull((const char*) &data[i], TSDB_DATA_TYPE_DOUBLE)) { - (*numOfNull) += 1; - continue; - } - - double dv = 0; - dv = GET_DOUBLE_VAL(&(data[i])); - dsum += dv; - if (dmin > dv) { - dmin = dv; - *minIndex = i; - } - - if (dmax < dv) { - dmax = dv; - *maxIndex = i; - } - - // if (isNull(&lastVal, TSDB_DATA_TYPE_DOUBLE)) { - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } else { - // *wsum = lastVal * (primaryKey[i] - lastKey); - // lastKey = primaryKey[i]; - // lastVal = data[i]; - // } - } - - double csum = 0; - csum = GET_DOUBLE_VAL(sum); - csum += dsum; - - -#ifdef _TD_ARM_32_ - SET_DOUBLE_VAL_ALIGN(sum, &csum); - SET_DOUBLE_VAL_ALIGN(max, &dmax); - SET_DOUBLE_VAL_ALIGN(min, &dmin); -#else - *sum = csum; - *max = dmax; - *min = dmin; -#endif -} - -void getStatistics(char *priData, char *data, int32_t size, int32_t numOfRow, int32_t type, int64_t *min, int64_t *max, - int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int32_t *numOfNull) { - int64_t *primaryKey = (int64_t *)priData; - if (type == TSDB_DATA_TYPE_BINARY || type == TSDB_DATA_TYPE_NCHAR) { - for (int32_t i = 0; i < numOfRow; ++i) { - if (isNull(data + i * size, type)) { - (*numOfNull) += 1; - continue; - } - } - } else { - if (type == TSDB_DATA_TYPE_TINYINT || type == TSDB_DATA_TYPE_BOOL) { - getStatics_i8(primaryKey, type, (int8_t *)data, numOfRow, min, max, sum, minIndex, maxIndex, numOfNull); - } else if (type == TSDB_DATA_TYPE_SMALLINT) { - getStatics_i16(primaryKey, (int16_t *)data, numOfRow, min, max, sum, minIndex, maxIndex, numOfNull); - } else if (type == TSDB_DATA_TYPE_INT) { - getStatics_i32(primaryKey, (int32_t *)data, numOfRow, min, max, sum, minIndex, maxIndex, numOfNull); - } else if (type == TSDB_DATA_TYPE_BIGINT || type == TSDB_DATA_TYPE_TIMESTAMP) { - getStatics_i64(primaryKey, (int64_t *)data, numOfRow, min, max, sum, minIndex, maxIndex, numOfNull); - } else if (type == TSDB_DATA_TYPE_DOUBLE) { - getStatics_d(primaryKey, (double *)data, numOfRow, (double*) min, (double*) max, (double*) sum, minIndex, maxIndex, numOfNull); - } else if (type == TSDB_DATA_TYPE_FLOAT) { - getStatics_f(primaryKey, (float *)data, numOfRow, (double*) min, (double*) max, (double*) sum, minIndex, maxIndex, numOfNull); - } - } -} /** * param[1]: start time diff --git a/src/common/src/ttypes.c b/src/common/src/ttypes.c index 626fde3293..a972881a41 100644 --- a/src/common/src/ttypes.c +++ b/src/common/src/ttypes.c @@ -32,18 +32,280 @@ const int32_t TYPE_BYTES[11] = { sizeof(VarDataOffsetT) // TSDB_DATA_TYPE_NCHAR }; +static void getStatics_i8(const TSKEY *primaryKey, const void *pData, int32_t numOfRow, int64_t *min, int64_t *max, + int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int16_t *numOfNull) { + int8_t *data = (int8_t *)pData; + *min = INT64_MAX; + *max = INT64_MIN; + *minIndex = 0; + *maxIndex = 0; + + ASSERT(numOfRow <= INT16_MAX); + + // int64_t lastKey = 0; + // int8_t lastVal = TSDB_DATA_TINYINT_NULL; + + for (int32_t i = 0; i < numOfRow; ++i) { + if (isNull((char *)&data[i], TSDB_DATA_TYPE_TINYINT)) { + (*numOfNull) += 1; + continue; + } + + *sum += data[i]; + if (*min > data[i]) { + *min = data[i]; + *minIndex = i; + } + + if (*max < data[i]) { + *max = data[i]; + *maxIndex = i; + } + } +} + +static void getStatics_i16(const TSKEY *primaryKey, const void *pData, int32_t numOfRow, int64_t *min, int64_t *max, + int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int16_t *numOfNull) { + int16_t *data = (int16_t *)pData; + *min = INT64_MAX; + *max = INT64_MIN; + *minIndex = 0; + *maxIndex = 0; + + ASSERT(numOfRow <= INT16_MAX); + + // int64_t lastKey = 0; + // int16_t lastVal = TSDB_DATA_SMALLINT_NULL; + + for (int32_t i = 0; i < numOfRow; ++i) { + if (isNull((const char*) &data[i], TSDB_DATA_TYPE_SMALLINT)) { + (*numOfNull) += 1; + continue; + } + + *sum += data[i]; + if (*min > data[i]) { + *min = data[i]; + *minIndex = i; + } + + if (*max < data[i]) { + *max = data[i]; + *maxIndex = i; + } + + // if (isNull(&lastVal, TSDB_DATA_TYPE_SMALLINT)) { + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } else { + // *wsum = lastVal * (primaryKey[i] - lastKey); + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } + } +} + +static void getStatics_i32(const TSKEY *primaryKey, const void *pData, int32_t numOfRow, int64_t *min, int64_t *max, + int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int16_t *numOfNull) { + int32_t *data = (int32_t *)pData; + *min = INT64_MAX; + *max = INT64_MIN; + *minIndex = 0; + *maxIndex = 0; + + ASSERT(numOfRow <= INT16_MAX); + + // int64_t lastKey = 0; + // int32_t lastVal = TSDB_DATA_INT_NULL; + + for (int32_t i = 0; i < numOfRow; ++i) { + if (isNull((const char*) &data[i], TSDB_DATA_TYPE_INT)) { + (*numOfNull) += 1; + continue; + } + + *sum += data[i]; + if (*min > data[i]) { + *min = data[i]; + *minIndex = i; + } + + if (*max < data[i]) { + *max = data[i]; + *maxIndex = i; + } + + // if (isNull(&lastVal, TSDB_DATA_TYPE_INT)) { + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } else { + // *wsum = lastVal * (primaryKey[i] - lastKey); + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } + } +} + +static void getStatics_i64(const TSKEY *primaryKey, const void *pData, int32_t numOfRow, int64_t *min, int64_t *max, + int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int16_t *numOfNull) { + int64_t *data = (int64_t *)pData; + *min = INT64_MAX; + *max = INT64_MIN; + *minIndex = 0; + *maxIndex = 0; + + ASSERT(numOfRow <= INT16_MAX); + + for (int32_t i = 0; i < numOfRow; ++i) { + if (isNull((const char*) &data[i], TSDB_DATA_TYPE_BIGINT)) { + (*numOfNull) += 1; + continue; + } + + *sum += data[i]; + if (*min > data[i]) { + *min = data[i]; + *minIndex = i; + } + + if (*max < data[i]) { + *max = data[i]; + *maxIndex = i; + } + + // if (isNull(&lastVal, TSDB_DATA_TYPE_BIGINT)) { + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } else { + // *wsum = lastVal * (primaryKey[i] - lastKey); + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } + } +} + +static void getStatics_f(const TSKEY *primaryKey, const void *pData, int32_t numOfRow, int64_t *min, int64_t *max, + int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int16_t *numOfNull) { + float *data = (float *)pData; + float fmin = DBL_MAX; + float fmax = -DBL_MAX; + double dsum = 0; + *minIndex = 0; + *maxIndex = 0; + + ASSERT(numOfRow <= INT16_MAX); + + for (int32_t i = 0; i < numOfRow; ++i) { + if (isNull((const char*) &data[i], TSDB_DATA_TYPE_FLOAT)) { + (*numOfNull) += 1; + continue; + } + + float fv = 0; + fv = GET_FLOAT_VAL(&(data[i])); + dsum += fv; + if (fmin > fv) { + fmin = fv; + *minIndex = i; + } + + if (fmax < fv) { + fmax = fv; + *maxIndex = i; + } + + // if (isNull(&lastVal, TSDB_DATA_TYPE_FLOAT)) { + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } else { + // *wsum = lastVal * (primaryKey[i] - lastKey); + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } + } + + double csum = 0; + csum = GET_DOUBLE_VAL(sum); + csum += dsum; +#ifdef _TD_ARM_32_ + SET_DOUBLE_VAL_ALIGN(sum, &csum); + SET_DOUBLE_VAL_ALIGN(max, &fmax); + SET_DOUBLE_VAL_ALIGN(min, &fmin); +#else + *sum = csum; + *max = fmax; + *min = fmin; +#endif +} + +static void getStatics_d(const TSKEY *primaryKey, const void *pData, int32_t numOfRow, int64_t *min, int64_t *max, + int64_t *sum, int16_t *minIndex, int16_t *maxIndex, int16_t *numOfNull) { + double *data = (double *)pData; + double dmin = DBL_MAX; + double dmax = -DBL_MAX; + double dsum = 0; + *minIndex = 0; + *maxIndex = 0; + + ASSERT(numOfRow <= INT16_MAX); + + for (int32_t i = 0; i < numOfRow; ++i) { + if (isNull((const char*) &data[i], TSDB_DATA_TYPE_DOUBLE)) { + (*numOfNull) += 1; + continue; + } + + double dv = 0; + dv = GET_DOUBLE_VAL(&(data[i])); + dsum += dv; + if (dmin > dv) { + dmin = dv; + *minIndex = i; + } + + if (dmax < dv) { + dmax = dv; + *maxIndex = i; + } + + // if (isNull(&lastVal, TSDB_DATA_TYPE_DOUBLE)) { + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } else { + // *wsum = lastVal * (primaryKey[i] - lastKey); + // lastKey = primaryKey[i]; + // lastVal = data[i]; + // } + } + + double csum = 0; + csum = GET_DOUBLE_VAL(sum); + csum += dsum; + + +#ifdef _TD_ARM_32_ + SET_DOUBLE_VAL_ALIGN(sum, &csum); + SET_DOUBLE_VAL_ALIGN(max, &dmax); + SET_DOUBLE_VAL_ALIGN(min, &dmin); +#else + *sum = csum; + *max = dmax; + *min = dmin; +#endif +} + tDataTypeDescriptor tDataTypeDesc[11] = { - {TSDB_DATA_TYPE_NULL, 6, 1, "NOTYPE", NULL, NULL}, - {TSDB_DATA_TYPE_BOOL, 4, CHAR_BYTES, "BOOL", tsCompressBool, tsDecompressBool}, - {TSDB_DATA_TYPE_TINYINT, 7, CHAR_BYTES, "TINYINT", tsCompressTinyint, tsDecompressTinyint}, - {TSDB_DATA_TYPE_SMALLINT, 8, SHORT_BYTES, "SMALLINT", tsCompressSmallint, tsDecompressSmallint}, - {TSDB_DATA_TYPE_INT, 3, INT_BYTES, "INT", tsCompressInt, tsDecompressInt}, - {TSDB_DATA_TYPE_BIGINT, 6, LONG_BYTES, "BIGINT", tsCompressBigint, tsDecompressBigint}, - {TSDB_DATA_TYPE_FLOAT, 5, FLOAT_BYTES, "FLOAT", tsCompressFloat, tsDecompressFloat}, - {TSDB_DATA_TYPE_DOUBLE, 6, DOUBLE_BYTES, "DOUBLE", tsCompressDouble, tsDecompressDouble}, - {TSDB_DATA_TYPE_BINARY, 6, 0, "BINARY", tsCompressString, tsDecompressString}, - {TSDB_DATA_TYPE_TIMESTAMP, 9, LONG_BYTES, "TIMESTAMP", tsCompressTimestamp, tsDecompressTimestamp}, - {TSDB_DATA_TYPE_NCHAR, 5, 8, "NCHAR", tsCompressString, tsDecompressString}, + {TSDB_DATA_TYPE_NULL, 6, 1, "NOTYPE", NULL, NULL, NULL}, + {TSDB_DATA_TYPE_BOOL, 4, CHAR_BYTES, "BOOL", tsCompressBool, tsDecompressBool, NULL}, + {TSDB_DATA_TYPE_TINYINT, 7, CHAR_BYTES, "TINYINT", tsCompressTinyint, tsDecompressTinyint, getStatics_i8}, + {TSDB_DATA_TYPE_SMALLINT, 8, SHORT_BYTES, "SMALLINT", tsCompressSmallint, tsDecompressSmallint, getStatics_i16}, + {TSDB_DATA_TYPE_INT, 3, INT_BYTES, "INT", tsCompressInt, tsDecompressInt, getStatics_i32}, + {TSDB_DATA_TYPE_BIGINT, 6, LONG_BYTES, "BIGINT", tsCompressBigint, tsDecompressBigint, getStatics_i64}, + {TSDB_DATA_TYPE_FLOAT, 5, FLOAT_BYTES, "FLOAT", tsCompressFloat, tsDecompressFloat, getStatics_f}, + {TSDB_DATA_TYPE_DOUBLE, 6, DOUBLE_BYTES, "DOUBLE", tsCompressDouble, tsDecompressDouble, getStatics_d}, + {TSDB_DATA_TYPE_BINARY, 6, 0, "BINARY", tsCompressString, tsDecompressString, NULL}, + {TSDB_DATA_TYPE_TIMESTAMP, 9, LONG_BYTES, "TIMESTAMP", tsCompressTimestamp, tsDecompressTimestamp, NULL}, + {TSDB_DATA_TYPE_NCHAR, 5, 8, "NCHAR", tsCompressString, tsDecompressString, NULL}, }; char tTokenTypeSwitcher[13] = { diff --git a/src/inc/taosdef.h b/src/inc/taosdef.h index 23436fe6a5..5dad1bdb53 100644 --- a/src/inc/taosdef.h +++ b/src/inc/taosdef.h @@ -147,6 +147,8 @@ typedef struct tDataTypeDescriptor { char algorithm, char *const buffer, int bufferSize); int (*decompFunc)(const char *const input, int compressedSize, const int nelements, char *const output, int outputSize, char algorithm, char *const buffer, int bufferSize); + void (*getStatisFunc)(const TSKEY *primaryKey, const void *pData, int32_t numofrow, int64_t *min, int64_t *max, + int64_t *sum, int16_t *minindex, int16_t *maxindex, int16_t *numofnull); } tDataTypeDescriptor; extern tDataTypeDescriptor tDataTypeDesc[11]; diff --git a/src/tsdb/inc/tsdbMain.h b/src/tsdb/inc/tsdbMain.h index fbf6e0f272..6b7a77c798 100644 --- a/src/tsdb/inc/tsdbMain.h +++ b/src/tsdb/inc/tsdbMain.h @@ -325,6 +325,13 @@ typedef struct { int16_t len; // Column length // TODO: int16_t is not enough int32_t type : 8; int32_t offset : 24; + int64_t sum; + int64_t max; + int64_t min; + int16_t maxIndex; + int16_t minIndex; + int16_t numOfNull; + char padding[2]; } SCompCol; // TODO: Take recover into account diff --git a/src/tsdb/src/tsdbRWHelper.c b/src/tsdb/src/tsdbRWHelper.c index e32a646296..ebecf887d3 100644 --- a/src/tsdb/src/tsdbRWHelper.c +++ b/src/tsdb/src/tsdbRWHelper.c @@ -703,6 +703,11 @@ static int tsdbWriteBlockToFile(SRWHelper *pHelper, SFile *pFile, SDataCols *pDa pCompCol->colId = pDataCol->colId; pCompCol->type = pDataCol->type; + if (tDataTypeDesc[pDataCol->type].getStatisFunc) { + (*tDataTypeDesc[pDataCol->type].getStatisFunc)( + (TSKEY *)(pDataCols->cols[0].pData), pDataCol->pData, rowsToWrite, &(pCompCol->min), &(pCompCol->max), + &(pCompCol->sum), &(pCompCol->minIndex), &(pCompCol->maxIndex), &(pCompCol->numOfNull)); + } nColsNotAllNull++; } From e7a165bfd7dcdab32fa6ecdf950a560a12cbff84 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Thu, 14 May 2020 08:27:35 +0000 Subject: [PATCH 038/126] fix tsdb print int64_t data --- src/tsdb/src/tsdbMain.c | 2 +- src/tsdb/src/tsdbMeta.c | 6 +++--- 2 files changed, 4 insertions(+), 4 deletions(-) diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index 41837eab5f..956a82cb4f 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -840,7 +840,7 @@ static int32_t tdInsertRowToTable(STsdbRepo *pRepo, SDataRow row, STable *pTable pTable->mem->numOfPoints = tSkipListGetSize(pTable->mem->pData); - tsdbTrace("vgId:%d, tid:%d, uid:" PRId64 ", a row is inserted to table! key:" PRId64, + tsdbTrace("vgId:%d, tid:%d, uid:%" PRId64 ", a row is inserted to table! key:%" PRId64, pRepo->config.tsdbId, pTable->tableId.tid, pTable->tableId.uid, dataRowKey(row)); return 0; diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index 59d776c0ba..b7a7535a48 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -356,11 +356,11 @@ int tsdbCreateTable(TsdbRepoT *repo, STableCfg *pCfg) { // Register to meta if (newSuper) { tsdbAddTableToMeta(pMeta, super, true); - tsdbTrace("vgId:%d, super table is created! uid:" PRId64, pRepo->config.tsdbId, + tsdbTrace("vgId:%d, super table is created! uid:%" PRId64, pRepo->config.tsdbId, super->tableId.uid); } tsdbAddTableToMeta(pMeta, table, true); - tsdbTrace("vgId:%d, table is created! tid:%d, uid:" PRId64, pRepo->config.tsdbId, table->tableId.tid, + tsdbTrace("vgId:%d, table is created! tid:%d, uid:%" PRId64, pRepo->config.tsdbId, table->tableId.tid, table->tableId.uid); // Write to meta file @@ -409,7 +409,7 @@ int tsdbDropTable(TsdbRepoT *repo, STableId tableId) { return -1; } - tsdbTrace("vgId:%d, table is dropped! tid:%d, uid:" PRId64, pRepo->config.tsdbId, tableId.tid, tableId.uid); + tsdbTrace("vgId:%d, table is dropped! tid:%d, uid:%" PRId64, pRepo->config.tsdbId, tableId.tid, tableId.uid); if (tsdbRemoveTableFromMeta(pMeta, pTable) < 0) return -1; return 0; From cff7b8aff06a762c9556242d9196fb877252f49d Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Thu, 14 May 2020 16:41:20 +0800 Subject: [PATCH 039/126] fix bug while send status msg --- src/mnode/src/mgmtDnode.c | 1 + src/mnode/src/mgmtVgroup.c | 2 +- src/vnode/src/vnodeMain.c | 1 - 3 files changed, 2 insertions(+), 2 deletions(-) diff --git a/src/mnode/src/mgmtDnode.c b/src/mnode/src/mgmtDnode.c index 463f5dde47..c3ae8b5ab1 100644 --- a/src/mnode/src/mgmtDnode.c +++ b/src/mnode/src/mgmtDnode.c @@ -74,6 +74,7 @@ static int32_t mgmtDnodeActionDelete(SSdbOper *pOper) { SDnodeObj *pDnode = pOper->pObj; #ifndef _SYNC + //TODO: drop dnode local mgmtDropAllDnodeVgroups(pDnode); #endif mgmtDropMnodeLocal(pDnode->dnodeId); diff --git a/src/mnode/src/mgmtVgroup.c b/src/mnode/src/mgmtVgroup.c index f8447a31fd..8b3ab5e8d1 100644 --- a/src/mnode/src/mgmtVgroup.c +++ b/src/mnode/src/mgmtVgroup.c @@ -666,7 +666,6 @@ static SMDDropVnodeMsg *mgmtBuildDropVnodeMsg(int32_t vgId) { } void mgmtSendDropVnodeMsg(int32_t vgId, SRpcIpSet *ipSet, void *ahandle) { - mTrace("vgId:%d, send drop vnode msg, ahandle:%p", vgId, ahandle); SMDDropVnodeMsg *pDrop = mgmtBuildDropVnodeMsg(vgId); SRpcMsg rpcMsg = { .handle = ahandle, @@ -682,6 +681,7 @@ static void mgmtSendDropVgroupMsg(SVgObj *pVgroup, void *ahandle) { mTrace("vgId:%d, send drop all vnodes msg, ahandle:%p", pVgroup->vgId, ahandle); for (int32_t i = 0; i < pVgroup->numOfVnodes; ++i) { SRpcIpSet ipSet = mgmtGetIpSetFromIp(pVgroup->vnodeGid[i].pDnode->dnodeEp); + mTrace("vgId:%d, send drop vnode msg to dnode:%d, ahandle:%p", vgId, pVgroup->vnodeGid[i].dnodeId, ahandle); mgmtSendDropVnodeMsg(pVgroup->vgId, &ipSet, ahandle); } } diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index a194a93d2b..4bcc0760ab 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -352,7 +352,6 @@ static void vnodeBuildVloadMsg(SVnodeObj *pVnode, SDMStatusMsg *pStatus) { pLoad->status = pVnode->status; pLoad->role = pVnode->role; pLoad->replica = pVnode->syncCfg.replica; - pStatus->openVnodes++; } void vnodeBuildStatusMsg(void *param) { From f2567eb782701df093284da41edaf6b4d2a8fad9 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Thu, 14 May 2020 16:56:24 +0800 Subject: [PATCH 040/126] fix memory leak while drop stable --- src/mnode/src/mgmtTable.c | 1 + src/mnode/src/mgmtVgroup.c | 2 +- 2 files changed, 2 insertions(+), 1 deletion(-) diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index bd4f022bc1..db5bcfbe62 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -546,6 +546,7 @@ static void *mgmtGetSuperTableByUid(uint64_t uid) { pIter = mgmtGetNextSuperTable(pIter, &pStable); if (pStable == NULL) break; if (pStable->uid == uid) { + sdbFreeIter(pIter); return pStable; } mgmtDecTableRef(pStable); diff --git a/src/mnode/src/mgmtVgroup.c b/src/mnode/src/mgmtVgroup.c index 8b3ab5e8d1..1416ed5f58 100644 --- a/src/mnode/src/mgmtVgroup.c +++ b/src/mnode/src/mgmtVgroup.c @@ -681,7 +681,7 @@ static void mgmtSendDropVgroupMsg(SVgObj *pVgroup, void *ahandle) { mTrace("vgId:%d, send drop all vnodes msg, ahandle:%p", pVgroup->vgId, ahandle); for (int32_t i = 0; i < pVgroup->numOfVnodes; ++i) { SRpcIpSet ipSet = mgmtGetIpSetFromIp(pVgroup->vnodeGid[i].pDnode->dnodeEp); - mTrace("vgId:%d, send drop vnode msg to dnode:%d, ahandle:%p", vgId, pVgroup->vnodeGid[i].dnodeId, ahandle); + mTrace("vgId:%d, send drop vnode msg to dnode:%d, ahandle:%p", pVgroup->vgId, pVgroup->vnodeGid[i].dnodeId, ahandle); mgmtSendDropVnodeMsg(pVgroup->vgId, &ipSet, ahandle); } } From c094c957f64e14838dc78d5dca68f3782fe65d1a Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Thu, 14 May 2020 17:09:59 +0800 Subject: [PATCH 041/126] scripts --- tests/script/general/db/delete.sim | 59 ++++++++++++++++++ tests/script/jenkins/basic.txt | 15 ++--- tests/script/unique/db/commit.sim | 4 +- tests/script/unique/db/delete.sim | 51 ++++++++++++++-- tests/script/unique/dnode/vnode_clean.sim | 73 +++++++++++------------ 5 files changed, 148 insertions(+), 54 deletions(-) create mode 100644 tests/script/general/db/delete.sim diff --git a/tests/script/general/db/delete.sim b/tests/script/general/db/delete.sim new file mode 100644 index 0000000000..f86774c2cf --- /dev/null +++ b/tests/script/general/db/delete.sim @@ -0,0 +1,59 @@ +system sh/stop_dnodes.sh +system sh/deploy.sh -n dnode1 -i 1 +system sh/cfg.sh -n dnode1 -c wallevel -v 2 +system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v 10 + +print ========= start dnodes +system sh/exec.sh -n dnode1 -s start +sleep 3000 +sql connect + +print ======== step1 +sql create database db blocks 2 maxtables 1000 +sql create table db.mt (ts timestamp, tbcol int) TAGS(tgcol int) + +$tbPrefix = db.t +$i = 0 +while $i < 2000 + $tb = $tbPrefix . $i + sql create table $tb using db.mt tags( $i ) + $i = $i + 1 +endw + +print ======== step2 +sleep 1000 +sql drop database db +sql show databases +if $rows != 0 then + return -1 +endi + +sleep 1000 +sql show dnodes +print dnode1 openVnodes $data2_1 +if $data2_1 != 0 then + return -1 +endi + +print ======= step3 +system sh/exec.sh -n dnode1 -s stop -x SIGINT +sleep 1000 +system sh/exec.sh -n dnode1 -s start + +$x = 0 +step3: + $x = $x + 1 + sleep 2000 + if $x == 30 then + return -1 + endi + +sql show mnodes +print dnode1 role $data2_1 +if $data2_1 != master then + goto step3 +endi + +sleep 1000 + +system sh/exec.sh -n dnode1 -s stop -x SIGINT diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index c9cb696016..94c9c71edc 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -49,6 +49,7 @@ cd ../../../debug; make ./test.sh -f general/db/basic3.sim ./test.sh -f general/db/basic4.sim ./test.sh -f general/db/basic5.sim +./test.sh -f unique/db/delete.sim ./test.sh -f general/db/delete_reuse1.sim ./test.sh -f general/db/delete_reuse2.sim ./test.sh -f general/db/delete_reusevnode.sim @@ -243,15 +244,15 @@ cd ../../../debug; make #slguan ./test.sh -u -f unique/big/maxvnodes.sim ./test.sh -u -f unique/big/tcp.sim -##./test.sh -u -f unique/cluster/balance1.sim -##./test.sh -u -f unique/cluster/balance2.sim -##./test.sh -u -f unique/cluster/balance3.sim +#jeff ./test.sh -u -f unique/cluster/balance1.sim +#jeff ./test.sh -u -f unique/cluster/balance2.sim +#jeff ./test.sh -u -f unique/cluster/balance3.sim #./test.sh -u -f unique/cluster/cache.sim ./test.sh -u -f unique/column/replica3.sim -#./test.sh -u -f unique/db/commit.sim -#./test.sh -u -f unique/db/delete.sim +#hongze ./test.sh -u -f unique/db/commit.sim +./test.sh -u -f unique/db/delete.sim #./test.sh -u -f unique/db/delete_part.sim ##./test.sh -u -f unique/db/replica_add12.sim ##./test.sh -u -f unique/db/replica_add13.sim @@ -269,7 +270,7 @@ cd ../../../debug; make ##./test.sh -u -f unique/dnode/offline2.sim ./test.sh -u -f unique/dnode/remove1.sim #hongze ./test.sh -u -f unique/dnode/remove2.sim -#./test.sh -u -f unique/dnode/vnode_clean.sim +./test.sh -u -f unique/dnode/vnode_clean.sim ./test.sh -u -f unique/http/admin.sim ./test.sh -u -f unique/http/opentsdb.sim @@ -302,6 +303,6 @@ cd ../../../debug; make #./test.sh -u -f unique/vnode/replica2_basic.sim ./test.sh -u -f unique/vnode/replica2_basic2.sim #./test.sh -u -f unique/vnode/replica2_repeat.sim -##./test.sh -u -f unique/vnode/replica3_basic.sim +#hongze ./test.sh -u -f unique/vnode/replica3_basic.sim #./test.sh -u -f unique/vnode/replica3_repeat.sim #./test.sh -u -f unique/vnode/replica3_vgroup.sim diff --git a/tests/script/unique/db/commit.sim b/tests/script/unique/db/commit.sim index 648cd8db2f..5bf6ea6f10 100644 --- a/tests/script/unique/db/commit.sim +++ b/tests/script/unique/db/commit.sim @@ -72,8 +72,8 @@ sql import into tb values (now - 10d , -10 ) sql import into tb values (now - 11d , -11 ) sql select * from tb order by ts desc -print ===> rows $rows -print ===> last $data01 +print ===> rows $rows expect $num +print ===> last $data01 expect $data01 if $rows != $num then return -1 diff --git a/tests/script/unique/db/delete.sim b/tests/script/unique/db/delete.sim index e222db8d70..dcdd1ae9e9 100644 --- a/tests/script/unique/db/delete.sim +++ b/tests/script/unique/db/delete.sim @@ -1,7 +1,4 @@ system sh/stop_dnodes.sh - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/deploy.sh -n dnode3 -i 3 @@ -18,20 +15,20 @@ system sh/cfg.sh -n dnode3 -c numOfTotalVnodes -v 10 print ========= start dnodes system sh/exec_up.sh -n dnode1 -s start +sleep 3000 sql connect sql create dnode $hostname2 system sh/exec_up.sh -n dnode2 -s start sql create dnode $hostname3 system sh/exec_up.sh -n dnode3 -s start -sleep 3000 print ======== step1 -sql create database db replica 3 ablocks 2 tblocks 5 maxtables 10000 +sql create database db replica 3 blocks 2 maxtables 1000 sql create table db.mt (ts timestamp, tbcol int) TAGS(tgcol int) $tbPrefix = db.t $i = 0 -while $i < 100000 +while $i < 2000 $tb = $tbPrefix . $i sql create table $tb using db.mt tags( $i ) $i = $i + 1 @@ -45,6 +42,48 @@ if $rows != 0 then return -1 endi +sleep 3000 +sql show dnodes +print dnode1 openVnodes $data2_1 +print dnode2 openVnodes $data2_2 +print dnode3 openVnodes $data2_3 +if $data2_1 != 0 then + return -1 +endi +if $data2_2 != 0 then + return -1 +endi +if $data2_3 != 0 then + return -1 +endi + +print ======== step3 + +system sh/exec.sh -n dnode1 -s stop -x SIGINT +system sh/exec.sh -n dnode2 -s stop -x SIGINT +system sh/exec.sh -n dnode3 -s stop -x SIGINT + +sleep 1000 +system sh/exec.sh -n dnode1 -s start -t +system sh/exec.sh -n dnode2 -s start -t +system sh/exec.sh -n dnode3 -s start -t + +$x = 0 +step3: + $x = $x + 1 + sleep 2000 + if $x == 10 then + return -1 + endi + +sql show mnodes +print dnode1 role $data2_1 +if $data2_1 != master then + goto step3 +endi + +sleep 1000 + system sh/exec_up.sh -n dnode1 -s stop -x SIGINT system sh/exec_up.sh -n dnode2 -s stop -x SIGINT system sh/exec_up.sh -n dnode3 -s stop -x SIGINT diff --git a/tests/script/unique/dnode/vnode_clean.sim b/tests/script/unique/dnode/vnode_clean.sim index da34c7bc9b..d46e1a751e 100644 --- a/tests/script/unique/dnode/vnode_clean.sim +++ b/tests/script/unique/dnode/vnode_clean.sim @@ -29,7 +29,7 @@ sql insert into d1.t1 values(now+5s, 11) sql show dnodes print dnode1 openVnodes $data2_1 -if $data2_1 != 3 then +if $data2_1 != 1 then return -1 endi @@ -41,16 +41,16 @@ $x = 0 show2: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes print dnode1 openVnodes $data2_1 print dnode2 openVnodes $data2_2 -if $data2_1 != 4 then +if $data2_1 != 0 then goto show2 endi -if $data2_2 != 3 then +if $data2_2 != 1 then goto show2 endi @@ -68,7 +68,7 @@ $x = 0 sql show dnodes print dnode1 openVnodes $data2_1 print dnode2 openVnodes $data2_2 -if $data2_1 != 4 then +if $data2_1 != 0 then return -1 endi if $data2_2 != 2 then @@ -82,7 +82,7 @@ $x = 0 show4: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes @@ -91,7 +91,7 @@ print dnode2 openVnodes $data2_2 if $data2_1 != 2 then goto show4 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show4 endi if $rows != 1 then @@ -102,13 +102,8 @@ system sh/exec_up.sh -n dnode2 -s stop -x SIGINT print ========== step5 sleep 2000 -sql create dnode $hostname2 -system sh/deploy.sh -n dnode2 -i 2 -system sh/cfg.sh -n dnode2 -c numOfMPeers -v 1 -system sh/cfg.sh -n dnode2 -c balanceInterval -v 10 -system sh/cfg.sh -n dnode2 -c mgmtEqualVnodeNum -v 4 -system sh/cfg.sh -n dnode2 -c wallevel -v 1 -system sh/exec_up.sh -n dnode2 -s start +sql create dnode $hostname3 +system sh/exec_up.sh -n dnode3 -s start $x = 0 show5: @@ -119,11 +114,11 @@ show5: endi sql show dnodes print dnode1 openVnodes $data2_1 -print dnode2 openVnodes $data2_2 -if $data2_1 != 4 then +print dnode3 openVnodes $data2_3 +if $data2_1 != 0 then goto show5 endi -if $data2_2 != 2 then +if $data2_3 != 2 then goto show5 endi @@ -138,17 +133,17 @@ sql insert into d3.t3 values(now+5s, 31) sql show dnodes print dnode1 openVnodes $data2_1 -print dnode2 openVnodes $data2_2 -if $data2_1 != 4 then +print dnode2 openVnodes $data2_3 +if $data2_1 != 0 then return -1 endi -if $data2_2 != 1 then +if $data2_3 != 3 then return -1 endi print ========== step7 -sql create dnode $hostname3 -system sh/exec_up.sh -n dnode3 -s start +sql create dnode $hostname4 +system sh/exec_up.sh -n dnode4 -s start $x = 0 show7: @@ -160,15 +155,15 @@ show7: sql show dnodes print dnode1 openVnodes $data2_1 -print dnode2 openVnodes $data2_2 print dnode3 openVnodes $data2_3 -if $data2_1 != 4 then +print dnode4 openVnodes $data2_4 +if $data2_1 != 0 then goto show7 endi -if $data2_2 != 2 then +if $data2_3 != 2 then goto show7 endi -if $data2_3 != 3 then +if $data2_4 != 1 then goto show7 endi @@ -185,49 +180,49 @@ $x = 0 show8: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes print dnode1 openVnodes $data2_1 -print dnode2 openVnodes $data2_2 print dnode3 openVnodes $data2_3 -if $data2_1 != 4 then - goto show8 -endi -if $data2_2 != 2 then +print dnode4 openVnodes $data2_4 +if $data2_1 != 0 then goto show8 endi if $data2_3 != 2 then goto show8 endi +if $data2_4 != 2 then + goto show8 +endi print ========== step9 -sql drop dnode $hostname2 +sql drop dnode $hostname3 $x = 0 show9: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes print dnode1 openVnodes $data2_1 -print dnode2 openVnodes $data2_2 print dnode3 openVnodes $data2_3 -if $data2_1 != 4 then +print dnode4 openVnodes $data2_4 +if $data2_1 != 0 then goto show9 endi -if $data2_2 != NULL then +if $data2_3 != null then goto show9 endi -if $data2_3 != 0 then +if $data2_4 != 4 then goto show9 endi -system sh/exec_up.sh -n dnode2 -s stop -x SIGINT +system sh/exec_up.sh -n dnode3 -s stop -x SIGINT print ========== step10 sql select * from d1.t1 order by t desc From 995f90d4c198fce1eef038417d1d451a16310138 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Thu, 14 May 2020 17:50:42 +0800 Subject: [PATCH 042/126] add tag test cases. --- tests/pytest/tag_lite/create-tags-boundary.py | 55 +++++++++++ .../pytest/tag_lite/datatype-without-alter.py | 98 +++++++++++++++++++ 2 files changed, 153 insertions(+) create mode 100644 tests/pytest/tag_lite/create-tags-boundary.py create mode 100644 tests/pytest/tag_lite/datatype-without-alter.py diff --git a/tests/pytest/tag_lite/create-tags-boundary.py b/tests/pytest/tag_lite/create-tags-boundary.py new file mode 100644 index 0000000000..de9711afae --- /dev/null +++ b/tests/pytest/tag_lite/create-tags-boundary.py @@ -0,0 +1,55 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + boundary = 32 + for x in range(0, boundary): + stb_name = "stb%d" % x + + tagSeq = "tag0 int" + for y in range(1, x+1): + tagSeq = tagSeq + ", tag%d int" % y + + tdLog.info("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) + tdSql.execute("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) + + tdSql.query("show stables") + tdSql.checkRows(boundary) + + stb_name = "stb%d" % (boundary+1) + tagSeq = tagSeq + ", tag%d int" % (boundary+1) + tdLog.info("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) + tdSql.error("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) + tdSql.query("show stables") + tdSql.checkRows(boundary) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/tag_lite/datatype-without-alter.py b/tests/pytest/tag_lite/datatype-without-alter.py new file mode 100644 index 0000000000..1a8d05d648 --- /dev/null +++ b/tests/pytest/tag_lite/datatype-without-alter.py @@ -0,0 +1,98 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + self.ntables = 10 + self.rowsPerTable = 10 + self.startTime = 1520000010000 + + tdDnodes.stop(1) + tdDnodes.deploy(1) + tdDnodes.start(1) + + tdLog.info("================= step0") + tdSql.execute('reset query cache') + tdLog.info("drop database db if exits") + tdSql.execute('drop database if exists db') + tdLog.info("================= step1") + tdSql.execute('create database db maxtables 4') + tdLog.sleep(5) + tdSql.execute('use db') + + tdLog.info("================= step1") + tdLog.info("create 1 super table") + tdSql.execute('create table stb (ts timestamp, i int) \ + tags (tin int, tfl float, tbg bigint, tdo double, tbi binary(10), tbl bool)') + + tdLog.info("================= step2") + tdLog.info("create %d tables" % self.ntables) + for tid in range(1, self.ntables + 1): + tdSql.execute( + 'create table tb%d using stb tags(%d,%f,%ld,%f,\'%s\',%d)' % + (tid, + tid % + 3, + 1.2 * + tid, + self.startTime + + tid, + 1.22 * + tid, + 't' + + str(tid), + tid % + 2)) + tdLog.sleep(5) + + tdLog.info("================= step3") + tdLog.info( + "insert %d data in to each %d tables" % + (self.rowsPerTable, self.ntables)) + for rid in range(1, self.rowsPerTable + 1): + sqlcmd = ['insert into'] + for tid in range(1, self.ntables + 1): + sqlcmd.append( + 'tb%d values(%ld,%d)' % + (tid, self.startTime + rid, rid)) + tdSql.execute(" ".join(sqlcmd)) + tdSql.query('select count(*) from stb') + tdSql.checkData(0, 0, self.rowsPerTable * self.ntables) + + tdLog.info("================= step6") + tdLog.info("group and filter by tag1 int") + tdSql.query('select max(i) from stb where tbl=0 group by tin') + tdSql.checkRows(3) + tdSql.execute('reset query cache') + tdSql.query('select max(i) from stb where tbl=true group by tin') + tdSql.checkData(2, 0, self.rowsPerTable) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) From ddc68fb721af92b94bf4a05a64ff13d06f613314 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Thu, 14 May 2020 17:57:28 +0800 Subject: [PATCH 043/126] fix sid index while create table --- src/mnode/src/mgmtTable.c | 14 +++++++------- 1 file changed, 7 insertions(+), 7 deletions(-) diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index db5bcfbe62..3e3b16fa9d 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -1460,15 +1460,15 @@ static void mgmtProcessCreateChildTableMsg(SQueuedMsg *pMsg) { return; } - int32_t sid = taosAllocateId(pVgroup->idPool); - if (sid <= 0) { - mTrace("tables:%s, no enough sid in vgId:%d", pCreate->tableId, pVgroup->vgId); - mgmtCreateVgroup(mgmtCloneQueuedMsg(pMsg), pMsg->pDb); - return; - } - if (pMsg->retry == 0) { if (pMsg->pTable == NULL) { + int32_t sid = taosAllocateId(pVgroup->idPool); + if (sid <= 0) { + mTrace("tables:%s, no enough sid in vgId:%d", pCreate->tableId, pVgroup->vgId); + mgmtCreateVgroup(mgmtCloneQueuedMsg(pMsg), pMsg->pDb); + return; + } + pMsg->pTable = (STableObj *)mgmtDoCreateChildTable(pCreate, pVgroup, sid); mgmtIncTableRef(pMsg->pTable); } From 8ff091de25affc3ef52d488cb5f3cc9cd2a485df Mon Sep 17 00:00:00 2001 From: Tao Liu Date: Thu, 14 May 2020 10:19:29 +0000 Subject: [PATCH 044/126] [TD-324] add affected rows in the insert cmd result --- src/inc/tsdb.h | 2 +- src/tsdb/src/tsdbMain.c | 12 +++++++----- src/vnode/src/vnodeWrite.c | 11 +++++------ 3 files changed, 13 insertions(+), 12 deletions(-) diff --git a/src/inc/tsdb.h b/src/inc/tsdb.h index 32e3541692..ee851ca064 100644 --- a/src/inc/tsdb.h +++ b/src/inc/tsdb.h @@ -140,7 +140,7 @@ STableInfo *tsdbGetTableInfo(TsdbRepoT *pRepo, STableId tid); * * @return the number of points inserted, -1 for failure and the error number is set */ -int32_t tsdbInsertData(TsdbRepoT *pRepo, SSubmitMsg *pMsg); +int32_t tsdbInsertData(TsdbRepoT *repo, SSubmitMsg *pMsg, SShellSubmitRspMsg * pRsp) ; // -- FOR QUERY TIME SERIES DATA diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index c85f5cc838..f1bddadabe 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -29,7 +29,7 @@ static int32_t tsdbCheckAndSetDefaultCfg(STsdbCfg *pCfg); static int32_t tsdbSetRepoEnv(STsdbRepo *pRepo); static int32_t tsdbDestroyRepoEnv(STsdbRepo *pRepo); // static int tsdbOpenMetaFile(char *tsdbDir); -static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY now); +static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY now, int * affectedrows); static int32_t tsdbRestoreCfg(STsdbRepo *pRepo, STsdbCfg *pCfg); static int32_t tsdbGetDataDirName(STsdbRepo *pRepo, char *fname); static void * tsdbCommitData(void *arg); @@ -406,22 +406,23 @@ STableInfo *tsdbGetTableInfo(TsdbRepoT *pRepo, STableId tableId) { } // TODO: need to return the number of data inserted -int32_t tsdbInsertData(TsdbRepoT *repo, SSubmitMsg *pMsg) { +int32_t tsdbInsertData(TsdbRepoT *repo, SSubmitMsg *pMsg, SShellSubmitRspMsg * pRsp) { SSubmitMsgIter msgIter; STsdbRepo *pRepo = (STsdbRepo *)repo; tsdbInitSubmitMsgIter(pMsg, &msgIter); SSubmitBlk *pBlock = NULL; int32_t code = TSDB_CODE_SUCCESS; + int32_t affectedrows = 0; TSKEY now = taosGetTimestamp(pRepo->config.precision); while ((pBlock = tsdbGetSubmitMsgNext(&msgIter)) != NULL) { - if ((code = tsdbInsertDataToTable(repo, pBlock, now)) != TSDB_CODE_SUCCESS) { + if ((code = tsdbInsertDataToTable(repo, pBlock, now, &affectedrows)) != TSDB_CODE_SUCCESS) { return code; } } - + pRsp->affectedRows = htonl(affectedrows); return code; } @@ -846,7 +847,7 @@ static int32_t tdInsertRowToTable(STsdbRepo *pRepo, SDataRow row, STable *pTable return 0; } -static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY now) { +static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY now, int32_t *affectedrows) { STsdbRepo *pRepo = (STsdbRepo *)repo; STableId tableId = {.uid = pBlock->uid, .tid = pBlock->tid}; @@ -875,6 +876,7 @@ static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY if (tdInsertRowToTable(pRepo, row, pTable) < 0) { return -1; } + (*affectedrows)++; } return TSDB_CODE_SUCCESS; diff --git a/src/vnode/src/vnodeWrite.c b/src/vnode/src/vnodeWrite.c index ec0a3b2f0b..635c466978 100644 --- a/src/vnode/src/vnodeWrite.c +++ b/src/vnode/src/vnodeWrite.c @@ -91,17 +91,16 @@ static int32_t vnodeProcessSubmitMsg(SVnodeObj *pVnode, void *pCont, SRspRet *pR // save insert result into item vTrace("vgId:%d, submit msg is processed", pVnode->vgId); - code = tsdbInsertData(pVnode->tsdb, pCont); - + pRet->len = sizeof(SShellSubmitRspMsg); pRet->rsp = rpcMallocCont(pRet->len); SShellSubmitRspMsg *pRsp = pRet->rsp; - + code = tsdbInsertData(pVnode->tsdb, pCont, pRsp); + pRsp->numOfFailedBlocks = 0; //TODO + //pRet->len += pRsp->numOfFailedBlocks * sizeof(SShellSubmitRspBlock); //TODO pRsp->code = 0; pRsp->numOfRows = htonl(1); - pRsp->affectedRows = htonl(1); - pRsp->numOfFailedBlocks = 0; - + return code; } From f45bf7705f9b0c83c683f7a911d039012309dbe8 Mon Sep 17 00:00:00 2001 From: Shuaiqiang Chang Date: Thu, 14 May 2020 18:47:57 +0800 Subject: [PATCH 045/126] test: add stable/insert.py;query/query.py --- tests/pytest/query/query.py | 53 +++++++++++++++++++++++++++++++ tests/pytest/stable/__init__.py | 0 tests/pytest/stable/insert.py | 56 +++++++++++++++++++++++++++++++++ 3 files changed, 109 insertions(+) create mode 100644 tests/pytest/query/query.py create mode 100644 tests/pytest/stable/__init__.py create mode 100644 tests/pytest/stable/insert.py diff --git a/tests/pytest/query/query.py b/tests/pytest/query/query.py new file mode 100644 index 0000000000..a906943247 --- /dev/null +++ b/tests/pytest/query/query.py @@ -0,0 +1,53 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import tdLog +from util.cases import tdCases +from util.sql import tdSql + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + print("==============step1") + tdSql.execute( + "create table if not exists st (ts timestamp, tagtype int) tags(dev nchar(50))") + tdSql.execute( + 'CREATE TABLE if not exists dev_001 using st tags("dev_01")') + tdSql.execute( + 'CREATE TABLE if not exists dev_002 using st tags("dev_02")') + + print("==============step2") + + tdSql.execute( + """INSERT INTO dev_001(ts, tagtype) VALUES('2020-05-13 10:00:00.000', 1), + ('2020-05-13 10:00:00.001', 1) + dev_002 VALUES('2020-05-13 10:00:00.001', 1)""") + + tdSql.query("select * from db.st where ts='2020-05-13 10:00:00.000'") + tdSql.checkRows(1) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/stable/__init__.py b/tests/pytest/stable/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/tests/pytest/stable/insert.py b/tests/pytest/stable/insert.py new file mode 100644 index 0000000000..4f41d4aa93 --- /dev/null +++ b/tests/pytest/stable/insert.py @@ -0,0 +1,56 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import tdLog +from util.cases import tdCases +from util.sql import tdSql + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + print("==============step1") + tdSql.execute( + "create table if not exists st (ts timestamp, tagtype int) tags(dev nchar(50))") + tdSql.execute( + 'CREATE TABLE if not exists dev_001 using st tags("dev_01")') + tdSql.execute( + 'CREATE TABLE if not exists dev_002 using st tags("dev_02")') + + print("==============step2") + + tdSql.execute( + """INSERT INTO dev_001(ts, tagtype) VALUES('2020-05-13 10:00:00.000', 1), + ('2020-05-13 10:00:00.001', 1) + dev_002 VALUES('2020-05-13 10:00:00.001', 1)""") + + tdSql.query("select * from db.st where dev='dev_01'") + tdSql.checkRows(2) + + tdSql.query("select * from db.st where dev='dev_02'") + tdSql.checkRows(1) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) From 24058f1d357185051912c6a7e154bbffeae55261 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Thu, 14 May 2020 19:05:20 +0800 Subject: [PATCH 046/126] scripts --- tests/script/general/db/delete.sim | 6 ++++++ tests/script/jenkins/basic.txt | 2 +- tests/script/unique/db/delete.sim | 17 +++++++++++------ tests/script/unique/db/delete_part.sim | 14 +++++++++----- 4 files changed, 27 insertions(+), 12 deletions(-) diff --git a/tests/script/general/db/delete.sim b/tests/script/general/db/delete.sim index f86774c2cf..f95676088b 100644 --- a/tests/script/general/db/delete.sim +++ b/tests/script/general/db/delete.sim @@ -20,6 +20,12 @@ while $i < 2000 $i = $i + 1 endw +sql show db.vgroups +if $rows != 2 then + return -1 +endi + +return print ======== step2 sleep 1000 sql drop database db diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index 94c9c71edc..b86113eb51 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -49,7 +49,7 @@ cd ../../../debug; make ./test.sh -f general/db/basic3.sim ./test.sh -f general/db/basic4.sim ./test.sh -f general/db/basic5.sim -./test.sh -f unique/db/delete.sim +./test.sh -f general/db/delete.sim ./test.sh -f general/db/delete_reuse1.sim ./test.sh -f general/db/delete_reuse2.sim ./test.sh -f general/db/delete_reusevnode.sim diff --git a/tests/script/unique/db/delete.sim b/tests/script/unique/db/delete.sim index dcdd1ae9e9..0ae6a3c13c 100644 --- a/tests/script/unique/db/delete.sim +++ b/tests/script/unique/db/delete.sim @@ -34,6 +34,11 @@ while $i < 2000 $i = $i + 1 endw +sql show db.vgroups +if $rows != 2 then + return -1 +endi + print ======== step2 sleep 1000 sql drop database db @@ -59,14 +64,14 @@ endi print ======== step3 -system sh/exec.sh -n dnode1 -s stop -x SIGINT -system sh/exec.sh -n dnode2 -s stop -x SIGINT -system sh/exec.sh -n dnode3 -s stop -x SIGINT +system sh/exec_up.sh -n dnode1 -s stop -x SIGINT +system sh/exec_up.sh -n dnode2 -s stop -x SIGINT +system sh/exec_up.sh -n dnode3 -s stop -x SIGINT sleep 1000 -system sh/exec.sh -n dnode1 -s start -t -system sh/exec.sh -n dnode2 -s start -t -system sh/exec.sh -n dnode3 -s start -t +system sh/exec_up.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode3 -s start $x = 0 step3: diff --git a/tests/script/unique/db/delete_part.sim b/tests/script/unique/db/delete_part.sim index 3d1cc5dc63..7cf326e191 100644 --- a/tests/script/unique/db/delete_part.sim +++ b/tests/script/unique/db/delete_part.sim @@ -31,17 +31,17 @@ system sh/cfg.sh -n dnode4 -c maxtablesPerVnode -v 4 print ========= start dnodes system sh/exec_up.sh -n dnode1 -s start +sleep 3000 sql connect sql create dnode $hostname2 system sh/exec_up.sh -n dnode2 -s start -sleep 3000 $loop = 0 begin: $db = db . $loop - print ======== step1 + print ======== step1 $loop sql create database $db sql use $db @@ -53,15 +53,16 @@ begin: $x = $x + 1 endw - print ======== step2 + print ======== step2 $loop system sh/exec_up.sh -n dnode2 -s stop + sleep 1000 sql drop database $db - print ======== step3 + print ======== step3 $loop sleep 3000 system sh/exec_up.sh -n dnode2 -s start - sleep 20000 + sleep 5000 print ===> test times : $loop if $loop > 5 then @@ -69,6 +70,9 @@ begin: endi $loop = $loop + 1 + + sql reset query cache + sleep 1000 goto begin From b814a46320eae4579264570e0114d2392a015135 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Thu, 14 May 2020 19:43:14 +0800 Subject: [PATCH 047/126] make python test framework detect TDinternal and TDengine automatically. [TD-328] --- tests/pytest/util/dnodes.py | 53 ++++++++++++++++++++++++++----------- 1 file changed, 37 insertions(+), 16 deletions(-) diff --git a/tests/pytest/util/dnodes.py b/tests/pytest/util/dnodes.py index 23adab2c47..b641927c9f 100644 --- a/tests/pytest/util/dnodes.py +++ b/tests/pytest/util/dnodes.py @@ -38,9 +38,9 @@ class TDSimClient: tdLog.exit(cmd) def deploy(self): - self.logDir = "%s/sim/psim/log" % (self.path,) - self.cfgDir = "%s/sim/psim/cfg" % (self.path) - self.cfgPath = "%s/sim/psim/cfg/taos.cfg" % (self.path) + self.logDir = "%s/pysim/psim/log" % (self.path,) + self.cfgDir = "%s/pysim/psim/cfg" % (self.path) + self.cfgPath = "%s/pysim/psim/cfg/taos.cfg" % (self.path) cmd = "rm -rf " + self.logDir if os.system(cmd) != 0: @@ -100,10 +100,10 @@ class TDDnode: self.valgrind = value def deploy(self): - self.logDir = "%s/sim/dnode%d/log" % (self.path, self.index) - self.dataDir = "%s/sim/dnode%d/data" % (self.path, self.index) - self.cfgDir = "%s/sim/dnode%d/cfg" % (self.path, self.index) - self.cfgPath = "%s/sim/dnode%d/cfg/taos.cfg" % (self.path, self.index) + self.logDir = "%s/pysim/dnode%d/log" % (self.path, self.index) + self.dataDir = "%s/pysim/dnode%d/data" % (self.path, self.index) + self.cfgDir = "%s/pysim/dnode%d/cfg" % (self.path, self.index) + self.cfgPath = "%s/pysim/dnode%d/cfg/taos.cfg" % (self.path, self.index) cmd = "rm -rf " + self.dataDir if os.system(cmd) != 0: @@ -177,21 +177,42 @@ class TDDnode: (self.index, self.cfgPath)) def start(self): - binPath = os.path.dirname(os.path.realpath(__file__)) - binPath = binPath + "/../../../debug/" - binPath = os.path.realpath(binPath) - binPath += "/build/bin/" + selfPath = os.path.dirname(os.path.realpath(__file__)) + binPath = "" + + if ("TDinternal" in selfPath): + projPath = selfPath + "/../../../../" + + for root, dirs, files in os.walk(projPath): + if ("taosd" in files): + rootRealPath = os.path.dirname(os.path.realpath(root)) + if ("community" not in rootRealPath): + binPath = os.path.join(root, "taosd") + break; + else: + projPath = selfPath + "/../../../" + for root, dirs, files in os.walk(projPath): + if ("taosd" in files): + rootRealPath = os.path.dirname(os.path.realpath(root)) + if ("packaging" not in rootRealPath): + binPath = os.path.join(root, "taosd") + break; + + if (binPath == ""): + tdLog.exit("taosd not found!s") + else: + tdLog.notice("taosd found in %s" % rootRealPath) if self.deployed == 0: tdLog.exit("dnode:%d is not deployed" % (self.index)) if self.valgrind == 0: - cmd = "nohup %staosd -c %s > /dev/null 2>&1 & " % ( + cmd = "nohup %s -c %s > /dev/null 2>&1 & " % ( binPath, self.cfgDir) else: valgrindCmdline = "valgrind --tool=memcheck --leak-check=full --show-reachable=no --track-origins=yes --show-leak-kinds=all -v --workaround-gcc296-bugs=yes" - cmd = "nohup %s %staosd -c %s 2>&1 & " % ( + cmd = "nohup %s %s -c %s 2>&1 & " % ( valgrindCmdline, binPath, self.cfgDir) print(cmd) @@ -268,11 +289,11 @@ class TDDnode: tdLog.exit(cmd) def getDnodeRootDir(self, index): - dnodeRootDir = "%s/sim/psim/dnode%d" % (self.path, index) + dnodeRootDir = "%s/pysim/psim/dnode%d" % (self.path, index) return dnodeRootDir def getDnodesRootDir(self): - dnodesRootDir = "%s/sim/psim" % (self.path) + dnodesRootDir = "%s/pysim/psim" % (self.path) return dnodesRootDir @@ -417,7 +438,7 @@ class TDDnodes: # tdLog.exit(cmd) def getDnodesRootDir(self): - dnodesRootDir = "%s/sim" % (self.path) + dnodesRootDir = "%s/pysim" % (self.path) return dnodesRootDir def getSimCfgPath(self): From e0cd9c2a0f0eca5e815fefe15e26668e52be2292 Mon Sep 17 00:00:00 2001 From: StoneT2000 Date: Thu, 14 May 2020 14:52:33 -0700 Subject: [PATCH 048/126] Nodejs connector update --- src/connector/nodejs/nodetaos/cinterface.js | 112 ++++++++------------ src/connector/nodejs/nodetaos/cursor.js | 28 ++--- src/connector/nodejs/test/test.js | 4 +- src/connector/nodejs/test/testSubscribe.js | 16 +++ 4 files changed, 68 insertions(+), 92 deletions(-) create mode 100644 src/connector/nodejs/test/testSubscribe.js diff --git a/src/connector/nodejs/nodetaos/cinterface.js b/src/connector/nodejs/nodetaos/cinterface.js index 2b409268d9..99271844cd 100644 --- a/src/connector/nodejs/nodetaos/cinterface.js +++ b/src/connector/nodejs/nodetaos/cinterface.js @@ -241,17 +241,12 @@ function CTaosInterface (config = null, pass = false) { 'taos_fetch_rows_a': [ ref.types.void, [ ref.types.void_ptr, ref.types.void_ptr, ref.types.void_ptr ]], // Subscription - //TAOS_SUB *taos_subscribe(char *host, char *user, char *pass, char *db, char *table, long time, int mseconds) - ////TAOS_SUB *taos_subscribe(char *host, char *user, char *pass, char *db, char *table, int64_t time, int mseconds); - 'taos_subscribe': [ ref.types.void_ptr, [ ref.types.char_ptr, ref.types.char_ptr, ref.types.char_ptr, ref.types.char_ptr, ref.types.char_ptr, ref.types.int64, ref.types.int] ], - //TAOS_ROW taos_consume(TAOS_SUB *tsub); - 'taos_consume': [ ref.refType(ref.types.void_ptr2), [ref.types.void_ptr] ], + //TAOS_SUB *taos_subscribe(TAOS* taos, int restart, const char* topic, const char *sql, TAOS_SUBSCRIBE_CALLBACK fp, void *param, int interval) + 'taos_subscribe': [ ref.types.void_ptr, [ ref.types.void_ptr, ref.types.int, ref.types.char_ptr, ref.types.char_ptr, ref.types.void_ptr, ref.types.void_ptr, ref.types.int] ], + // TAOS_RES *taos_consume(TAOS_SUB *tsub) + 'taos_consume': [ ref.types.void_ptr, [ref.types.void_ptr] ], //void taos_unsubscribe(TAOS_SUB *tsub); 'taos_unsubscribe': [ ref.types.void, [ ref.types.void_ptr ] ], - //int taos_subfields_count(TAOS_SUB *tsub); - 'taos_subfields_count': [ ref.types.int, [ref.types.void_ptr ] ], - //TAOS_FIELD *taos_fetch_subfields(TAOS_SUB *tsub); - 'taos_fetch_subfields': [ ref.refType(TaosField), [ ref.types.void_ptr ] ], // Continuous Query //TAOS_STREAM *taos_open_stream(TAOS *taos, char *sqlstr, void (*fp)(void *param, TAOS_RES *, TAOS_ROW row), @@ -362,7 +357,7 @@ CTaosInterface.prototype.fetchBlock = function fetchBlock(result, fields) { blocks.fill(null); num_of_rows = Math.abs(num_of_rows); let offset = 0; - pblock = pblock.deref() + pblock = pblock.deref(); for (let i = 0; i < fields.length; i++) { if (!convertFunctions[fields[i]['type']] ) { @@ -472,64 +467,45 @@ CTaosInterface.prototype.getClientInfo = function getClientInfo() { } // Subscription -CTaosInterface.prototype.subscribe = function subscribe(host=null, user="root", password="taosdata", db=null, table=null, time=null, mseconds=null) { - let dbOrig = db; - let tableOrig = table; - try { - host = host != null ? ref.allocCString(host) : ref.alloc(ref.types.char_ptr, ref.NULL); +CTaosInterface.prototype.subscribe = function subscribe(connection, restart, topic, sql, interval) { + let topicOrig = topic; + let sqlOrig = sql; + try { + sql = sql != null ? ref.allocCString(sql) : ref.alloc(ref.types.char_ptr, ref.NULL); } catch(err) { - throw "Attribute Error: host is expected as a str"; + throw "Attribute Error: sql is expected as a str"; } try { - user = ref.allocCString(user) + topic = topic != null ? ref.allocCString(topic) : ref.alloc(ref.types.char_ptr, ref.NULL); } catch(err) { - throw "Attribute Error: user is expected as a str"; + throw TypeError("topic is expected as a str"); } - try { - password = ref.allocCString(password); - } - catch(err) { - throw "Attribute Error: password is expected as a str"; - } - try { - db = db != null ? ref.allocCString(db) : ref.alloc(ref.types.char_ptr, ref.NULL); - } - catch(err) { - throw "Attribute Error: db is expected as a str"; - } - try { - table = table != null ? ref.allocCString(table) : ref.alloc(ref.types.char_ptr, ref.NULL); - } - catch(err) { - throw TypeError("table is expected as a str"); - } - try { - mseconds = ref.alloc(ref.types.int, mseconds); - } - catch(err) { - throw TypeError("mseconds is expected as an int"); - } - //TAOS_SUB *taos_subscribe(char *host, char *user, char *pass, char *db, char *table, int64_t time, int mseconds); - let subscription = this.libtaos.taos_subscribe(host, user, password, db, table, time, mseconds); + // try { + // interval = ref.alloc(ref.types.int, interval); + // } + // catch(err) { + // throw TypeError("interval is expected as an int"); + // } + restart = ref.alloc(ref.types.int, restart); + //TAOS_SUB *taos_subscribe(TAOS* taos, int restart, const char* topic, const char *sql, TAOS_SUBSCRIBE_CALLBACK fp, void *param, int interval) + let subscription = this.libtaos.taos_subscribe(connection, restart, topic, sql, null, null, interval); if (ref.isNull(subscription)) { throw new errors.TDError('Failed to subscribe to TDengine | Database: ' + dbOrig + ', Table: ' + tableOrig); } else { - console.log('Successfully subscribed to TDengine | Database: ' + dbOrig + ', Table: ' + tableOrig); + console.log('Successfully subscribed to TDengine - Topic: ' + topicOrig); } return subscription; } -CTaosInterface.prototype.subFieldsCount = function subFieldsCount(subscription) { - return this.libtaos.taos_subfields_count(subscription); -} -CTaosInterface.prototype.fetchSubFields = function fetchSubFields(subscription) { - let pfields = this.libtaos.taos_fetch_subfields(subscription); - let pfieldscount = this.subFieldsCount(subscription); + +CTaosInterface.prototype.consume = function consume(subscription) { + let result = this.libtaos.taos_consume(subscription); let fields = []; + let pfields = this.fetchFields(result); if (ref.isNull(pfields) == false) { - pfields = ref.reinterpret(pfields, 68 * pfieldscount , 0); + pfields = ref.reinterpret(pfields, this.numFields(result) * 68, 0); for (let i = 0; i < pfields.length; i += 68) { //0 - 63 = name //64 - 65 = bytes, 66 - 67 = type fields.push( { @@ -539,27 +515,23 @@ CTaosInterface.prototype.fetchSubFields = function fetchSubFields(subscription) }) } } - return fields; -} -CTaosInterface.prototype.consume = function consume(subscription) { - let row = this.libtaos.taos_consume(subscription); - let fields = this.fetchSubFields(subscription); - //let isMicro = (cti.libtaos.taos_result_precision(result) == FieldTypes.C_TIMESTAMP_MICRO); - let isMicro = false; //no supported function for determining precision? - let blocks = new Array(fields.length); - blocks.fill(null); - let numOfRows2 = 1; //Math.abs(numOfRows2); - let offset = 0; - if (numOfRows2 > 0){ - for (let i = 0; i < fields.length; i++) { - if (!convertFunctions[fields[i]['type']] ) { - throw new errors.DatabaseError("Invalid data type returned from database"); + + let data = []; + while(true) { + let { blocks, num_of_rows } = this.fetchBlock(result, fields); + if (num_of_rows == 0) { + break; + } + for (let i = 0; i < num_of_rows; i++) { + data.push([]); + let rowBlock = new Array(fields.length); + for (let j = 0; j < fields.length; j++) { + rowBlock[j] = blocks[j][i]; } - blocks[i] = convertFunctions[fields[i]['type']](row, numOfRows2, fields[i]['bytes'], offset, isMicro); - offset += fields[i]['bytes'] * numOfRows2; + data[data.length-1] = (rowBlock); } } - return {blocks:blocks, fields:fields}; + return { data: data, fields: fields, result: result }; } CTaosInterface.prototype.unsubscribe = function unsubscribe(subscription) { //void taos_unsubscribe(TAOS_SUB *tsub); diff --git a/src/connector/nodejs/nodetaos/cursor.js b/src/connector/nodejs/nodetaos/cursor.js index 092c19dfd4..acfe96dfbc 100644 --- a/src/connector/nodejs/nodetaos/cursor.js +++ b/src/connector/nodejs/nodetaos/cursor.js @@ -405,18 +405,16 @@ TDengineCursor.prototype.getClientInfo = function getClientInfo() { /** * Subscribe to a table from a database in TDengine. * @param {Object} config - A configuration object containing the configuration options for the subscription - * @param {string} config.host - The host to subscribe to - * @param {string} config.user - The user to subscribe as - * @param {string} config.password - The password for the said user - * @param {string} config.db - The db containing the table to subscribe to - * @param {string} config.table - The name of the table to subscribe to - * @param {number} config.time - The start time to start a subscription session - * @param {number} config.mseconds - The pulling period of the subscription session + * @param {string} config.restart - whether or not to continue a subscription if it already exits, otherwise start from beginning + * @param {string} config.topic - The unique identifier of a subscription + * @param {string} config.sql - A sql statement for data query + * @param {string} config.interval - The pulling interval * @return {Buffer} A buffer pointing to the subscription session handle * @since 1.3.0 */ TDengineCursor.prototype.subscribe = function subscribe(config) { - return this._chandle.subscribe(config.host, config.user, config.password, config.db, config.table, config.time, config.mseconds); + let restart = config.restart ? 1 : 0; + return this._chandle.subscribe(this._connection._conn, restart, config.topic, config.sql, config.interval); }; /** * An infinite loop that consumes the latest data and calls a callback function that is provided. @@ -426,18 +424,8 @@ TDengineCursor.prototype.subscribe = function subscribe(config) { */ TDengineCursor.prototype.consumeData = async function consumeData(subscription, callback) { while (true) { - let res = this._chandle.consume(subscription); - let data = []; - let num_of_rows = res.blocks[0].length; - for (let j = 0; j < num_of_rows; j++) { - data.push([]); - let rowBlock = new Array(res.fields.length); - for (let k = 0; k < res.fields.length; k++) { - rowBlock[k] = res.blocks[k][j]; - } - data[data.length-1] = rowBlock; - } - callback(data, res.fields, subscription); + let { data, fields, result} = this._chandle.consume(subscription); + callback(data, fields, result); } } /** diff --git a/src/connector/nodejs/test/test.js b/src/connector/nodejs/test/test.js index 67f0a783b9..5d96e798d8 100644 --- a/src/connector/nodejs/test/test.js +++ b/src/connector/nodejs/test/test.js @@ -33,12 +33,12 @@ for (let i = 0; i < 10000; i++) { parseInt( R(-Math.pow(2,31) + 1 , Math.pow(2,31) - 1) ), // Int parseInt( R(-Math.pow(2,31) + 1 , Math.pow(2,31) - 1) ), // BigInt parseFloat( R(-3.4E38, 3.4E38) ), // Float - parseFloat( R(-1.7E308, 1.7E308) ), // Double + parseFloat( R(-1.7E30, 1.7E30) ), // Double "\"Long Binary\"", // Binary parseInt( R(-32767, 32767) ), // Small Int parseInt( R(-127, 127) ), // Tiny Int randomBool(), - "\"Nchars 一些中文字幕\""]; // Bool + "\"Nchars\""]; // Bool c1.execute('insert into td_connector_test.all_types values(' + insertData.join(',') + ' );', {quiet:true}); if (i % 1000 == 0) { console.log("Insert # " , i); diff --git a/src/connector/nodejs/test/testSubscribe.js b/src/connector/nodejs/test/testSubscribe.js new file mode 100644 index 0000000000..30fb3f4256 --- /dev/null +++ b/src/connector/nodejs/test/testSubscribe.js @@ -0,0 +1,16 @@ +const taos = require('../tdengine'); +var conn = taos.connect({host:"127.0.0.1", user:"root", password:"taosdata", config:"/etc/taos",port:10}); +var c1 = conn.cursor(); +let stime = new Date(); +let interval = 1000; +c1.execute('use td_connector_test'); +let sub = c1.subscribe({ + restart: true, + sql: "select AVG(_int) from td_connector_test.all_Types;", + topic: 'all_Types', + interval: 1000 +}); + +c1.consumeData(sub, (data, fields) => { + console.log(data); +}); \ No newline at end of file From 19fbf34e7f57fc85a17b7618f00feeab11e3aebc Mon Sep 17 00:00:00 2001 From: StoneT2000 Date: Thu, 14 May 2020 14:53:56 -0700 Subject: [PATCH 049/126] Patch --- src/connector/nodejs/package-lock.json | 2 +- src/connector/nodejs/package.json | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/src/connector/nodejs/package-lock.json b/src/connector/nodejs/package-lock.json index ab7789f7c6..1137e35106 100644 --- a/src/connector/nodejs/package-lock.json +++ b/src/connector/nodejs/package-lock.json @@ -1,6 +1,6 @@ { "name": "td-connector", - "version": "1.5.0", + "version": "1.6.1", "lockfileVersion": 1, "requires": true, "dependencies": { diff --git a/src/connector/nodejs/package.json b/src/connector/nodejs/package.json index 7f42d40a91..8d7a971aa3 100644 --- a/src/connector/nodejs/package.json +++ b/src/connector/nodejs/package.json @@ -1,6 +1,6 @@ { "name": "td-connector", - "version": "1.5.0", + "version": "1.6.1", "description": "A Node.js connector for TDengine.", "main": "tdengine.js", "scripts": { From 29e635547fb2cddda1db9c7b490777b6eb26006a Mon Sep 17 00:00:00 2001 From: StoneT2000 Date: Thu, 14 May 2020 14:55:56 -0700 Subject: [PATCH 050/126] Update cinterface.js --- src/connector/nodejs/nodetaos/cinterface.js | 9 ++------- 1 file changed, 2 insertions(+), 7 deletions(-) diff --git a/src/connector/nodejs/nodetaos/cinterface.js b/src/connector/nodejs/nodetaos/cinterface.js index 99271844cd..d076beb8c0 100644 --- a/src/connector/nodejs/nodetaos/cinterface.js +++ b/src/connector/nodejs/nodetaos/cinterface.js @@ -482,14 +482,9 @@ CTaosInterface.prototype.subscribe = function subscribe(connection, restart, top catch(err) { throw TypeError("topic is expected as a str"); } - // try { - // interval = ref.alloc(ref.types.int, interval); - // } - // catch(err) { - // throw TypeError("interval is expected as an int"); - // } + restart = ref.alloc(ref.types.int, restart); - //TAOS_SUB *taos_subscribe(TAOS* taos, int restart, const char* topic, const char *sql, TAOS_SUBSCRIBE_CALLBACK fp, void *param, int interval) + let subscription = this.libtaos.taos_subscribe(connection, restart, topic, sql, null, null, interval); if (ref.isNull(subscription)) { throw new errors.TDError('Failed to subscribe to TDengine | Database: ' + dbOrig + ', Table: ' + tableOrig); From 530aa3e5e7ebee1a10f6c8cdd1ea3f95a0c999f8 Mon Sep 17 00:00:00 2001 From: jtao1735 Date: Fri, 15 May 2020 00:53:55 +0000 Subject: [PATCH 051/126] set file version correctly --- src/inc/tsync.h | 4 ++-- src/vnode/inc/vnodeInt.h | 14 +++++++------- src/vnode/src/vnodeMain.c | 17 ++++++++++++----- 3 files changed, 21 insertions(+), 14 deletions(-) diff --git a/src/inc/tsync.h b/src/inc/tsync.h index 0d6004bba5..137b97e287 100644 --- a/src/inc/tsync.h +++ b/src/inc/tsync.h @@ -57,7 +57,7 @@ typedef struct { // if name is empty(name[0] is zero), get the file from index or after, used by master // if name is provided(name[0] is not zero), get the named file at the specified index, used by unsynced node // it returns the file magic number and size, if file not there, magic shall be 0. -typedef uint32_t (*FGetFileInfo)(void *ahandle, char *name, uint32_t *index, int32_t *size); +typedef uint32_t (*FGetFileInfo)(void *ahandle, char *name, uint32_t *index, int32_t *size, uint64_t *fversion); // get the wal file from index or after // return value, -1: error, 1:more wal files, 0:last WAL. if name[0]==0, no WAL file @@ -73,7 +73,7 @@ typedef void (*FConfirmForward)(void *ahandle, void *mhandle, int32_t code); typedef void (*FNotifyRole)(void *ahandle, int8_t role); // when data file is synced successfully, notity app -typedef void (*FNotifyFileSynced)(void *ahandle); +typedef void (*FNotifyFileSynced)(void *ahandle, uint64_t fversion); typedef struct { int32_t vgId; // vgroup ID diff --git a/src/vnode/inc/vnodeInt.h b/src/vnode/inc/vnodeInt.h index d41957d8f4..dea9369dd8 100644 --- a/src/vnode/inc/vnodeInt.h +++ b/src/vnode/inc/vnodeInt.h @@ -37,8 +37,8 @@ typedef struct { int32_t refCount; // reference count int status; int8_t role; - int64_t version; - int64_t savedVersion; + int64_t version; // current version + int64_t fversion; // version on saved data file void *wqueue; void *rqueue; void *wal; @@ -46,11 +46,11 @@ typedef struct { void *sync; void *events; void *cq; // continuous query - int32_t cfgVersion; - STsdbCfg tsdbCfg; - SSyncCfg syncCfg; - SWalCfg walCfg; - char * rootDir; + int32_t cfgVersion; + STsdbCfg tsdbCfg; + SSyncCfg syncCfg; + SWalCfg walCfg; + char *rootDir; } SVnodeObj; int vnodeWriteToQueue(void *param, void *pHead, int type); diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index 4bcc0760ab..9e4e8e185c 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -196,6 +196,7 @@ int32_t vnodeOpen(int32_t vnode, char *rootDir) { } vnodeReadVersion(pVnode); + pVnode->fversion = pVnode->version; pVnode->wqueue = dnodeAllocateWqueue(pVnode); pVnode->rqueue = dnodeAllocateRqueue(pVnode); @@ -394,7 +395,7 @@ static int vnodeProcessTsdbStatus(void *arg, int status) { SVnodeObj *pVnode = arg; if (status == TSDB_STATUS_COMMIT_START) { - pVnode->savedVersion = pVnode->version; + pVnode->fversion = pVnode->version; return walRenew(pVnode->wal); } @@ -404,8 +405,9 @@ static int vnodeProcessTsdbStatus(void *arg, int status) { return 0; } -static uint32_t vnodeGetFileInfo(void *ahandle, char *name, uint32_t *index, int32_t *size) { +static uint32_t vnodeGetFileInfo(void *ahandle, char *name, uint32_t *index, int32_t *size, uint64_t *fversion) { SVnodeObj *pVnode = ahandle; + *fversion = pVnode->fversion; return tsdbGetFileInfo(pVnode->tsdb, name, index, size); } @@ -425,12 +427,17 @@ static void vnodeNotifyRole(void *ahandle, int8_t role) { cqStop(pVnode->cq); } -static void vnodeNotifyFileSynced(void *ahandle) { +static void vnodeNotifyFileSynced(void *ahandle, uint64_t fversion) { SVnodeObj *pVnode = ahandle; vTrace("vgId:%d, data file is synced", pVnode->vgId); + pVnode->fversion = fversion; + pVnode->version = fversion; + vnodeSaveVersion(pVnode); + char rootDir[128] = "\0"; sprintf(rootDir, "%s/tsdb", pVnode->rootDir); + // close tsdb, then open tsdb tsdbCloseRepo(pVnode->tsdb); STsdbAppH appH = {0}; @@ -706,14 +713,14 @@ static int32_t vnodeSaveVersion(SVnodeObj *pVnode) { char * content = calloc(1, maxLen + 1); len += snprintf(content + len, maxLen - len, "{\n"); - len += snprintf(content + len, maxLen - len, " \"version\": %" PRId64 "\n", pVnode->savedVersion); + len += snprintf(content + len, maxLen - len, " \"version\": %" PRId64 "\n", pVnode->fversion); len += snprintf(content + len, maxLen - len, "}\n"); fwrite(content, 1, len, fp); fclose(fp); free(content); - vPrint("vgId:%d, save vnode version:%" PRId64 " succeed", pVnode->vgId, pVnode->savedVersion); + vPrint("vgId:%d, save vnode version:%" PRId64 " succeed", pVnode->vgId, pVnode->fversion); return 0; } From f0b483f37e119f2f3d803fd2b88846d2380c732a Mon Sep 17 00:00:00 2001 From: jtao1735 Date: Fri, 15 May 2020 01:15:54 +0000 Subject: [PATCH 052/126] set file version correctly --- src/mnode/src/mgmtSdb.c | 2 +- src/vnode/src/vnodeMain.c | 4 ++-- 2 files changed, 3 insertions(+), 3 deletions(-) diff --git a/src/mnode/src/mgmtSdb.c b/src/mnode/src/mgmtSdb.c index 0520bf8493..c0d389f305 100644 --- a/src/mnode/src/mgmtSdb.c +++ b/src/mnode/src/mgmtSdb.c @@ -185,7 +185,7 @@ void sdbUpdateMnodeRoles() { } } -static uint32_t sdbGetFileInfo(void *ahandle, char *name, uint32_t *index, int32_t *size) { +static uint32_t sdbGetFileInfo(void *ahandle, char *name, uint32_t *index, int32_t *size, uint64_t *fversion) { sdbUpdateMnodeRoles(); return 0; } diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index 3dc4c0a640..0f92be0967 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -37,10 +37,10 @@ static int32_t vnodeReadCfg(SVnodeObj *pVnode); static int32_t vnodeSaveVersion(SVnodeObj *pVnode); static bool vnodeReadVersion(SVnodeObj *pVnode); static int vnodeProcessTsdbStatus(void *arg, int status); -static uint32_t vnodeGetFileInfo(void *ahandle, char *name, uint32_t *index, int32_t *size); +static uint32_t vnodeGetFileInfo(void *ahandle, char *name, uint32_t *index, int32_t *size, uint64_t *fversion); static int vnodeGetWalInfo(void *ahandle, char *name, uint32_t *index); static void vnodeNotifyRole(void *ahandle, int8_t role); -static void vnodeNotifyFileSynced(void *ahandle); +static void vnodeNotifyFileSynced(void *ahandle, uint64_t fversion); static pthread_once_t vnodeModuleInit = PTHREAD_ONCE_INIT; From 44d0bfa4503d5e859c23077c4fcd9a8f6b178893 Mon Sep 17 00:00:00 2001 From: jtao1735 Date: Fri, 15 May 2020 01:56:56 +0000 Subject: [PATCH 053/126] post semaphore before memcpy --- src/dnode/src/dnodeShell.c | 2 +- src/rpc/src/rpcMain.c | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/src/dnode/src/dnodeShell.c b/src/dnode/src/dnodeShell.c index 52407dc7a4..fbed164839 100644 --- a/src/dnode/src/dnodeShell.c +++ b/src/dnode/src/dnodeShell.c @@ -157,8 +157,8 @@ static int dnodeRetrieveUserAuthInfo(char *user, char *spi, char *encrypt, char if (rpcRsp.code != 0) { dError("user:%s, auth msg received from mnode, error:%s", user, tstrerror(rpcRsp.code)); } else { - dTrace("user:%s, auth msg received from mnode", user); SDMAuthRsp *pRsp = rpcRsp.pCont; + dTrace("user:%s, auth msg received from mnode", user); memcpy(secret, pRsp->secret, TSDB_KEY_LEN); memcpy(ckey, pRsp->ckey, TSDB_KEY_LEN); *spi = pRsp->spi; diff --git a/src/rpc/src/rpcMain.c b/src/rpc/src/rpcMain.c index 3e638eb3d3..7e80f0d282 100644 --- a/src/rpc/src/rpcMain.c +++ b/src/rpc/src/rpcMain.c @@ -898,9 +898,9 @@ static void rpcNotifyClient(SRpcReqContext *pContext, SRpcMsg *pMsg) { if (pContext->pRsp) { // for synchronous API - tsem_post(pContext->pSem); memcpy(pContext->pSet, &pContext->ipSet, sizeof(SRpcIpSet)); memcpy(pContext->pRsp, pMsg, sizeof(SRpcMsg)); + tsem_post(pContext->pSem); } else { // for asynchronous API SRpcIpSet *pIpSet = NULL; From 2e5e522b99e7cb2c909195a9841ec3b89924935e Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:10:32 +0800 Subject: [PATCH 054/126] move test section to an independent document. --- README.md | 2 + ...o-Run-Test-And-How-To-Add-New-Test-Case.md | 183 ++++++++++++++++++ 2 files changed, 185 insertions(+) create mode 100644 tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md diff --git a/README.md b/README.md index 0babfe7776..010396a3ec 100644 --- a/README.md +++ b/README.md @@ -116,6 +116,8 @@ TDengine provides abundant developing tools for users to develop on TDengine. Fo - [Node.js](https://www.taosdata.com/en/documentation/connector/#Node.js-Connector) # How to run the test cases and how to add a new test case? + TDengine's test framework and all test cases are fully open source. + Please refer to [this document](https://www.github.com/taosdata/TDengine/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. ### Prepare development environment diff --git a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md new file mode 100644 index 0000000000..7618263e78 --- /dev/null +++ b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md @@ -0,0 +1,183 @@ +### How to add a new test case + +**1. TSIM test cases:** + +TSIM test cases are the testing framework has been used internally. Now it still be used to run the test cases we develop in the past as a legacy system. We are turning to use Python to develop new test case and are abandoning TSIM gradually. + +**2. Python test cases:** + +**2.1 Please refer to \/tests/pytest/insert/basic.py to add a new +test case.** The new test case must implement 3 functions, where self.init() +and self.stop() simply copy the contents of insert/basic.py and the test +logic is implemented in self.run(). You can refer to the code in the util +directory for more information. + +**2.2 Edit smoketest.sh to add the path and filename of the new test case** + +Note: The Python test framework may continue to be improved in the future, +hopefully, to provide more functionality and ease of writing test cases. The +method of writing the test case above does not exclude that it will also be +affected. + +**2.3 What test.py does in detail:** + +test.py is the entry program for test case execution and monitoring. + +test.py has the following functions. + +\-f --file, Specifies the test case file name to be executed +-p --path, Specifies deployment path + +\-m --master, Specifies the master server IP for cluster deployment +-c--cluster, test cluster function +-s--stop, terminates all running nodes + +\-g--valgrind, load valgrind for memory leak detection test + +\-h--help, display help + +**2.4 What util/log.py does in detail:** + +log.py is quite simple, the main thing is that you can print the output in +different colors as needed. The success() should be called for successful +test case execution and the success() will print green text. The exit() will +print red text and exit the program, exit() should be called for test +failure. + +**util/log.py** + +... + +    def info(self, info): + +        printf("%s %s" % (datetime.datetime.now(), info)) + +  + +    def sleep(self, sec): + +        printf("%s sleep %d seconds" % (datetime.datetime.now(), sec)) + +        time.sleep(sec) + +  + +    def debug(self, err): + +        printf("\\033[1;36m%s %s\\033[0m" % (datetime.datetime.now(), err)) + +  + +    def success(self, info): + +        printf("\\033[1;32m%s %s\\033[0m" % (datetime.datetime.now(), info)) + +  + +    def notice(self, err): + +        printf("\\033[1;33m%s %s\\033[0m" % (datetime.datetime.now(), err)) + +  + +    def exit(self, err): + +        printf("\\033[1;31m%s %s\\033[0m" % (datetime.datetime.now(), err)) + +        sys.exit(1) + +  + +    def printNoPrefix(self, info): + +        printf("\\033[1;36m%s\\033[0m" % (info) + +... + +**2.5 What util/sql.py does in detail:** + +SQL.py is mainly used to execute SQL statements to manipulate the database, +and the code is extracted and commented as follows: + +**util/sql.py** + +\# prepare() is mainly used to set up the environment for testing table and +data, and to set up the database db for testing. do not call prepare() if you +need to test the database operation command. + +def prepare(self): + +tdLog.info("prepare database:db") + +self.cursor.execute('reset query cache') + +self.cursor.execute('drop database if exists db') + +self.cursor.execute('create database db') + +self.cursor.execute('use db') + +... + +\# query() is mainly used to execute select statements for normal syntax input + +def query(self, sql): + +... + +\# error() is mainly used to execute the select statement with the wrong syntax +input, the error will be caught as a reasonable behavior, if not caught it will +prove that the test failed + +def error() + +... + +\# checkRows() is used to check the number of returned lines after calling +query(select ...) after calling the query(select ...) to check the number of +rows of returned results. + +def checkRows(self, expectRows): + +... + +\# checkData() is used to check the returned result data after calling +query(select ...) after the query(select ...) is called, failure to meet +expectation is + +def checkData(self, row, col, data): + +... + +\# getData() returns the result data after calling query(select ...) to return +the resulting data after calling query(select ...) + +def getData(self, row, col): + +... + +\# execute() used to execute sql and return the number of affected rows + +def execute(self, sql): + +... + +\# executeTimes() Multiple executions of the same sql statement + +def executeTimes(self, sql, times): + +... + +\# CheckAffectedRows() Check if the number of affected rows is as expected + +def checkAffectedRows(self, expectAffectedRows): + +... + +> Note: Both Python2 and Python3 are currently supported by the Python test +> case. Since Python2 is no longer officially supported by January 1, 2020, it +> is recommended that subsequent test case development be guaranteed to run +> correctly on Python3. For Python2, please consider being compatible if +> appropriate without additional +> burden.   + From 111e6c1f357ffa4542dcb1ae1b0fd6be2eafa2c4 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:15:07 +0800 Subject: [PATCH 055/126] Update README.md --- README.md | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/README.md b/README.md index 010396a3ec..9e9b183e91 100644 --- a/README.md +++ b/README.md @@ -117,7 +117,7 @@ TDengine provides abundant developing tools for users to develop on TDengine. Fo # How to run the test cases and how to add a new test case? TDengine's test framework and all test cases are fully open source. - Please refer to [this document](https://www.github.com/taosdata/TDengine/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. + Please refer to [this document](https://github.com/taosdata/TDengine/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. ### Prepare development environment From 5096d58259b6c454576bdbf177c5c89feb7cb9a8 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:17:36 +0800 Subject: [PATCH 056/126] Update README.md --- README.md | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/README.md b/README.md index 9e9b183e91..47ac644f66 100644 --- a/README.md +++ b/README.md @@ -117,7 +117,7 @@ TDengine provides abundant developing tools for users to develop on TDengine. Fo # How to run the test cases and how to add a new test case? TDengine's test framework and all test cases are fully open source. - Please refer to [this document](https://github.com/taosdata/TDengine/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. + Please refer to [this document](tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. ### Prepare development environment From 3446883fb4c46e6e476f31b53aa3a78db8d9dd13 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:19:38 +0800 Subject: [PATCH 057/126] Update How-To-Run-Test-And-How-To-Add-New-Test-Case.md --- tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md index 7618263e78..1dd1715951 100644 --- a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md +++ b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md @@ -2,7 +2,7 @@ **1. TSIM test cases:** -TSIM test cases are the testing framework has been used internally. Now it still be used to run the test cases we develop in the past as a legacy system. We are turning to use Python to develop new test case and are abandoning TSIM gradually. +TSIM was the testing framework has been used internally. Now it still be used to run the test cases we develop in the past as a legacy system. We are turning to use Python to develop new test case and are abandoning TSIM gradually. **2. Python test cases:** From 249401e6eb099e7956e21f931ad608fc1c369418 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:23:12 +0800 Subject: [PATCH 058/126] Update README.md --- README.md | 227 ------------------------------------------------------ 1 file changed, 227 deletions(-) diff --git a/README.md b/README.md index 47ac644f66..8c5bc46ef7 100644 --- a/README.md +++ b/README.md @@ -119,233 +119,6 @@ TDengine provides abundant developing tools for users to develop on TDengine. Fo TDengine's test framework and all test cases are fully open source. Please refer to [this document](tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. -### Prepare development environment - -1. sudo apt install - build-essential cmake net-tools python-pip python-setuptools python3-pip - python3-setuptools valgrind psmisc curl - -2. git clone ; cd TDengine - -3. mkdir debug; cd debug; cmake ..; make ; sudo make install - -4. pip install src/connector/python/linux/python2 ; pip3 install - src/connector/python/linux/python3 - -### How to run TSIM test suite - -1. cd \/tests/script - -2. sudo ./test.sh - -### How to run Python test suite - -1. cd \/tests/pytest - -2. ./smoketest.sh \# for smoke test - -3. ./smoketest.sh -g \# for memory leak detection test with valgrind - -4. ./fulltest.sh \# for full test - -> Note1: TDengine daemon's configuration and data files are stored in -> \/sim directory. As a historical design, it's same place with -> TSIM script. So after the TSIM script ran with sudo privilege, the directory -> has been used by TSIM then the python script cannot write it by a normal -> user. You need to remove the directory completely first before running the -> Python test case. We should consider using two different locations to store -> for TSIM and Python script. - -> Note2: if you need to debug crash problem with a core dump, you need -> manually edit smoketest.sh or fulltest.sh to add "ulimit -c unlimited" -> before the script line. Then you can look for the core file in -> \/tests/pytest after the program crash. - -### How to add a new test case - -**1. add a new TSIM test cases:** - -TSIM test cases are now included in the new development branch and can be -added to the TDengine/tests/script/test.sh script based on the manual test -methods necessary to add test cases as described above. - -**2. add a new Python test cases:** - -**2.1 Please refer to \/tests/pytest/insert/basic.py to add a new -test case.** The new test case must implement 3 functions, where self.init() -and self.stop() simply copy the contents of insert/basic.py and the test -logic is implemented in self.run(). You can refer to the code in the util -directory for more information. - -**2.2 Edit smoketest.sh to add the path and filename of the new test case** - -Note: The Python test framework may continue to be improved in the future, -hopefully, to provide more functionality and ease of writing test cases. The -method of writing the test case above does not exclude that it will also be -affected. - -**2.3 What test.py does in detail:** - -test.py is the entry program for test case execution and monitoring. - -test.py has the following functions. - -\-f --file, Specifies the test case file name to be executed --p --path, Specifies deployment path - -\-m --master, Specifies the master server IP for cluster deployment --c--cluster, test cluster function --s--stop, terminates all running nodes - -\-g--valgrind, load valgrind for memory leak detection test - -\-h--help, display help - -**2.4 What util/log.py does in detail:** - -log.py is quite simple, the main thing is that you can print the output in -different colors as needed. The success() should be called for successful -test case execution and the success() will print green text. The exit() will -print red text and exit the program, exit() should be called for test -failure. - -**util/log.py** - -... - -    def info(self, info): - -        printf("%s %s" % (datetime.datetime.now(), info)) - -  - -    def sleep(self, sec): - -        printf("%s sleep %d seconds" % (datetime.datetime.now(), sec)) - -        time.sleep(sec) - -  - -    def debug(self, err): - -        printf("\\033[1;36m%s %s\\033[0m" % (datetime.datetime.now(), err)) - -  - -    def success(self, info): - -        printf("\\033[1;32m%s %s\\033[0m" % (datetime.datetime.now(), info)) - -  - -    def notice(self, err): - -        printf("\\033[1;33m%s %s\\033[0m" % (datetime.datetime.now(), err)) - -  - -    def exit(self, err): - -        printf("\\033[1;31m%s %s\\033[0m" % (datetime.datetime.now(), err)) - -        sys.exit(1) - -  - -    def printNoPrefix(self, info): - -        printf("\\033[1;36m%s\\033[0m" % (info) - -... - -**2.5 What util/sql.py does in detail:** - -SQL.py is mainly used to execute SQL statements to manipulate the database, -and the code is extracted and commented as follows: - -**util/sql.py** - -\# prepare() is mainly used to set up the environment for testing table and -data, and to set up the database db for testing. do not call prepare() if you -need to test the database operation command. - -def prepare(self): - -tdLog.info("prepare database:db") - -self.cursor.execute('reset query cache') - -self.cursor.execute('drop database if exists db') - -self.cursor.execute('create database db') - -self.cursor.execute('use db') - -... - -\# query() is mainly used to execute select statements for normal syntax input - -def query(self, sql): - -... - -\# error() is mainly used to execute the select statement with the wrong syntax -input, the error will be caught as a reasonable behavior, if not caught it will -prove that the test failed - -def error() - -... - -\# checkRows() is used to check the number of returned lines after calling -query(select ...) after calling the query(select ...) to check the number of -rows of returned results. - -def checkRows(self, expectRows): - -... - -\# checkData() is used to check the returned result data after calling -query(select ...) after the query(select ...) is called, failure to meet -expectation is - -def checkData(self, row, col, data): - -... - -\# getData() returns the result data after calling query(select ...) to return -the resulting data after calling query(select ...) - -def getData(self, row, col): - -... - -\# execute() used to execute sql and return the number of affected rows - -def execute(self, sql): - -... - -\# executeTimes() Multiple executions of the same sql statement - -def executeTimes(self, sql, times): - -... - -\# CheckAffectedRows() Check if the number of affected rows is as expected - -def checkAffectedRows(self, expectAffectedRows): - -... - -> Note: Both Python2 and Python3 are currently supported by the Python test -> case. Since Python2 is no longer officially supported by January 1, 2020, it -> is recommended that subsequent test case development be guaranteed to run -> correctly on Python3. For Python2, please consider being compatible if -> appropriate without additional -> burden.   - ### CI Covenant submission adoption principle. - Every commit / PR compilation must pass. Currently, the warning is treated From a547756c56c8b08a1077839c7e4a997c041281ad Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:28:41 +0800 Subject: [PATCH 059/126] Update How-To-Run-Test-And-How-To-Add-New-Test-Case.md --- ...o-Run-Test-And-How-To-Add-New-Test-Case.md | 37 +++++++++++++++++++ 1 file changed, 37 insertions(+) diff --git a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md index 1dd1715951..e7a758988f 100644 --- a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md +++ b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md @@ -1,3 +1,40 @@ +### Prepare development environment + +1. sudo apt install + build-essential cmake net-tools python-pip python-setuptools python3-pip + python3-setuptools valgrind psmisc curl + +2. git clone ; cd TDengine + +3. mkdir debug; cd debug; cmake ..; make ; sudo make install + +4. pip install src/connector/python/linux/python2 ; pip3 install + src/connector/python/linux/python3 + +### How to run Python test suite + +1. cd \/tests/pytest + +2. ./smoketest.sh \# for smoke test + +3. ./smoketest.sh -g \# for memory leak detection test with valgrind + +4. ./fulltest.sh \# for full test + +> Note1: TDengine daemon's configuration and data files are stored in +> \/sim directory. As a historical design, it's same place with +> TSIM script. So after the TSIM script ran with sudo privilege, the directory +> has been used by TSIM then the python script cannot write it by a normal +> user. You need to remove the directory completely first before running the +> Python test case. We should consider using two different locations to store +> for TSIM and Python script. + +> Note2: if you need to debug crash problem with a core dump, you need +> manually edit smoketest.sh or fulltest.sh to add "ulimit -c unlimited" +> before the script line. Then you can look for the core file in +> \/tests/pytest after the program crash. + + ### How to add a new test case **1. TSIM test cases:** From f8c6980cfca83bb3a8ad35979d2698212a8b1663 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Fri, 15 May 2020 03:28:46 +0000 Subject: [PATCH 060/126] change tsdb log format --- src/tsdb/inc/tsdbMain.h | 20 ++++++++++---------- 1 file changed, 10 insertions(+), 10 deletions(-) diff --git a/src/tsdb/inc/tsdbMain.h b/src/tsdb/inc/tsdbMain.h index 6b7a77c798..e9714285f0 100644 --- a/src/tsdb/inc/tsdbMain.h +++ b/src/tsdb/inc/tsdbMain.h @@ -29,20 +29,20 @@ extern "C" { extern int tsdbDebugFlag; -#define tsdbError(...) \ - if (tsdbDebugFlag & DEBUG_ERROR) { \ - taosPrintLog("ERROR TSDB ", tsdbDebugFlag, __VA_ARGS__); \ +#define tsdbError(...) \ + if (tsdbDebugFlag & DEBUG_ERROR) { \ + taosPrintLog("ERROR TDB ", tsdbDebugFlag, __VA_ARGS__); \ } -#define tsdbWarn(...) \ - if (tsdbDebugFlag & DEBUG_WARN) { \ - taosPrintLog("WARN TSDB ", tsdbDebugFlag, __VA_ARGS__); \ +#define tsdbWarn(...) \ + if (tsdbDebugFlag & DEBUG_WARN) { \ + taosPrintLog("WARN TDB ", tsdbDebugFlag, __VA_ARGS__); \ } -#define tsdbTrace(...) \ - if (tsdbDebugFlag & DEBUG_TRACE) { \ - taosPrintLog("TSDB ", tsdbDebugFlag, __VA_ARGS__); \ +#define tsdbTrace(...) \ + if (tsdbDebugFlag & DEBUG_TRACE) { \ + taosPrintLog("TDB ", tsdbDebugFlag, __VA_ARGS__); \ } #define tsdbPrint(...) \ - { taosPrintLog("TSDB ", 255, __VA_ARGS__); } + { taosPrintLog("TDB ", 255, __VA_ARGS__); } // ------------------------------ TSDB META FILE INTERFACES ------------------------------ #define TSDB_META_FILE_NAME "META" From 16fa66b875401f95a0602afd18ff3d29aa23c8a5 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:30:31 +0800 Subject: [PATCH 061/126] Update README.md --- README.md | 24 ++++-------------------- 1 file changed, 4 insertions(+), 20 deletions(-) diff --git a/README.md b/README.md index 8c5bc46ef7..d75680cb22 100644 --- a/README.md +++ b/README.md @@ -115,26 +115,6 @@ TDengine provides abundant developing tools for users to develop on TDengine. Fo - [RESTful API](https://www.taosdata.com/en/documentation/connector/#RESTful-Connector) - [Node.js](https://www.taosdata.com/en/documentation/connector/#Node.js-Connector) -# How to run the test cases and how to add a new test case? - TDengine's test framework and all test cases are fully open source. - Please refer to [this document](tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. - -### CI Covenant submission adoption principle. - -- Every commit / PR compilation must pass. Currently, the warning is treated - as an error, so the warning must also be resolved. - -- Test cases that already exist must pass. - -- Because CI is very important to support build and automatically test - procedure, it is necessary to manually test the test case before adding it - and do as many iterations as possible to ensure that the test case provides - stable and reliable test results when added. - -> Note: In the future, according to the requirements and test development -> progress will add stress testing, performance testing, code style, -> and other features based on functional testing. - ### Third Party Connectors The TDengine community has also kindly built some of their own connectors! Follow the links below to find the source code for them. @@ -142,6 +122,10 @@ The TDengine community has also kindly built some of their own connectors! Follo - [Rust Connector](https://github.com/taosdata/TDengine/tree/master/tests/examples/rust) - [.Net Core Connector](https://github.com/maikebing/Maikebing.EntityFrameworkCore.Taos) +# How to run the test cases and how to add a new test case? + TDengine's test framework and all test cases are fully open source. + Please refer to [this document](tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md) for how to run test and develop new test case. + # TDengine Roadmap - Support event-driven stream computing - Support user defined functions From 70b511cf717057924202f132fc6762a69b183504 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:31:12 +0800 Subject: [PATCH 062/126] Update How-To-Run-Test-And-How-To-Add-New-Test-Case.md --- ...ow-To-Run-Test-And-How-To-Add-New-Test-Case.md | 15 +++++++++++++++ 1 file changed, 15 insertions(+) diff --git a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md index e7a758988f..246ab0ea37 100644 --- a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md +++ b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md @@ -218,3 +218,18 @@ def checkAffectedRows(self, expectAffectedRows): > appropriate without additional > burden.   +### CI Covenant submission adoption principle. + +- Every commit / PR compilation must pass. Currently, the warning is treated + as an error, so the warning must also be resolved. + +- Test cases that already exist must pass. + +- Because CI is very important to support build and automatically test + procedure, it is necessary to manually test the test case before adding it + and do as many iterations as possible to ensure that the test case provides + stable and reliable test results when added. + +> Note: In the future, according to the requirements and test development +> progress will add stress testing, performance testing, code style, +> and other features based on functional testing. From 25976474d4d1f1e4c2498f86daaae750df3520fc Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 11:32:33 +0800 Subject: [PATCH 063/126] Update How-To-Run-Test-And-How-To-Add-New-Test-Case.md --- tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md index 246ab0ea37..7c42d47d1b 100644 --- a/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md +++ b/tests/How-To-Run-Test-And-How-To-Add-New-Test-Case.md @@ -218,7 +218,7 @@ def checkAffectedRows(self, expectAffectedRows): > appropriate without additional > burden.   -### CI Covenant submission adoption principle. +### CI submission adoption principle. - Every commit / PR compilation must pass. Currently, the warning is treated as an error, so the warning must also be resolved. From 75f3a46067c999dc65ac6b05640665dbad961d76 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Fri, 15 May 2020 12:00:56 +0800 Subject: [PATCH 064/126] scripts --- tests/script/general/stable/dnode3.sim | 223 ++++++++++++++++++ tests/script/general/stable/testSuite.sim | 1 + tests/script/jenkins/basic.txt | 53 ++--- tests/script/unique/db/delete.sim | 3 +- tests/script/unique/db/delete_part.sim | 121 +++++++++- tests/script/unique/db/replica_part.sim | 6 +- tests/script/unique/http/opentsdb.sim | 2 +- .../{metrics => stable}/balance_replica1.sim | 7 +- .../unique/{metrics => stable}/dnode2.sim | 9 +- .../{metrics => stable}/dnode2_stop.sim | 13 +- .../unique/{metrics => stable}/dnode3.sim | 14 +- .../{metrics => stable}/replica2_dnode4.sim | 19 +- .../{metrics => stable}/replica2_vnode3.sim | 9 +- .../{metrics => stable}/replica3_dnode6.sim | 30 +-- .../{metrics => stable}/replica3_vnode3.sim | 21 +- .../unique/{metrics => stable}/testSuite.sim | 0 tests/script/unique/table/back_insert.sim | 7 - tests/script/unique/table/delete_part.sim | 85 ------- tests/script/unique/table/testSuite.sim | 1 - tests/script/unique/testSuite.sim | 3 - tests/script/unique/vnode/commit.sim | 158 ------------- tests/script/unique/vnode/many.sim | 14 +- tests/script/unique/vnode/replica2_basic.sim | 199 ---------------- tests/script/unique/vnode/replica2_repeat.sim | 4 +- tests/script/unique/vnode/replica3_repeat.sim | 4 +- tests/script/unique/vnode/replica3_vgroup.sim | 28 +-- tests/script/unique/vnode/testSuite.sim | 2 - 27 files changed, 435 insertions(+), 601 deletions(-) create mode 100644 tests/script/general/stable/dnode3.sim rename tests/script/unique/{metrics => stable}/balance_replica1.sim (97%) rename tests/script/unique/{metrics => stable}/dnode2.sim (97%) rename tests/script/unique/{metrics => stable}/dnode2_stop.sim (93%) rename tests/script/unique/{metrics => stable}/dnode3.sim (96%) rename tests/script/unique/{metrics => stable}/replica2_dnode4.sim (94%) rename tests/script/unique/{metrics => stable}/replica2_vnode3.sim (97%) rename tests/script/unique/{metrics => stable}/replica3_dnode6.sim (92%) rename tests/script/unique/{metrics => stable}/replica3_vnode3.sim (94%) rename tests/script/unique/{metrics => stable}/testSuite.sim (100%) delete mode 100644 tests/script/unique/table/back_insert.sim delete mode 100644 tests/script/unique/table/delete_part.sim delete mode 100644 tests/script/unique/table/testSuite.sim delete mode 100644 tests/script/unique/testSuite.sim delete mode 100644 tests/script/unique/vnode/commit.sim delete mode 100644 tests/script/unique/vnode/replica2_basic.sim diff --git a/tests/script/general/stable/dnode3.sim b/tests/script/general/stable/dnode3.sim new file mode 100644 index 0000000000..38d05a924b --- /dev/null +++ b/tests/script/general/stable/dnode3.sim @@ -0,0 +1,223 @@ +system sh/stop_dnodes.sh + +system sh/deploy.sh -n dnode1 -i 1 +system sh/deploy.sh -n dnode2 -i 2 +system sh/deploy.sh -n dnode3 -i 3 +system sh/deploy.sh -n dnode4 -i 4 +system sh/cfg.sh -n dnode1 -c walLevel -v 0 +system sh/cfg.sh -n dnode2 -c walLevel -v 0 +system sh/cfg.sh -n dnode3 -c walLevel -v 0 +system sh/cfg.sh -n dnode4 -c walLevel -v 0 +system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v 4 +system sh/cfg.sh -n dnode2 -c numOfTotalVnodes -v 4 +system sh/cfg.sh -n dnode3 -c numOfTotalVnodes -v 4 +system sh/cfg.sh -n dnode4 -c numOfTotalVnodes -v 4 +system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 +system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 +system sh/cfg.sh -n dnode3 -c maxtablesPerVnode -v 4 +system sh/cfg.sh -n dnode4 -c maxtablesPerVnode -v 4 +system sh/exec.sh -n dnode1 -s start + +sql connect + +sql create dnode $hostname2 +sql create dnode $hostname3 +sql create dnode $hostname4 +system sh/exec.sh -n dnode2 -s start +system sh/exec.sh -n dnode3 -s start +system sh/exec.sh -n dnode4 -s start +$x = 0 +createDnode: + $x = $x + 1 + sleep 1000 + if $x == 20 then + return -1 + endi +sql show dnodes; +if $data4_2 == offline then + goto createDnode +endi +if $data4_3 == offline then + goto createDnode +endi +if $data4_4 == offline then + goto createDnode +endi + +print ======================== dnode1 start + +$dbPrefix = r3v3_db +$tbPrefix = r3v3_tb +$mtPrefix = r3v3_mt +$tbNum = 10 +$rowNum = 20 +$totalNum = 200 + +print =============== step1 +$i = 0 +$db = $dbPrefix . $i +$mt = $mtPrefix . $i + +sql create database $db maxTables 4 +sql use $db +sql create table $mt (ts timestamp, tbcol int) TAGS(tgcol int) + +$i = 0 +while $i < $tbNum + $tb = $tbPrefix . $i + sql create table $tb using $mt tags( $i ) + + $x = 0 + while $x < $rowNum + $val = $x * 60000 + $ms = 1519833600000 + $val + sql insert into $tb values ($ms , $x ) + $x = $x + 1 + endw + + $i = $i + 1 +endw + +sql show vgroups +print vgroups ==> $rows +if $rows != 3 then + return -1 +endi + +sleep 100 + +print =============== step2 +$i = 1 +$tb = $tbPrefix . $i + +sql select count(*) from $tb +print ===> $data00 +if $data00 != $rowNum then + return -1 +endi + +sql select count(tbcol) from $tb +print ===> $data00 +if $data00 != $rowNum then + return -1 +endi + +print =============== step3 +sql select count(tbcol) from $tb where ts <= 1519833840000 +print ===> $data00 +if $data00 != 5 then + return -1 +endi + +print =============== step4 +sql select count(tbcol) as b from $tb +print ===> $data00 +if $data00 != $rowNum then + return -1 +endi + +print =============== step5 +sql select count(tbcol) as b from $tb interval(1m) +print ===> $data01 +if $data01 != 1 then + return -1 +endi + +sql select count(tbcol) as b from $tb interval(1d) +print ===> $data01 +if $data01 != $rowNum then + return -1 +endi + +print =============== step6 +sql select count(tbcol) as b from $tb where ts <= 1519833840000 interval(1m) +print ===> $data01 +if $data01 != 1 then + return -1 +endi +if $rows != 5 then + return -1 +endi + +print =============== step7 +print select count(*) from $mt +sql select count(*) from $mt +print ===> $data00 +if $data00 != $totalNum then + return -1 +endi + +sql select count(tbcol) from $mt +print ===> $data00 +if $data00 != $totalNum then + return -1 +endi + +print =============== step8 +sql select count(tbcol) as c from $mt where ts <= 1519833840000 +print ===> $data00 +if $data00 != 50 then + return -1 +endi + +sql select count(tbcol) as c from $mt where tgcol < 5 +print ===> $data00 +if $data00 != 100 then + return -1 +endi + +sql select count(tbcol) as c from $mt where tgcol < 5 and ts <= 1519833840000 +print ===> $data00 +if $data00 != 25 then + return -1 +endi + +print =============== step9 +sql select count(tbcol) as b from $mt interval(1m) +print ===> $data01 +if $data01 != 10 then + return -1 +endi + +sql select count(tbcol) as b from $mt interval(1d) +print ===> $data01 +if $data01 != 200 then + return -1 +endi + +print =============== step10 +sql select count(tbcol) as b from $mt group by tgcol +print ===> $data00 +if $data00 != $rowNum then + return -1 +endi + +if $rows != $tbNum then + return -1 +endi + +print =============== step11 +sql select count(tbcol) as b from $mt where ts <= 1519833840000 interval(1m) group by tgcol +print ===> $data01 +if $data01 != 1 then + return -1 +endi +if $rows != 50 then + return -1 +endi + +print =============== clear +sql drop database $db +sql show databases +if $rows != 0 then + return -1 +endi + +system sh/exec.sh -n dnode1 -s stop -x SIGINT +system sh/exec.sh -n dnode2 -s stop -x SIGINT +system sh/exec.sh -n dnode3 -s stop -x SIGINT +system sh/exec.sh -n dnode4 -s stop -x SIGINT +system sh/exec.sh -n dnode5 -s stop -x SIGINT +system sh/exec.sh -n dnode6 -s stop -x SIGINT +system sh/exec.sh -n dnode7 -s stop -x SIGINT +system sh/exec.sh -n dnode8 -s stop -x SIGINT \ No newline at end of file diff --git a/tests/script/general/stable/testSuite.sim b/tests/script/general/stable/testSuite.sim index a3696c8706..e786ac9ca4 100644 --- a/tests/script/general/stable/testSuite.sim +++ b/tests/script/general/stable/testSuite.sim @@ -1,4 +1,5 @@ run general/stable/disk.sim +run general/stable/dnode3.sim run general/stable/metrics.sim run general/stable/values.sim run general/stable/vnode3.sim diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index b86113eb51..c59ea987de 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -85,10 +85,10 @@ cd ../../../debug; make ./test.sh -f general/import/basic.sim ./test.sh -f general/import/commit.sim ./test.sh -f general/import/large.sim -#hongze ./test.sh -f general/import/replica1.sim +#liao ./test.sh -f general/import/replica1.sim ./test.sh -f general/insert/basic.sim -#hongze ./test.sh -f general/insert/insert_drop.sim +#liao ./test.sh -f general/insert/insert_drop.sim ./test.sh -f general/insert/query_block1_memory.sim ./test.sh -f general/insert/query_block2_memory.sim ./test.sh -f general/insert/query_block1_file.sim @@ -150,6 +150,7 @@ cd ../../../debug; make #./test.sh -f general/parser/bug.sim ./test.sh -f general/stable/disk.sim +#./test.sh -f general/stable/dnode3.sim ./test.sh -f general/stable/metrics.sim ./test.sh -f general/stable/values.sim ./test.sh -f general/stable/vnode3.sim @@ -251,16 +252,16 @@ cd ../../../debug; make ./test.sh -u -f unique/column/replica3.sim -#hongze ./test.sh -u -f unique/db/commit.sim +#hongze crash ./test.sh -u -f unique/db/commit.sim ./test.sh -u -f unique/db/delete.sim -#./test.sh -u -f unique/db/delete_part.sim -##./test.sh -u -f unique/db/replica_add12.sim -##./test.sh -u -f unique/db/replica_add13.sim -##./test.sh -u -f unique/db/replica_add23.sim -##./test.sh -u -f unique/db/replica_reduce21.sim -##./test.sh -u -f unique/db/replica_reduce32.sim -##./test.sh -u -f unique/db/replica_reduce31.sim -##./test.sh -u -f unique/db/replica_part.sim +./test.sh -u -f unique/db/delete_part.sim +./test.sh -u -f unique/db/replica_add12.sim +#hongze crash ./test.sh -u -f unique/db/replica_add13.sim +#hongze crash ./test.sh -u -f unique/db/replica_add23.sim +#hongze crash ./test.sh -u -f unique/db/replica_reduce21.sim +./test.sh -u -f unique/db/replica_reduce32.sim +#hongze crash /test.sh -u -f unique/db/replica_reduce31.sim +./test.sh -u -f unique/db/replica_part.sim ##./test.sh -u -f unique/dnode/balance1.sim ##./test.sh -u -f unique/dnode/balance2.sim @@ -278,14 +279,14 @@ cd ../../../debug; make #./test.sh -u -f unique/import/replica2.sim #./test.sh -u -f unique/import/replica3.sim -#./test.sh -u -f unique/metrics/balance_replica1.sim -#./test.sh -u -f unique/metrics/dnode2_stop.sim -#./test.sh -u -f unique/metrics/dnode2.sim -#./test.sh -u -f unique/metrics/dnode3.sim -#./test.sh -u -f unique/metrics/replica2_dnode4.sim -#./test.sh -u -f unique/metrics/replica2_vnode3.sim -#./test.sh -u -f unique/metrics/replica3_dnode6.sim -#./test.sh -u -f unique/metrics/replica3_vnode3.sim +#./test.sh -u -f unique/stable/balance_replica1.sim +#./test.sh -u -f unique/stable/dnode2_stop.sim +#./test.sh -u -f unique/stable/dnode2.sim +#./test.sh -u -f unique/stable/dnode3.sim +#./test.sh -u -f unique/stable/replica2_dnode4.sim +#./test.sh -u -f unique/stable/replica2_vnode3.sim +#./test.sh -u -f unique/stable/replica3_dnode6.sim +#./test.sh -u -f unique/stable/replica3_vnode3.sim ./test.sh -u -f unique/mnode/mgmt22.sim ./test.sh -u -f unique/mnode/mgmt23.sim @@ -296,13 +297,9 @@ cd ../../../debug; make ./test.sh -u -f unique/mnode/mgmt34.sim ./test.sh -u -f unique/mnode/mgmtr2.sim -##./test.sh -u -f unique/table/delete_part.sim - -#./test.sh -u -f unique/vnode/commit.sim -#./test.sh -u -f unique/vnode/many.sim -#./test.sh -u -f unique/vnode/replica2_basic.sim +./test.sh -u -f unique/vnode/many.sim ./test.sh -u -f unique/vnode/replica2_basic2.sim -#./test.sh -u -f unique/vnode/replica2_repeat.sim -#hongze ./test.sh -u -f unique/vnode/replica3_basic.sim -#./test.sh -u -f unique/vnode/replica3_repeat.sim -#./test.sh -u -f unique/vnode/replica3_vgroup.sim +./test.sh -u -f unique/vnode/replica2_repeat.sim +./test.sh -u -f unique/vnode/replica3_basic.sim +./test.sh -u -f unique/vnode/replica3_repeat.sim +./test.sh -u -f unique/vnode/replica3_vgroup.sim diff --git a/tests/script/unique/db/delete.sim b/tests/script/unique/db/delete.sim index 0ae6a3c13c..5688333d20 100644 --- a/tests/script/unique/db/delete.sim +++ b/tests/script/unique/db/delete.sim @@ -34,13 +34,14 @@ while $i < 2000 $i = $i + 1 endw +sleep 2500 + sql show db.vgroups if $rows != 2 then return -1 endi print ======== step2 -sleep 1000 sql drop database db sql show databases if $rows != 0 then diff --git a/tests/script/unique/db/delete_part.sim b/tests/script/unique/db/delete_part.sim index 7cf326e191..179d729d8d 100644 --- a/tests/script/unique/db/delete_part.sim +++ b/tests/script/unique/db/delete_part.sim @@ -45,27 +45,126 @@ begin: sql create database $db sql use $db - $x = 0 - while $x < 32 - $tb = tb . $x - sql create table $tb (ts timestamp, i int) - sql insert into $tb values(now, $x ) - $x = $x + 1 - endw + sql create table t11 (ts timestamp, i int) + sql insert into t11 values(now, 1 ) + sql create table t12 (ts timestamp, i int) + sql insert into t12 values(now, 1 ) + sql create table t13 (ts timestamp, i int) + sql insert into t13 values(now, 1 ) + sql create table t14 (ts timestamp, i int) + sql insert into t14 values(now, 1 ) + sleep 1200 + + sql create table t21 (ts timestamp, i int) + sql insert into t21 values(now, 1 ) + sql create table t22 (ts timestamp, i int) + sql insert into t22 values(now, 1 ) + sql create table t23 (ts timestamp, i int) + sql insert into t23 values(now, 1 ) + sql create table t24 (ts timestamp, i int) + sql insert into t24 values(now, 1 ) + sleep 1200 + + sql create table t31 (ts timestamp, i int) + sql insert into t31 values(now, 1 ) + sql create table t32 (ts timestamp, i int) + sql insert into t32 values(now, 1 ) + sql create table t33 (ts timestamp, i int) + sql insert into t33 values(now, 1 ) + sql create table t34 (ts timestamp, i int) + sql insert into t34 values(now, 1 ) + sleep 1200 + + sql create table t41 (ts timestamp, i int) + sql insert into t41 values(now, 1 ) + sql create table t42 (ts timestamp, i int) + sql insert into t42 values(now, 1 ) + sql create table t43 (ts timestamp, i int) + sql insert into t43 values(now, 1 ) + sql create table t44 (ts timestamp, i int) + sql insert into t44 values(now, 1 ) + sleep 1200 + + sql create table t51 (ts timestamp, i int) + sql insert into t51 values(now, 1 ) + sql create table t52 (ts timestamp, i int) + sql insert into t52 values(now, 1 ) + sql create table t53 (ts timestamp, i int) + sql insert into t53 values(now, 1 ) + sql create table t54 (ts timestamp, i int) + sql insert into t54 values(now, 1 ) + sleep 1200 + + sql create table t61 (ts timestamp, i int) + sql insert into t61 values(now, 1 ) + sql create table t62 (ts timestamp, i int) + sql insert into t62 values(now, 1 ) + sql create table t63 (ts timestamp, i int) + sql insert into t63 values(now, 1 ) + sql create table t64 (ts timestamp, i int) + sql insert into t64 values(now, 1 ) + sleep 1200 + + sql create table t71 (ts timestamp, i int) + sql insert into t71 values(now, 1 ) + sql create table t72 (ts timestamp, i int) + sql insert into t72 values(now, 1 ) + sql create table t73 (ts timestamp, i int) + sql insert into t73 values(now, 1 ) + sql create table t74 (ts timestamp, i int) + sql insert into t74 values(now, 1 ) + sleep 1200 + + sql create table t81 (ts timestamp, i int) + sql insert into t81 values(now, 1 ) + sql create table t82 (ts timestamp, i int) + sql insert into t82 values(now, 1 ) + sql create table t83 (ts timestamp, i int) + sql insert into t83 values(now, 1 ) + sql create table t84 (ts timestamp, i int) + sql insert into t84 values(now, 1 ) + sleep 1200 + + sql show dnodes + print dnode1 openVnodes $data2_1 + print dnode2 openVnodes $data2_2 + if $data2_1 != 4 then + return -1 + endi + if $data2_2 != 4 then + return -1 + endi print ======== step2 $loop + system sh/exec_up.sh -n dnode2 -s stop sleep 1000 + print ==> drop database $db sql drop database $db - print ======== step3 $loop - sleep 3000 + sleep 2000 system sh/exec_up.sh -n dnode2 -s start - sleep 5000 + sleep 15000 + + sql show dnodes + print dnode1 openVnodes $data2_1 $data4_1 + print dnode2 openVnodes $data2_2 $data4_2 + if $data2_1 != 0 then + return -1 + endi + if $data2_2 != 0 then + return -1 + endi + if $data4_1 != ready then + return -1 + endi + if $data4_2 != ready then + return -1 + endi print ===> test times : $loop - if $loop > 5 then + if $loop > 3 then return 0 endi diff --git a/tests/script/unique/db/replica_part.sim b/tests/script/unique/db/replica_part.sim index f0ffb89015..76e3eaabbe 100644 --- a/tests/script/unique/db/replica_part.sim +++ b/tests/script/unique/db/replica_part.sim @@ -7,9 +7,9 @@ system sh/deploy.sh -n dnode3 -i 3 system sh/cfg.sh -n dnode1 -c wallevel -v 2 system sh/cfg.sh -n dnode2 -c wallevel -v 2 system sh/cfg.sh -n dnode3 -c wallevel -v 2 -system sh/cfg.sh -n dnode1 -c numOfMPeers -v 2 -system sh/cfg.sh -n dnode2 -c numOfMPeers -v 2 -system sh/cfg.sh -n dnode3 -c numOfMPeers -v 2 +system sh/cfg.sh -n dnode1 -c numOfMPeers -v 1 +system sh/cfg.sh -n dnode2 -c numOfMPeers -v 1 +system sh/cfg.sh -n dnode3 -c numOfMPeers -v 1 system sh/cfg.sh -n dnode1 -c mgmtEqualVnodeNum -v 4 system sh/cfg.sh -n dnode2 -c mgmtEqualVnodeNum -v 4 system sh/cfg.sh -n dnode3 -c mgmtEqualVnodeNum -v 4 diff --git a/tests/script/unique/http/opentsdb.sim b/tests/script/unique/http/opentsdb.sim index ad044e3984..4e126c4e60 100644 --- a/tests/script/unique/http/opentsdb.sim +++ b/tests/script/unique/http/opentsdb.sim @@ -204,7 +204,7 @@ system_content curl -u root:taosdata -d '[{"metric": "sys_mem","timestamp": 134 print $system_content -if $system_content != @{"failed":1,"success":1}@ then +if $system_content != @{"failed":0,"success":2}@ then return -1 endi diff --git a/tests/script/unique/metrics/balance_replica1.sim b/tests/script/unique/stable/balance_replica1.sim similarity index 97% rename from tests/script/unique/metrics/balance_replica1.sim rename to tests/script/unique/stable/balance_replica1.sim index 52bf558faa..8cf41319a0 100644 --- a/tests/script/unique/metrics/balance_replica1.sim +++ b/tests/script/unique/stable/balance_replica1.sim @@ -1,7 +1,4 @@ system sh/stop_dnodes.sh - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v 4 @@ -26,7 +23,7 @@ $totalNum = 200 print ============== step1 print ========= start dnode1 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect $i = 0 @@ -81,7 +78,7 @@ if $dnode2Vnodes != NULL then endi print =============== step3 start dnode2 sql create dnode $hostname2 -system sh/exec.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode2 -s start sleep 8000 $x = 0 diff --git a/tests/script/unique/metrics/dnode2.sim b/tests/script/unique/stable/dnode2.sim similarity index 97% rename from tests/script/unique/metrics/dnode2.sim rename to tests/script/unique/stable/dnode2.sim index cd76b39ba0..2d894c6542 100644 --- a/tests/script/unique/metrics/dnode2.sim +++ b/tests/script/unique/stable/dnode2.sim @@ -1,7 +1,4 @@ system sh/stop_dnodes.sh - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/cfg.sh -n dnode1 -c walLevel -v 0 @@ -10,12 +7,12 @@ system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v 4 system sh/cfg.sh -n dnode2 -c numOfTotalVnodes -v 4 system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect sql create dnode $hostname2 -system sh/exec.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode2 -s start $x = 0 createDnode: @@ -25,7 +22,7 @@ createDnode: return -1 endi sql show dnodes; -if $data4_192.168.0.2 == offline then +if $data4_2 == offline then goto createDnode endi diff --git a/tests/script/unique/metrics/dnode2_stop.sim b/tests/script/unique/stable/dnode2_stop.sim similarity index 93% rename from tests/script/unique/metrics/dnode2_stop.sim rename to tests/script/unique/stable/dnode2_stop.sim index 996482d11e..55ad5fcf09 100644 --- a/tests/script/unique/metrics/dnode2_stop.sim +++ b/tests/script/unique/stable/dnode2_stop.sim @@ -1,7 +1,4 @@ system sh/stop_dnodes.sh - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/cfg.sh -n dnode1 -c walLevel -v 0 @@ -10,11 +7,11 @@ system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v 4 system sh/cfg.sh -n dnode2 -c numOfTotalVnodes -v 4 system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect sql create dnode $hostname2 -system sh/exec.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode2 -s start $x = 0 createDnode: @@ -24,7 +21,7 @@ createDnode: return -1 endi sql show dnodes; -if $data4_192.168.0.2 == offline then +if $data4_2 == offline then goto createDnode endi @@ -76,7 +73,7 @@ endi sleep 100 -system sh/exec.sh -n dnode2 -s stop -x SIGINT +system sh/exec_up.sh -n dnode2 -s stop -x SIGINT print =============== step2 sql select count(*) from $mt -x step2 @@ -87,7 +84,7 @@ sql select count(tbcol) from $mt -x step21 return -1 step21: -system sh/exec.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode2 -s start sleep 10000 print =============== step3 diff --git a/tests/script/unique/metrics/dnode3.sim b/tests/script/unique/stable/dnode3.sim similarity index 96% rename from tests/script/unique/metrics/dnode3.sim rename to tests/script/unique/stable/dnode3.sim index 3a5419dff4..384129a94c 100644 --- a/tests/script/unique/metrics/dnode3.sim +++ b/tests/script/unique/stable/dnode3.sim @@ -1,8 +1,4 @@ system sh/stop_dnodes.sh - - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/deploy.sh -n dnode3 -i 3 @@ -15,14 +11,14 @@ system sh/cfg.sh -n dnode3 -c numOfTotalVnodes -v 4 system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode3 -c maxtablesPerVnode -v 4 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect sql create dnode $hostname2 -system sh/exec.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode2 -s start sql create dnode $hostname3 -system sh/exec.sh -n dnode3 -s start +system sh/exec_up.sh -n dnode3 -s start $x = 0 createDnode: @@ -32,10 +28,10 @@ createDnode: return -1 endi sql show dnodes; -if $data4_192.168.0.2 == offline then +if $data4_2 == offline then goto createDnode endi -if $data4_192.168.0.3 == offline then +if $data4_3 == offline then goto createDnode endi diff --git a/tests/script/unique/metrics/replica2_dnode4.sim b/tests/script/unique/stable/replica2_dnode4.sim similarity index 94% rename from tests/script/unique/metrics/replica2_dnode4.sim rename to tests/script/unique/stable/replica2_dnode4.sim index bedc895dd1..f204e05949 100644 --- a/tests/script/unique/metrics/replica2_dnode4.sim +++ b/tests/script/unique/stable/replica2_dnode4.sim @@ -1,9 +1,4 @@ system sh/stop_dnodes.sh - - - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/deploy.sh -n dnode3 -i 3 @@ -20,16 +15,16 @@ system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode3 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode4 -c maxtablesPerVnode -v 4 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect sql create dnode $hostname2 sql create dnode $hostname3 sql create dnode $hostname4 -system sh/exec.sh -n dnode2 -s start -system sh/exec.sh -n dnode3 -s start -system sh/exec.sh -n dnode4 -s start +system sh/exec_up.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode3 -s start +system sh/exec_up.sh -n dnode4 -s start $x = 0 createDnode: @@ -39,13 +34,13 @@ createDnode: return -1 endi sql show dnodes; -if $data4_192.168.0.2 == offline then +if $data4_2 == offline then goto createDnode endi -if $data4_192.168.0.3 == offline then +if $data4_3 == offline then goto createDnode endi -if $data4_192.168.0.4 == offline then +if $data4_4 == offline then goto createDnode endi diff --git a/tests/script/unique/metrics/replica2_vnode3.sim b/tests/script/unique/stable/replica2_vnode3.sim similarity index 97% rename from tests/script/unique/metrics/replica2_vnode3.sim rename to tests/script/unique/stable/replica2_vnode3.sim index 9a1d3477be..238e2e4aee 100644 --- a/tests/script/unique/metrics/replica2_vnode3.sim +++ b/tests/script/unique/stable/replica2_vnode3.sim @@ -1,7 +1,4 @@ system sh/stop_dnodes.sh - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/cfg.sh -n dnode1 -c walLevel -v 0 @@ -10,11 +7,11 @@ system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v 4 system sh/cfg.sh -n dnode2 -c numOfTotalVnodes -v 4 system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect sql create dnode $hostname2 -system sh/exec.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode2 -s start $x = 0 createDnode: @@ -24,7 +21,7 @@ createDnode: return -1 endi sql show dnodes; -if $data4_192.168.0.2 == offline then +if $data4_2 == offline then goto createDnode endi diff --git a/tests/script/unique/metrics/replica3_dnode6.sim b/tests/script/unique/stable/replica3_dnode6.sim similarity index 92% rename from tests/script/unique/metrics/replica3_dnode6.sim rename to tests/script/unique/stable/replica3_dnode6.sim index 135e594cdc..1c8a8ae10e 100644 --- a/tests/script/unique/metrics/replica3_dnode6.sim +++ b/tests/script/unique/stable/replica3_dnode6.sim @@ -1,12 +1,4 @@ system sh/stop_dnodes.sh - - - - - - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/deploy.sh -n dnode3 -i 3 @@ -35,7 +27,7 @@ system sh/cfg.sh -n dnode4 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode5 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode6 -c maxtablesPerVnode -v 4 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect sql create dnode $hostname2 @@ -43,11 +35,11 @@ sql create dnode $hostname3 sql create dnode $hostname4 sql create dnode $hostname5 sql create dnode $hostname6 -system sh/exec.sh -n dnode2 -s start -system sh/exec.sh -n dnode3 -s start -system sh/exec.sh -n dnode4 -s start -system sh/exec.sh -n dnode5 -s start -system sh/exec.sh -n dnode6 -s start +system sh/exec_up.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode3 -s start +system sh/exec_up.sh -n dnode4 -s start +system sh/exec_up.sh -n dnode5 -s start +system sh/exec_up.sh -n dnode6 -s start $x = 0 createDnode: @@ -57,19 +49,19 @@ createDnode: return -1 endi sql show dnodes; -if $data4_192.168.0.2 == offline then +if $data4_2 == offline then goto createDnode endi -if $data4_192.168.0.3 == offline then +if $data4_3 == offline then goto createDnode endi -if $data4_192.168.0.4 == offline then +if $data4_4 == offline then goto createDnode endi -if $data4_192.168.0.5 == offline then +if $data4_5 == offline then goto createDnode endi -if $data4_192.168.0.6 == offline then +if $data4_6 == offline then goto createDnode endi diff --git a/tests/script/unique/metrics/replica3_vnode3.sim b/tests/script/unique/stable/replica3_vnode3.sim similarity index 94% rename from tests/script/unique/metrics/replica3_vnode3.sim rename to tests/script/unique/stable/replica3_vnode3.sim index ca147c1ef5..75870af4c4 100644 --- a/tests/script/unique/metrics/replica3_vnode3.sim +++ b/tests/script/unique/stable/replica3_vnode3.sim @@ -1,9 +1,5 @@ system sh/stop_dnodes.sh - - - - system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 system sh/deploy.sh -n dnode3 -i 3 @@ -20,16 +16,16 @@ system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode3 -c maxtablesPerVnode -v 4 system sh/cfg.sh -n dnode4 -c maxtablesPerVnode -v 4 -system sh/exec.sh -n dnode1 -s start +system sh/exec_up.sh -n dnode1 -s start sql connect sql create dnode $hostname2 sql create dnode $hostname3 sql create dnode $hostname4 -system sh/exec.sh -n dnode2 -s start -system sh/exec.sh -n dnode3 -s start -system sh/exec.sh -n dnode4 -s start +system sh/exec_up.sh -n dnode2 -s start +system sh/exec_up.sh -n dnode3 -s start +system sh/exec_up.sh -n dnode4 -s start $x = 0 createDnode: $x = $x + 1 @@ -38,13 +34,13 @@ createDnode: return -1 endi sql show dnodes; -if $data4_192.168.0.2 == offline then +if $data4_2 == offline then goto createDnode endi -if $data4_192.168.0.3 == offline then +if $data4_3 == offline then goto createDnode endi -if $data4_192.168.0.4 == offline then +if $data4_4 == offline then goto createDnode endi @@ -144,6 +140,7 @@ if $rows != 5 then endi print =============== step7 +print select count(*) from $mt sql select count(*) from $mt print ===> $data00 if $data00 != $totalNum then @@ -208,7 +205,7 @@ endi if $rows != 50 then return -1 endi -return + print =============== clear sql drop database $db sql show databases diff --git a/tests/script/unique/metrics/testSuite.sim b/tests/script/unique/stable/testSuite.sim similarity index 100% rename from tests/script/unique/metrics/testSuite.sim rename to tests/script/unique/stable/testSuite.sim diff --git a/tests/script/unique/table/back_insert.sim b/tests/script/unique/table/back_insert.sim deleted file mode 100644 index 43831cca95..0000000000 --- a/tests/script/unique/table/back_insert.sim +++ /dev/null @@ -1,7 +0,0 @@ -sql connect -$x = 1 -begin: - sql insert into db.tb values(now, $x ) -x begin - #print ===> insert successed $x - $x = $x + 1 -goto begin \ No newline at end of file diff --git a/tests/script/unique/table/delete_part.sim b/tests/script/unique/table/delete_part.sim deleted file mode 100644 index 04cb03598c..0000000000 --- a/tests/script/unique/table/delete_part.sim +++ /dev/null @@ -1,85 +0,0 @@ -system sh/stop_dnodes.sh -system sh/deploy.sh -n dnode1 -i 1 -system sh/deploy.sh -n dnode2 -i 2 -system sh/deploy.sh -n dnode3 -i 3 -system sh/deploy.sh -n dnode4 -i 4 - -system sh/cfg.sh -n dnode1 -c walLevel -v 0 -system sh/cfg.sh -n dnode2 -c walLevel -v 0 -system sh/cfg.sh -n dnode3 -c walLevel -v 0 -system sh/cfg.sh -n dnode4 -c walLevel -v 0 - -system sh/cfg.sh -n dnode1 -c numOfMPeers -v 1 -system sh/cfg.sh -n dnode2 -c numOfMPeers -v 1 -system sh/cfg.sh -n dnode3 -c numOfMPeers -v 1 -system sh/cfg.sh -n dnode4 -c numOfMPeers -v 1 - -system sh/cfg.sh -n dnode1 -c mgmtEqualVnodeNum -v 4 -system sh/cfg.sh -n dnode2 -c mgmtEqualVnodeNum -v 4 -system sh/cfg.sh -n dnode3 -c mgmtEqualVnodeNum -v 4 -system sh/cfg.sh -n dnode4 -c mgmtEqualVnodeNum -v 4 - -system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v 4 -system sh/cfg.sh -n dnode2 -c numOfTotalVnodes -v 4 -system sh/cfg.sh -n dnode3 -c numOfTotalVnodes -v 4 -system sh/cfg.sh -n dnode4 -c numOfTotalVnodes -v 4 - -system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v 4 -system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 4 -system sh/cfg.sh -n dnode3 -c maxtablesPerVnode -v 4 -system sh/cfg.sh -n dnode4 -c maxtablesPerVnode -v 4 - -print ========= start dnodes -system sh/exec.sh -n dnode1 -s start -sql connect -sql create dnode $hostname2 -system sh/exec.sh -n dnode2 -s start -sleep 3000 - -sql create database dpdb -sql use dpdb - -$loop = 0 -begin: - - print ======== step1 - - $x = 0 - while $x < 16 - $tb = tb . $x - sql create table $tb (ts timestamp, i int) - sql insert into $tb values(now, $x ) - $x = $x + 1 - endw - - print ======== step2 - system sh/exec.sh -n dnode2 -s stop - $x = 0 - while $x < 16 - $tb = tb . $x - sql drop table $tb - $x = $x + 1 - endw - - print ======== step3 - sleep 2000 - system sh/exec.sh -n dnode2 -s start - sleep 3000 - - print ===> test times : $loop - if $loop > 20 then - return 0 - endi - - $loop = $loop + 1 - -goto begin - -system sh/exec_up.sh -n dnode1 -s stop -x SIGINT -system sh/exec_up.sh -n dnode2 -s stop -x SIGINT -system sh/exec_up.sh -n dnode3 -s stop -x SIGINT -system sh/exec_up.sh -n dnode4 -s stop -x SIGINT -system sh/exec_up.sh -n dnode5 -s stop -x SIGINT -system sh/exec_up.sh -n dnode6 -s stop -x SIGINT -system sh/exec_up.sh -n dnode7 -s stop -x SIGINT -system sh/exec_up.sh -n dnode8 -s stop -x SIGINT \ No newline at end of file diff --git a/tests/script/unique/table/testSuite.sim b/tests/script/unique/table/testSuite.sim deleted file mode 100644 index e0c0a1f2fa..0000000000 --- a/tests/script/unique/table/testSuite.sim +++ /dev/null @@ -1 +0,0 @@ -run unique/table/delete_part.sim diff --git a/tests/script/unique/testSuite.sim b/tests/script/unique/testSuite.sim deleted file mode 100644 index 374f9b7965..0000000000 --- a/tests/script/unique/testSuite.sim +++ /dev/null @@ -1,3 +0,0 @@ -################################# -run unique/mnode/testSuite.sim -################################## diff --git a/tests/script/unique/vnode/commit.sim b/tests/script/unique/vnode/commit.sim deleted file mode 100644 index 29c9f72335..0000000000 --- a/tests/script/unique/vnode/commit.sim +++ /dev/null @@ -1,158 +0,0 @@ -system sh/stop_dnodes.sh - -system sh/deploy.sh -n dnode1 -i 1 -system sh/deploy.sh -n dnode2 -i 2 -system sh/cfg.sh -n dnode1 -c wallevel -v 2 -system sh/cfg.sh -n dnode2 -c wallevel -v 2 -system sh/cfg.sh -n dnode1 -c numofMpeers -v 3 -system sh/cfg.sh -n dnode2 -c numofMpeers -v 3 -system sh/exec_up.sh -n dnode1 -s start - -sql connect -sql create dnode $hostname2 -system sh/exec_up.sh -n dnode2 -s start -sleep 3000 - -print =================== step 1 create db -sql create database c2db replica 2 days 10 keep 50 -sql use c2db -sql create table tb (ts timestamp, speed int) -sql insert into tb values(now, 0) - -print =================== step2 sleep 2000 and kill dnode2(SIGINT) -sleep 2000 -system sh/exec_up.sh -n dnode2 -s stop -x SIGINT -sleep 1000 - -print =================== step3 insert into dnode1 - -$x = 1 -while $x < 100 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -$x = 240 -while $x < 400 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -$x = 480 -while $x < 700 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -$x = 720 -while $x < 809 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -$x = 960 -while $x < 1043 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -$x = 1200 -while $x < 1244 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -$x = 1440 -while $x < 1677 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -$x = 1680 -while $x < 1683 - $time = $x . m - sql insert into tb values (now + $time , $x ) - $x = $x + 1 -endw - -print =================== step4 -sql select count(*) from tb -print select count(*) from tb ==> $data00 (expect 936) -if $data00 != 936 then - return -1 -endi -sql select * from tb order by ts desc -print select * from tb ==> $data00 $data01 $rows -if $data01 != 1682 then - return -1 -endi -if $rows != 936 then - return -1 -endi - -print =================== step5 sleep kill dnode1(SIGINT) then start dnode1 -system sh/exec_up.sh -n dnode1 -s stop -x SIGINT -sleep 5000 -system sh/exec_up.sh -n dnode1 -s start - -sleep 3000 -print =================== step6 start dnode2 and sleep 10000 (wait sync complete) -system sh/exec_up.sh -n dnode2 -s start -sleep 12000 - -print =================== step7 -sql_error insert into tb values(now + 1000h, 100) -sql select count(*) from tb order by ts desc -print select count(*) from tb ==> $data00 (expect <= 936) -if $data00 != 936 then - return -1 -endi -$remainRows = $data00 - -sql select * from tb order by ts desc -print select * from tb ==> $data00 $data01 $data10 $data11 $rows - -if $data11 != 1681 then - return -1 -endi -if $rows != $remainRows then - return -1 -endi - -print =================== step8 kill dnode1(SIGINT) and query -system sh/exec_up.sh -n dnode1 -s stop -x SIGINT -sleep 2000 - -print =================== step9 -sql select count(*) from tb order by ts desc -print select count(*) from tb ==> $data00 (expect == $remainRows ) -if $data00 > $remainRows then - return -1 -endi -if $data00 <= 0 then - return -1 -endi - -$remainRows = $data00 -sql select * from tb order by ts desc -print select * from tb ==> $data00 $data01 $rows - -if $rows != $remainRows then - return -1 -endi - -system sh/exec_up.sh -n dnode1 -s stop -x SIGINT -system sh/exec_up.sh -n dnode2 -s stop -x SIGINT -system sh/exec_up.sh -n dnode3 -s stop -x SIGINT -system sh/exec_up.sh -n dnode4 -s stop -x SIGINT -system sh/exec_up.sh -n dnode5 -s stop -x SIGINT -system sh/exec_up.sh -n dnode6 -s stop -x SIGINT -system sh/exec_up.sh -n dnode7 -s stop -x SIGINT -system sh/exec_up.sh -n dnode8 -s stop -x SIGINT diff --git a/tests/script/unique/vnode/many.sim b/tests/script/unique/vnode/many.sim index 0504207c2e..bb3e8813bd 100644 --- a/tests/script/unique/vnode/many.sim +++ b/tests/script/unique/vnode/many.sim @@ -53,27 +53,27 @@ sql select count(*) from db4.tb4 $lastRows4 = $rows print ======== step2 -run_back cluster/vnode/back_insert_many.sim +run_back unique/vnode/back_insert_many.sim sleep 5000 print ======== step3 system sh/exec_up.sh -n dnode2 -s stop -sleep 10000 +sleep 5000 $x = 0 loop: print ======== step4 system sh/exec_up.sh -n dnode2 -s start -sleep 10000 +sleep 5000 system sh/exec_up.sh -n dnode3 -s stop -sleep 10000 +sleep 5000 print ======== step5 system sh/exec_up.sh -n dnode3 -s start -sleep 10000 +sleep 5000 system sh/exec_up.sh -n dnode2 -s stop -sleep 10000 +sleep 5000 print ======== step6 sql select count(*) from db1.tb1 @@ -108,7 +108,7 @@ print ======== step7 print ======== loop Times $x -if $x < 5 then +if $x < 2 then $x = $x + 1 goto loop endi diff --git a/tests/script/unique/vnode/replica2_basic.sim b/tests/script/unique/vnode/replica2_basic.sim deleted file mode 100644 index a0ea7085cb..0000000000 --- a/tests/script/unique/vnode/replica2_basic.sim +++ /dev/null @@ -1,199 +0,0 @@ -system sh/stop_dnodes.sh - -system sh/deploy.sh -n dnode1 -i 1 -system sh/deploy.sh -n dnode2 -i 2 -system sh/cfg.sh -n dnode1 -c wallevel -v 2 -system sh/cfg.sh -n dnode2 -c wallevel -v 2 -system sh/cfg.sh -n dnode1 -c numofMpeers -v 3 -system sh/cfg.sh -n dnode2 -c numofMpeers -v 3 -system sh/exec_up.sh -n dnode1 -s start - -sql connect -sql create dnode $hostname2 -system sh/exec_up.sh -n dnode2 -s start -sleep 3000 - -$N = 10 -$db = d1 -$table = table_r2 - -print =================== step 1 -sql create database $db replica 3 -sql use $db -sql create table $table (ts timestamp, speed int) -x error_create -return -1 -error_create: -sql drop database $db - -print =================== step 2 - -sql create database $db replica 2 -sql use $db - -sql create table $table (ts timestamp, speed int) -sleep 1000 - -print =================== step 3 -$x = 1 -$y = $x + $N -$expect = $N -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 4 -system sh/exec_up.sh -n dnode2 -s stop -sleep 2000 -$y = $x + $N -$expect = $N * 2 -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 5 -system sh/exec_up.sh -n dnode2 -s start -sleep 2000 -$y = $x + $N -$expect = $N * 3 -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 6 -system sh/exec_up.sh -n dnode1 -s stop -sleep 2000 -$y = $x + $N -$expect = $N * 4 -while $x < $y -$ms = $x . m -sql insert into $table values (now + $ms , $x ) -$x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then -return -1 -endi - -print =================== step 7 -system sh/exec_up.sh -n dnode1 -s start -sleep 2000 -$y = $x + $N -$expect = $N * 5 -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 8 -system sh/ip.sh -i 1 -s down - -sleep 2000 -$y = $x + $N -$expect = $N * 6 -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 9 - -sleep 2000 -$y = $x + $N -$expect = $N * 7 -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 10 -system sh/ip.sh -i 2 -s down - -sleep 2000 -$y = $x + $N -$expect = $N * 8 -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 11 - -sleep 2000 -$y = $x + $N -$expect = $N * 9 -while $x < $y - $ms = $x . m - sql insert into $table values (now + $ms , $x ) - $x = $x + 1 -endw - -sql select * from $table -print sql select * from $table -> $rows points -if $rows != $expect then - return -1 -endi - -print =================== step 12 - -system sh/exec_up.sh -n dnode1 -s stop -x SIGINT -system sh/exec_up.sh -n dnode2 -s stop -x SIGINT -system sh/exec_up.sh -n dnode3 -s stop -x SIGINT -system sh/exec_up.sh -n dnode4 -s stop -x SIGINT -system sh/exec_up.sh -n dnode5 -s stop -x SIGINT -system sh/exec_up.sh -n dnode6 -s stop -x SIGINT -system sh/exec_up.sh -n dnode7 -s stop -x SIGINT -system sh/exec_up.sh -n dnode8 -s stop -x SIGINT \ No newline at end of file diff --git a/tests/script/unique/vnode/replica2_repeat.sim b/tests/script/unique/vnode/replica2_repeat.sim index f7da1babb7..a6bd226484 100644 --- a/tests/script/unique/vnode/replica2_repeat.sim +++ b/tests/script/unique/vnode/replica2_repeat.sim @@ -33,7 +33,7 @@ sql select count(*) from db.tb $lastRows = $rows print ======== step2 -run_back cluster/vnode/back_insert.sim +run_back unique/vnode/back_insert.sim sleep 3000 print ======== step3 @@ -66,7 +66,7 @@ print ======== step7 $lastRows = $data00 print ======== loop Times $x -if $x < 5 then +if $x < 2 then $x = $x + 1 goto loop endi diff --git a/tests/script/unique/vnode/replica3_repeat.sim b/tests/script/unique/vnode/replica3_repeat.sim index 8c3ed902fb..2f311a5d7a 100644 --- a/tests/script/unique/vnode/replica3_repeat.sim +++ b/tests/script/unique/vnode/replica3_repeat.sim @@ -36,7 +36,7 @@ sql select count(*) from db.tb $lastRows = $rows print ======== step2 -run_back cluster/vnode/back_insert.sim +run_back unique/vnode/back_insert.sim sleep 3000 print ======== step3 @@ -75,7 +75,7 @@ print ======== step8 $lastRows = $data00 print ======== loop Times $x -if $x < 5 then +if $x < 2 then $x = $x + 1 goto loop endi diff --git a/tests/script/unique/vnode/replica3_vgroup.sim b/tests/script/unique/vnode/replica3_vgroup.sim index f63bf1783d..6315a4335c 100644 --- a/tests/script/unique/vnode/replica3_vgroup.sim +++ b/tests/script/unique/vnode/replica3_vgroup.sim @@ -33,7 +33,7 @@ sleep 3001 $tbPre = m -$N = 280 +$N = 300 $x = 0 $y = $x + $N while $x < $y @@ -46,20 +46,20 @@ endw #print =================== step 2 -#$x = 1 -#$y = $x + $N -#$expect = $N -#while $x < $y -# $ms = $x . m -# sql insert into $table values (now + $ms , $x ) -# $x = $x + 1 -#endw +$x = -500 +$y = $x + $N +while $x < $y + $ms = $x . m + sql insert into $table values (now $ms , $x ) + $x = $x + 1 +endw -#sql select * from $table -#print sql select * from $table -> $rows points -#if $rows != $expect then -# return -1 -#endi +$expect = $N + 1 +sql select * from $table +print sql select * from $table -> $rows points expect $expect +if $rows != $expect then + return -1 +endi system sh/exec_up.sh -n dnode1 -s stop -x SIGINT system sh/exec_up.sh -n dnode2 -s stop -x SIGINT diff --git a/tests/script/unique/vnode/testSuite.sim b/tests/script/unique/vnode/testSuite.sim index 46b01aaa45..3a9db66beb 100644 --- a/tests/script/unique/vnode/testSuite.sim +++ b/tests/script/unique/vnode/testSuite.sim @@ -1,6 +1,4 @@ -run unique/vnode/commit.sim run unique/vnode/many.sim -run unique/vnode/replica2_basic.sim run unique/vnode/replica2_basic2.sim run unique/vnode/replica2_repeat.sim run unique/vnode/replica3_basic.sim From 35f5a2045d74f92ba1405efcba7dd50c4a307247 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 13:17:12 +0800 Subject: [PATCH 065/126] read boundary value from taosdef.h --- tests/pytest/dbmgmt/__init__.py | 0 .../pytest/dbmgmt/createTableAndDropDnodes.py | 151 +++++++++++++++ .../pytest/dbmgmt/createTableAndKillDnodes.py | 172 ++++++++++++++++++ tests/pytest/dbmgmt/database-name-boundary.py | 70 +++++++ tests/pytest/dbmgmt/dropDB_memory_test.py | 67 +++++++ tests/pytest/table/tablename-boundary.py | 6 +- tests/pytest/tag_lite/create-tags-boundary.py | 7 +- tests/pytest/test.py | 2 - 8 files changed, 470 insertions(+), 5 deletions(-) create mode 100644 tests/pytest/dbmgmt/__init__.py create mode 100644 tests/pytest/dbmgmt/createTableAndDropDnodes.py create mode 100644 tests/pytest/dbmgmt/createTableAndKillDnodes.py create mode 100644 tests/pytest/dbmgmt/database-name-boundary.py create mode 100644 tests/pytest/dbmgmt/dropDB_memory_test.py diff --git a/tests/pytest/dbmgmt/__init__.py b/tests/pytest/dbmgmt/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/tests/pytest/dbmgmt/createTableAndDropDnodes.py b/tests/pytest/dbmgmt/createTableAndDropDnodes.py new file mode 100644 index 0000000000..6e29c023ab --- /dev/null +++ b/tests/pytest/dbmgmt/createTableAndDropDnodes.py @@ -0,0 +1,151 @@ +# -*- coding: utf-8 -*- + +import sys +import taos +import threading +import traceback +import random +import datetime +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class TDTestCase: + + def init(self): + tdLog.debug("start to execute %s" % __file__) + tdLog.info("prepare cluster") + tdDnodes.stopAll() + tdDnodes.deploy(1) + tdDnodes.start(1) + + self.conn = taos.connect(config=tdDnodes.getSimCfgPath()) + tdSql.init(self.conn.cursor()) + tdSql.execute('reset query cache') + tdSql.execute('create dnode 192.168.0.2') + tdDnodes.deploy(2) + tdDnodes.start(2) + tdSql.execute('create dnode 192.168.0.3') + tdDnodes.deploy(3) + tdDnodes.start(3) + time.sleep(3) + + self.db = "db" + self.stb = "stb" + self.tbPrefix = "tb" + self.tbNum = 100000 + self.count = 0 + # self.conn = taos.connect(config=tdDnodes.getSimCfgPath()) + self.threadNum = 1 + # threadLock = threading.Lock() + # global counter for number of tables created by all threads + self.global_counter = 0 + + tdSql.init(self.conn.cursor()) + + def _createTable(self, threadId): + print("Thread%d : createTable" % (threadId)) + conn = taos.connect(config=tdDnodes.getSimCfgPath()) + cursor = conn.cursor() + i = 0 + try: + sql = "use %s" % (self.db) + cursor.execute(sql) + while i < self.tbNum: + if (i % self.threadNum == threadId): + cursor.execute( + "create table tb%d using %s tags(%d)" % + (i + 1, self.stb, i + 1)) + with threading.Lock(): + self.global_counter += 1 + i += 1 + except Exception as e: + tdLog.info( + "Failure when creating table tb%d, exception: %s" % + (i + 1, str(e))) + finally: + cursor.close() + conn.close() + + def _interfereDnodes(self, threadId, dnodeId): + conn = taos.connect(config=tdDnodes.getSimCfgPath()) + cursor = conn.cursor() + # interfere dnode while creating table + print("Thread%d to interfere dnode%d" % (threadId, dnodeId)) + while self.global_counter < self.tbNum * 0.05: + time.sleep(0.2) + cursor.execute("drop dnode 192.168.0.%d" % (dnodeId)) + while self.global_counter < self.tbNum * 0.15: + time.sleep(0.2) + cursor.execute("create dnode 192.168.0.%d" % (dnodeId)) + while self.global_counter < self.tbNum * 0.35: + time.sleep(0.2) + cursor.execute("drop dnode 192.168.0.%d" % (dnodeId)) + while self.global_counter < self.tbNum * 0.45: + time.sleep(0.2) + cursor.execute("create dnode 192.168.0.%d" % (dnodeId)) + while self.global_counter < self.tbNum * 0.65: + time.sleep(0.2) + cursor.execute("drop dnode 192.168.0.%d" % (dnodeId)) + while self.global_counter < self.tbNum * 0.85: + time.sleep(0.2) + cursor.execute("create dnode 192.168.0.%d" % (dnodeId)) + + def run(self): + tdLog.info("================= creating database with replica 2") + threadId = 0 + threads = [] + try: + tdSql.execute("drop database if exists %s" % (self.db)) + tdSql.execute( + "create database %s replica 2 cache 2048 ablocks 2.0 tblocks 10 tables 2000" % + (self.db)) + tdLog.sleep(3) + tdSql.execute("use %s" % (self.db)) + tdSql.execute( + "create table %s (ts timestamp, c1 bigint, stime timestamp) tags(tg1 bigint)" % + (self.stb)) + tdLog.info("Start to create tables") + while threadId < self.threadNum: + tdLog.info("Thread-%d starts to create tables" % (threadId)) + cThread = threading.Thread( + target=self._createTable, + name="thread-%d" % + (threadId), + args=( + threadId, + )) + cThread.start() + threads.append(cThread) + threadId += 1 + + except Exception as e: + tdLog.info("Failed to create tb%d, exception: %s" % (i, str(e))) + # tdDnodes.stopAll() + finally: + time.sleep(1) + + threading.Thread( + target=self._interfereDnodes, + name="thread-interfereDnode%d" % + (3), + args=( + 1, + 3, + )).start() + for t in range(len(threads)): + tdLog.info("Join threads") + # threads[t].start() + threads[t].join() + + tdSql.query("show stables") + tdSql.checkData(0, 4, self.tbNum) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addCluster(__file__, TDTestCase()) diff --git a/tests/pytest/dbmgmt/createTableAndKillDnodes.py b/tests/pytest/dbmgmt/createTableAndKillDnodes.py new file mode 100644 index 0000000000..7772ecdc68 --- /dev/null +++ b/tests/pytest/dbmgmt/createTableAndKillDnodes.py @@ -0,0 +1,172 @@ +# -*- coding: utf-8 -*- + +import sys +import taos +import threading +import traceback +import random +import datetime +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class TDTestCase: + + def init(self): + tdLog.debug("start to execute %s" % __file__) + tdLog.info("prepare cluster") + tdDnodes.stopAll() + tdDnodes.deploy(1) + tdDnodes.start(1) + + self.conn = taos.connect(config=tdDnodes.getSimCfgPath()) + tdSql.init(self.conn.cursor()) + tdSql.execute('reset query cache') + tdSql.execute('create dnode 192.168.0.2') + tdDnodes.deploy(2) + tdDnodes.start(2) + tdSql.execute('create dnode 192.168.0.3') + tdDnodes.deploy(3) + tdDnodes.start(3) + time.sleep(3) + + self.db = "db" + self.stb = "stb" + self.tbPrefix = "tb" + self.tbNum = 100000 + self.count = 0 + # self.conn = taos.connect(config=tdDnodes.getSimCfgPath()) + self.threadNum = 1 + # threadLock = threading.Lock() + # global counter for number of tables created by all threads + self.global_counter = 0 + + tdSql.init(self.conn.cursor()) + + def _createTable(self, threadId): + print("Thread%d : createTable" % (threadId)) + conn = taos.connect(config=tdDnodes.getSimCfgPath()) + cursor = conn.cursor() + i = 0 + try: + sql = "use %s" % (self.db) + cursor.execute(sql) + while i < self.tbNum: + if (i % self.threadNum == threadId): + cursor.execute( + "create table tb%d using %s tags(%d)" % + (i + 1, self.stb, i + 1)) + with threading.Lock(): + self.global_counter += 1 + time.sleep(0.01) + i += 1 + except Exception as e: + tdLog.info( + "Failure when creating table tb%d, exception: %s" % + (i + 1, str(e))) + finally: + cursor.close() + conn.close() + + def _interfereDnodes(self, threadId, dnodeId): + # interfere dnode while creating table + print("Thread%d to interfere dnode%d" % (threadId, dnodeId)) + percent = 0.05 + loop = int(1 / (2 * percent)) + for t in range(1, loop): + while self.global_counter < self.tbNum * (t * percent): + time.sleep(0.2) + tdDnodes.forcestop(dnodeId) + while self.global_counter < self.tbNum * ((t + 1) * percent): + time.sleep(0.2) + tdDnodes.start(dnodeId) + + # while self.global_counter < self.tbNum * 0.05: + # time.sleep(0.2) + # tdDnodes.forcestop(dnodeId) + # while self.global_counter < self.tbNum * 0.10: + # time.sleep(0.2) + # tdDnodes.start(dnodeId) + # while self.global_counter < self.tbNum * 0.15: + # time.sleep(0.2) + # tdDnodes.forcestop(dnodeId) + # while self.global_counter < self.tbNum * 0.20: + # time.sleep(0.2) + # tdDnodes.start(dnodeId) + # while self.global_counter < self.tbNum * 0.25: + # time.sleep(0.2) + # tdDnodes.forcestop(dnodeId) + # while self.global_counter < self.tbNum * 0.30: + # time.sleep(0.2) + # tdDnodes.start(dnodeId) + # while self.global_counter < self.tbNum * 0.35: + # time.sleep(0.2) + # tdDnodes.forcestop(dnodeId) + # while self.global_counter < self.tbNum * 0.40: + # time.sleep(0.2) + # tdDnodes.start(dnodeId) + # while self.global_counter < self.tbNum * 0.45: + # time.sleep(0.2) + # tdDnodes.forcestop(dnodeId) + # while self.global_counter < self.tbNum * 0.50: + # time.sleep(0.2) + # tdDnodes.start(dnodeId) + + def run(self): + tdLog.info("================= creating database with replica 2") + threadId = 0 + threads = [] + try: + tdSql.execute("drop database if exists %s" % (self.db)) + tdSql.execute( + "create database %s replica 2 cache 1024 ablocks 2.0 tblocks 4 tables 1000" % + (self.db)) + tdLog.sleep(3) + tdSql.execute("use %s" % (self.db)) + tdSql.execute( + "create table %s (ts timestamp, c1 bigint, stime timestamp) tags(tg1 bigint)" % + (self.stb)) + tdLog.info("Start to create tables") + while threadId < self.threadNum: + tdLog.info("Thread-%d starts to create tables" % (threadId)) + cThread = threading.Thread( + target=self._createTable, + name="thread-%d" % + (threadId), + args=( + threadId, + )) + cThread.start() + threads.append(cThread) + threadId += 1 + + except Exception as e: + tdLog.info("Failed to create tb%d, exception: %s" % (i, str(e))) + # tdDnodes.stopAll() + finally: + time.sleep(1) + + threading.Thread( + target=self._interfereDnodes, + name="thread-interfereDnode%d" % + (3), + args=( + 1, + 3, + )).start() + for t in range(len(threads)): + tdLog.info("Join threads") + # threads[t].start() + threads[t].join() + + tdSql.query("show stables") + tdSql.checkData(0, 4, self.tbNum) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addCluster(__file__, TDTestCase()) diff --git a/tests/pytest/dbmgmt/database-name-boundary.py b/tests/pytest/dbmgmt/database-name-boundary.py new file mode 100644 index 0000000000..6bb66be141 --- /dev/null +++ b/tests/pytest/dbmgmt/database-name-boundary.py @@ -0,0 +1,70 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import datetime +import string +import random +import subprocess + +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + + chars = string.ascii_uppercase+string.ascii_lowercase + + getDbNameLen = "grep -w '#define TSDB_DB_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" + dbNameMaxLen = int(subprocess.check_output(getDbNameLen, shell=True)) + tdLog.notice("DB name max length is %d" % dbNameMaxLen) + + tdLog.info("=============== step1") + db_name = ''.join(random.choices(chars, k=(dbNameMaxLen+1))) + tdLog.info('db_name length %d' % len(db_name)) + tdLog.info('create database %s' % db_name) + tdSql.error('create database %s' % db_name) + + tdLog.info("=============== step2") + db_name = ''.join(random.choices(chars, k=dbNameMaxLen)) + tdLog.info('db_name length %d' % len(db_name)) + tdLog.info('create database %s' % db_name) + tdSql.execute('create database %s' % db_name) + + tdSql.query('show databases') + tdSql.checkRows(1) + tdSql.checkData(0, 0, db_name.lower()) + + tdLog.info("=============== step3") + db_name = ''.join(random.choices(chars, k=(dbNameMaxLen-1))) + tdLog.info('db_name length %d' % len(db_name)) + tdLog.info('create database %s' % db_name) + tdSql.execute('create database %s' % db_name) + + tdSql.query('show databases') + tdSql.checkRows(2) + tdSql.checkData(0, 0, db_name.lower()) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/dbmgmt/dropDB_memory_test.py b/tests/pytest/dbmgmt/dropDB_memory_test.py new file mode 100644 index 0000000000..b029945be2 --- /dev/null +++ b/tests/pytest/dbmgmt/dropDB_memory_test.py @@ -0,0 +1,67 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import taos +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + tbNum = 10000 + insertRows = 1 + db = "db" + loop = 2 + tdSql.execute("drop database if exists %s" % (db)) + tdSql.execute("reset query cache") + tdLog.sleep(1) + for k in range(1, loop + 1): + tdLog.info("===========Loop%d starts============" % (k)) + tdSql.execute( + "create database %s cache 163840 ablocks 40 maxtables 5000 wal 0" % + (db)) + tdSql.execute("use %s" % (db)) + tdSql.execute( + "create table stb (ts timestamp, c1 int) tags(t1 bigint, t2 double)") + for j in range(1, tbNum): + tdSql.execute( + "create table tb%d using stb tags(%d, %d)" % + (j, j, j)) + + for j in range(1, tbNum): + for i in range(0, insertRows): + tdSql.execute( + "insert into tb%d values (now + %dm, %d)" % + (j, i, i)) + tdSql.query("select * from tb%d" % (j)) + tdSql.checkRows(insertRows) + tdLog.info("insert %d rows into tb%d" % (insertRows, j)) + # tdSql.sleep(3) + tdSql.execute("drop database %s" % (db)) + tdLog.sleep(2) + tdLog.info("===========Loop%d completed!=============" % (k)) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +#tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/table/tablename-boundary.py b/tests/pytest/table/tablename-boundary.py index 2a2ef997be..ee90b1ca92 100644 --- a/tests/pytest/table/tablename-boundary.py +++ b/tests/pytest/table/tablename-boundary.py @@ -3,6 +3,7 @@ import sys import string import random +import subprocess from util.log import * from util.cases import * from util.sql import * @@ -16,8 +17,11 @@ class TDTestCase: def run(self): tdSql.prepare() + getTableNameLen = "grep -w '#define TSDB_TABLE_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" + tableNameMaxLen = int(subprocess.check_output(getTableNameLen, shell=True)) + tdLog.notice("table name max length is %d" % tableNameMaxLen) chars = string.ascii_uppercase+string.ascii_lowercase - tb_name = ''.join(random.choices(chars, k=192)) + tb_name = ''.join(random.choices(chars, k=tableNameMaxLen)) tdLog.info('tb_name length %d' % len(tb_name)) tdLog.info('create table %s (ts timestamp, value int)' % tb_name) tdSql.error('create table %s (ts timestamp, speed binary(4089))' % tb_name) diff --git a/tests/pytest/tag_lite/create-tags-boundary.py b/tests/pytest/tag_lite/create-tags-boundary.py index de9711afae..b63b2168c5 100644 --- a/tests/pytest/tag_lite/create-tags-boundary.py +++ b/tests/pytest/tag_lite/create-tags-boundary.py @@ -12,6 +12,7 @@ # -*- coding: utf-8 -*- import sys +import subprocess from util.log import * from util.cases import * from util.sql import * @@ -25,7 +26,9 @@ class TDTestCase: def run(self): tdSql.prepare() - boundary = 32 + getMaxTagNum = "grep -w TSDB_MAX_TAGS ../../src/inc/taosdef.h|awk '{print $3}'" + boundary = int(subprocess.check_output(getMaxTagNum, shell=True)) + tdLog.notice("get max tags number is %d" % boundary) for x in range(0, boundary): stb_name = "stb%d" % x @@ -40,7 +43,7 @@ class TDTestCase: tdSql.checkRows(boundary) stb_name = "stb%d" % (boundary+1) - tagSeq = tagSeq + ", tag%d int" % (boundary+1) + tagSeq = tagSeq + ", tag%d int" % (boundary) tdLog.info("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) tdSql.error("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) tdSql.query("show stables") diff --git a/tests/pytest/test.py b/tests/pytest/test.py index a4129be34c..65685fecdc 100644 --- a/tests/pytest/test.py +++ b/tests/pytest/test.py @@ -70,8 +70,6 @@ if __name__ == "__main__": toBeKilled = "valgrind.bin" killCmd = "ps -ef|grep -w %s| grep -v grep | awk '{print $2}' | xargs kill -HUP " % toBeKilled -# os.system(killCmd) -# time.sleep(1) psCmd = "ps -ef|grep -w %s| grep -v grep | awk '{print $2}'" % toBeKilled processID = subprocess.check_output(psCmd, shell=True) From 2f7644b4656aac552620c9400679136ca5af97ac Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 13:27:31 +0800 Subject: [PATCH 066/126] fix autopep8 format. --- tests/pytest/dbmgmt/database-name-boundary.py | 6 +- tests/pytest/insert/binary-boundary.py | 94 +++++++++- tests/pytest/insert/nchar-boundary.py | 16 +- tests/pytest/insert/nchar-unicode.py | 167 +++++++++++++----- tests/pytest/query/query.py | 2 +- tests/pytest/stable/insert.py | 2 +- tests/pytest/table/tablename-boundary.py | 14 +- tests/pytest/tag_lite/create-tags-boundary.py | 20 ++- tests/pytest/util/dnodes.py | 7 +- 9 files changed, 260 insertions(+), 68 deletions(-) diff --git a/tests/pytest/dbmgmt/database-name-boundary.py b/tests/pytest/dbmgmt/database-name-boundary.py index 6bb66be141..b57740ebaa 100644 --- a/tests/pytest/dbmgmt/database-name-boundary.py +++ b/tests/pytest/dbmgmt/database-name-boundary.py @@ -29,14 +29,14 @@ class TDTestCase: def run(self): - chars = string.ascii_uppercase+string.ascii_lowercase + chars = string.ascii_uppercase + string.ascii_lowercase getDbNameLen = "grep -w '#define TSDB_DB_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" dbNameMaxLen = int(subprocess.check_output(getDbNameLen, shell=True)) tdLog.notice("DB name max length is %d" % dbNameMaxLen) tdLog.info("=============== step1") - db_name = ''.join(random.choices(chars, k=(dbNameMaxLen+1))) + db_name = ''.join(random.choices(chars, k=(dbNameMaxLen + 1))) tdLog.info('db_name length %d' % len(db_name)) tdLog.info('create database %s' % db_name) tdSql.error('create database %s' % db_name) @@ -52,7 +52,7 @@ class TDTestCase: tdSql.checkData(0, 0, db_name.lower()) tdLog.info("=============== step3") - db_name = ''.join(random.choices(chars, k=(dbNameMaxLen-1))) + db_name = ''.join(random.choices(chars, k=(dbNameMaxLen - 1))) tdLog.info('db_name length %d' % len(db_name)) tdLog.info('create database %s' % db_name) tdSql.execute('create database %s' % db_name) diff --git a/tests/pytest/insert/binary-boundary.py b/tests/pytest/insert/binary-boundary.py index 9211c4ae89..583217a732 100644 --- a/tests/pytest/insert/binary-boundary.py +++ b/tests/pytest/insert/binary-boundary.py @@ -25,7 +25,21 @@ class TDTestCase: tdSql.error("insert into tb values (now, )") with open("../../README.md", "r") as inputFile: - data = inputFile.read(4084).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + data = inputFile.read(4084).replace( + "\n", + " ").replace( + "\\", + " ").replace( + "\'", + " ").replace( + "\"", + " ").replace( + "[", + " ").replace( + "]", + " ").replace( + "!", + " ") tdLog.info("insert %d length data: %s" % (len(data), data)) @@ -39,17 +53,79 @@ class TDTestCase: tdLog.info("tdSql.checkData(0, 1, '%s')" % data) tdSql.checkData(0, 1, data) - tdLog.info('create table tb2 (ts timestamp, speed binary(2040), temp binary(2044))') - tdSql.execute('create table tb2 (ts timestamp, speed binary(2040), temp binary(2044))') - speed = inputFile.read(2044).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") - temp = inputFile.read(2040).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + tdLog.info( + 'create table tb2 (ts timestamp, speed binary(2040), temp binary(2044))') + tdSql.execute( + 'create table tb2 (ts timestamp, speed binary(2040), temp binary(2044))') + speed = inputFile.read(2044).replace( + "\n", + " ").replace( + "\\", + " ").replace( + "\'", + " ").replace( + "\"", + " ").replace( + "[", + " ").replace( + "]", + " ").replace( + "!", + " ") + temp = inputFile.read(2040).replace( + "\n", + " ").replace( + "\\", + " ").replace( + "\'", + " ").replace( + "\"", + " ").replace( + "[", + " ").replace( + "]", + " ").replace( + "!", + " ") tdLog.info("insert into tb values (now+3a, speed, temp)") - tdSql.error("insert into tb values (now+3a, '%s', '%s')" % (speed, temp)) + tdSql.error( + "insert into tb values (now+3a, '%s', '%s')" % + (speed, temp)) - speed = inputFile.read(2040).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") - temp = inputFile.read(2044).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + speed = inputFile.read(2040).replace( + "\n", + " ").replace( + "\\", + " ").replace( + "\'", + " ").replace( + "\"", + " ").replace( + "[", + " ").replace( + "]", + " ").replace( + "!", + " ") + temp = inputFile.read(2044).replace( + "\n", + " ").replace( + "\\", + " ").replace( + "\'", + " ").replace( + "\"", + " ").replace( + "[", + " ").replace( + "]", + " ").replace( + "!", + " ") tdLog.info("insert into tb values (now+4a, speed, temp)") - tdSql.error("insert into tb values (now+4a, '%s', '%s')" % (speed, temp)) + tdSql.error( + "insert into tb values (now+4a, '%s', '%s')" % + (speed, temp)) tdLog.info('tdSql.checkRow(2)') tdSql.checkRows(2) diff --git a/tests/pytest/insert/nchar-boundary.py b/tests/pytest/insert/nchar-boundary.py index 33f7a5a30b..255cc5b79a 100644 --- a/tests/pytest/insert/nchar-boundary.py +++ b/tests/pytest/insert/nchar-boundary.py @@ -33,7 +33,21 @@ class TDTestCase: tdSql.checkData(0, 1, 'taosdata') with open("../../README.md", "r") as inputFile: - data = inputFile.read(1021).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + data = inputFile.read(1021).replace( + "\n", + " ").replace( + "\\", + " ").replace( + "\'", + " ").replace( + "\"", + " ").replace( + "[", + " ").replace( + "]", + " ").replace( + "!", + " ") tdLog.info("insert %d length data: %s" % (len(data), data)) diff --git a/tests/pytest/insert/nchar-unicode.py b/tests/pytest/insert/nchar-unicode.py index 8ddfd4e53a..12eef379d3 100644 --- a/tests/pytest/insert/nchar-unicode.py +++ b/tests/pytest/insert/nchar-unicode.py @@ -33,7 +33,21 @@ class TDTestCase: tdSql.checkData(0, 1, 'taosdata') with open("../../README.md", "r") as inputFile: - data = inputFile.read(1021).replace("\n", " ").replace("\\", " ").replace("\'", " ").replace("\"", " ").replace("[", " ").replace("]", " ").replace("!", " ") + data = inputFile.read(1021).replace( + "\n", + " ").replace( + "\\", + " ").replace( + "\'", + " ").replace( + "\"", + " ").replace( + "[", + " ").replace( + "]", + " ").replace( + "!", + " ") tdLog.info("insert %d length data: %s" % (len(data), data)) @@ -44,7 +58,7 @@ class TDTestCase: # https://www.ltg.ed.ac.uk/~richard/unicode-sample.html # Basic Latin - data = '! # $ % & ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ? @ A B C D E F G H I J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _ ` a b c d e f g h i j k l m n o p q r s t u v w x y z { | } ~' + data = r'! # $ % & ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ? @ A B C D E F G H I J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _ ` a b c d e f g h i j k l m n o p q r s t u v w x y z { | } ~' tdLog.info("insert Basic Latin %d length data: %s" % (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") @@ -53,7 +67,9 @@ class TDTestCase: # Latin-1 Supplement data = ' ¡ ¢ £ ¤ ¥ ¦ § ¨ © ª « ¬ ­ ® ¯ ° ± ² ³ ´ µ ¶ · ¸ ¹ º » ¼ ½ ¾ ¿ À Á Â Ã Ä Å Æ Ç È É Ê Ë Ì Í Î Ï Ð Ñ Ò Ó Ô Õ Ö × Ø Ù Ú Û Ü Ý Þ ß à á â ã ä å æ ç è é ê ë ì í î ï ð ñ ò ó ô õ ö ÷ ø ù ú û ü ý þ ÿ' - tdLog.info("insert Latin-1 Supplement %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Latin-1 Supplement %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(4) @@ -61,7 +77,9 @@ class TDTestCase: # Latin Extended-A data = 'Ā ā Ă ă Ą ą Ć ć Ĉ ĉ Ċ ċ Č č Ď ď Đ đ Ē ē Ĕ ĕ Ė ė Ę ę Ě ě Ĝ ĝ Ğ ğ Ġ ġ Ģ ģ Ĥ ĥ Ħ ħ Ĩ ĩ Ī ī Ĭ ĭ Į į İ ı IJ ij Ĵ ĵ Ķ ķ ĸ Ĺ ĺ Ļ ļ Ľ ľ Ŀ ŀ Ł ł Ń ń Ņ ņ Ň ň ʼn Ŋ ŋ Ō ō Ŏ ŏ Ő ő Œ œ Ŕ ŕ Ŗ ŗ Ř ř Ś ś Ŝ ŝ Ş ş Š š Ţ ţ Ť ť Ŧ ŧ Ũ ũ Ū ū Ŭ ŭ Ů ů Ű ű Ų ų Ŵ ŵ Ŷ ŷ Ÿ Ź ź Ż ż Ž ž ſ' - tdLog.info("insert Latin Extended-A %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Latin Extended-A %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(5) @@ -69,7 +87,9 @@ class TDTestCase: # Latin Extended-B data = 'ƀ Ɓ Ƃ ƃ Ƅ ƅ Ɔ Ƈ ƈ Ɖ Ɗ Ƌ ƌ ƍ Ǝ Ə Ɛ Ƒ ƒ Ɠ Ɣ ƕ Ɩ Ɨ Ƙ ƙ ƚ ƛ Ɯ Ɲ ƞ Ɵ Ơ ơ Ƣ ƣ Ƥ ƥ Ʀ Ƨ ƨ Ʃ ƪ ƫ Ƭ ƭ Ʈ Ư ư Ʊ Ʋ Ƴ ƴ Ƶ ƶ Ʒ Ƹ ƹ ƺ ƻ Ƽ ƽ ƾ ƿ ǀ ǁ ǂ ǃ DŽ Dž dž LJ Lj lj NJ Nj nj Ǎ ǎ Ǐ ǐ Ǒ ǒ Ǔ ǔ Ǖ ǖ Ǘ ǘ Ǚ ǚ Ǜ ǜ ǝ Ǟ ǟ Ǡ ǡ Ǣ ǣ Ǥ ǥ Ǧ ǧ Ǩ ǩ Ǫ ǫ Ǭ ǭ Ǯ ǯ ǰ DZ Dz dz Ǵ ǵ Ǻ ǻ Ǽ ǽ Ǿ ǿ Ȁ ȁ Ȃ ȃ ...' - tdLog.info("insert Latin Extended-B %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Latin Extended-B %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(6) @@ -77,7 +97,9 @@ class TDTestCase: # IPA Extensions data = 'ɐ ɑ ɒ ɓ ɔ ɕ ɖ ɗ ɘ ə ɚ ɛ ɜ ɝ ɞ ɟ ɠ ɡ ɢ ɣ ɤ ɥ ɦ ɧ ɨ ɩ ɪ ɫ ɬ ɭ ɮ ɯ ɰ ɱ ɲ ɳ ɴ ɵ ɶ ɷ ɸ ɹ ɺ ɻ ɼ ɽ ɾ ɿ ʀ ʁ ʂ ʃ ʄ ʅ ʆ ʇ ʈ ʉ ʊ ʋ ʌ ʍ ʎ ʏ ʐ ʑ ʒ ʓ ʔ ʕ ʖ ʗ ʘ ʙ ʚ ʛ ʜ ʝ ʞ ʟ ʠ ʡ ʢ ʣ ʤ ʥ ʦ ʧ ʨ' - tdLog.info("insert IPA Extensions %d length data: %s" % (len(data), data)) + tdLog.info( + "insert IPA Extensions %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(7) @@ -85,7 +107,9 @@ class TDTestCase: # Spacing Modifier Letters data = 'ʰ ʱ ʲ ʳ ʴ ʵ ʶ ʷ ʸ ʹ ʺ ʻ ʼ ʽ ʾ ʿ ˀ ˁ ˂ ˃ ˄ ˅ ˆ ˇ ˈ ˉ ˊ ˋ ˌ ˍ ˎ ˏ ː ˑ ˒ ˓ ˔ ˕ ˖ ˗ ˘ ˙ ˚ ˛ ˜ ˝ ˞ ˠ ˡ ˢ ˣ ˤ ˥ ˦ ˧ ˨ ˩' - tdLog.info("insert Spacing Modifier Letters %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Spacing Modifier Letters %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(8) @@ -93,7 +117,9 @@ class TDTestCase: # Combining Diacritical Marks data = '̀ ́ ̂ ̃ ̄ ̅ ̆ ̇ ̈ ̉ ̊ ̋ ̌ ̍ ̎ ̏ ̐ ̑ ̒ ̓ ̔ ̕ ̖ ̗ ̘ ̙ ̚ ̛ ̜ ̝ ̞ ̟ ̠ ̡ ̢ ̣ ̤ ̥ ̦ ̧ ̨ ̩ ̪ ̫ ̬ ̭ ̮ ̯ ̰ ̱ ̲ ̳ ̴ ̵ ̶ ̷ ̸ ̹ ̺ ̻ ̼ ̽ ̾ ̿ ̀ ́ ͂ ̓ ̈́ ͅ ͠ ͡' - tdLog.info("insert Combining Diacritical Marks %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Combining Diacritical Marks %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(9) @@ -133,7 +159,9 @@ class TDTestCase: # Arabic data = '، ؛ ؟ ء آ أ ؤ إ ئ ا ب ة ت ث ج ح خ د ذ ر ز س ش ص ض ط ظ ع غ ـ ف ق ك ل م ن ه و ى ي ً ٌ ٍ َ ُ ِ ّ ْ ٠ ١ ٢ ٣ ٤ ٥ ٦ ٧ ٨ ٩ ٪ ٫ ٬ ٭ ٰ ٱ ٲ ٳ ٴ ٵ ٶ ٷ ٸ ٹ ٺ ٻ ټ ٽ پ ٿ ڀ ځ ڂ ڃ ڄ څ چ ڇ ڈ ډ ڊ ڋ ڌ ڍ ڎ ڏ ڐ ڑ ڒ ړ ڔ ڕ ږ ڗ ژ ڙ ښ ڛ ڜ ڝ ڞ ڟ ڠ ڡ ڢ ڣ ڤ ڥ ڦ ڧ ڨ ک ڪ ګ ڬ ڭ ڮ گ ڰ ڱ ...' - tdLog.info("FAILED: insert Arabic %d length data: %s" % (len(data), data)) + tdLog.info( + "FAILED: insert Arabic %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(14) @@ -261,7 +289,9 @@ class TDTestCase: # Latin Extended Additional data = 'Ḁ ḁ Ḃ ḃ Ḅ ḅ Ḇ ḇ Ḉ ḉ Ḋ ḋ Ḍ ḍ Ḏ ḏ Ḑ ḑ Ḓ ḓ Ḕ ḕ Ḗ ḗ Ḙ ḙ Ḛ ḛ Ḝ ḝ Ḟ ḟ Ḡ ḡ Ḣ ḣ Ḥ ḥ Ḧ ḧ Ḩ ḩ Ḫ ḫ Ḭ ḭ Ḯ ḯ Ḱ ḱ Ḳ ḳ Ḵ ḵ Ḷ ḷ Ḹ ḹ Ḻ ḻ Ḽ ḽ Ḿ ḿ Ṁ ṁ Ṃ ṃ Ṅ ṅ Ṇ ṇ Ṉ ṉ Ṋ ṋ Ṍ ṍ Ṏ ṏ Ṑ ṑ Ṓ ṓ Ṕ ṕ Ṗ ṗ Ṙ ṙ Ṛ ṛ Ṝ ṝ Ṟ ṟ Ṡ ṡ Ṣ ṣ Ṥ ṥ Ṧ ṧ Ṩ ṩ Ṫ ṫ Ṭ ṭ Ṯ ṯ Ṱ ṱ Ṳ ṳ Ṵ ṵ Ṷ ṷ Ṹ ṹ Ṻ ṻ Ṽ ṽ Ṿ ṿ ...' - tdLog.info("insert Latin Extended Additional %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Latin Extended Additional %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(30) @@ -269,7 +299,9 @@ class TDTestCase: # Geek Extended data = 'ἀ ἁ ἂ ἃ ἄ ἅ ἆ ἇ Ἀ Ἁ Ἂ Ἃ Ἄ Ἅ Ἆ Ἇ ἐ ἑ ἒ ἓ ἔ ἕ Ἐ Ἑ Ἒ Ἓ Ἔ Ἕ ἠ ἡ ἢ ἣ ἤ ἥ ἦ ἧ Ἠ Ἡ Ἢ Ἣ Ἤ Ἥ Ἦ Ἧ ἰ ἱ ἲ ἳ ἴ ἵ ἶ ἷ Ἰ Ἱ Ἲ Ἳ Ἴ Ἵ Ἶ Ἷ ὀ ὁ ὂ ὃ ὄ ὅ Ὀ Ὁ Ὂ Ὃ Ὄ Ὅ ὐ ὑ ὒ ὓ ὔ ὕ ὖ ὗ Ὑ Ὓ Ὕ Ὗ ὠ ὡ ὢ ὣ ὤ ὥ ὦ ὧ Ὠ Ὡ Ὢ Ὣ Ὤ Ὥ Ὦ Ὧ ὰ ά ὲ έ ὴ ή ὶ ί ὸ ό ὺ ύ ὼ ώ ᾀ ᾁ ᾂ ᾃ ᾄ ᾅ ᾆ ᾇ ᾈ ᾉ ᾊ ᾋ ᾌ ᾍ ...' - tdLog.info("insert Geek Extended %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Geek Extended %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(31) @@ -277,7 +309,9 @@ class TDTestCase: # General Punctuation data = '                      ‐ ‑ ‒ – — ― ‖ ‗ ‘ ’ ‚ ‛ “ ” „ ‟ † ‡ • ‣ ․ ‥ … ‧ 
 
 ' - tdLog.info("insert General Punctuation %d length data: %s" % (len(data), data)) + tdLog.info( + "insert General Punctuation %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(32) @@ -285,7 +319,9 @@ class TDTestCase: # Superscripts and Subscripts data = '⁰ ⁴ ⁵ ⁶ ⁷ ⁸ ⁹ ⁺ ⁻ ⁼ ⁽ ⁾ ⁿ ₀ ₁ ₂ ₃ ₄ ₅ ₆ ₇ ₈ ₉ ₊ ₋ ₌ ₍ ₎' - tdLog.info("insert Superscripts and Subscripts %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Superscripts and Subscripts %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(33) @@ -293,7 +329,9 @@ class TDTestCase: # Currency Symbols data = '₠ ₡ ₢ ₣ ₤ ₥ ₦ ₧ ₨ ₩ ₪ ₫' - tdLog.info("insert Currency Symbols %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Currency Symbols %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(34) @@ -301,7 +339,9 @@ class TDTestCase: # Combining Marks for Symbols data = '⃐ ⃑ ⃒ ⃓ ⃔ ⃕ ⃖ ⃗ ⃘ ⃙ ⃚ ⃛ ⃜ ⃝ ⃞ ⃟ ⃠ ⃡' - tdLog.info("insert Combining Marks for Symbols %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Combining Marks for Symbols %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(35) @@ -309,7 +349,9 @@ class TDTestCase: # Letterlike Symbols data = '℀ ℁ ℂ ℃ ℄ ℅ ℆ ℇ ℈ ℉ ℊ ℋ ℌ ℍ ℎ ℏ ℐ ℑ ℒ ℓ ℔ ℕ № ℗ ℘ ℙ ℚ ℛ ℜ ℝ ℞ ℟ ℠ ℡ ™ ℣ ℤ ℥ Ω ℧ ℨ ℩ K Å ℬ ℭ ℮ ℯ ℰ ℱ Ⅎ ℳ ℴ ℵ ℶ ℷ ℸ' - tdLog.info("insert Letterlike Symbols %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Letterlike Symbols %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(36) @@ -317,7 +359,9 @@ class TDTestCase: # Number Forms data = '⅓ ⅔ ⅕ ⅖ ⅗ ⅘ ⅙ ⅚ ⅛ ⅜ ⅝ ⅞ ⅟ Ⅰ Ⅱ Ⅲ Ⅳ Ⅴ Ⅵ Ⅶ Ⅷ Ⅸ Ⅹ Ⅺ Ⅻ Ⅼ Ⅽ Ⅾ Ⅿ ⅰ ⅱ ⅲ ⅳ ⅴ ⅵ ⅶ ⅷ ⅸ ⅹ ⅺ ⅻ ⅼ ⅽ ⅾ ⅿ ↀ ↁ ↂ' - tdLog.info("insert Number Forms %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Number Forms %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(37) @@ -333,7 +377,9 @@ class TDTestCase: # Mathematical Operators data = '∀ ∁ ∂ ∃ ∄ ∅ ∆ ∇ ∈ ∉ ∊ ∋ ∌ ∍ ∎ ∏ ∐ ∑ − ∓ ∔ ∕ ∖ ∗ ∘ ∙ √ ∛ ∜ ∝ ∞ ∟ ∠ ∡ ∢ ∣ ∤ ∥ ∦ ∧ ∨ ∩ ∪ ∫ ∬ ∭ ∮ ∯ ∰ ∱ ∲ ∳ ∴ ∵ ∶ ∷ ∸ ∹ ∺ ∻ ∼ ∽ ∾ ∿ ≀ ≁ ≂ ≃ ≄ ≅ ≆ ≇ ≈ ≉ ≊ ≋ ≌ ≍ ≎ ≏ ≐ ≑ ≒ ≓ ≔ ≕ ≖ ≗ ≘ ≙ ≚ ≛ ≜ ≝ ≞ ≟ ≠ ≡ ≢ ≣ ≤ ≥ ≦ ≧ ≨ ≩ ≪ ≫ ≬ ≭ ≮ ≯ ≰ ≱ ≲ ≳ ≴ ≵ ≶ ≷ ≸ ≹ ≺ ≻ ≼ ≽ ≾ ≿ ...' - tdLog.info("insert Mathematical Operators %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Mathematical Operators %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(39) @@ -341,7 +387,9 @@ class TDTestCase: # Miscellaneous Technical data = '⌀ ⌂ ⌃ ⌄ ⌅ ⌆ ⌇ ⌈ ⌉ ⌊ ⌋ ⌌ ⌍ ⌎ ⌏ ⌐ ⌑ ⌒ ⌓ ⌔ ⌕ ⌖ ⌗ ⌘ ⌙ ⌚ ⌛ ⌜ ⌝ ⌞ ⌟ ⌠ ⌡ ⌢ ⌣ ⌤ ⌥ ⌦ ⌧ ⌨ 〈 〉 ⌫ ⌬ ⌭ ⌮ ⌯ ⌰ ⌱ ⌲ ⌳ ⌴ ⌵ ⌶ ⌷ ⌸ ⌹ ⌺ ⌻ ⌼ ⌽ ⌾ ⌿ ⍀ ⍁ ⍂ ⍃ ⍄ ⍅ ⍆ ⍇ ⍈ ⍉ ⍊ ⍋ ⍌ ⍍ ⍎ ⍏ ⍐ ⍑ ⍒ ⍓ ⍔ ⍕ ⍖ ⍗ ⍘ ⍙ ⍚ ⍛ ⍜ ⍝ ⍞ ⍟ ⍠ ⍡ ⍢ ⍣ ⍤ ⍥ ⍦ ⍧ ⍨ ⍩ ⍪ ⍫ ⍬ ⍭ ⍮ ⍯ ⍰ ⍱ ⍲ ⍳ ⍴ ⍵ ⍶ ⍷ ⍸ ⍹ ⍺' - tdLog.info("insert Miscellaneous Technical %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Miscellaneous Technical %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(40) @@ -349,7 +397,9 @@ class TDTestCase: # Control Pictures data = '␀ ␁ ␂ ␃ ␄ ␅ ␆ ␇ ␈ ␉ ␊ ␋ ␌ ␍ ␎ ␏ ␐ ␑ ␒ ␓ ␔ ␕ ␖ ␗ ␘ ␙ ␚ ␛ ␜ ␝ ␞ ␟ ␠ ␡ ␢ ␣ ␤' - tdLog.info("insert Control Pictures %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Control Pictures %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(41) @@ -357,7 +407,9 @@ class TDTestCase: # Optical Character Recognition data = '⑀ ⑁ ⑂ ⑃ ⑄ ⑅ ⑆ ⑇ ⑈ ⑉ ⑊' - tdLog.info("insert Optical Character Recognition %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Optical Character Recognition %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(42) @@ -365,7 +417,9 @@ class TDTestCase: # Enclosed Alphanumerics data = '① ② ③ ④ ⑤ ⑥ ⑦ ⑧ ⑨ ⑩ ⑪ ⑫ ⑬ ⑭ ⑮ ⑯ ⑰ ⑱ ⑲ ⑳ ⑴ ⑵ ⑶ ⑷ ⑸ ⑹ ⑺ ⑻ ⑼ ⑽ ⑾ ⑿ ⒀ ⒁ ⒂ ⒃ ⒄ ⒅ ⒆ ⒇ ⒈ ⒉ ⒊ ⒋ ⒌ ⒍ ⒎ ⒏ ⒐ ⒑ ⒒ ⒓ ⒔ ⒕ ⒖ ⒗ ⒘ ⒙ ⒚ ⒛ ⒜ ⒝ ⒞ ⒟ ⒠ ⒡ ⒢ ⒣ ⒤ ⒥ ⒦ ⒧ ⒨ ⒩ ⒪ ⒫ ⒬ ⒭ ⒮ ⒯ ⒰ ⒱ ⒲ ⒳ ⒴ ⒵ Ⓐ Ⓑ Ⓒ Ⓓ Ⓔ Ⓕ Ⓖ Ⓗ Ⓘ Ⓙ Ⓚ Ⓛ Ⓜ Ⓝ Ⓞ Ⓟ Ⓠ Ⓡ Ⓢ Ⓣ Ⓤ Ⓥ Ⓦ Ⓧ Ⓨ Ⓩ ⓐ ⓑ ⓒ ⓓ ⓔ ⓕ ⓖ ⓗ ⓘ ⓙ ⓚ ⓛ ⓜ ⓝ ⓞ ⓟ ...' - tdLog.info("insert Enclosed Alphanumerics %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Enclosed Alphanumerics %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(43) @@ -381,7 +435,9 @@ class TDTestCase: # Block Elements data = '▀ ▁ ▂ ▃ ▄ ▅ ▆ ▇ █ ▉ ▊ ▋ ▌ ▍ ▎ ▏ ▐ ░ ▒ ▓ ▔ ▕' - tdLog.info("insert Block Elements %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Block Elements %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(45) @@ -389,7 +445,9 @@ class TDTestCase: # Geometric Shapes data = '■ □ ▢ ▣ ▤ ▥ ▦ ▧ ▨ ▩ ▪ ▫ ▬ ▭ ▮ ▯ ▰ ▱ ▲ △ ▴ ▵ ▶ ▷ ▸ ▹ ► ▻ ▼ ▽ ▾ ▿ ◀ ◁ ◂ ◃ ◄ ◅ ◆ ◇ ◈ ◉ ◊ ○ ◌ ◍ ◎ ● ◐ ◑ ◒ ◓ ◔ ◕ ◖ ◗ ◘ ◙ ◚ ◛ ◜ ◝ ◞ ◟ ◠ ◡ ◢ ◣ ◤ ◥ ◦ ◧ ◨ ◩ ◪ ◫ ◬ ◭ ◮ ◯' - tdLog.info("insert Geometric Shapes %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Geometric Shapes %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(46) @@ -397,7 +455,9 @@ class TDTestCase: # Miscellaneous Symbols data = '☀ ☁ ☂ ☃ ☄ ★ ☆ ☇ ☈ ☉ ☊ ☋ ☌ ☍ ☎ ☏ ☐ ☑ ☒ ☓ ☚ ☛ ☜ ☝ ☞ ☟ ☠ ☡ ☢ ☣ ☤ ☥ ☦ ☧ ☨ ☩ ☪ ☫ ☬ ☭ ☮ ☯ ☰ ☱ ☲ ☳ ☴ ☵ ☶ ☷ ☸ ☹ ☺ ☻ ☼ ☽ ☾ ☿ ♀ ♁ ♂ ♃ ♄ ♅ ♆ ♇ ♈ ♉ ♊ ♋ ♌ ♍ ♎ ♏ ♐ ♑ ♒ ♓ ♔ ♕ ♖ ♗ ♘ ♙ ♚ ♛ ♜ ♝ ♞ ♟ ♠ ♡ ♢ ♣ ♤ ♥ ♦ ♧ ♨ ♩ ♪ ♫ ♬ ♭ ♮ ♯' - tdLog.info("insert Miscellaneous Symbols %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Miscellaneous Symbols %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(47) @@ -413,7 +473,9 @@ class TDTestCase: # CJK Symbols and Punctuation data = '、 。 〃 〄 々 〆 〇 〈 〉 《 》 「 」 『 』 【 】 〒 〓 〔 〕 〖 〗 〘 〙 〚 〛 〜 〝 〞 〟 〠 〡 〢 〣 〤 〥 〦 〧 〨 〩 〪 〫 〬 〭 〮 〯 〰 〱 〲 〳 〴 〵 〶 〷 〿' - tdLog.info("insert CJK Symbols and Punctuation %d length data: %s" % (len(data), data)) + tdLog.info( + "insert CJK Symbols and Punctuation %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(49) @@ -445,7 +507,9 @@ class TDTestCase: # Hangul Compatibility Jamo data = 'ㄱ ㄲ ㄳ ㄴ ㄵ ㄶ ㄷ ㄸ ㄹ ㄺ ㄻ ㄼ ㄽ ㄾ ㄿ ㅀ ㅁ ㅂ ㅃ ㅄ ㅅ ㅆ ㅇ ㅈ ㅉ ㅊ ㅋ ㅌ ㅍ ㅎ ㅏ ㅐ ㅑ ㅒ ㅓ ㅔ ㅕ ㅖ ㅗ ㅘ ㅙ ㅚ ㅛ ㅜ ㅝ ㅞ ㅟ ㅠ ㅡ ㅢ ㅣ ㅤ ㅥ ㅦ ㅧ ㅨ ㅩ ㅪ ㅫ ㅬ ㅭ ㅮ ㅯ ㅰ ㅱ ㅲ ㅳ ㅴ ㅵ ㅶ ㅷ ㅸ ㅹ ㅺ ㅻ ㅼ ㅽ ㅾ ㅿ ㆀ ㆁ ㆂ ㆃ ㆄ ㆅ ㆆ ㆇ ㆈ ㆉ ㆊ ㆋ ㆌ ㆍ ㆎ' - tdLog.info("insert Hangul Compatibility Jamo %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Hangul Compatibility Jamo %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(53) @@ -461,7 +525,9 @@ class TDTestCase: # Enclosed CJK Letters and Months data = '㈀ ㈁ ㈂ ㈃ ㈄ ㈅ ㈆ ㈇ ㈈ ㈉ ㈊ ㈋ ㈌ ㈍ ㈎ ㈏ ㈐ ㈑ ㈒ ㈓ ㈔ ㈕ ㈖ ㈗ ㈘ ㈙ ㈚ ㈛ ㈜ ㈠ ㈡ ㈢ ㈣ ㈤ ㈥ ㈦ ㈧ ㈨ ㈩ ㈪ ㈫ ㈬ ㈭ ㈮ ㈯ ㈰ ㈱ ㈲ ㈳ ㈴ ㈵ ㈶ ㈷ ㈸ ㈹ ㈺ ㈻ ㈼ ㈽ ㈾ ㈿ ㉀ ㉁ ㉂ ㉃ ㉠ ㉡ ㉢ ㉣ ㉤ ㉥ ㉦ ㉧ ㉨ ㉩ ㉪ ㉫ ㉬ ㉭ ㉮ ㉯ ㉰ ㉱ ㉲ ㉳ ㉴ ㉵ ㉶ ㉷ ㉸ ㉹ ㉺ ㉻ ㉿ ㊀ ㊁ ㊂ ㊃ ㊄ ㊅ ㊆ ㊇ ㊈ ㊉ ㊊ ㊋ ㊌ ㊍ ㊎ ㊏ ㊐ ㊑ ㊒ ㊓ ㊔ ㊕ ㊖ ㊗ ㊘ ㊙ ㊚ ㊛ ㊜ ㊝ ㊞ ㊟ ㊠ ㊡ ...' - tdLog.info("insert Enclosed CJK Letters and Months %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Enclosed CJK Letters and Months %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(55) @@ -469,7 +535,9 @@ class TDTestCase: # CJK Compatibility data = '㌀ ㌁ ㌂ ㌃ ㌄ ㌅ ㌆ ㌇ ㌈ ㌉ ㌊ ㌋ ㌌ ㌍ ㌎ ㌏ ㌐ ㌑ ㌒ ㌓ ㌔ ㌕ ㌖ ㌗ ㌘ ㌙ ㌚ ㌛ ㌜ ㌝ ㌞ ㌟ ㌠ ㌡ ㌢ ㌣ ㌤ ㌥ ㌦ ㌧ ㌨ ㌩ ㌪ ㌫ ㌬ ㌭ ㌮ ㌯ ㌰ ㌱ ㌲ ㌳ ㌴ ㌵ ㌶ ㌷ ㌸ ㌹ ㌺ ㌻ ㌼ ㌽ ㌾ ㌿ ㍀ ㍁ ㍂ ㍃ ㍄ ㍅ ㍆ ㍇ ㍈ ㍉ ㍊ ㍋ ㍌ ㍍ ㍎ ㍏ ㍐ ㍑ ㍒ ㍓ ㍔ ㍕ ㍖ ㍗ ㍘ ㍙ ㍚ ㍛ ㍜ ㍝ ㍞ ㍟ ㍠ ㍡ ㍢ ㍣ ㍤ ㍥ ㍦ ㍧ ㍨ ㍩ ㍪ ㍫ ㍬ ㍭ ㍮ ㍯ ㍰ ㍱ ㍲ ㍳ ㍴ ㍵ ㍶ ㍻ ㍼ ㍽ ㍾ ㍿ ㎀ ㎁ ㎂ ㎃ ...' - tdLog.info("insert CJK Compatibility %d length data: %s" % (len(data), data)) + tdLog.info( + "insert CJK Compatibility %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(56) @@ -477,7 +545,9 @@ class TDTestCase: # CJK Unified Ideographs data = '一 丁 丂 七 丄 丅 丆 万 丈 三 上 下 丌 不 与 丏 丐 丑 丒 专 且 丕 世 丗 丘 丙 业 丛 东 丝 丞 丟 丠 両 丢 丣 两 严 並 丧 丨 丩 个 丫 丬 中 丮 丯 丰 丱 串 丳 临 丵 丶 丷 丸 丹 为 主 丼 丽 举 丿 乀 乁 乂 乃 乄 久 乆 乇 么 义 乊 之 乌 乍 乎 乏 乐 乑 乒 乓 乔 乕 乖 乗 乘 乙 乚 乛 乜 九 乞 也 习 乡 乢 乣 乤 乥 书 乧 乨 乩 乪 乫 乬 乭 乮 乯 买 乱 乲 乳 乴 乵 乶 乷 乸 乹 乺 乻 乼 乽 乾 乿 ...' - tdLog.info("insert CJK Unified Ideographs %d length data: %s" % (len(data), data)) + tdLog.info( + "insert CJK Unified Ideographs %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(57) @@ -485,7 +555,9 @@ class TDTestCase: # Hangul Syllables data = '一 丁 丂 七 丄 丅 丆 万 丈 三 上 下 丌 不 与 丏 丐 丑 丒 专 且 丕 世 丗 丘 丙 业 丛 东 丝 丞 丟 丠 両 丢 丣 两 严 並 丧 丨 丩 个 丫 丬 中 丮 丯 丰 丱 串 丳 临 丵 丶 丷 丸 丹 为 主 丼 丽 举 丿 乀 乁 乂 乃 乄 久 乆 乇 么 义 乊 之 乌 乍 乎 乏 乐 乑 乒 乓 乔 乕 乖 乗 乘 乙 乚 乛 乜 九 乞 也 习 乡 乢 乣 乤 乥 书 乧 乨 乩 乪 乫 乬 乭 乮 乯 买 乱 乲 乳 乴 乵 乶 乷 乸 乹 乺 乻 乼 乽 乾 乿 ...' - tdLog.info("insert Hangul Syllables %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Hangul Syllables %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(58) @@ -501,7 +573,9 @@ class TDTestCase: # CJK Compatibility Ideographs data = '豈 更 車 賈 滑 串 句 龜 龜 契 金 喇 奈 懶 癩 羅 蘿 螺 裸 邏 樂 洛 烙 珞 落 酪 駱 亂 卵 欄 爛 蘭 鸞 嵐 濫 藍 襤 拉 臘 蠟 廊 朗 浪 狼 郎 來 冷 勞 擄 櫓 爐 盧 老 蘆 虜 路 露 魯 鷺 碌 祿 綠 菉 錄 鹿 論 壟 弄 籠 聾 牢 磊 賂 雷 壘 屢 樓 淚 漏 累 縷 陋 勒 肋 凜 凌 稜 綾 菱 陵 讀 拏 樂 諾 丹 寧 怒 率 異 北 磻 便 復 不 泌 數 索 參 塞 省 葉 說 殺 辰 沈 拾 若 掠 略 亮 兩 凉 梁 糧 良 諒 量 勵 ...' - tdLog.info("insert CJK Compatibility Ideographs %d length data: %s" % (len(data), data)) + tdLog.info( + "insert CJK Compatibility Ideographs %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(60) @@ -509,7 +583,9 @@ class TDTestCase: # Alphabetic Presentation Forms data = 'ff fi fl ffi ffl ſt st ﬓ ﬔ ﬕ ﬖ ﬗ ﬞ ײַ ﬠ ﬡ ﬢ ﬣ ﬤ ﬥ ﬦ ﬧ ﬨ ﬩ שׁ שׂ שּׁ שּׂ אַ אָ אּ בּ גּ דּ הּ וּ זּ טּ יּ ךּ כּ לּ מּ נּ סּ ףּ פּ צּ קּ רּ שּ תּ וֹ בֿ כֿ פֿ ﭏ' - tdLog.info("insert Alphabetic Presentation Forms %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Alphabetic Presentation Forms %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(61) @@ -517,7 +593,9 @@ class TDTestCase: # Arabic Presentation Forms-A data = 'ﭐ ﭑ ﭒ ﭓ ﭔ ﭕ ﭖ ﭗ ﭘ ﭙ ﭚ ﭛ ﭜ ﭝ ﭞ ﭟ ﭠ ﭡ ﭢ ﭣ ﭤ ﭥ ﭦ ﭧ ﭨ ﭩ ﭪ ﭫ ﭬ ﭭ ﭮ ﭯ ﭰ ﭱ ﭲ ﭳ ﭴ ﭵ ﭶ ﭷ ﭸ ﭹ ﭺ ﭻ ﭼ ﭽ ﭾ ﭿ ﮀ ﮁ ﮂ ﮃ ﮄ ﮅ ﮆ ﮇ ﮈ ﮉ ﮊ ﮋ ﮌ ﮍ ﮎ ﮏ ﮐ ﮑ ﮒ ﮓ ﮔ ﮕ ﮖ ﮗ ﮘ ﮙ ﮚ ﮛ ﮜ ﮝ ﮞ ﮟ ﮠ ﮡ ﮢ ﮣ ﮤ ﮥ ﮦ ﮧ ﮨ ﮩ ﮪ ﮫ ﮬ ﮭ ﮮ ﮯ ﮰ ﮱ ﯓ ﯔ ﯕ ﯖ ﯗ ﯘ ﯙ ﯚ ﯛ ﯜ ﯝ ﯞ ﯟ ﯠ ﯡ ﯢ ﯣ ﯤ ﯥ ﯦ ﯧ ﯨ ﯩ ﯪ ﯫ ﯬ ﯭ ﯮ ﯯ ﯰ ...' - tdLog.info("insert Arabic Presentation Forms-A %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Arabic Presentation Forms-A %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(62) @@ -525,7 +603,9 @@ class TDTestCase: # Combining Half Marks data = '︠ ︡ ︢ ︣' - tdLog.info("insert Combining Half Marks %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Combining Half Marks %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(63) @@ -533,7 +613,9 @@ class TDTestCase: # CJK Compatibility Forms data = '︰ ︱ ︲ ︳ ︴ ︵ ︶ ︷ ︸ ︹ ︺ ︻ ︼ ︽ ︾ ︿ ﹀ ﹁ ﹂ ﹃ ﹄ ﹉ ﹊ ﹋ ﹌ ﹍ ﹎ ﹏' - tdLog.info("insert CJK Compatibility Forms %d length data: %s" % (len(data), data)) + tdLog.info( + "insert CJK Compatibility Forms %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(64) @@ -541,7 +623,9 @@ class TDTestCase: # Small Form Variants data = '﹐ ﹑ ﹒ ﹔ ﹕ ﹖ ﹗ ﹘ ﹙ ﹚ ﹛ ﹜ ﹝ ﹞ ﹟ ﹠ ﹡ ﹢ ﹣ ﹤ ﹥ ﹦ ﹨ ﹩ ﹪ ﹫' - tdLog.info("insert Small Form Variants %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Small Form Variants %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(65) @@ -549,7 +633,9 @@ class TDTestCase: # Arabic Presentation Forms-B data = 'ﹰ ﹱ ﹲ ﹴ ﹶ ﹷ ﹸ ﹹ ﹺ ﹻ ﹼ ﹽ ﹾ ﹿ ﺀ ﺁ ﺂ ﺃ ﺄ ﺅ ﺆ ﺇ ﺈ ﺉ ﺊ ﺋ ﺌ ﺍ ﺎ ﺏ ﺐ ﺑ ﺒ ﺓ ﺔ ﺕ ﺖ ﺗ ﺘ ﺙ ﺚ ﺛ ﺜ ﺝ ﺞ ﺟ ﺠ ﺡ ﺢ ﺣ ﺤ ﺥ ﺦ ﺧ ﺨ ﺩ ﺪ ﺫ ﺬ ﺭ ﺮ ﺯ ﺰ ﺱ ﺲ ﺳ ﺴ ﺵ ﺶ ﺷ ﺸ ﺹ ﺺ ﺻ ﺼ ﺽ ﺾ ﺿ ﻀ ﻁ ﻂ ﻃ ﻄ ﻅ ﻆ ﻇ ﻈ ﻉ ﻊ ﻋ ﻌ ﻍ ﻎ ﻏ ﻐ ﻑ ﻒ ﻓ ﻔ ﻕ ﻖ ﻗ ﻘ ﻙ ﻚ ﻛ ﻜ ﻝ ﻞ ﻟ ﻠ ﻡ ﻢ ﻣ ﻤ ﻥ ﻦ ﻧ ﻨ ﻩ ﻪ ﻫ ﻬ ﻭ ﻮ ﻯ ﻰ ﻱ ...' - tdLog.info("insert Arabic Presentation Forms-B %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Arabic Presentation Forms-B %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(66) @@ -557,13 +643,14 @@ class TDTestCase: # Halfwidth and Fullwidth Forms data = '! " # $ % & ' ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ? @ A B C D E F G H I J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _ ` a b c d e f g h i j k l m n o p q r s t u v w x y z { | } ~ 。 「 」 、 ・ ヲ ァ ィ ゥ ェ ォ ャ ュ ョ ッ ー ア イ ウ エ オ カ キ ク ケ コ サ シ ス セ ソ タ チ ツ ...' - tdLog.info("insert Halfwidth and Fullwidth Forms %d length data: %s" % (len(data), data)) + tdLog.info( + "insert Halfwidth and Fullwidth Forms %d length data: %s" % + (len(data), data)) tdSql.execute("insert into tb values (now, '%s')" % data) tdSql.query("select * from tb") tdSql.checkRows(67) tdSql.checkData(66, 1, data) - def stop(self): tdSql.close() tdLog.success("%s successfully executed" % __file__) diff --git a/tests/pytest/query/query.py b/tests/pytest/query/query.py index a906943247..68b8baab64 100644 --- a/tests/pytest/query/query.py +++ b/tests/pytest/query/query.py @@ -37,7 +37,7 @@ class TDTestCase: print("==============step2") tdSql.execute( - """INSERT INTO dev_001(ts, tagtype) VALUES('2020-05-13 10:00:00.000', 1), + """INSERT INTO dev_001(ts, tagtype) VALUES('2020-05-13 10:00:00.000', 1), ('2020-05-13 10:00:00.001', 1) dev_002 VALUES('2020-05-13 10:00:00.001', 1)""") diff --git a/tests/pytest/stable/insert.py b/tests/pytest/stable/insert.py index 4f41d4aa93..9f9e7c6e06 100644 --- a/tests/pytest/stable/insert.py +++ b/tests/pytest/stable/insert.py @@ -37,7 +37,7 @@ class TDTestCase: print("==============step2") tdSql.execute( - """INSERT INTO dev_001(ts, tagtype) VALUES('2020-05-13 10:00:00.000', 1), + """INSERT INTO dev_001(ts, tagtype) VALUES('2020-05-13 10:00:00.000', 1), ('2020-05-13 10:00:00.001', 1) dev_002 VALUES('2020-05-13 10:00:00.001', 1)""") diff --git a/tests/pytest/table/tablename-boundary.py b/tests/pytest/table/tablename-boundary.py index ee90b1ca92..fba1b2cf3c 100644 --- a/tests/pytest/table/tablename-boundary.py +++ b/tests/pytest/table/tablename-boundary.py @@ -18,18 +18,24 @@ class TDTestCase: tdSql.prepare() getTableNameLen = "grep -w '#define TSDB_TABLE_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" - tableNameMaxLen = int(subprocess.check_output(getTableNameLen, shell=True)) + tableNameMaxLen = int( + subprocess.check_output( + getTableNameLen, shell=True)) tdLog.notice("table name max length is %d" % tableNameMaxLen) - chars = string.ascii_uppercase+string.ascii_lowercase + chars = string.ascii_uppercase + string.ascii_lowercase tb_name = ''.join(random.choices(chars, k=tableNameMaxLen)) tdLog.info('tb_name length %d' % len(tb_name)) tdLog.info('create table %s (ts timestamp, value int)' % tb_name) - tdSql.error('create table %s (ts timestamp, speed binary(4089))' % tb_name) + tdSql.error( + 'create table %s (ts timestamp, speed binary(4089))' % + tb_name) tb_name = ''.join(random.choices(chars, k=191)) tdLog.info('tb_name length %d' % len(tb_name)) tdLog.info('create table %s (ts timestamp, value int)' % tb_name) - tdSql.execute('create table %s (ts timestamp, speed binary(4089))' % tb_name) + tdSql.execute( + 'create table %s (ts timestamp, speed binary(4089))' % + tb_name) def stop(self): tdSql.close() diff --git a/tests/pytest/tag_lite/create-tags-boundary.py b/tests/pytest/tag_lite/create-tags-boundary.py index b63b2168c5..12058b2b21 100644 --- a/tests/pytest/tag_lite/create-tags-boundary.py +++ b/tests/pytest/tag_lite/create-tags-boundary.py @@ -33,19 +33,27 @@ class TDTestCase: stb_name = "stb%d" % x tagSeq = "tag0 int" - for y in range(1, x+1): + for y in range(1, x + 1): tagSeq = tagSeq + ", tag%d int" % y - tdLog.info("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) - tdSql.execute("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) + tdLog.info( + "create table %s (ts timestamp, value int) tags (%s)" % + (stb_name, tagSeq)) + tdSql.execute( + "create table %s (ts timestamp, value int) tags (%s)" % + (stb_name, tagSeq)) tdSql.query("show stables") tdSql.checkRows(boundary) - stb_name = "stb%d" % (boundary+1) + stb_name = "stb%d" % (boundary + 1) tagSeq = tagSeq + ", tag%d int" % (boundary) - tdLog.info("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) - tdSql.error("create table %s (ts timestamp, value int) tags (%s)" % (stb_name, tagSeq)) + tdLog.info( + "create table %s (ts timestamp, value int) tags (%s)" % + (stb_name, tagSeq)) + tdSql.error( + "create table %s (ts timestamp, value int) tags (%s)" % + (stb_name, tagSeq)) tdSql.query("show stables") tdSql.checkRows(boundary) diff --git a/tests/pytest/util/dnodes.py b/tests/pytest/util/dnodes.py index b641927c9f..63cdccecbc 100644 --- a/tests/pytest/util/dnodes.py +++ b/tests/pytest/util/dnodes.py @@ -103,7 +103,8 @@ class TDDnode: self.logDir = "%s/pysim/dnode%d/log" % (self.path, self.index) self.dataDir = "%s/pysim/dnode%d/data" % (self.path, self.index) self.cfgDir = "%s/pysim/dnode%d/cfg" % (self.path, self.index) - self.cfgPath = "%s/pysim/dnode%d/cfg/taos.cfg" % (self.path, self.index) + self.cfgPath = "%s/pysim/dnode%d/cfg/taos.cfg" % ( + self.path, self.index) cmd = "rm -rf " + self.dataDir if os.system(cmd) != 0: @@ -188,7 +189,7 @@ class TDDnode: rootRealPath = os.path.dirname(os.path.realpath(root)) if ("community" not in rootRealPath): binPath = os.path.join(root, "taosd") - break; + break else: projPath = selfPath + "/../../../" for root, dirs, files in os.walk(projPath): @@ -196,7 +197,7 @@ class TDDnode: rootRealPath = os.path.dirname(os.path.realpath(root)) if ("packaging" not in rootRealPath): binPath = os.path.join(root, "taosd") - break; + break if (binPath == ""): tdLog.exit("taosd not found!s") From 9df5abb0e2a2afc3b45281ff9d4abf8ac0a779df Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Fri, 15 May 2020 05:28:57 +0000 Subject: [PATCH 067/126] change meta file name --- src/tsdb/inc/tsdbMain.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/tsdb/inc/tsdbMain.h b/src/tsdb/inc/tsdbMain.h index 6b7a77c798..8a73400d24 100644 --- a/src/tsdb/inc/tsdbMain.h +++ b/src/tsdb/inc/tsdbMain.h @@ -45,7 +45,7 @@ extern int tsdbDebugFlag; { taosPrintLog("TSDB ", 255, __VA_ARGS__); } // ------------------------------ TSDB META FILE INTERFACES ------------------------------ -#define TSDB_META_FILE_NAME "META" +#define TSDB_META_FILE_NAME "meta" #define TSDB_META_HASH_FRACTION 1.1 typedef int (*iterFunc)(void *, void *cont, int contLen); From 56bf37bea86e0e965482433c013be49e8925ce4d Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 14:05:03 +0800 Subject: [PATCH 068/126] add new cases to fulltest.sh --- tests/pytest/fulltest.sh | 9 ++++++++- 1 file changed, 8 insertions(+), 1 deletion(-) diff --git a/tests/pytest/fulltest.sh b/tests/pytest/fulltest.sh index e37dc6748a..ec772fd4d1 100755 --- a/tests/pytest/fulltest.sh +++ b/tests/pytest/fulltest.sh @@ -10,10 +10,17 @@ python3 ./test.py $1 -f insert/tinyint.py python3 ./test.py $1 -f insert/date.py python3 ./test.py $1 -f insert/binary.py python3 ./test.py $1 -f insert/nchar.py +python3 ./test.py $1 -f insert/nchar-boundary.py +python3 ./test.py $1 -f insert/nchar-unicode.py python3 ./test.py $1 -f table/column_name.py python3 ./test.py $1 -f table/column_num.py python3 ./test.py $1 -f table/db_table.py +python3 ./test.py $1 -f table/tablename-boundary.py + +python3 ./test.py $1 -f tag_lite/create-tags-boundary.py + +python3 ./test.py $1 -f dbmgmt/database-name-boundary.py python3 ./test.py $1 -f import_merge/importBlock1HO.py python3 ./test.py $1 -f import_merge/importBlock1HPO.py @@ -87,4 +94,4 @@ python3 ./test.py $1 -f user/user_create.py python3 ./test.py $1 -f user/pass_len.py # table -#python3 ./test.py $1 -f table/del_stable.py \ No newline at end of file +#python3 ./test.py $1 -f table/del_stable.py From 617eb33ebe6a357464a8aed1873df8611687d0ba Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Fri, 15 May 2020 14:13:02 +0800 Subject: [PATCH 069/126] scripts --- tests/script/jenkins/basic.txt | 44 ++++++++++++------------ tests/script/unique/db/replica_add13.sim | 4 +++ tests/script/unique/dnode/balance1.sim | 22 ++++++------ tests/script/unique/dnode/balance2.sim | 18 +++++----- tests/script/unique/dnode/balance3.sim | 8 ++--- tests/script/unique/dnode/balancex.sim | 8 ++--- tests/script/unique/dnode/offline1.sim | 2 +- tests/script/unique/dnode/offline2.sim | 7 ++-- tests/script/unique/stable/dnode3.sim | 6 ++-- 9 files changed, 63 insertions(+), 56 deletions(-) diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index c59ea987de..f253de09c4 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -150,7 +150,7 @@ cd ../../../debug; make #./test.sh -f general/parser/bug.sim ./test.sh -f general/stable/disk.sim -#./test.sh -f general/stable/dnode3.sim +#liao ./test.sh -f general/stable/dnode3.sim ./test.sh -f general/stable/metrics.sim ./test.sh -f general/stable/values.sim ./test.sh -f general/stable/vnode3.sim @@ -252,23 +252,23 @@ cd ../../../debug; make ./test.sh -u -f unique/column/replica3.sim -#hongze crash ./test.sh -u -f unique/db/commit.sim +#liao wait ./test.sh -u -f unique/db/commit.sim ./test.sh -u -f unique/db/delete.sim ./test.sh -u -f unique/db/delete_part.sim ./test.sh -u -f unique/db/replica_add12.sim -#hongze crash ./test.sh -u -f unique/db/replica_add13.sim -#hongze crash ./test.sh -u -f unique/db/replica_add23.sim -#hongze crash ./test.sh -u -f unique/db/replica_reduce21.sim +#hongze ./test.sh -u -f unique/db/replica_add13.sim +#hongze wait ./test.sh -u -f unique/db/replica_add23.sim +#hongze wait ./test.sh -u -f unique/db/replica_reduce21.sim ./test.sh -u -f unique/db/replica_reduce32.sim -#hongze crash /test.sh -u -f unique/db/replica_reduce31.sim +#hongze wait /test.sh -u -f unique/db/replica_reduce31.sim ./test.sh -u -f unique/db/replica_part.sim -##./test.sh -u -f unique/dnode/balance1.sim -##./test.sh -u -f unique/dnode/balance2.sim -##./test.sh -u -f unique/dnode/balance3.sim -##./test.sh -u -f unique/dnode/balancex.sim -##./test.sh -u -f unique/dnode/offline1.sim -##./test.sh -u -f unique/dnode/offline2.sim +./test.sh -u -f unique/dnode/balance1.sim +./test.sh -u -f unique/dnode/balance2.sim +./test.sh -u -f unique/dnode/balance3.sim +./test.sh -u -f unique/dnode/balancex.sim +./test.sh -u -f unique/dnode/offline1.sim +#hongze wait ./test.sh -u -f unique/dnode/offline2.sim ./test.sh -u -f unique/dnode/remove1.sim #hongze ./test.sh -u -f unique/dnode/remove2.sim ./test.sh -u -f unique/dnode/vnode_clean.sim @@ -276,17 +276,17 @@ cd ../../../debug; make ./test.sh -u -f unique/http/admin.sim ./test.sh -u -f unique/http/opentsdb.sim -#./test.sh -u -f unique/import/replica2.sim -#./test.sh -u -f unique/import/replica3.sim +#liao wait ./test.sh -u -f unique/import/replica2.sim +#liao wait ./test.sh -u -f unique/import/replica3.sim -#./test.sh -u -f unique/stable/balance_replica1.sim -#./test.sh -u -f unique/stable/dnode2_stop.sim -#./test.sh -u -f unique/stable/dnode2.sim -#./test.sh -u -f unique/stable/dnode3.sim -#./test.sh -u -f unique/stable/replica2_dnode4.sim -#./test.sh -u -f unique/stable/replica2_vnode3.sim -#./test.sh -u -f unique/stable/replica3_dnode6.sim -#./test.sh -u -f unique/stable/replica3_vnode3.sim +#liao wait ./test.sh -u -f unique/stable/balance_replica1.sim +#liao wait ./test.sh -u -f unique/stable/dnode2_stop.sim +#liao wait ./test.sh -u -f unique/stable/dnode2.sim +#liao wait ./test.sh -u -f unique/stable/dnode3.sim +#liao wait ./test.sh -u -f unique/stable/replica2_dnode4.sim +#liao wait ./test.sh -u -f unique/stable/replica2_vnode3.sim +#liao wait ./test.sh -u -f unique/stable/replica3_dnode6.sim +#liao wait ./test.sh -u -f unique/stable/replica3_vnode3.sim ./test.sh -u -f unique/mnode/mgmt22.sim ./test.sh -u -f unique/mnode/mgmt23.sim diff --git a/tests/script/unique/db/replica_add13.sim b/tests/script/unique/db/replica_add13.sim index ac7e3f5c5c..d0533207e7 100644 --- a/tests/script/unique/db/replica_add13.sim +++ b/tests/script/unique/db/replica_add13.sim @@ -179,21 +179,25 @@ sql insert into d3.t3 values(now, 4) sql insert into d4.t4 values(now, 4) sql select * from d1.t1 +print select * from d1.t1 $rows if $rows != 4 then return -1 endi sql select * from d2.t2 +print select * from d2.t2 $rows if $rows != 4 then return -1 endi sql select * from d3.t3 +print select * from d3.t3 $rows if $rows != 4 then return -1 endi sql select * from d4.t4 +print select * from d4.t4 $rows if $rows != 4 then return -1 endi diff --git a/tests/script/unique/dnode/balance1.sim b/tests/script/unique/dnode/balance1.sim index 34d3310394..9a598e1704 100644 --- a/tests/script/unique/dnode/balance1.sim +++ b/tests/script/unique/dnode/balance1.sim @@ -53,7 +53,7 @@ $x = 0 show2: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -93,7 +93,7 @@ $x = 0 show4: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -103,7 +103,7 @@ print dnode2 openVnodes $data2_2 if $data2_1 != 2 then goto show4 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show4 endi if $rows != 1 then @@ -131,7 +131,7 @@ print dnode3 openVnodes $data2_3 if $data2_1 != 0 then goto show5 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show5 endi if $data2_3 != 2 then @@ -155,7 +155,7 @@ print dnode3 openVnodes $data2_3 if $data2_1 != 0 then return -1 endi -if $data2_2 != NULL then +if $data2_2 != null then return -1 endi if $data2_3 != 3 then @@ -170,7 +170,7 @@ $x = 0 show7: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -182,7 +182,7 @@ print dnode4 openVnodes $data2_4 if $data2_1 != 0 then goto show7 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show7 endi if $data2_3 != 2 then @@ -210,7 +210,7 @@ print dnode4 openVnodes $data2_4 if $data2_1 != 0 then return -1 endi -if $data2_2 != NULL then +if $data2_2 != null then return -1 endi if $data2_3 != 2 then @@ -227,7 +227,7 @@ $x = 0 show9: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -240,10 +240,10 @@ print dnode4 openVnodes $data2_4 if $data2_1 != 0 then goto show9 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show9 endi -if $data2_3 != NULL then +if $data2_3 != null then goto show9 endi if $data2_4 != 4 then diff --git a/tests/script/unique/dnode/balance2.sim b/tests/script/unique/dnode/balance2.sim index 9786a854a5..f039579012 100644 --- a/tests/script/unique/dnode/balance2.sim +++ b/tests/script/unique/dnode/balance2.sim @@ -65,7 +65,7 @@ $x = 0 show2: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -76,7 +76,7 @@ print dnode3 openVnodes $data2_3 if $data2_1 != 2 then goto show2 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show2 endi if $data2_3 != 2 then @@ -105,7 +105,7 @@ print dnode4 openVnodes $data2_4 if $data2_1 != 0 then goto show3 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show3 endi if $data2_3 != 2 then @@ -132,7 +132,7 @@ print dnode4 openVnodes $data2_4 if $data2_1 != 0 then return -1 endi -if $data2_2 != NULL then +if $data2_2 != null then return -1 endi if $data2_3 != 3 then @@ -150,7 +150,7 @@ $x = 0 show5: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -163,7 +163,7 @@ print dnode5 openVnodes $data2_5 if $data2_1 != 0 then goto show5 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show5 endi if $data2_3 != 2 then @@ -183,7 +183,7 @@ $x = 0 show6: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -196,10 +196,10 @@ print dnode5 openVnodes $data2_5 if $data2_1 != 0 then goto show6 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show6 endi -if $data2_3 != NULL then +if $data2_3 != null then goto show6 endi if $data2_4 != 3 then diff --git a/tests/script/unique/dnode/balance3.sim b/tests/script/unique/dnode/balance3.sim index 6d5bbc77a5..acb0d033d4 100644 --- a/tests/script/unique/dnode/balance3.sim +++ b/tests/script/unique/dnode/balance3.sim @@ -88,7 +88,7 @@ print dnode4 openVnodes $data2_4 if $data2_1 != 2 then goto show2 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show2 endi if $data2_3 != 2 then @@ -122,7 +122,7 @@ print dnode5 openVnodes $data2_5 if $data2_1 != 0 then goto show3 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show3 endi if $data2_3 != 2 then @@ -162,7 +162,7 @@ print dnode5 openVnodes $data2_5 if $data2_1 != 0 then goto show4 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show4 endi if $data2_3 != 3 then @@ -228,7 +228,7 @@ endi if $data2_6 != 3 then goto show6 endi -if $data2_3 != NULL then +if $data2_3 != null then goto show6 endi if $data2_4 != 3 then diff --git a/tests/script/unique/dnode/balancex.sim b/tests/script/unique/dnode/balancex.sim index 4b46db4b49..202c9b5396 100644 --- a/tests/script/unique/dnode/balancex.sim +++ b/tests/script/unique/dnode/balancex.sim @@ -50,7 +50,7 @@ $x = 0 show2: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi @@ -77,7 +77,7 @@ $x = 0 show3: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes @@ -122,7 +122,7 @@ $x = 0 show5: $x = $x + 1 sleep 2000 - if $x == 30 then + if $x == 10 then return -1 endi sql show dnodes @@ -132,7 +132,7 @@ print dnode3 openVnodes $data2_3 if $data2_1 != 1 then goto show5 endi -if $data2_2 != NULL then +if $data2_2 != null then goto show5 endi if $data2_3 != 3 then diff --git a/tests/script/unique/dnode/offline1.sim b/tests/script/unique/dnode/offline1.sim index 4d67b5f55c..5e4ab65be3 100644 --- a/tests/script/unique/dnode/offline1.sim +++ b/tests/script/unique/dnode/offline1.sim @@ -63,7 +63,7 @@ print dnode1 $data4_2 if $data4_1 != ready then return -1 endi -if $data4_2 != NULL then +if $data4_2 != null then return -1 endi diff --git a/tests/script/unique/dnode/offline2.sim b/tests/script/unique/dnode/offline2.sim index 6aa85465dd..c526e45b6e 100644 --- a/tests/script/unique/dnode/offline2.sim +++ b/tests/script/unique/dnode/offline2.sim @@ -82,15 +82,18 @@ $x = 0 show4: $x = $x + 1 sleep 5000 - if $x == 50 then + if $x == 10 then return -1 endi sql show dnodes +print dnode1 $data4_1 +print dnode2 $data4_2 +print dnode3 $data4_3 if $data4_1 != ready then goto show4 endi -if $data4_2 != NULL then +if $data4_2 != null then goto show4 endi if $data4_3 != ready then diff --git a/tests/script/unique/stable/dnode3.sim b/tests/script/unique/stable/dnode3.sim index 384129a94c..c9dd31f6f8 100644 --- a/tests/script/unique/stable/dnode3.sim +++ b/tests/script/unique/stable/dnode3.sim @@ -77,11 +77,11 @@ if $rows != 3 then endi sql show dnodes -$dnode1Vnodes = $data3_192.168.0.1 +$dnode1Vnodes = $data2_1 print dnode1 $dnode1Vnodes -$dnode2Vnodes = $data3_192.168.0.2 +$dnode2Vnodes = $data2_2 print dnode2 $dnode2Vnodes -$dnode3Vnodes = $data3_192.168.0.3 +$dnode3Vnodes = $data2_3 print dnode3 $dnode3Vnodes if $dnode1Vnodes != 3 then From 89e3ce2d196b8979903daa6d44775eb5dad7b6bc Mon Sep 17 00:00:00 2001 From: Bomin Zhang Date: Thu, 14 May 2020 18:17:41 +0800 Subject: [PATCH 070/126] TD-325: skiplist support duplicated key --- src/util/inc/tskiplist.h | 11 +- src/util/src/tskiplist.c | 244 +++++++++++++++++++++------------------ 2 files changed, 139 insertions(+), 116 deletions(-) diff --git a/src/util/inc/tskiplist.h b/src/util/inc/tskiplist.h index 759ecbb7ed..686e5ab313 100644 --- a/src/util/inc/tskiplist.h +++ b/src/util/inc/tskiplist.h @@ -174,7 +174,7 @@ void tSkipListNewNodeInfo(SSkipList *pSkipList, int32_t *level, int32_t *headSiz SSkipListNode *tSkipListPut(SSkipList *pSkipList, SSkipListNode *pNode); /** - * get only *one* node of which key is equalled to pKey, even there are more than one nodes are of the same key + * get *all* nodes which key are equivalent to pKey * * @param pSkipList * @param pKey @@ -234,14 +234,13 @@ SSkipListNode *tSkipListIterGet(SSkipListIterator *iter); void *tSkipListDestroyIter(SSkipListIterator *iter); /* - * remove only one node of the pKey value. - * If more than one node has the same value, any one will be removed + * remove nodes of the pKey value. + * If more than one node has the same value, all will be removed * * @Return - * true: one node has been removed - * false: no node has been removed + * the count of removed nodes */ -bool tSkipListRemove(SSkipList *pSkipList, SSkipListKey key); +uint32_t tSkipListRemove(SSkipList *pSkipList, SSkipListKey key); /* * remove the specified node in parameters diff --git a/src/util/src/tskiplist.c b/src/util/src/tskiplist.c index 25ea49b60d..c9c1991dbe 100644 --- a/src/util/src/tskiplist.c +++ b/src/util/src/tskiplist.c @@ -74,7 +74,47 @@ static void tSkipListDoInsert(SSkipList *pSkipList, SSkipListNode **forward, SSk static SSkipListNode* tSkipListPushBack(SSkipList *pSkipList, SSkipListNode *pNode); static SSkipListNode* tSkipListPushFront(SSkipList* pSkipList, SSkipListNode *pNode); static SSkipListIterator* doCreateSkipListIterator(SSkipList *pSkipList, int32_t order); -static SSkipListNode* tSkipListDoGet(SSkipList *pSkipList, SSkipListKey key); + + +// when order is TSDB_ORDER_ASC, return the last node with key less than val +// when order is TSDB_ORDER_DESC, return the first node with key large than val +static SSkipListNode* getPriorNode(SSkipList* pSkipList, const char* val, int32_t order) { + __compar_fn_t comparFn = pSkipList->comparFn; + SSkipListNode *pNode = NULL; + + if (order == TSDB_ORDER_ASC) { + pNode = pSkipList->pHead; + for (int32_t i = pSkipList->level - 1; i >= 0; --i) { + SSkipListNode *p = SL_GET_FORWARD_POINTER(pNode, i); + while (p != pSkipList->pTail) { + char *key = SL_GET_NODE_KEY(pSkipList, p); + if (comparFn(key, val) < 0) { + pNode = p; + p = SL_GET_FORWARD_POINTER(p, i); + } else { + break; + } + } + } + } else { + pNode = pSkipList->pTail; + for (int32_t i = pSkipList->level - 1; i >= 0; --i) { + SSkipListNode *p = SL_GET_BACKWARD_POINTER(pNode, i); + while (p != pSkipList->pHead) { + char *key = SL_GET_NODE_KEY(pSkipList, p); + if (comparFn(key, val) > 0) { + pNode = p; + p = SL_GET_BACKWARD_POINTER(p, i); + } else { + break; + } + } + } + } + + return pNode; +} + static bool initForwardBackwardPtr(SSkipList* pSkipList) { uint32_t maxLevel = pSkipList->maxLevel; @@ -240,13 +280,37 @@ SSkipListNode *tSkipListPut(SSkipList *pSkipList, SSkipListNode *pNode) { return pNode; } + + SArray* tSkipListGet(SSkipList *pSkipList, SSkipListKey key) { SArray* sa = taosArrayInit(1, POINTER_BYTES); - SSkipListNode* pNode = tSkipListDoGet(pSkipList, key); - taosArrayPush(sa, &pNode); + + if (pSkipList->lock) { + pthread_rwlock_wrlock(pSkipList->lock); + } + + SSkipListNode* pNode = getPriorNode(pSkipList, key, TSDB_ORDER_ASC); + while (1) { + SSkipListNode *p = SL_GET_FORWARD_POINTER(pNode, 0); + if (p == pSkipList->pTail) { + break; + } + if (pSkipList->comparFn(key, SL_GET_NODE_KEY(pSkipList, p)) != 0) { + break; + } + taosArrayPush(sa, &p); + pNode = p; + } + + if (pSkipList->lock) { + pthread_rwlock_unlock(pSkipList->lock); + } + return sa; } + + size_t tSkipListGetSize(const SSkipList* pSkipList) { if (pSkipList == NULL) { return 0; @@ -375,14 +439,52 @@ size_t tSkipListGetSize(const SSkipList* pSkipList) { // return true; //} -bool tSkipListRemove(SSkipList *pSkipList, SSkipListKey key) { - SSkipListNode* pNode = tSkipListDoGet(pSkipList, key); - if (pNode != NULL) { - tSkipListRemoveNode(pSkipList, pNode); - return true; +uint32_t tSkipListRemove(SSkipList *pSkipList, SSkipListKey key) { + uint32_t count = 0; + + if (pSkipList->lock) { + pthread_rwlock_wrlock(pSkipList->lock); } - - return false; + + SSkipListNode* pNode = getPriorNode(pSkipList, key, TSDB_ORDER_ASC); + while (1) { + SSkipListNode *p = SL_GET_FORWARD_POINTER(pNode, 0); + if (p == pSkipList->pTail) { + break; + } + if (pSkipList->comparFn(key, SL_GET_NODE_KEY(pSkipList, p)) != 0) { + break; + } + + for (int32_t j = p->level - 1; j >= 0; --j) { + SSkipListNode* prev = SL_GET_BACKWARD_POINTER(p, j); + SSkipListNode* next = SL_GET_FORWARD_POINTER(p, j); + SL_GET_FORWARD_POINTER(prev, j) = next; + SL_GET_BACKWARD_POINTER(next, j) = prev; + } + + if (pSkipList->keyInfo.freeNode) { + tfree(p); + } + + ++count; + } + + // compress the minimum level of skip list + while (pSkipList->level > 0) { + if (SL_GET_FORWARD_POINTER(pSkipList->pHead, pSkipList->level - 1) != NULL) { + break; + } + pSkipList->level--; + } + + pSkipList->size -= count; + + if (pSkipList->lock) { + pthread_rwlock_unlock(pSkipList->lock); + } + + return count; } void tSkipListRemoveNode(SSkipList *pSkipList, SSkipListNode *pNode) { @@ -425,54 +527,25 @@ SSkipListIterator* tSkipListCreateIter(SSkipList *pSkipList) { } SSkipListIterator *tSkipListCreateIterFromVal(SSkipList* pSkipList, const char* val, int32_t type, int32_t order) { - if (pSkipList == NULL) { - return NULL; - } - assert(order == TSDB_ORDER_ASC || order == TSDB_ORDER_DESC); - + assert(pSkipList != NULL); + + SSkipListIterator* iter = doCreateSkipListIterator(pSkipList, order); if (val == NULL) { - return doCreateSkipListIterator(pSkipList, order); - } else { - - SSkipListNode *forward[MAX_SKIP_LIST_LEVEL] = {0}; - - int32_t ret = -1; - __compar_fn_t filterComparFn = getKeyComparFunc(pSkipList->keyInfo.type); - SSkipListNode* pNode = pSkipList->pHead; - - for (int32_t i = pSkipList->level - 1; i >= 0; --i) { - SSkipListNode *p = SL_GET_FORWARD_POINTER(pNode, i); - while (p != pSkipList->pTail) { - char *key = SL_GET_NODE_KEY(pSkipList, p); - - if ((ret = filterComparFn(key, val)) < 0) { - pNode = p; - p = SL_GET_FORWARD_POINTER(p, i); - } else { - break; - } - } - - forward[i] = pNode; - } - - SSkipListIterator* iter = doCreateSkipListIterator(pSkipList, order); - - // set the initial position - if (order == TSDB_ORDER_ASC) { - iter->cur = forward[0]; // greater equals than the value - } else { - iter->cur = SL_GET_FORWARD_POINTER(forward[0], 0); - - if (ret == 0) { - assert(iter->cur != pSkipList->pTail); - iter->cur = SL_GET_FORWARD_POINTER(iter->cur, 0); - } - } - return iter; } + + if (pSkipList->lock) { + pthread_rwlock_rdlock(pSkipList->lock); + } + + iter->cur = getPriorNode(pSkipList, val, order); + + if (pSkipList->lock) { + pthread_rwlock_unlock(pSkipList->lock); + } + + return iter; } bool tSkipListIterNext(SSkipListIterator *iter) { @@ -487,17 +560,9 @@ bool tSkipListIterNext(SSkipListIterator *iter) { } if (iter->order == TSDB_ORDER_ASC) { // ascending order iterate - if (iter->cur == NULL) { - iter->cur = SL_GET_FORWARD_POINTER(pSkipList->pHead, 0); - } else { - iter->cur = SL_GET_FORWARD_POINTER(iter->cur, 0); - } + iter->cur = SL_GET_FORWARD_POINTER(iter->cur, 0); } else { // descending order iterate - if (iter->cur == NULL) { - iter->cur = SL_GET_BACKWARD_POINTER(pSkipList->pTail, 0); - } else { - iter->cur = SL_GET_BACKWARD_POINTER(iter->cur, 0); - } + iter->cur = SL_GET_BACKWARD_POINTER(iter->cur, 0); } if (pSkipList->lock) { @@ -638,57 +703,16 @@ SSkipListNode* tSkipListPushBack(SSkipList *pSkipList, SSkipListNode *pNode) { return pNode; } -SSkipListNode* tSkipListDoGet(SSkipList *pSkipList, SSkipListKey skey) { - SSkipListNode *pNode = pSkipList->pHead; - SSkipListNode *pRes = NULL; - - if (pSkipList->lock) { - pthread_rwlock_rdlock(pSkipList->lock); - } - -#if SKIP_LIST_RECORD_PERFORMANCE - pSkipList->state.queryCount++; -#endif - - __compar_fn_t cmparFn = getComparFunc(pSkipList->keyInfo.type, 0); - - int32_t ret = -1; - for (int32_t i = pSkipList->level - 1; i >= 0; --i) { - SSkipListNode *p = SL_GET_FORWARD_POINTER(pNode, i); - while (p != pSkipList->pTail) { - char *key = SL_GET_NODE_KEY(pSkipList, p); - - if ((ret = cmparFn(key, skey)) < 0) { - pNode = p; - p = SL_GET_FORWARD_POINTER(p, i); - } else { - break; - } - } - - // find the qualified key - if (ret == 0) { - pRes = SL_GET_FORWARD_POINTER(pNode, i); - break; - // skip list does not allowed duplicated key, abort further retrieve data -// if (!pSkipList->keyInfo.dupKey) { -// break; -// } - } - } - - if (pSkipList->lock) { - pthread_rwlock_unlock(pSkipList->lock); - } - - return pRes; -} - SSkipListIterator* doCreateSkipListIterator(SSkipList *pSkipList, int32_t order) { SSkipListIterator* iter = calloc(1, sizeof(SSkipListIterator)); iter->pSkipList = pSkipList; iter->order = order; + if(order == TSDB_ORDER_ASC) { + iter->cur = pSkipList->pHead; + } else { + iter->cur = pSkipList->pTail; + } return iter; } \ No newline at end of file From a6534288079971c8ca898454c8d6244188649ff5 Mon Sep 17 00:00:00 2001 From: Bomin Zhang Date: Fri, 15 May 2020 14:14:59 +0800 Subject: [PATCH 071/126] TD-325: add unit test --- src/util/src/tskiplist.c | 6 +++- src/util/tests/skiplistTest.cpp | 59 ++++++++++++++++++++++----------- 2 files changed, 45 insertions(+), 20 deletions(-) diff --git a/src/util/src/tskiplist.c b/src/util/src/tskiplist.c index c9c1991dbe..b72db6a8d8 100644 --- a/src/util/src/tskiplist.c +++ b/src/util/src/tskiplist.c @@ -150,7 +150,11 @@ SSkipList *tSkipListCreate(uint8_t maxLevel, uint8_t keyType, uint8_t keyLen, ui maxLevel = MAX_SKIP_LIST_LEVEL; } - pSkipList->keyInfo = (SSkipListKeyInfo){.type = keyType, .len = keyLen, .dupKey = dupKey, .freeNode = freeNode}; + pSkipList->keyInfo.type = keyType; + pSkipList->keyInfo.len = keyLen; + pSkipList->keyInfo.dupKey = dupKey; + pSkipList->keyInfo.freeNode = freeNode; + pSkipList->keyFn = fn; pSkipList->comparFn = getKeyComparFunc(keyType); pSkipList->maxLevel = maxLevel; diff --git a/src/util/tests/skiplistTest.cpp b/src/util/tests/skiplistTest.cpp index 3713e71a01..70445a3d65 100644 --- a/src/util/tests/skiplistTest.cpp +++ b/src/util/tests/skiplistTest.cpp @@ -281,34 +281,55 @@ void skiplistPerformanceTest() { // todo not support duplicated key yet void duplicatedKeyTest() { -#if 0 - SSkipListKey key; - key.nType = TSDB_DATA_TYPE_INT; + SSkipList *pSkipList = tSkipListCreate(MAX_SKIP_LIST_LEVEL, TSDB_DATA_TYPE_INT, sizeof(int), true, false, true, getkey); - SSkipListNode **pNodes = NULL; - - SSkipList *pSkipList = tSkipListCreate(MAX_SKIP_LIST_LEVEL, TSDB_DATA_TYPE_INT, sizeof(int)); - - for (int32_t i = 0; i < 10000; ++i) { + for (int32_t i = 0; i < 200; ++i) { for (int32_t j = 0; j < 5; ++j) { - key.i64Key = i; - tSkipListPut(pSkipList, "", &key, 1); + int32_t level, size; + tSkipListNewNodeInfo(pSkipList, &level, &size); + SSkipListNode* d = (SSkipListNode*)calloc(1, size + sizeof(int32_t)); + d->level = level; + int32_t* key = (int32_t*)SL_GET_NODE_KEY(pSkipList, d); + key[0] = i; + tSkipListPut(pSkipList, d); } } - tSkipListPrint(pSkipList, 1); - for (int32_t i = 0; i < 100; ++i) { - key.i64Key = rand() % 1000; - int32_t size = tSkipListGets(pSkipList, &key, &pNodes); - - assert(size == 5); - - tfree(pNodes); + SSkipListKey key; + SArray* nodes = tSkipListGet(pSkipList, (char*)(&i)); + assert( taosArrayGetSize(nodes) == 5 ); + taosArrayDestroy(nodes); } + int32_t key = 101; + uint32_t num = tSkipListRemove(pSkipList, (char*)(&key)); + assert(num == 5); + + SArray* nodes = tSkipListGet(pSkipList, (char*)(&key)); + assert( taosArrayGetSize(nodes) == 0 ); + taosArrayDestroy(nodes); + + key = 102; + SSkipListIterator* iter = tSkipListCreateIterFromVal(pSkipList, (char*)(&key), TSDB_DATA_TYPE_INT, TSDB_ORDER_ASC); + for(int i = 0; i < 6; i++) { + assert(tSkipListIterNext(iter) == true); + SSkipListNode* node = tSkipListIterGet(iter); + int32_t* val = (int32_t*)SL_GET_NODE_KEY(pSkipList, node); + assert((i < 5) == ((*val) == key)); + } + tSkipListDestroyIter(iter); + + iter = tSkipListCreateIterFromVal(pSkipList, (char*)(&key), TSDB_DATA_TYPE_INT, TSDB_ORDER_DESC); + for(int i = 0; i < 6; i++) { + assert(tSkipListIterNext(iter) == true); + SSkipListNode* node = tSkipListIterGet(iter); + int32_t* val = (int32_t*)SL_GET_NODE_KEY(pSkipList, node); + assert((i < 5) == ((*val) == key)); + } + tSkipListDestroyIter(iter); + tSkipListDestroy(pSkipList); -#endif } } // namespace From de65f537445018e533c8f42ad2fdf0026d224097 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Fri, 15 May 2020 06:26:57 +0000 Subject: [PATCH 072/126] fix redefine --- src/tsdb/src/tsdbMeta.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index b7a7535a48..2ea7b3ef5a 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -6,7 +6,7 @@ #include "tsdbMain.h" #define TSDB_SUPER_TABLE_SL_LEVEL 5 // TODO: may change here -#define TSDB_META_FILE_NAME "META" +// #define TSDB_META_FILE_NAME "META" const int32_t DEFAULT_TAG_INDEX_COLUMN = 0; // skip list built based on the first column of tags From ac5d75361188c3dbfb9ef1623821f84f2aa9eed7 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Fri, 15 May 2020 14:52:41 +0800 Subject: [PATCH 073/126] fix bug while create log database --- src/plugins/monitor/src/monitorMain.c | 5 +++++ 1 file changed, 5 insertions(+) diff --git a/src/plugins/monitor/src/monitorMain.c b/src/plugins/monitor/src/monitorMain.c index 76b322d01b..ae8038e444 100644 --- a/src/plugins/monitor/src/monitorMain.c +++ b/src/plugins/monitor/src/monitorMain.c @@ -109,6 +109,11 @@ static void monitorStartSystemRetry() { } static void monitorInitConn(void *para, void *unused) { + if (dnodeGetDnodeId() <= 0) { + monitorStartSystemRetry(); + return; + } + monitorPrint("starting to initialize monitor service .."); tsMonitorConn.state = MONITOR_STATE_INITIALIZING; From 3d6e32dd591e264b5c688ce86d611a4730a24d67 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Fri, 15 May 2020 14:54:14 +0800 Subject: [PATCH 074/126] scripts --- tests/script/jenkins/basic.txt | 12 +++++----- tests/script/unique/cluster/balance1.sim | 8 +++---- tests/script/unique/cluster/balance2.sim | 12 +++++----- tests/script/unique/cluster/balance3.sim | 8 +++---- tests/script/unique/cluster/cache.sim | 29 ++++++++++++------------ 5 files changed, 34 insertions(+), 35 deletions(-) diff --git a/tests/script/jenkins/basic.txt b/tests/script/jenkins/basic.txt index f253de09c4..272183b26d 100644 --- a/tests/script/jenkins/basic.txt +++ b/tests/script/jenkins/basic.txt @@ -241,14 +241,14 @@ cd ../../../debug; make ./test.sh -u -f unique/account/user_create.sim ./test.sh -u -f unique/account/user_len.sim -#./test.sh -u -f unique/big/balance.sim -#slguan ./test.sh -u -f unique/big/maxvnodes.sim +#liao wait ./test.sh -u -f unique/big/balance.sim +#liao wait ./test.sh -u -f unique/big/maxvnodes.sim ./test.sh -u -f unique/big/tcp.sim -#jeff ./test.sh -u -f unique/cluster/balance1.sim -#jeff ./test.sh -u -f unique/cluster/balance2.sim -#jeff ./test.sh -u -f unique/cluster/balance3.sim -#./test.sh -u -f unique/cluster/cache.sim +./test.sh -u -f unique/cluster/balance1.sim +./test.sh -u -f unique/cluster/balance2.sim +./test.sh -u -f unique/cluster/balance3.sim +./test.sh -u -f unique/cluster/cache.sim ./test.sh -u -f unique/column/replica3.sim diff --git a/tests/script/unique/cluster/balance1.sim b/tests/script/unique/cluster/balance1.sim index 10e05971d7..424a80d25a 100644 --- a/tests/script/unique/cluster/balance1.sim +++ b/tests/script/unique/cluster/balance1.sim @@ -77,7 +77,7 @@ print dnode2 $dnode2Vnodes if $dnode1Vnodes != 2 then return -1 endi -if $dnode2Vnodes != NULL then +if $dnode2Vnodes != null then return -1 endi @@ -146,7 +146,7 @@ print dnode2 $dnode2Vnodes if $dnode1Vnodes != 3 then goto show4 endi -if $dnode2Vnodes != NULL then +if $dnode2Vnodes != null then goto show4 endi @@ -229,7 +229,7 @@ print dnode3 $dnode3Vnodes if $dnode1Vnodes != 3 then goto show8 endi -if $dnode3Vnodes != NULL then +if $dnode3Vnodes != null then goto show8 endi @@ -245,7 +245,7 @@ if $dnode1Role != master then return -1 endi -if $dnode3Role != NULL then +if $dnode3Role != null then return -1 endi diff --git a/tests/script/unique/cluster/balance2.sim b/tests/script/unique/cluster/balance2.sim index d741e03eec..08fdd233e0 100644 --- a/tests/script/unique/cluster/balance2.sim +++ b/tests/script/unique/cluster/balance2.sim @@ -131,7 +131,7 @@ print dnode3 $dnode3Vnodes if $dnode1Vnodes != 3 then goto show2 endi -if $dnode2Vnodes != NULL then +if $dnode2Vnodes != null then goto show2 endi if $dnode3Vnodes != 3 then @@ -194,7 +194,7 @@ print dnode4 ==> $dnode4Role if $dnode1Role != master then return -1 endi -if $dnode2Role != NULL then +if $dnode2Role != null then return -1 endi if $dnode3Role != slave then @@ -231,7 +231,7 @@ endi if $dnode4Vnodes != 3 then goto show4 endi -if $dnode3Vnodes != NULL then +if $dnode3Vnodes != null then goto show4 endi @@ -248,10 +248,10 @@ print dnode4 ==> $dnode4Role if $dnode1Role != master then return -1 endi -if $dnode2Role != NULL then +if $dnode2Role != null then return -1 endi -if $dnode3Role != NULL then +if $dnode3Role != null then return -1 endi @@ -339,7 +339,7 @@ print dnode4 $dnode4Vnodes $dnode5Vnodes = $data2_5 print dnode5 $dnode5Vnodes -if $dnode1Vnodes != NULL then +if $dnode1Vnodes != null then goto show6 endi if $dnode4Vnodes != 3 then diff --git a/tests/script/unique/cluster/balance3.sim b/tests/script/unique/cluster/balance3.sim index e9847e21da..407adc7f3b 100644 --- a/tests/script/unique/cluster/balance3.sim +++ b/tests/script/unique/cluster/balance3.sim @@ -110,7 +110,7 @@ endi if $dnode3Vnodes != 3 then goto show1 endi -if $dnode4Vnodes != NULL then +if $dnode4Vnodes != null then goto show1 endi @@ -166,7 +166,7 @@ print dnode4 $dnode4Vnodes if $dnode1Vnodes != 3 then goto show3 endi -if $dnode2Vnodes != NULL then +if $dnode2Vnodes != null then goto show3 endi if $dnode3Vnodes != 3 then @@ -232,7 +232,7 @@ endi if $dnode5Vnodes != 3 then goto show5 endi -if $dnode3Vnodes != NULL then +if $dnode3Vnodes != null then goto show5 endi if $dnode4Vnodes != 3 then @@ -298,7 +298,7 @@ endi if $dnode6Vnodes != 3 then goto show7 endi -if $dnode4Vnodes != NULL then +if $dnode4Vnodes != null then goto show7 endi diff --git a/tests/script/unique/cluster/cache.sim b/tests/script/unique/cluster/cache.sim index 41f9db69f3..e23b407828 100644 --- a/tests/script/unique/cluster/cache.sim +++ b/tests/script/unique/cluster/cache.sim @@ -4,26 +4,18 @@ system sh/stop_dnodes.sh system sh/deploy.sh -n dnode1 -i 1 system sh/deploy.sh -n dnode2 -i 2 -system sh/cfg.sh -n dnode1 -c walLevel -v 0 -system sh/cfg.sh -n dnode2 -c walLevel -v 0 +system sh/cfg.sh -n dnode1 -c walLevel -v 0 +system sh/cfg.sh -n dnode2 -c walLevel -v 0 system sh/cfg.sh -n dnode1 -c httpMaxThreads -v 2 system sh/cfg.sh -n dnode2 -c httpMaxThreads -v 2 system sh/cfg.sh -n dnode1 -c monitor -v 1 -system sh/cfg.sh -n dnode2 -c http -v 1 +system sh/cfg.sh -n dnode1 -c monitor -v 2 +system sh/cfg.sh -n dnode2 -c http -v 1 system sh/cfg.sh -n dnode1 -c enableHttp -v 1 system sh/cfg.sh -n dnode2 -c monitor -v 1 system sh/cfg.sh -n dnode1 -c monitorInterval -v 1 system sh/cfg.sh -n dnode2 -c monitorInterval -v 1 -system sh/cfg.sh -n dnode1 -c maxVnodeConnections -v 30000 -system sh/cfg.sh -n dnode2 -c maxVnodeConnections -v 30000 -system sh/cfg.sh -n dnode1 -c maxMgmtConnections -v 30000 -system sh/cfg.sh -n dnode2 -c maxMgmtConnections -v 30000 -system sh/cfg.sh -n dnode1 -c maxMeterConnections -v 30000 -system sh/cfg.sh -n dnode2 -c maxMeterConnections -v 30000 -system sh/cfg.sh -n dnode1 -c maxShellConns -v 30000 -system sh/cfg.sh -n dnode2 -c maxShellConns -v 30000 - system sh/exec.sh -n dnode1 -s start sleep 3000 sql connect @@ -45,13 +37,20 @@ sleep 3000 system sh/exec.sh -n dnode2 -s start sql create dnode $hostname2 -sleep 20000 -sql select * from log.dn_192_168_0_1 + +sleep 10000 + +sql show log.tables; +if $rows != 5 then + return -1 +endi + +sql select * from log.dn1 print ===>rows $rows print $data00 $data01 $data02 print $data10 $data11 $data12 print $data20 $data21 $data22 -if $rows < 20 then +if $rows < 10 then return -1 endi From 4e6b6ec0c15feac03cfbe5d29ea408e6070a654d Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Fri, 15 May 2020 07:05:51 +0000 Subject: [PATCH 075/126] change file name to normal case --- src/tsdb/src/tsdbMain.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index a7b59033f1..9852b95f27 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -18,7 +18,7 @@ int tsdbDebugFlag = 135; #define TSDB_MIN_ID 0 #define TSDB_MAX_ID INT_MAX -#define TSDB_CFG_FILE_NAME "CONFIG" +#define TSDB_CFG_FILE_NAME "config" #define TSDB_DATA_DIR_NAME "data" #define TSDB_DEFAULT_FILE_BLOCK_ROW_OPTION 0.7 #define TSDB_MAX_LAST_FILE_SIZE (1024 * 1024 * 10) // 10M From ce944ebb83959fca5944329fc18f39358916f576 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 15:40:01 +0800 Subject: [PATCH 076/126] reduce valgrind output. --- .travis.yml | 8 +++++--- 1 file changed, 5 insertions(+), 3 deletions(-) diff --git a/.travis.yml b/.travis.yml index 41937853d6..b9a653e795 100644 --- a/.travis.yml +++ b/.travis.yml @@ -49,7 +49,7 @@ matrix: ./test-all.sh $TRAVIS_EVENT_TYPE || travis_terminate $? cd ${TRAVIS_BUILD_DIR}/tests/pytest - ./valgrind-test.sh -g 2>&1 | tee mem-error-out.txt + ./valgrind-test.sh -g 2>&1 > mem-error-out.txt sleep 1 # Color setting @@ -59,12 +59,13 @@ matrix: GREEN_UNDERLINE='\033[4;32m' NC='\033[0m' - grep 'ERROR SUMMARY' mem-error-out.txt|grep -v 'grep'|uniq|tee uniq-mem-error-out.txt + grep 'start to execute\|ERROR SUMMARY' mem-error-out.txt|grep -v 'grep'|uniq|tee uniq-mem-error-out.txt for memError in `cat uniq-mem-error-out.txt | awk '{print $4}'` do if [ -n "$memError" ]; then if [ "$memError" -gt 12 ]; then + cat uniq-mem-error-out.txt echo -e "${RED} ## Memory errors number valgrind reports is $memError.\ More than our threshold! ## ${NC}" travis_terminate $memError @@ -72,11 +73,12 @@ matrix: fi done - grep 'definitely lost:' mem-error-out.txt|grep -v 'grep'|uniq|tee uniq-definitely-lost-out.txt + grep 'start to execute\|definitely lost:' mem-error-out.txt|grep -v 'grep'|uniq|tee uniq-definitely-lost-out.txt for defiMemError in `cat uniq-definitely-lost-out.txt | awk '{print $7}'` do if [ -n "$defiMemError" ]; then if [ "$defiMemError" -gt 13 ]; then + cat uniq-definitely-list-out.txt echo -e "${RED} ## Memory errors number valgrind reports \ Definitely lost is $defiMemError. More than our threshold! ## ${NC}" travis_terminate $defiMemError From ea099d2dbf7d6b9d5c2e4ae8cc92a8f7f9633469 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Fri, 15 May 2020 15:55:48 +0800 Subject: [PATCH 077/126] scripts --- tests/script/unique/db/replica_add13.sim | 48 ++++++++++++------------ 1 file changed, 24 insertions(+), 24 deletions(-) diff --git a/tests/script/unique/db/replica_add13.sim b/tests/script/unique/db/replica_add13.sim index d0533207e7..9f66faab0a 100644 --- a/tests/script/unique/db/replica_add13.sim +++ b/tests/script/unique/db/replica_add13.sim @@ -47,10 +47,10 @@ sql create table d2.t2 (ts timestamp, i int) sql create table d3.t3 (ts timestamp, i int) sql create table d4.t4 (ts timestamp, i int) -sql insert into d1.t1 values(now, 1) -sql insert into d2.t2 values(now, 1) -sql insert into d3.t3 values(now, 1) -sql insert into d4.t4 values(now, 1) +sql insert into d1.t1 values(1589529000011, 1) +sql insert into d2.t2 values(1589529000021, 1) +sql insert into d3.t3 values(1589529000031, 1) +sql insert into d4.t4 values(1589529000041, 1) sql select * from d1.t1 if $rows != 1 then @@ -111,10 +111,10 @@ if $data2_3 != 4 then endi print ======== step4 -sql insert into d1.t1 values(now, 2) -sql insert into d2.t2 values(now, 2) -sql insert into d3.t3 values(now, 2) -sql insert into d4.t4 values(now, 2) +sql insert into d1.t1 values(1589529000012, 2) +sql insert into d2.t2 values(1589529000022, 2) +sql insert into d3.t3 values(1589529000032, 2) +sql insert into d4.t4 values(1589529000042, 2) sql select * from d1.t1 if $rows != 2 then @@ -142,10 +142,10 @@ sleep 1000 system sh/exec_up.sh -n dnode2 -s stop -x SIGINT sleep 5000 -sql insert into d1.t1 values(now, 3) -sql insert into d2.t2 values(now, 3) -sql insert into d3.t3 values(now, 3) -sql insert into d4.t4 values(now, 3) +sql insert into d1.t1 values(1589529000013, 3) +sql insert into d2.t2 values(1589529000023, 3) +sql insert into d3.t3 values(1589529000033, 3) +sql insert into d4.t4 values(1589529000043, 3) sql select * from d1.t1 if $rows != 3 then @@ -173,10 +173,10 @@ sleep 5000 system sh/exec_up.sh -n dnode3 -s stop -x SIGINT sleep 3000 -sql insert into d1.t1 values(now, 4) -sql insert into d2.t2 values(now, 4) -sql insert into d3.t3 values(now, 4) -sql insert into d4.t4 values(now, 4) +sql insert into d1.t1 values(1589529000014, 4) +sql insert into d2.t2 values(1589529000024, 4) +sql insert into d3.t3 values(1589529000034, 4) +sql insert into d4.t4 values(1589529000044, 4) sql select * from d1.t1 print select * from d1.t1 $rows @@ -208,10 +208,10 @@ sleep 5000 system sh/exec_up.sh -n dnode4 -s stop -x SIGINT sleep 3000 -sql insert into d1.t1 values(now, 5) -sql insert into d2.t2 values(now, 5) -sql insert into d3.t3 values(now, 5) -sql insert into d4.t4 values(now, 5) +sql insert into d1.t1 values(1589529000015, 5) +sql insert into d2.t2 values(1589529000025, 5) +sql insert into d3.t3 values(1589529000035, 5) +sql insert into d4.t4 values(1589529000045, 5) sql select * from d1.t1 if $rows != 5 then @@ -239,10 +239,10 @@ sleep 5000 system sh/exec_up.sh -n dnode2 -s stop -x SIGINT sleep 3000 -sql insert into d1.t1 values(now, 6) -sql insert into d2.t2 values(now, 6) -sql insert into d3.t3 values(now, 6) -sql insert into d4.t4 values(now, 6) +sql insert into d1.t1 values(1589529000016, 6) +sql insert into d2.t2 values(1589529000026, 6) +sql insert into d3.t3 values(1589529000036, 6) +sql insert into d4.t4 values(1589529000046, 6) sql select * from d1.t1 if $rows != 6 then From 5868f3459c45b904bb8257144e4af0e7e05aa31e Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 16:00:26 +0800 Subject: [PATCH 078/126] reduce python test case output. --- tests/pytest/insert/float.py | 8 ++++---- tests/pytest/insert/int.py | 10 +++++----- tests/pytest/test.py | 3 ++- tests/pytest/util/cases.py | 4 +--- tests/pytest/util/dnodes.py | 4 ++-- 5 files changed, 14 insertions(+), 15 deletions(-) diff --git a/tests/pytest/insert/float.py b/tests/pytest/insert/float.py index 30d7e223f1..414833877e 100644 --- a/tests/pytest/insert/float.py +++ b/tests/pytest/insert/float.py @@ -43,7 +43,7 @@ class TDTestCase: "This test failed: insert wrong data error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("insert wrong data error catched") + tdLog.info("insert wrong data error catched") cmd = 'select * from tb order by ts desc' tdLog.info(cmd) @@ -82,7 +82,7 @@ class TDTestCase: insert wrong data error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("insert wrong data error catched") + tdLog.info("insert wrong data error catched") cmd = "insert into tb values (now+4a, 0)" tdLog.info(cmd) @@ -103,7 +103,7 @@ class TDTestCase: "This test failed: insert wrong data error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("insert wrong data error catched") + tdLog.info("insert wrong data error catched") cmd = "insert into tb values (now+5a, 2)" tdLog.info(cmd) @@ -124,7 +124,7 @@ class TDTestCase: "This test failed: insert wrong data error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("insert wrong data error catched") + tdLog.info("insert wrong data error catched") cmd = "insert into tb values (now+6a, 2)" tdLog.info(cmd) diff --git a/tests/pytest/insert/int.py b/tests/pytest/insert/int.py index d007cc56ea..350426a5bd 100644 --- a/tests/pytest/insert/int.py +++ b/tests/pytest/insert/int.py @@ -47,7 +47,7 @@ class TDTestCase: "This test failed: INT data overflow error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("INT data overflow error catched") + tdLog.info("INT data overflow error catched") cmd = 'insert into tb values (now+1m, NULL)' tdLog.info(cmd) @@ -76,7 +76,7 @@ class TDTestCase: "This test failed: INT data overflow error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("INT data overflow error catched") + tdLog.info("INT data overflow error catched") cmd = 'insert into tb values (now+3m, NULL)' tdLog.info(cmd) @@ -96,7 +96,7 @@ class TDTestCase: "This test failed: insert wrong data error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("insert wrong data error catched") + tdLog.info("insert wrong data error catched") cmd = 'insert into tb values (now+4m, 0)' tdLog.info(cmd) @@ -116,7 +116,7 @@ class TDTestCase: "This test failed: insert wrong data error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("insert wrong data error catched") + tdLog.info("insert wrong data error catched") cmd = 'insert into tb values (now+5m, 2)' tdLog.info(cmd) @@ -135,7 +135,7 @@ class TDTestCase: "This test failed: insert wrong data error _not_ catched") except Exception as e: tdLog.info(repr(e)) - tdLog.notice("insert wrong data error catched") + tdLog.info("insert wrong data error catched") cmd = 'insert into tb values (now+6m, 2)' tdLog.info(cmd) diff --git a/tests/pytest/test.py b/tests/pytest/test.py index 65685fecdc..9d76b0a70e 100644 --- a/tests/pytest/test.py +++ b/tests/pytest/test.py @@ -79,7 +79,8 @@ if __name__ == "__main__": time.sleep(1) processID = subprocess.check_output(psCmd, shell=True) - tdLog.exit('stop All dnodes') + tdLog.info('stop All dnodes') + sys.exit(0) tdDnodes.init(deployPath) tdDnodes.setTestCluster(testCluster) diff --git a/tests/pytest/util/cases.py b/tests/pytest/util/cases.py index 9a4f0fc98a..9026cd0f2f 100644 --- a/tests/pytest/util/cases.py +++ b/tests/pytest/util/cases.py @@ -57,7 +57,7 @@ class TDCases: runNum += 1 continue - tdLog.notice("total %d Linux test case(s) executed" % (runNum)) + tdLog.info("total %d Linux test case(s) executed" % (runNum)) def runOneLinux(self, conn, fileName): testModule = self.__dynamicLoadModule(fileName) @@ -76,8 +76,6 @@ class TDCases: runNum += 1 continue - tdLog.success("total %d Linux test case(s) executed" % (runNum)) - def runAllWindows(self, conn): # TODO: load all Windows cases here runNum = 0 diff --git a/tests/pytest/util/dnodes.py b/tests/pytest/util/dnodes.py index 63cdccecbc..0789c3bc3f 100644 --- a/tests/pytest/util/dnodes.py +++ b/tests/pytest/util/dnodes.py @@ -202,7 +202,7 @@ class TDDnode: if (binPath == ""): tdLog.exit("taosd not found!s") else: - tdLog.notice("taosd found in %s" % rootRealPath) + tdLog.info("taosd found in %s" % rootRealPath) if self.deployed == 0: tdLog.exit("dnode:%d is not deployed" % (self.index)) @@ -408,7 +408,7 @@ class TDDnodes: tdLog.exit("index:%d should on a scale of [1, 10]" % (index)) def stopAll(self): - tdLog.debug("stop all dnodes") + tdLog.info("stop all dnodes") for i in range(len(self.dnodes)): self.dnodes[i].stop() From f617394f4d7387b9523e0db4e78f4fff43b707d7 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Fri, 15 May 2020 08:03:10 +0000 Subject: [PATCH 079/126] add table name to tsdb log --- src/tsdb/src/tsdbMain.c | 8 ++++---- src/tsdb/src/tsdbMeta.c | 13 +++++++------ 2 files changed, 11 insertions(+), 10 deletions(-) diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index 9852b95f27..673cd6003c 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -841,8 +841,8 @@ static int32_t tdInsertRowToTable(STsdbRepo *pRepo, SDataRow row, STable *pTable pTable->mem->numOfPoints = tSkipListGetSize(pTable->mem->pData); - tsdbTrace("vgId:%d, tid:%d, uid:%" PRId64 ", a row is inserted to table! key:%" PRId64, - pRepo->config.tsdbId, pTable->tableId.tid, pTable->tableId.uid, dataRowKey(row)); + tsdbTrace("vgId:%d, tid:%d, uid:%" PRId64 ", table:%s a row is inserted to table! key:%" PRId64, pRepo->config.tsdbId, + pTable->tableId.tid, pTable->tableId.uid, varDataVal(pTable->name), dataRowKey(row)); return 0; } @@ -867,9 +867,9 @@ static int32_t tsdbInsertDataToTable(TsdbRepoT *repo, SSubmitBlk *pBlock, TSKEY tsdbInitSubmitBlkIter(pBlock, &blkIter); while ((row = tsdbGetSubmitBlkNext(&blkIter)) != NULL) { if (dataRowKey(row) < minKey || dataRowKey(row) > maxKey) { - tsdbError("vgId:%d, table tid:%d, talbe uid:%ld timestamp is out of range. now:" PRId64 ", maxKey:" PRId64 + tsdbError("vgId:%d, table:%s, tid:%d, talbe uid:%ld timestamp is out of range. now:" PRId64 ", maxKey:" PRId64 ", minKey:" PRId64, - pRepo->config.tsdbId, pTable->tableId.tid, pTable->tableId.uid, now, minKey, maxKey); + pRepo->config.tsdbId, varDataVal(pTable->name), pTable->tableId.tid, pTable->tableId.uid, now, minKey, maxKey); return TSDB_CODE_TIMESTAMP_OUT_OF_RANGE; } diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index 2ea7b3ef5a..aaea50267d 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -310,7 +310,7 @@ int tsdbCreateTable(TsdbRepoT *repo, STableCfg *pCfg) { // todo refactor extract method size_t size = strnlen(pCfg->sname, TSDB_TABLE_NAME_LEN); - super->name = malloc(size + VARSTR_HEADER_SIZE); + super->name = calloc(1, size + VARSTR_HEADER_SIZE + 1); STR_WITH_SIZE_TO_VARSTR(super->name, pCfg->sname, size); // index the first tag column @@ -339,7 +339,7 @@ int tsdbCreateTable(TsdbRepoT *repo, STableCfg *pCfg) { table->tableId = pCfg->tableId; size_t size = strnlen(pCfg->name, TSDB_TABLE_NAME_LEN); - table->name = malloc(size + VARSTR_HEADER_SIZE); + table->name = calloc(1, size + VARSTR_HEADER_SIZE + 1); STR_WITH_SIZE_TO_VARSTR(table->name, pCfg->name, size); table->lastKey = 0; @@ -356,12 +356,12 @@ int tsdbCreateTable(TsdbRepoT *repo, STableCfg *pCfg) { // Register to meta if (newSuper) { tsdbAddTableToMeta(pMeta, super, true); - tsdbTrace("vgId:%d, super table is created! uid:%" PRId64, pRepo->config.tsdbId, + tsdbTrace("vgId:%d, super table %s is created! uid:%" PRId64, pRepo->config.tsdbId, varDataVal(super->name), super->tableId.uid); } tsdbAddTableToMeta(pMeta, table, true); - tsdbTrace("vgId:%d, table is created! tid:%d, uid:%" PRId64, pRepo->config.tsdbId, table->tableId.tid, - table->tableId.uid); + tsdbTrace("vgId:%d, table %s is created! tid:%d, uid:%" PRId64, pRepo->config.tsdbId, varDataVal(table->name), + table->tableId.tid, table->tableId.uid); // Write to meta file int bufLen = 0; @@ -409,7 +409,8 @@ int tsdbDropTable(TsdbRepoT *repo, STableId tableId) { return -1; } - tsdbTrace("vgId:%d, table is dropped! tid:%d, uid:%" PRId64, pRepo->config.tsdbId, tableId.tid, tableId.uid); + tsdbTrace("vgId:%d, table %s is dropped! tid:%d, uid:%" PRId64, pRepo->config.tsdbId, varDataVal(pTable->name), + tableId.tid, tableId.uid); if (tsdbRemoveTableFromMeta(pMeta, pTable) < 0) return -1; return 0; From d69c99d1e395457c82a592c3a43fd24b0e7b9b17 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Fri, 15 May 2020 08:23:26 +0000 Subject: [PATCH 080/126] fix coredump due to table delete --- src/tsdb/src/tsdbMain.c | 1 + 1 file changed, 1 insertion(+) diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index 673cd6003c..c63de165d3 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -169,6 +169,7 @@ static int tsdbRestoreInfo(STsdbRepo *pRepo) { if (tsdbSetAndOpenHelperFile(&rhelper, pFGroup) < 0) goto _err; for (int i = 1; i < pRepo->config.maxTables; i++) { STable * pTable = pMeta->tables[i]; + if (pTable == NULL) continue; SCompIdx *pIdx = &rhelper.pCompIdx[i]; if (pIdx->offset > 0 && pTable->lastKey < pIdx->maxKey) pTable->lastKey = pIdx->maxKey; From 22d79ca1eccd455afd77c21e98c307459688cc9f Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 16:43:51 +0800 Subject: [PATCH 081/126] fixup: do not cat log again. --- .travis.yml | 2 -- 1 file changed, 2 deletions(-) diff --git a/.travis.yml b/.travis.yml index b9a653e795..714fb6a405 100644 --- a/.travis.yml +++ b/.travis.yml @@ -65,7 +65,6 @@ matrix: do if [ -n "$memError" ]; then if [ "$memError" -gt 12 ]; then - cat uniq-mem-error-out.txt echo -e "${RED} ## Memory errors number valgrind reports is $memError.\ More than our threshold! ## ${NC}" travis_terminate $memError @@ -78,7 +77,6 @@ matrix: do if [ -n "$defiMemError" ]; then if [ "$defiMemError" -gt 13 ]; then - cat uniq-definitely-list-out.txt echo -e "${RED} ## Memory errors number valgrind reports \ Definitely lost is $defiMemError. More than our threshold! ## ${NC}" travis_terminate $defiMemError From 221ae2dc5d32e4bc6af6da8fbfa8392403642720 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 16:45:07 +0800 Subject: [PATCH 082/126] remove importCacheFileT.py as not consistant result for now. --- tests/pytest/smoketest.sh | 2 -- tests/pytest/valgrind-test.sh | 2 -- 2 files changed, 4 deletions(-) diff --git a/tests/pytest/smoketest.sh b/tests/pytest/smoketest.sh index 853ebe1d76..c0878354e0 100755 --- a/tests/pytest/smoketest.sh +++ b/tests/pytest/smoketest.sh @@ -29,8 +29,6 @@ python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f table/db_table.py python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f import_merge/importCacheFileT.py -python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f import_merge/importDataLastSub.py python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f import_merge/importHead.py diff --git a/tests/pytest/valgrind-test.sh b/tests/pytest/valgrind-test.sh index 1d65830fa3..77c2b321df 100755 --- a/tests/pytest/valgrind-test.sh +++ b/tests/pytest/valgrind-test.sh @@ -29,7 +29,5 @@ python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f table/db_table.py python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f import_merge/importCacheFileT.py -python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f import_merge/importDataLastSub.py python3 ./test.py $1 -s && sleep 1 From f0b5b14e42f1be3e85edf23843be77c41462a66a Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Fri, 15 May 2020 09:35:52 +0000 Subject: [PATCH 083/126] fix valgrind unitialized warning --- src/tsdb/src/tsdbRWHelper.c | 2 ++ 1 file changed, 2 insertions(+) diff --git a/src/tsdb/src/tsdbRWHelper.c b/src/tsdb/src/tsdbRWHelper.c index ebecf887d3..829d7ab3fd 100644 --- a/src/tsdb/src/tsdbRWHelper.c +++ b/src/tsdb/src/tsdbRWHelper.c @@ -701,6 +701,8 @@ static int tsdbWriteBlockToFile(SRWHelper *pHelper, SFile *pFile, SDataCols *pDa continue; } + memset(pCompCol, 0, sizeof(*pCompCol)); + pCompCol->colId = pDataCol->colId; pCompCol->type = pDataCol->type; if (tDataTypeDesc[pDataCol->type].getStatisFunc) { From 84cc10bf28b413420712394c09acaa1aa7e3b474 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 18:33:06 +0800 Subject: [PATCH 084/126] add max column number check case. --- tests/pytest/table/column_num.py | 109 ++++++++----------------------- 1 file changed, 27 insertions(+), 82 deletions(-) diff --git a/tests/pytest/table/column_num.py b/tests/pytest/table/column_num.py index 87299827cc..6e9b6ca353 100644 --- a/tests/pytest/table/column_num.py +++ b/tests/pytest/table/column_num.py @@ -1,6 +1,7 @@ # -*- coding: utf-8 -*- import sys +import subprocess from util.log import * from util.cases import * from util.sql import * @@ -14,127 +15,71 @@ class TDTestCase: def run(self): tdSql.prepare() - # TSIM: system sh/stop_dnodes.sh - # TSIM: - # TSIM: system sh/ip.sh -i 1 -s up - # TSIM: system sh/deploy.sh -n dnode1 -m 192.168.0.1 -i 192.168.0.1 - # TSIM: system sh/cfg.sh -n dnode1 -c walLevel -v 0 - # TSIM: system sh/exec.sh -n dnode1 -s start - # TSIM: - # TSIM: sleep 3000 - # TSIM: sql connect - # TSIM: - # TSIM: $i = 0 - # TSIM: $dbPrefix = lm_cn_db - # TSIM: $tbPrefix = lm_cn_tb - # TSIM: $db = $dbPrefix . $i - # TSIM: $tb = $tbPrefix . $i - # TSIM: - # TSIM: print =============== step1 tdLog.info('=============== step1') - # TSIM: sql create database $db - # TSIM: sql use $db - # TSIM: - # TSIM: sql create table $tb() -x step1 tdLog.info('create table tb() -x step1') tdSql.error('create table tb()') - # TSIM: return -1 - # TSIM: step1: - # TSIM: - # TSIM: sql show tables tdLog.info('show tables') tdSql.query('show tables') # TSIM: if $rows != 0 then tdLog.info('tdSql.checkRow(0)') tdSql.checkRows(0) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: print =============== step2 tdLog.info('=============== step2') # TSIM: sql create table $tb (ts timestamp) -x step2 tdLog.info('create table tb (ts timestamp) -x step2') tdSql.error('create table tb (ts timestamp) ') - # TSIM: return -1 - # TSIM: step2: - # TSIM: - # TSIM: sql show tables tdLog.info('show tables') tdSql.query('show tables') # TSIM: if $rows != 0 then tdLog.info('tdSql.checkRow(0)') tdSql.checkRows(0) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: print =============== step3 tdLog.info('=============== step3') - # TSIM: sql create table $tb (ts int) -x step3 tdLog.info('create table tb (ts int) -x step3') tdSql.error('create table tb (ts int) ') - # TSIM: return -1 - # TSIM: step3: - # TSIM: - # TSIM: sql show tables tdLog.info('show tables') tdSql.query('show tables') - # TSIM: if $rows != 0 then tdLog.info('tdSql.checkRow(0)') tdSql.checkRows(0) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: print =============== step4 tdLog.info('=============== step4') - # TSIM: sql create table $tb (ts timestamp, a1 int, a2 int, a3 int, a4 - # int, a5 int, a6 int, a7 int, a8 int, a9 int, a10 int, a11 int, a12 - # int, a13 int, a14 int, a15 int, a16 int, a17 int, a18 int, a19 int, - # a20 int, a21 int, a22 int, a23 int, a24 int, a25 int, a26 int, a27 - # int, a28 int,a29 int,a30 int,a31 int,a32 int, b1 int, b2 int, b3 int, - # b4 int, b5 int, b6 int, b7 int, b8 int, b9 int, b10 int, b11 int, b12 - # int, b13 int, b14 int, b15 int, b16 int, b17 int, b18 int, b19 int, - # b20 int, b21 int, b22 int, b23 int, b24 int, b25 int, b26 int, b27 - # int, b28 int,b29 int,b30 int,b31 int,b32 int) tdLog.info('create table tb (ts timestamp, a1 int, a2 int, a3 int, a4 int, a5 int, a6 int, a7 int, a8 int, a9 int, a10 int, a11 int, a12 int, a13 int, a14 int, a15 int, a16 int, a17 int, a18 int, a19 int, a20 int, a21 int, a22 int, a23 int, a24 int, a25 int, a26 int, a27 int, a28 int,a29 int,a30 int,a31 int,a32 int, b1 int, b2 int, b3 int, b4 int, b5 int, b6 int, b7 int, b8 int, b9 int, b10 int, b11 int, b12 int, b13 int, b14 int, b15 int, b16 int, b17 int, b18 int, b19 int, b20 int, b21 int, b22 int, b23 int, b24 int, b25 int, b26 int, b27 int, b28 int,b29 int,b30 int,b31 int,b32 int)') tdSql.execute('create table tb (ts timestamp, a1 int, a2 int, a3 int, a4 int, a5 int, a6 int, a7 int, a8 int, a9 int, a10 int, a11 int, a12 int, a13 int, a14 int, a15 int, a16 int, a17 int, a18 int, a19 int, a20 int, a21 int, a22 int, a23 int, a24 int, a25 int, a26 int, a27 int, a28 int,a29 int,a30 int,a31 int,a32 int, b1 int, b2 int, b3 int, b4 int, b5 int, b6 int, b7 int, b8 int, b9 int, b10 int, b11 int, b12 int, b13 int, b14 int, b15 int, b16 int, b17 int, b18 int, b19 int, b20 int, b21 int, b22 int, b23 int, b24 int, b25 int, b26 int, b27 int, b28 int,b29 int,b30 int,b31 int,b32 int)') # TSIM: # TSIM: sql show tables tdLog.info('show tables') tdSql.query('show tables') - # TSIM: if $rows != 1 then tdLog.info('tdSql.checkRow(1)') tdSql.checkRows(1) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: print =============== step5 + tdLog.info('=============== step5') - # TSIM: $i = 1 - # TSIM: $tb = $tbPrefix . $i - # TSIM: - # TSIM: sql create table $tb (ts timestamp, a1 int, a2 int, a3 int, a4 - # int, a5 int, a6 int, a7 int, a8 int, a9 int, a10 int, a11 int, a12 - # int, a13 int, a14 int, a15 int, a16 int, a17 int, a18 int, a19 int, - # a20 int, a21 int, a22 int, a23 int, a24 int, a25 int, a26 int, a27 - # int, a28 int,a29 int,a30 int,a31 int,a32 int, b1 int, b2 int, b3 int, - # b4 int, b5 int) - tdLog.info('create table tb1 (ts timestamp, a1 int, a2 int, a3 int, a4 int, a5 int, a6 int, a7 int, a8 int, a9 int, a10 int, a11 int, a12 int, a13 int, a14 int, a15 int, a16 int, a17 int, a18 int, a19 int, a20 int, a21 int, a22 int, a23 int, a24 int, a25 int, a26 int, a27 int, a28 int,a29 int,a30 int,a31 int,a32 int, b1 int, b2 int, b3 int, b4 int, b5 int)') - tdSql.execute('create table tb1 (ts timestamp, a1 int, a2 int, a3 int, a4 int, a5 int, a6 int, a7 int, a8 int, a9 int, a10 int, a11 int, a12 int, a13 int, a14 int, a15 int, a16 int, a17 int, a18 int, a19 int, a20 int, a21 int, a22 int, a23 int, a24 int, a25 int, a26 int, a27 int, a28 int,a29 int,a30 int,a31 int,a32 int, b1 int, b2 int, b3 int, b4 int, b5 int)') - # TSIM: - # TSIM: sql show tables + + getMaxColumnNum = "grep -w '#define TSDB_MAX_COLUMNS' ../../src/inc/taosdef.h|awk '{print $3}'" + boundary = int(subprocess.check_output(getMaxColumnNum, shell=True)) + tdLog.notice("get max column number is %d" % boundary) + + columnSeq = "ts timestamp" + for x in range(0, boundary): + columnSeq = columnSeq + ", col%d int" % x + + tdLog.info("create table tb1 (%s)" % columnSeq) + tdSql.error('create table tb1 (%s)' % columnSeq) + + columnSeq = "ts timestamp" + for x in range(0, boundary - 1): + columnSeq = columnSeq + ", col%d int" % x + + tdLog.info("create table tb1 (%s)" % columnSeq) + tdSql.execute('create table tb1 (%s)' % columnSeq) + tdLog.info('show tables') tdSql.query('show tables') # TSIM: if $rows != 2 then tdLog.info('tdSql.checkRow(2)') tdSql.checkRows(2) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: sql insert into $tb values (now, 1 , 2 , 3 , 4 , 5 , 6 , 7 , 8 - # , 9 , 10 , 11 , 12 , 13 , 14 , 15 , 16 , 17 , 18 , 19 , 20 , 21 , 22 - # , 23 , 24 , 25 ,26 , 27 ,28 ,29,30,31, 32, 33, 34, 35, 36, 37) - tdLog.info("insert into tb1 values (now, 1 , 2 , 3 , 4 , 5 , 6 , 7 , 8 , 9 , 10 , 11 , 12 , 13 , 14 , 15 , 16 , 17 , 18 , 19 , 20 , 21 , 22 , 23 , 24 , 25 ,26 , 27 ,28 ,29,30,31, 32, 33, 34, 35, 36, 37)") - tdSql.execute("insert into tb1 values (now, 1 , 2 , 3 , 4 , 5 , 6 , 7 , 8 , 9 , 10 , 11 , 12 , 13 , 14 , 15 , 16 , 17 , 18 , 19 , 20 , 21 , 22 , 23 , 24 , 25 ,26 , 27 ,28 ,29,30,31, 32, 33, 34, 35, 36, 37)") + + data = "now" + for x in range(0, boundary-1): + data = data + ", %d" % x + tdLog.info("insert into tb1 values (%s)" % data) + tdSql.execute("insert into tb1 values (%s)" % data) # TSIM: sql select * from $tb tdLog.info('select * from tb1') tdSql.query('select * from tb1') From 6b8aae25a72a9f3d74dcb48b9085d66286debad5 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 18:40:12 +0800 Subject: [PATCH 085/126] change dist to bionicfor python 3.6+ --- .travis.yml | 1 + 1 file changed, 1 insertion(+) diff --git a/.travis.yml b/.travis.yml index 41937853d6..14d34ec970 100644 --- a/.travis.yml +++ b/.travis.yml @@ -6,6 +6,7 @@ # matrix: - os: linux + dist: bionic language: c git: From b4b092b48831df8d0492ae32ea9d769b165634fb Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Fri, 15 May 2020 19:06:41 +0800 Subject: [PATCH 086/126] add random test. --- .travis.yml | 4 ++-- tests/pytest/dbmgmt/database-name-boundary.py | 2 +- tests/pytest/table/column_num.py | 2 +- tests/pytest/tag_lite/create-tags-boundary.py | 2 +- tests/pytest/util/dnodes.py | 10 ++-------- 5 files changed, 7 insertions(+), 13 deletions(-) diff --git a/.travis.yml b/.travis.yml index 8b7ec6ffe7..da0c47ea56 100644 --- a/.travis.yml +++ b/.travis.yml @@ -62,7 +62,7 @@ matrix: grep 'start to execute\|ERROR SUMMARY' mem-error-out.txt|grep -v 'grep'|uniq|tee uniq-mem-error-out.txt - for memError in `cat uniq-mem-error-out.txt | awk '{print $4}'` + for memError in `grep 'ERROR SUMMARY' uniq-mem-error-out.txt | awk '{print $4}'` do if [ -n "$memError" ]; then if [ "$memError" -gt 12 ]; then @@ -74,7 +74,7 @@ matrix: done grep 'start to execute\|definitely lost:' mem-error-out.txt|grep -v 'grep'|uniq|tee uniq-definitely-lost-out.txt - for defiMemError in `cat uniq-definitely-lost-out.txt | awk '{print $7}'` + for defiMemError in `grep 'definitely lost:' uniq-definitely-lost-out.txt | awk '{print $7}'` do if [ -n "$defiMemError" ]; then if [ "$defiMemError" -gt 13 ]; then diff --git a/tests/pytest/dbmgmt/database-name-boundary.py b/tests/pytest/dbmgmt/database-name-boundary.py index b57740ebaa..ff6dce22ae 100644 --- a/tests/pytest/dbmgmt/database-name-boundary.py +++ b/tests/pytest/dbmgmt/database-name-boundary.py @@ -33,7 +33,7 @@ class TDTestCase: getDbNameLen = "grep -w '#define TSDB_DB_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" dbNameMaxLen = int(subprocess.check_output(getDbNameLen, shell=True)) - tdLog.notice("DB name max length is %d" % dbNameMaxLen) + tdLog.info("DB name max length is %d" % dbNameMaxLen) tdLog.info("=============== step1") db_name = ''.join(random.choices(chars, k=(dbNameMaxLen + 1))) diff --git a/tests/pytest/table/column_num.py b/tests/pytest/table/column_num.py index 6e9b6ca353..486541bab7 100644 --- a/tests/pytest/table/column_num.py +++ b/tests/pytest/table/column_num.py @@ -53,7 +53,7 @@ class TDTestCase: getMaxColumnNum = "grep -w '#define TSDB_MAX_COLUMNS' ../../src/inc/taosdef.h|awk '{print $3}'" boundary = int(subprocess.check_output(getMaxColumnNum, shell=True)) - tdLog.notice("get max column number is %d" % boundary) + tdLog.info("get max column number is %d" % boundary) columnSeq = "ts timestamp" for x in range(0, boundary): diff --git a/tests/pytest/tag_lite/create-tags-boundary.py b/tests/pytest/tag_lite/create-tags-boundary.py index 12058b2b21..e80f458f0c 100644 --- a/tests/pytest/tag_lite/create-tags-boundary.py +++ b/tests/pytest/tag_lite/create-tags-boundary.py @@ -28,7 +28,7 @@ class TDTestCase: getMaxTagNum = "grep -w TSDB_MAX_TAGS ../../src/inc/taosdef.h|awk '{print $3}'" boundary = int(subprocess.check_output(getMaxTagNum, shell=True)) - tdLog.notice("get max tags number is %d" % boundary) + tdLog.info("get max tags number is %d" % boundary) for x in range(0, boundary): stb_name = "stb%d" % x diff --git a/tests/pytest/util/dnodes.py b/tests/pytest/util/dnodes.py index 0789c3bc3f..9f7466a7e7 100644 --- a/tests/pytest/util/dnodes.py +++ b/tests/pytest/util/dnodes.py @@ -244,11 +244,8 @@ class TDDnode: time.sleep(1) processID = subprocess.check_output(psCmd, shell=True) + self.running = 0 tdLog.debug("dnode:%d is stopped by kill -INT" % (self.index)) - tdLog.debug( - "wait 2 seconds for the dnode:%d to stop." % - (self.index)) - time.sleep(2) def forcestop(self): if self.valgrind == 0: @@ -267,11 +264,8 @@ class TDDnode: time.sleep(1) processID = subprocess.check_output(psCmd, shell=True) + self.running = 0 tdLog.debug("dnode:%d is stopped by kill -KILL" % (self.index)) - tdLog.debug( - "wait 2 seconds for the dnode:%d to stop." % - (self.index)) - time.sleep(2) def startIP(self): cmd = "sudo ifconfig lo:%d 192.168.0.%d up" % (self.index, self.index) From 53a0e401d48dadb9fea72416f6957b0fe6145e19 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Sat, 16 May 2020 09:52:05 +0800 Subject: [PATCH 087/126] gitignore --- .gitignore | 3 +++ 1 file changed, 3 insertions(+) diff --git a/.gitignore b/.gitignore index d0af51d31b..83df761654 100644 --- a/.gitignore +++ b/.gitignore @@ -33,5 +33,8 @@ Target/ *.failed *.sql sim/ +psim/ +pysim/ +*.out *DS_Store From 9570328908be602153fb1fe45d76db6b6a97fe06 Mon Sep 17 00:00:00 2001 From: Bomin Zhang Date: Sat, 16 May 2020 11:03:27 +0800 Subject: [PATCH 088/126] TD-333: boundary check --- src/client/inc/tscUtil.h | 2 +- src/client/inc/tsclient.h | 2 +- src/inc/taosdef.h | 10 +- src/rpc/src/rpcMain.c | 8 +- tests/pytest/table/boundary.py | 161 +++++++++++++++++++++++ tests/pytest/table/tablename-boundary.py | 46 ------- 6 files changed, 173 insertions(+), 56 deletions(-) create mode 100644 tests/pytest/table/boundary.py delete mode 100644 tests/pytest/table/tablename-boundary.py diff --git a/src/client/inc/tscUtil.h b/src/client/inc/tscUtil.h index 1654f76f1c..dbbec01329 100644 --- a/src/client/inc/tscUtil.h +++ b/src/client/inc/tscUtil.h @@ -43,7 +43,7 @@ extern "C" { typedef struct SParsedColElem { int16_t colIndex; - int16_t offset; + uint16_t offset; } SParsedColElem; typedef struct SParsedDataColInfo { diff --git a/src/client/inc/tsclient.h b/src/client/inc/tsclient.h index a7eec31388..e6a37a2745 100644 --- a/src/client/inc/tsclient.h +++ b/src/client/inc/tsclient.h @@ -49,7 +49,7 @@ typedef struct STableComInfo { uint8_t numOfTags; uint8_t precision; int16_t numOfColumns; - int16_t rowSize; + int32_t rowSize; } STableComInfo; typedef struct STableMeta { diff --git a/src/inc/taosdef.h b/src/inc/taosdef.h index 5dad1bdb53..949f60c37b 100644 --- a/src/inc/taosdef.h +++ b/src/inc/taosdef.h @@ -193,20 +193,20 @@ void tsDataSwap(void *pLeft, void *pRight, int32_t type, int32_t size); #define TSDB_ACCT_LEN TSDB_UNI_LEN #define TSDB_PASSWORD_LEN TSDB_UNI_LEN -#define TSDB_MAX_COLUMNS 256 +#define TSDB_MAX_COLUMNS 1024 #define TSDB_MIN_COLUMNS 2 //PRIMARY COLUMN(timestamp) + other columns #define TSDB_NODE_NAME_LEN 64 #define TSDB_TABLE_NAME_LEN 192 #define TSDB_DB_NAME_LEN 32 #define TSDB_COL_NAME_LEN 64 -#define TSDB_MAX_SAVED_SQL_LEN TSDB_MAX_COLUMNS * 16 +#define TSDB_MAX_SAVED_SQL_LEN TSDB_MAX_COLUMNS * 64 #define TSDB_MAX_SQL_LEN TSDB_PAYLOAD_SIZE #define TSDB_MAX_ALLOWED_SQL_LEN (8*1024*1024U) // sql length should be less than 6mb -#define TSDB_MAX_BYTES_PER_ROW TSDB_MAX_COLUMNS * 16 -#define TSDB_MAX_TAGS_LEN 512 -#define TSDB_MAX_TAGS 32 +#define TSDB_MAX_BYTES_PER_ROW TSDB_MAX_COLUMNS * 64 +#define TSDB_MAX_TAGS_LEN 65536 +#define TSDB_MAX_TAGS 128 #define TSDB_AUTH_LEN 16 #define TSDB_KEY_LEN 16 diff --git a/src/rpc/src/rpcMain.c b/src/rpc/src/rpcMain.c index 7e80f0d282..ff96306bea 100644 --- a/src/rpc/src/rpcMain.c +++ b/src/rpc/src/rpcMain.c @@ -361,9 +361,10 @@ void rpcSendRequest(void *shandle, const SRpcIpSet *pIpSet, const SRpcMsg *pMsg) // connection type is application specific. // for TDengine, all the query, show commands shall have TCP connection char type = pMsg->msgType; - if (type == TSDB_MSG_TYPE_QUERY || type == TSDB_MSG_TYPE_CM_RETRIEVE || type == TSDB_MSG_TYPE_FETCH || - type == TSDB_MSG_TYPE_CM_STABLE_VGROUP || type == TSDB_MSG_TYPE_CM_TABLES_META || - type == TSDB_MSG_TYPE_CM_SHOW ) + if (type == TSDB_MSG_TYPE_QUERY || type == TSDB_MSG_TYPE_CM_RETRIEVE + || type == TSDB_MSG_TYPE_FETCH || type == TSDB_MSG_TYPE_CM_STABLE_VGROUP + || type == TSDB_MSG_TYPE_CM_TABLES_META || type == TSDB_MSG_TYPE_CM_TABLE_META + || type == TSDB_MSG_TYPE_CM_SHOW ) pContext->connType = RPC_CONN_TCPC; rpcSendReqToServer(pRpc, pContext); @@ -1109,6 +1110,7 @@ static void rpcSendMsgToPeer(SRpcConn *pConn, void *msg, int msgLen) { htonl(pHead->code), msgLen, pHead->sourceId, pHead->destId, pHead->tranId); } + tTrace("connection type is: %d", pConn->connType); writtenLen = (*taosSendData[pConn->connType])(pConn->peerIp, pConn->peerPort, pHead, msgLen, pConn->chandle); if (writtenLen != msgLen) { diff --git a/tests/pytest/table/boundary.py b/tests/pytest/table/boundary.py new file mode 100644 index 0000000000..faa222231b --- /dev/null +++ b/tests/pytest/table/boundary.py @@ -0,0 +1,161 @@ +# -*- coding: utf-8 -*- + +import random +import string +import subprocess +import sys +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init( self, conn ): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + + def getLimitFromSourceCode( self, name ): + cmd = "grep -w '#define %s' ../../src/inc/taosdef.h|awk '{print $3}'" % name + return int(subprocess.check_output(cmd, shell=True)) + + + def generateString( self, length ): + chars = string.ascii_uppercase + string.ascii_lowercase + v = "" + for i in range( length ): + v += random.choice( chars ) + return v + + + def checkTagBoundaries( self ): + tdLog.debug( "checking tag boundaries" ) + tdSql.prepare() + + maxTags = self.getLimitFromSourceCode( 'TSDB_MAX_TAGS' ) + totalTagsLen = self.getLimitFromSourceCode( 'TSDB_MAX_TAGS_LEN' ) + tdLog.notice( "max tags is %d" % maxTags ) + tdLog.notice( "max total tag length is %d" % totalTagsLen ) + + # for binary tags, 2 bytes are used for length + tagLen = (totalTagsLen - maxTags * 2) // maxTags + firstTagLen = totalTagsLen - 2 * maxTags - tagLen * (maxTags - 1) + + sql = "create table cars(ts timestamp, f int) tags(t0 binary(%d)" % firstTagLen + for i in range( 1, maxTags ): + sql += ", t%d binary(%d)" % (i, tagLen) + sql += ");" + + tdLog.debug( "creating super table: " + sql ) + tdSql.execute( sql ) + tdSql.query( 'show stables' ) + tdSql.checkRows( 1 ) + + for i in range( 10 ): + sql = "create table car%d using cars tags('%d'" % (i, i) + sql += ", '0'" * (maxTags - 1) + ");" + tdLog.debug( "creating table: " + sql ) + tdSql.execute( sql ) + + sql = "insert into car%d values(now, 0);" % i + tdLog.debug( "inserting data: " + sql ) + tdSql.execute( sql ) + + tdSql.query( 'show tables' ) + tdLog.info( 'tdSql.checkRow(10)' ) + tdSql.checkRows( 10 ) + + tdSql.query( 'select * from cars;' ) + tdSql.checkRows( 10 ) + + + def checkColumnBoundaries( self ): + tdLog.debug( "checking column boundaries" ) + tdSql.prepare() + + # one column is for timestamp + maxCols = self.getLimitFromSourceCode( 'TSDB_MAX_COLUMNS' ) - 1 + + sql = "create table cars (ts timestamp" + for i in range( maxCols ): + sql += ", c%d int" % i + sql += ");" + tdSql.execute( sql ) + tdSql.query( 'show tables' ) + tdSql.checkRows( 1 ) + + sql = "insert into cars values (now" + for i in range( maxCols ): + sql += ", %d" % i + sql += ");" + tdSql.execute( sql ) + tdSql.query( 'select * from cars' ) + tdSql.checkRows( 1 ) + + + def checkTableNameBoundaries( self ): + tdLog.debug( "checking table name boundaries" ) + tdSql.prepare() + + maxTableNameLen = self.getLimitFromSourceCode( 'TSDB_TABLE_NAME_LEN' ) + tdLog.notice( "table name max length is %d" % maxTableNameLen ) + + name = self.generateString( maxTableNameLen - 1) + tdLog.info( "table name is '%s'" % name ) + + tdSql.execute( "create table %s (ts timestamp, value int)" % name ) + tdSql.execute( "insert into %s values(now, 0)" % name ) + + tdSql.query( 'show tables' ) + tdSql.checkRows( 1 ) + + tdSql.query( 'select * from %s' % name ) + tdSql.checkRows( 1 ) + + + def checkRowBoundaries( self ): + tdLog.debug( "checking row boundaries" ) + tdSql.prepare() + + # 8 bytes for timestamp + maxRowSize = 65536 - 8 + maxCols = self.getLimitFromSourceCode( 'TSDB_MAX_COLUMNS' ) - 1 + + # for binary cols, 2 bytes are used for length + colLen = (maxRowSize - maxCols * 2) // maxCols + firstColLen = maxRowSize - 2 * maxCols - colLen * (maxCols - 1) + + sql = "create table cars (ts timestamp, c0 binary(%d)" % firstColLen + for i in range( 1, maxCols ): + sql += ", c%d binary(%d)" % (i, colLen) + sql += ");" + tdSql.execute( sql ) + tdSql.query( 'show tables' ) + tdSql.checkRows( 1 ) + + col = self.generateString( firstColLen ) + sql = "insert into cars values (now, '%s'" % col + col = self.generateString( colLen ) + for i in range( 1, maxCols ): + sql += ", '%s'" % col + sql += ");" + tdLog.info( sql ); + tdSql.execute( sql ) + tdSql.query( "select * from cars" ) + tdSql.checkRows( 1 ) + + + def run(self): + self.checkTagBoundaries() + self.checkColumnBoundaries() + self.checkTableNameBoundaries() + self.checkRowBoundaries() + + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/table/tablename-boundary.py b/tests/pytest/table/tablename-boundary.py deleted file mode 100644 index fba1b2cf3c..0000000000 --- a/tests/pytest/table/tablename-boundary.py +++ /dev/null @@ -1,46 +0,0 @@ -# -*- coding: utf-8 -*- - -import sys -import string -import random -import subprocess -from util.log import * -from util.cases import * -from util.sql import * - - -class TDTestCase: - def init(self, conn): - tdLog.debug("start to execute %s" % __file__) - tdSql.init(conn.cursor()) - - def run(self): - tdSql.prepare() - - getTableNameLen = "grep -w '#define TSDB_TABLE_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" - tableNameMaxLen = int( - subprocess.check_output( - getTableNameLen, shell=True)) - tdLog.notice("table name max length is %d" % tableNameMaxLen) - chars = string.ascii_uppercase + string.ascii_lowercase - tb_name = ''.join(random.choices(chars, k=tableNameMaxLen)) - tdLog.info('tb_name length %d' % len(tb_name)) - tdLog.info('create table %s (ts timestamp, value int)' % tb_name) - tdSql.error( - 'create table %s (ts timestamp, speed binary(4089))' % - tb_name) - - tb_name = ''.join(random.choices(chars, k=191)) - tdLog.info('tb_name length %d' % len(tb_name)) - tdLog.info('create table %s (ts timestamp, value int)' % tb_name) - tdSql.execute( - 'create table %s (ts timestamp, speed binary(4089))' % - tb_name) - - def stop(self): - tdSql.close() - tdLog.success("%s successfully executed" % __file__) - - -tdCases.addWindows(__file__, TDTestCase()) -tdCases.addLinux(__file__, TDTestCase()) From 05a289d86631a0db53881bd0dc415f7ce5f1c251 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Sat, 16 May 2020 11:35:31 +0800 Subject: [PATCH 089/126] make failed msg friendly. --- tests/pytest/table/column_num.py | 2 +- tests/pytest/table/tablename-boundary.py | 2 +- tests/pytest/util/cases.py | 2 +- tests/pytest/util/sql.py | 68 +++++++++++++++--------- 4 files changed, 47 insertions(+), 27 deletions(-) diff --git a/tests/pytest/table/column_num.py b/tests/pytest/table/column_num.py index 486541bab7..877f0409dc 100644 --- a/tests/pytest/table/column_num.py +++ b/tests/pytest/table/column_num.py @@ -76,7 +76,7 @@ class TDTestCase: tdSql.checkRows(2) data = "now" - for x in range(0, boundary-1): + for x in range(0, boundary - 1): data = data + ", %d" % x tdLog.info("insert into tb1 values (%s)" % data) tdSql.execute("insert into tb1 values (%s)" % data) diff --git a/tests/pytest/table/tablename-boundary.py b/tests/pytest/table/tablename-boundary.py index fba1b2cf3c..335073065c 100644 --- a/tests/pytest/table/tablename-boundary.py +++ b/tests/pytest/table/tablename-boundary.py @@ -21,7 +21,7 @@ class TDTestCase: tableNameMaxLen = int( subprocess.check_output( getTableNameLen, shell=True)) - tdLog.notice("table name max length is %d" % tableNameMaxLen) + tdLog.info("table name max length is %d" % tableNameMaxLen) chars = string.ascii_uppercase + string.ascii_lowercase tb_name = ''.join(random.choices(chars, k=tableNameMaxLen)) tdLog.info('tb_name length %d' % len(tb_name)) diff --git a/tests/pytest/util/cases.py b/tests/pytest/util/cases.py index 9026cd0f2f..f65b0dfde3 100644 --- a/tests/pytest/util/cases.py +++ b/tests/pytest/util/cases.py @@ -71,7 +71,7 @@ class TDCases: case.run() except Exception as e: tdLog.notice(repr(e)) - tdLog.exit("%s failed: %s" % (__file__, fileName)) + tdLog.exit("%s failed" % (fileName)) case.stop() runNum += 1 continue diff --git a/tests/pytest/util/sql.py b/tests/pytest/util/sql.py index 0e7e186206..75f3bd9044 100644 --- a/tests/pytest/util/sql.py +++ b/tests/pytest/util/sql.py @@ -15,6 +15,7 @@ import sys import os import time import datetime +import inspect from util.log import * @@ -44,7 +45,12 @@ class TDSql: except BaseException: expectErrNotOccured = False if expectErrNotOccured: - tdLog.exit("failed: sql:%.40s, expect error not occured" % (sql)) + frame = inspect.stack()[1] + callerModule = inspect.getmodule(frame[0]) + callerFilename = callerModule.__file__ + tdLog.exit( + "%s failed: sql:%.40s, expect error not occured" % + (callerFilename, sql)) else: tdLog.info("sql:%.40s, expect error occured" % (sql)) @@ -62,33 +68,39 @@ class TDSql: def checkRows(self, expectRows): if self.queryRows != expectRows: + frame = inspect.stack()[1] + callerModule = inspect.getmodule(frame[0]) + callerFilename = callerModule.__file__ tdLog.exit( - "failed: sql:%.40s, queryRows:%d != expect:%d" % - (self.sql, self.queryRows, expectRows)) + "%s failed: sql:%.40s, queryRows:%d != expect:%d" % + (callerFilename, self.sql, self.queryRows, expectRows)) tdLog.info("sql:%.40s, queryRows:%d == expect:%d" % (self.sql, self.queryRows, expectRows)) def checkData(self, row, col, data): + frame = inspect.stack()[1] + callerModule = inspect.getmodule(frame[0]) + callerFilename = callerModule.__file__ + if row < 0: tdLog.exit( - "failed: sql:%.40s, row:%d is smaller than zero" % - (self.sql, row)) + "%s failed: sql:%.40s, row:%d is smaller than zero" % + (callerFilename, self.sql, row)) if col < 0: tdLog.exit( - "failed: sql:%.40s, col:%d is smaller than zero" % - (self.sql, col)) + "%s failed: sql:%.40s, col:%d is smaller than zero" % + (callerFilename, self.sql, col)) if row >= self.queryRows: tdLog.exit( - "failed: sql:%.40s, row:%d is larger than queryRows:%d" % - (self.sql, row, self.queryRows)) + "%s failed: sql:%.40s, row:%d is larger than queryRows:%d" % + (callerFilename, self.sql, row, self.queryRows)) if col >= self.queryCols: tdLog.exit( - "failed: sql:%.40s, col:%d is larger than queryRows:%d" % - (self.sql, col, self.queryCols)) + "%s failed: sql:%.40s, col:%d is larger than queryRows:%d" % + (callerFilename, self.sql, col, self.queryCols)) if self.queryResult[row][col] != data: - tdLog.exit( - "failed: sql:%.40s row:%d col:%d data:%s != expect:%s" % - (self.sql, row, col, self.queryResult[row][col], data)) + tdLog.exit("%s failed: sql:%.40s row:%d col:%d data:%s != expect:%s" % ( + callerFilename, self.sql, row, col, self.queryResult[row][col], data)) if data is None: tdLog.info("sql:%.40s, row:%d col:%d data:%s == expect:%s" % @@ -104,22 +116,26 @@ class TDSql: (self.sql, row, col, self.queryResult[row][col], data)) def getData(self, row, col): + frame = inspect.stack()[1] + callerModule = inspect.getmodule(frame[0]) + callerFilename = callerModule.__file__ + if row < 0: tdLog.exit( - "failed: sql:%.40s, row:%d is smaller than zero" % - (self.sql, row)) + "%s failed: sql:%.40s, row:%d is smaller than zero" % + (callerFilename, self.sql, row)) if col < 0: tdLog.exit( - "failed: sql:%.40s, col:%d is smaller than zero" % - (self.sql, col)) + "%s failed: sql:%.40s, col:%d is smaller than zero" % + (callerFilename, self.sql, col)) if row >= self.queryRows: tdLog.exit( - "failed: sql:%.40s, row:%d is larger than queryRows:%d" % - (self.sql, row, self.queryRows)) + "%s failed: sql:%.40s, row:%d is larger than queryRows:%d" % + (callerFilename, self.sql, row, self.queryRows)) if col >= self.queryCols: tdLog.exit( - "failed: sql:%.40s, col:%d is larger than queryRows:%d" % - (self.sql, col, self.queryCols)) + "%s failed: sql:%.40s, col:%d is larger than queryRows:%d" % + (callerFilename, self.sql, col, self.queryCols)) return self.queryResult[row][col] def executeTimes(self, sql, times): @@ -137,8 +153,12 @@ class TDSql: def checkAffectedRows(self, expectAffectedRows): if self.affectedRows != expectAffectedRows: - tdLog.exit("failed: sql:%.40s, affectedRows:%d != expect:%d" % - (self.sql, self.affectedRows, expectAffectedRows)) + frame = inspect.stack()[1] + callerModule = inspect.getmodule(frame[0]) + callerFilename = callerModule.__file__ + + tdLog.exit("%s failed: sql:%.40s, affectedRows:%d != expect:%d" % ( + callerFilename, self.sql, self.affectedRows, expectAffectedRows)) tdLog.info("sql:%.40s, affectedRows:%d == expect:%d" % (self.sql, self.affectedRows, expectAffectedRows)) From 94f4e9bb3875c3d9f649c977600a852d67475f92 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Sat, 16 May 2020 15:23:59 +0800 Subject: [PATCH 090/126] add column name length case. --- tests/pytest/table/column_name.py | 91 +++++++------------------------ 1 file changed, 19 insertions(+), 72 deletions(-) diff --git a/tests/pytest/table/column_name.py b/tests/pytest/table/column_name.py index bb1f587a65..aa958fd60c 100644 --- a/tests/pytest/table/column_name.py +++ b/tests/pytest/table/column_name.py @@ -1,6 +1,9 @@ # -*- coding: utf-8 -*- import sys +import string +import random +import subprocess from util.log import * from util.cases import * from util.sql import * @@ -14,34 +17,9 @@ class TDTestCase: def run(self): tdSql.prepare() - # TSIM: system sh/stop_dnodes.sh - # TSIM: - # TSIM: system sh/ip.sh -i 1 -s up - # TSIM: system sh/deploy.sh -n dnode1 -m 192.168.0.1 -i 192.168.0.1 - # TSIM: system sh/cfg.sh -n dnode1 -c walLevel -v 0 - # TSIM: system sh/exec.sh -n dnode1 -s start - # TSIM: - # TSIM: sleep 3000 - # TSIM: sql connect - # TSIM: - # TSIM: $i = 0 - # TSIM: $dbPrefix = lm_cm_db - # TSIM: $tbPrefix = lm_cm_tb - # TSIM: $db = $dbPrefix . $i - # TSIM: $tb = $tbPrefix . $i - # TSIM: - # TSIM: print =============== step1 tdLog.info('=============== step1') - # TSIM: sql create database $db - # TSIM: sql use $db - # TSIM: - # TSIM: sql drop table dd -x step0 tdLog.info('drop table dd -x step0') tdSql.error('drop table dd') - # TSIM: return -1 - # TSIM: step0: - # TSIM: - # TSIM: sql create table $tb(ts timestamp, int) -x step1 tdLog.info('create table tb(ts timestamp, int) -x step1') tdSql.error('create table tb(ts timestamp, int)') # TSIM: return -1 @@ -112,37 +90,24 @@ class TDTestCase: tdLog.info('=============== step4') # TSIM: sql create table $tb (ts timestamp, # a0123456789012345678901234567890123456789 int) + getMaxColNum = "grep -w '#define TSDB_COL_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" + boundary = int(subprocess.check_output(getMaxColNum, shell=True)) + tdLog.info("get max column name length is %d" % boundary) + chars = string.ascii_uppercase + string.ascii_lowercase + +# col_name = ''.join(random.choices(chars, k=boundary+1)) +# tdLog.info( +# 'create table tb (ts timestamp, %s int), col_name length is %d' % (col_name, len(col_name))) +# tdSql.error( +# 'create table tb (ts timestamp, %s int)' % col_name) + + col_name = ''.join(random.choices(chars, k=boundary)) tdLog.info( - 'create table tb (ts timestamp, a0123456789012345678901234567890123456789 int)') + 'create table tb (ts timestamp, %s int), col_name length is %d' % + (col_name, len(col_name))) tdSql.execute( - 'create table tb (ts timestamp, a0123456789012345678901234567890123456789 int)') - # TSIM: sql drop table $tb - tdLog.info('drop table tb') - tdSql.execute('drop table tb') - # TSIM: - # TSIM: sql show tables - tdLog.info('show tables') - tdSql.query('show tables') - # TSIM: if $rows != 0 then - tdLog.info('tdSql.checkRow(0)') - tdSql.checkRows(0) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: print =============== step5 - tdLog.info('=============== step5') - # TSIM: sql create table $tb (ts timestamp, a0123456789 int) - tdLog.info('create table tb (ts timestamp, a0123456789 int)') - tdSql.execute('create table tb (ts timestamp, a0123456789 int)') - # TSIM: sql show tables - tdLog.info('show tables') - tdSql.query('show tables') - # TSIM: if $rows != 1 then - tdLog.info('tdSql.checkRow(1)') - tdSql.checkRows(1) - # TSIM: return -1 - # TSIM: endi - # TSIM: + 'create table tb (ts timestamp, %s int)' % col_name) + # TSIM: sql insert into $tb values (now , 1) tdLog.info("insert into tb values (now , 1)") tdSql.execute("insert into tb values (now , 1)") @@ -152,24 +117,6 @@ class TDTestCase: # TSIM: if $rows != 1 then tdLog.info('tdSql.checkRow(1)') tdSql.checkRows(1) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: sql drop database $db - tdLog.info('drop database db') - tdSql.execute('drop database db') - # TSIM: sql show databases - tdLog.info('show databases') - tdSql.query('show databases') - # TSIM: if $rows != 0 then - tdLog.info('tdSql.checkRow(0)') - tdSql.checkRows(0) - # TSIM: return -1 - # TSIM: endi - # TSIM: - # TSIM: - # TSIM: - # TSIM: # convert end def stop(self): From bd42e71513aa3490a8fc72f446cfff01f4de1861 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Sat, 16 May 2020 16:15:58 +0800 Subject: [PATCH 091/126] The table name stored in mnode is changed to a variable-length string --- src/inc/taosdef.h | 2 +- src/mnode/inc/mgmtDef.h | 2 +- src/mnode/inc/mgmtSdb.h | 3 +- src/mnode/src/mgmtSdb.c | 137 ++++++++++++++++++++++---------------- src/mnode/src/mgmtTable.c | 127 ++++++++++++++++++++++------------- src/tsdb/src/tsdbMeta.c | 2 +- 6 files changed, 164 insertions(+), 109 deletions(-) diff --git a/src/inc/taosdef.h b/src/inc/taosdef.h index 5dad1bdb53..943fb9e249 100644 --- a/src/inc/taosdef.h +++ b/src/inc/taosdef.h @@ -236,7 +236,7 @@ void tsDataSwap(void *pLeft, void *pRight, int32_t type, int32_t size); #define TSDB_PAYLOAD_SIZE (TSDB_DEFAULT_PKT_SIZE - 100) #define TSDB_DEFAULT_PAYLOAD_SIZE 1024 // default payload size #define TSDB_EXTRA_PAYLOAD_SIZE 128 // extra bytes for auth -#define TSDB_SQLCMD_SIZE 1024 +#define TSDB_CQ_SQL_SIZE 1024 #define TSDB_MAX_VNODES 256 #define TSDB_MIN_VNODES 50 #define TSDB_INVALID_VNODE_NUM 0 diff --git a/src/mnode/inc/mgmtDef.h b/src/mnode/inc/mgmtDef.h index f33531583a..894ee87099 100644 --- a/src/mnode/inc/mgmtDef.h +++ b/src/mnode/inc/mgmtDef.h @@ -68,7 +68,7 @@ typedef struct SMnodeObj { // todo use dynamic length string typedef struct { - char tableId[TSDB_TABLE_ID_LEN + 1]; + char *tableId; int8_t type; } STableObj; diff --git a/src/mnode/inc/mgmtSdb.h b/src/mnode/inc/mgmtSdb.h index a97b1219a9..975206d52e 100644 --- a/src/mnode/inc/mgmtSdb.h +++ b/src/mnode/inc/mgmtSdb.h @@ -35,7 +35,8 @@ typedef enum { typedef enum { SDB_KEY_STRING, SDB_KEY_INT, - SDB_KEY_AUTO + SDB_KEY_AUTO, + SDB_KEY_VAR_STRING, } ESdbKey; typedef enum { diff --git a/src/mnode/src/mgmtSdb.c b/src/mnode/src/mgmtSdb.c index c0d389f305..087c84effd 100644 --- a/src/mnode/src/mgmtSdb.c +++ b/src/mnode/src/mgmtSdb.c @@ -104,6 +104,14 @@ bool sdbIsServing() { return tsSdbObj.status == SDB_STATUS_SERVING; } +static void *sdbGetObjKey(SSdbTable *pTable, void *key) { + if (pTable->keyType == SDB_KEY_VAR_STRING) { + return *(char **)key; + } + + return key; +} + static char *sdbGetActionStr(int32_t action) { switch (action) { case SDB_ACTION_INSERT: @@ -116,20 +124,25 @@ static char *sdbGetActionStr(int32_t action) { return "invalid"; } -static char *sdbGetkeyStr(SSdbTable *pTable, void *row) { +static char *sdbGetKeyStr(SSdbTable *pTable, void *key) { static char str[16]; switch (pTable->keyType) { case SDB_KEY_STRING: - return (char *)row; + case SDB_KEY_VAR_STRING: + return (char *)key; case SDB_KEY_INT: case SDB_KEY_AUTO: - sprintf(str, "%d", *(int32_t *)row); + sprintf(str, "%d", *(int32_t *)key); return str; default: return "invalid"; } } +static char *sdbGetKeyStrFromObj(SSdbTable *pTable, void *key) { + return sdbGetKeyStr(pTable, sdbGetObjKey(pTable, key)); +} + static void *sdbGetTableFromId(int32_t tableId) { return tsSdbObj.tableList[tableId]; } @@ -332,50 +345,48 @@ void sdbCleanUp() { pthread_mutex_destroy(&tsSdbObj.mutex); } -void sdbIncRef(void *handle, void *pRow) { - if (pRow) { - SSdbTable *pTable = handle; - int32_t * pRefCount = (int32_t *)(pRow + pTable->refCountPos); - atomic_add_fetch_32(pRefCount, 1); - if (0 && (pTable->tableId == SDB_TABLE_MNODE || pTable->tableId == SDB_TABLE_DNODE)) { - sdbTrace("table:%s, add ref to record:%s:%s:%d", pTable->tableName, pTable->tableName, sdbGetkeyStr(pTable, pRow), - *pRefCount); - } +void sdbIncRef(void *handle, void *pObj) { + if (pObj == NULL) return; + + SSdbTable *pTable = handle; + int32_t * pRefCount = (int32_t *)(pObj + pTable->refCountPos); + atomic_add_fetch_32(pRefCount, 1); + if (0 && (pTable->tableId == SDB_TABLE_MNODE || pTable->tableId == SDB_TABLE_DNODE)) { + sdbTrace("table:%s, add ref to record:%s:%d", pTable->tableName, sdbGetKeyStrFromObj(pTable, pObj), *pRefCount); } } -void sdbDecRef(void *handle, void *pRow) { - if (pRow) { - SSdbTable *pTable = handle; - int32_t * pRefCount = (int32_t *)(pRow + pTable->refCountPos); - int32_t refCount = atomic_sub_fetch_32(pRefCount, 1); - if (0 && (pTable->tableId == SDB_TABLE_MNODE || pTable->tableId == SDB_TABLE_DNODE)) { - sdbTrace("table:%s, def ref of record:%s:%s:%d", pTable->tableName, pTable->tableName, sdbGetkeyStr(pTable, pRow), - *pRefCount); - } - int8_t *updateEnd = pRow + pTable->refCountPos - 1; - if (refCount <= 0 && *updateEnd) { - sdbTrace("table:%s, record:%s:%s:%d is destroyed", pTable->tableName, pTable->tableName, - sdbGetkeyStr(pTable, pRow), *pRefCount); - SSdbOper oper = {.pObj = pRow}; - (*pTable->destroyFp)(&oper); - } +void sdbDecRef(void *handle, void *pObj) { + if (pObj == NULL) return; + + SSdbTable *pTable = handle; + int32_t * pRefCount = (int32_t *)(pObj + pTable->refCountPos); + int32_t refCount = atomic_sub_fetch_32(pRefCount, 1); + if (0 && (pTable->tableId == SDB_TABLE_MNODE || pTable->tableId == SDB_TABLE_DNODE)) { + sdbTrace("table:%s, def ref of record:%s:%d", pTable->tableName, sdbGetKeyStrFromObj(pTable, pObj), *pRefCount); + } + + int8_t *updateEnd = pObj + pTable->refCountPos - 1; + if (refCount <= 0 && *updateEnd) { + sdbTrace("table:%s, record:%s:%d is destroyed", pTable->tableName, sdbGetKeyStrFromObj(pTable, pObj), *pRefCount); + SSdbOper oper = {.pObj = pObj}; + (*pTable->destroyFp)(&oper); } } -static SSdbRow *sdbGetRowMeta(void *handle, void *key) { - SSdbTable *pTable = (SSdbTable *)handle; - SSdbRow * pMeta; - - if (handle == NULL) return NULL; +static SSdbRow *sdbGetRowMeta(SSdbTable *pTable, void *key) { + if (pTable == NULL) return NULL; int32_t keySize = sizeof(int32_t); - if (pTable->keyType == SDB_KEY_STRING) { + if (pTable->keyType == SDB_KEY_STRING || pTable->keyType == SDB_KEY_VAR_STRING) { keySize = strlen((char *)key); } - pMeta = taosHashGet(pTable->iHandle, key, keySize); + + return taosHashGet(pTable->iHandle, key, keySize); +} - return pMeta; +static SSdbRow *sdbGetRowMetaFromObj(SSdbTable *pTable, void *key) { + return sdbGetRowMeta(pTable, sdbGetObjKey(pTable, key)); } void *sdbGetRow(void *handle, void *key) { @@ -387,7 +398,7 @@ void *sdbGetRow(void *handle, void *key) { pthread_mutex_lock(&pTable->mutex); int32_t keySize = sizeof(int32_t); - if (pTable->keyType == SDB_KEY_STRING) { + if (pTable->keyType == SDB_KEY_STRING || pTable->keyType == SDB_KEY_VAR_STRING) { keySize = strlen((char *)key); } pMeta = taosHashGet(pTable->iHandle, key, keySize); @@ -400,6 +411,10 @@ void *sdbGetRow(void *handle, void *key) { return pMeta->row; } +static void *sdbGetRowFromObj(SSdbTable *pTable, void *key) { + return sdbGetRow(pTable, sdbGetObjKey(pTable, key)); +} + static int32_t sdbInsertHash(SSdbTable *pTable, SSdbOper *pOper) { SSdbRow rowMeta; rowMeta.rowSize = pOper->rowSize; @@ -407,11 +422,14 @@ static int32_t sdbInsertHash(SSdbTable *pTable, SSdbOper *pOper) { pthread_mutex_lock(&pTable->mutex); + void * key = sdbGetObjKey(pTable, pOper->pObj); int32_t keySize = sizeof(int32_t); - if (pTable->keyType == SDB_KEY_STRING) { - keySize = strlen((char *)pOper->pObj); + + if (pTable->keyType == SDB_KEY_STRING || pTable->keyType == SDB_KEY_VAR_STRING) { + keySize = strlen((char *)key); } - taosHashPut(pTable->iHandle, pOper->pObj, keySize, &rowMeta, sizeof(SSdbRow)); + + taosHashPut(pTable->iHandle, key, keySize, &rowMeta, sizeof(SSdbRow)); sdbIncRef(pTable, pOper->pObj); pTable->numOfRows++; @@ -425,7 +443,7 @@ static int32_t sdbInsertHash(SSdbTable *pTable, SSdbOper *pOper) { pthread_mutex_unlock(&pTable->mutex); sdbTrace("table:%s, insert record:%s to hash, numOfRows:%d version:%" PRIu64, pTable->tableName, - sdbGetkeyStr(pTable, pOper->pObj), pTable->numOfRows, sdbGetVersion()); + sdbGetKeyStrFromObj(pTable, pOper->pObj), pTable->numOfRows, sdbGetVersion()); (*pTable->insertFp)(pOper); return TSDB_CODE_SUCCESS; @@ -436,17 +454,20 @@ static int32_t sdbDeleteHash(SSdbTable *pTable, SSdbOper *pOper) { pthread_mutex_lock(&pTable->mutex); + void * key = sdbGetObjKey(pTable, pOper->pObj); int32_t keySize = sizeof(int32_t); - if (pTable->keyType == SDB_KEY_STRING) { - keySize = strlen((char *)pOper->pObj); + + if (pTable->keyType == SDB_KEY_STRING || pTable->keyType == SDB_KEY_VAR_STRING) { + keySize = strlen((char *)key); } - taosHashRemove(pTable->iHandle, pOper->pObj, keySize); + + taosHashRemove(pTable->iHandle, key, keySize); pTable->numOfRows--; pthread_mutex_unlock(&pTable->mutex); sdbTrace("table:%s, delete record:%s from hash, numOfRows:%d version:%" PRIu64, pTable->tableName, - sdbGetkeyStr(pTable, pOper->pObj), pTable->numOfRows, sdbGetVersion()); + sdbGetKeyStrFromObj(pTable, pOper->pObj), pTable->numOfRows, sdbGetVersion()); int8_t *updateEnd = pOper->pObj + pTable->refCountPos - 1; *updateEnd = 1; @@ -457,7 +478,7 @@ static int32_t sdbDeleteHash(SSdbTable *pTable, SSdbOper *pOper) { static int32_t sdbUpdateHash(SSdbTable *pTable, SSdbOper *pOper) { sdbTrace("table:%s, update record:%s in hash, numOfRows:%d version:%" PRIu64, pTable->tableName, - sdbGetkeyStr(pTable, pOper->pObj), pTable->numOfRows, sdbGetVersion()); + sdbGetKeyStrFromObj(pTable, pOper->pObj), pTable->numOfRows, sdbGetVersion()); (*pTable->updateFp)(pOper); return TSDB_CODE_SUCCESS; @@ -488,7 +509,7 @@ static int sdbWrite(void *param, void *data, int type) { } else if (pHead->version != tsSdbObj.version + 1) { pthread_mutex_unlock(&tsSdbObj.mutex); sdbError("table:%s, failed to restore %s record:%s from wal, version:%" PRId64 " too large, sdb version:%" PRId64, - pTable->tableName, sdbGetActionStr(action), sdbGetkeyStr(pTable, pHead->cont), pHead->version, + pTable->tableName, sdbGetActionStr(action), sdbGetKeyStr(pTable, pHead->cont), pHead->version, tsSdbObj.version); return TSDB_CODE_OTHERS; } else { @@ -540,8 +561,8 @@ int32_t sdbInsertRow(SSdbOper *pOper) { SSdbTable *pTable = (SSdbTable *)pOper->table; if (pTable == NULL) return -1; - if (sdbGetRow(pTable, pOper->pObj)) { - sdbError("table:%s, failed to insert record:%s, already exist", pTable->tableName, sdbGetkeyStr(pTable, pOper->pObj)); + if (sdbGetRowFromObj(pTable, pOper->pObj)) { + sdbError("table:%s, failed to insert record:%s, already exist", pTable->tableName, sdbGetKeyStrFromObj(pTable, pOper->pObj)); sdbDecRef(pTable, pOper->pObj); return TSDB_CODE_ALREADY_THERE; } @@ -580,7 +601,7 @@ int32_t sdbDeleteRow(SSdbOper *pOper) { SSdbTable *pTable = (SSdbTable *)pOper->table; if (pTable == NULL) return -1; - SSdbRow *pMeta = sdbGetRowMeta(pTable, pOper->pObj); + SSdbRow *pMeta = sdbGetRowMetaFromObj(pTable, pOper->pObj); if (pMeta == NULL) { sdbTrace("table:%s, record is not there, delete failed", pTable->tableName); return -1; @@ -590,25 +611,27 @@ int32_t sdbDeleteRow(SSdbOper *pOper) { assert(pMetaRow != NULL); if (pOper->type == SDB_OPER_GLOBAL) { - int32_t rowSize = 0; + void * key = sdbGetObjKey(pTable, pOper->pObj); + int32_t keySize = 0; switch (pTable->keyType) { case SDB_KEY_STRING: - rowSize = strlen((char *)pOper->pObj) + 1; + case SDB_KEY_VAR_STRING: + keySize = strlen((char *)key) + 1; break; case SDB_KEY_INT: case SDB_KEY_AUTO: - rowSize = sizeof(uint64_t); + keySize = sizeof(uint32_t); break; default: return -1; } - int32_t size = sizeof(SWalHead) + rowSize; + int32_t size = sizeof(SWalHead) + keySize; SWalHead *pHead = taosAllocateQitem(size); pHead->version = 0; - pHead->len = rowSize; + pHead->len = keySize; pHead->msgType = pTable->tableId * 10 + SDB_ACTION_DELETE; - memcpy(pHead->cont, pOper->pObj, rowSize); + memcpy(pHead->cont, key, keySize); int32_t code = sdbWrite(pOper, pHead, pHead->msgType); taosFreeQitem(pHead); @@ -622,7 +645,7 @@ int32_t sdbUpdateRow(SSdbOper *pOper) { SSdbTable *pTable = (SSdbTable *)pOper->table; if (pTable == NULL) return -1; - SSdbRow *pMeta = sdbGetRowMeta(pTable, pOper->pObj); + SSdbRow *pMeta = sdbGetRowMetaFromObj(pTable, pOper->pObj); if (pMeta == NULL) { sdbTrace("table:%s, record is not there, delete failed", pTable->tableName); return -1; diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index 3e3b16fa9d..28b3c6e3dd 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -84,6 +84,7 @@ static void mgmtProcessAlterTableRsp(SRpcMsg *rpcMsg); static int32_t mgmtFindSuperTableColumnIndex(SSuperTableObj *pStable, char *colName); static void mgmtDestroyChildTable(SChildTableObj *pTable) { + tfree(pTable->info.tableId); tfree(pTable->schema); tfree(pTable->sql); tfree(pTable); @@ -180,6 +181,7 @@ static int32_t mgmtChildTableActionUpdate(SSdbOper *pOper) { SChildTableObj *pNew = pOper->pObj; SChildTableObj *pTable = mgmtGetChildTable(pNew->info.tableId); if (pTable != pNew) { + void *oldTableId = pTable->info.tableId; void *oldSql = pTable->sql; void *oldSchema = pTable->schema; memcpy(pTable, pNew, pOper->rowSize); @@ -188,6 +190,7 @@ static int32_t mgmtChildTableActionUpdate(SSdbOper *pOper) { free(pNew); free(oldSql); free(oldSchema); + free(oldTableId); } mgmtDecTableRef(pTable); @@ -195,51 +198,66 @@ static int32_t mgmtChildTableActionUpdate(SSdbOper *pOper) { } static int32_t mgmtChildTableActionEncode(SSdbOper *pOper) { - const int32_t maxRowSize = sizeof(SChildTableObj) + sizeof(SSchema) * (TSDB_MAX_TAGS + TSDB_MAX_COLUMNS + 16); SChildTableObj *pTable = pOper->pObj; assert(pTable != NULL && pOper->rowData != NULL); - if (pTable->info.type == TSDB_CHILD_TABLE) { - memcpy(pOper->rowData, pTable, tsChildTableUpdateSize); - pOper->rowSize = tsChildTableUpdateSize; - } else { + int32_t len = strlen(pTable->info.tableId); + if (len > TSDB_TABLE_ID_LEN) return TSDB_CODE_INVALID_TABLE_ID; + + memcpy(pOper->rowData, pTable->info.tableId, len); + memset(pOper->rowData + len, 0, 1); + len++; + + memcpy(pOper->rowData + len, (char*)pTable + sizeof(char *), tsChildTableUpdateSize); + len += tsChildTableUpdateSize; + + if (pTable->info.type != TSDB_CHILD_TABLE) { int32_t schemaSize = pTable->numOfColumns * sizeof(SSchema); - if (maxRowSize < tsChildTableUpdateSize + schemaSize) { - return TSDB_CODE_INVALID_MSG_LEN; + memcpy(pOper->rowData + len, pTable->schema, schemaSize); + len += schemaSize; + + if (pTable->sqlLen != 0) { + memcpy(pOper->rowData + len, pTable->sql, pTable->sqlLen); + len += pTable->sqlLen; } - memcpy(pOper->rowData, pTable, tsChildTableUpdateSize); - memcpy(pOper->rowData + tsChildTableUpdateSize, pTable->schema, schemaSize); - memcpy(pOper->rowData + tsChildTableUpdateSize + schemaSize, pTable->sql, pTable->sqlLen); - pOper->rowSize = tsChildTableUpdateSize + schemaSize + pTable->sqlLen; } + pOper->rowSize = len; + return TSDB_CODE_SUCCESS; } static int32_t mgmtChildTableActionDecode(SSdbOper *pOper) { assert(pOper->rowData != NULL); SChildTableObj *pTable = calloc(1, sizeof(SChildTableObj)); - if (pTable == NULL) { - return TSDB_CODE_SERV_OUT_OF_MEMORY; - } + if (pTable == NULL) return TSDB_CODE_SERV_OUT_OF_MEMORY; - memcpy(pTable, pOper->rowData, tsChildTableUpdateSize); + int32_t len = strlen(pOper->rowData); + if (len > TSDB_TABLE_ID_LEN) return TSDB_CODE_INVALID_TABLE_ID; + pTable->info.tableId = strdup(pOper->rowData); + len++; + + memcpy((char*)pTable + sizeof(char *), pOper->rowData + len, tsChildTableUpdateSize); + len += tsChildTableUpdateSize; if (pTable->info.type != TSDB_CHILD_TABLE) { int32_t schemaSize = pTable->numOfColumns * sizeof(SSchema); pTable->schema = (SSchema *)malloc(schemaSize); if (pTable->schema == NULL) { mgmtDestroyChildTable(pTable); - return TSDB_CODE_SERV_OUT_OF_MEMORY; + return TSDB_CODE_INVALID_TABLE_TYPE; } - memcpy(pTable->schema, pOper->rowData + tsChildTableUpdateSize, schemaSize); + memcpy(pTable->schema, pOper->rowData + len, schemaSize); + len += schemaSize; - pTable->sql = (char *)malloc(pTable->sqlLen); - if (pTable->sql == NULL) { - mgmtDestroyChildTable(pTable); - return TSDB_CODE_SERV_OUT_OF_MEMORY; + if (pTable->sqlLen != 0) { + pTable->sql = malloc(pTable->sqlLen); + if (pTable->sql == NULL) { + mgmtDestroyChildTable(pTable); + return TSDB_CODE_SERV_OUT_OF_MEMORY; + } + memcpy(pTable->sql, pOper->rowData + len, pTable->sqlLen); } - memcpy(pTable->sql, pOper->rowData + tsChildTableUpdateSize + schemaSize, pTable->sqlLen); } pOper->pObj = pTable; @@ -311,15 +329,15 @@ static int32_t mgmtChildTableActionRestored() { static int32_t mgmtInitChildTables() { SChildTableObj tObj; - tsChildTableUpdateSize = (int8_t *)tObj.updateEnd - (int8_t *)&tObj; + tsChildTableUpdateSize = (int8_t *)tObj.updateEnd - (int8_t *)&tObj.info.type; SSdbTableDesc tableDesc = { .tableId = SDB_TABLE_CTABLE, .tableName = "ctables", .hashSessions = tsMaxTables, - .maxRowSize = sizeof(SChildTableObj) + sizeof(SSchema) * (TSDB_MAX_TAGS + TSDB_MAX_COLUMNS + 16), + .maxRowSize = sizeof(SChildTableObj) + sizeof(SSchema) * (TSDB_MAX_TAGS + TSDB_MAX_COLUMNS + 16) + TSDB_TABLE_ID_LEN + TSDB_CQ_SQL_SIZE, .refCountPos = (int8_t *)(&tObj.refCount) - (int8_t *)&tObj, - .keyType = SDB_KEY_STRING, + .keyType = SDB_KEY_VAR_STRING, .insertFp = mgmtChildTableActionInsert, .deleteFp = mgmtChildTableActionDelete, .updateFp = mgmtChildTableActionUpdate, @@ -372,6 +390,7 @@ static void mgmtDestroySuperTable(SSuperTableObj *pStable) { taosHashCleanup(pStable->vgHash); pStable->vgHash = NULL; } + tfree(pStable->info.tableId); tfree(pStable->schema); tfree(pStable); } @@ -408,11 +427,13 @@ static int32_t mgmtSuperTableActionUpdate(SSdbOper *pOper) { SSuperTableObj *pNew = pOper->pObj; SSuperTableObj *pTable = mgmtGetSuperTable(pNew->info.tableId); if (pTable != pNew) { + void *oldTableId = pTable->info.tableId; void *oldSchema = pTable->schema; memcpy(pTable, pNew, pOper->rowSize); pTable->schema = pNew->schema; free(pNew->vgHash); free(pNew); + free(oldTableId); free(oldSchema); } mgmtDecTableRef(pTable); @@ -420,40 +441,50 @@ static int32_t mgmtSuperTableActionUpdate(SSdbOper *pOper) { } static int32_t mgmtSuperTableActionEncode(SSdbOper *pOper) { - const int32_t maxRowSize = sizeof(SChildTableObj) + sizeof(SSchema) * (TSDB_MAX_TAGS + TSDB_MAX_COLUMNS + 16); - SSuperTableObj *pStable = pOper->pObj; assert(pOper->pObj != NULL && pOper->rowData != NULL); + int32_t len = strlen(pStable->info.tableId); + if (len > TSDB_TABLE_ID_LEN) len = TSDB_CODE_INVALID_TABLE_ID; + + memcpy(pOper->rowData, pStable->info.tableId, len); + memset(pOper->rowData + len, 0, 1); + len++; + + memcpy(pOper->rowData + len, (char*)pStable + sizeof(char *), tsSuperTableUpdateSize); + len += tsSuperTableUpdateSize; + int32_t schemaSize = sizeof(SSchema) * (pStable->numOfColumns + pStable->numOfTags); + memcpy(pOper->rowData + len, pStable->schema, schemaSize); + len += schemaSize; - if (maxRowSize < tsSuperTableUpdateSize + schemaSize) { - return TSDB_CODE_INVALID_MSG_LEN; - } - - memcpy(pOper->rowData, pStable, tsSuperTableUpdateSize); - memcpy(pOper->rowData + tsSuperTableUpdateSize, pStable->schema, schemaSize); - pOper->rowSize = tsSuperTableUpdateSize + schemaSize; + pOper->rowSize = len; return TSDB_CODE_SUCCESS; } static int32_t mgmtSuperTableActionDecode(SSdbOper *pOper) { assert(pOper->rowData != NULL); - SSuperTableObj *pStable = (SSuperTableObj *) calloc(1, sizeof(SSuperTableObj)); if (pStable == NULL) return TSDB_CODE_SERV_OUT_OF_MEMORY; - memcpy(pStable, pOper->rowData, tsSuperTableUpdateSize); + int32_t len = strlen(pOper->rowData); + if (len > TSDB_TABLE_ID_LEN) return TSDB_CODE_INVALID_TABLE_ID; + pStable->info.tableId = strdup(pOper->rowData); + len++; + + memcpy((char*)pStable + sizeof(char *), pOper->rowData + len, tsSuperTableUpdateSize); + len += tsSuperTableUpdateSize; int32_t schemaSize = sizeof(SSchema) * (pStable->numOfColumns + pStable->numOfTags); pStable->schema = malloc(schemaSize); if (pStable->schema == NULL) { mgmtDestroySuperTable(pStable); - return -1; + return TSDB_CODE_NOT_SUPER_TABLE; } - memcpy(pStable->schema, pOper->rowData + tsSuperTableUpdateSize, schemaSize); + memcpy(pStable->schema, pOper->rowData + len, schemaSize); + pOper->pObj = pStable; return TSDB_CODE_SUCCESS; @@ -465,15 +496,15 @@ static int32_t mgmtSuperTableActionRestored() { static int32_t mgmtInitSuperTables() { SSuperTableObj tObj; - tsSuperTableUpdateSize = (int8_t *)tObj.updateEnd - (int8_t *)&tObj; + tsSuperTableUpdateSize = (int8_t *)tObj.updateEnd - (int8_t *)&tObj.info.type; SSdbTableDesc tableDesc = { .tableId = SDB_TABLE_STABLE, .tableName = "stables", .hashSessions = TSDB_MAX_SUPER_TABLES, - .maxRowSize = tsSuperTableUpdateSize + sizeof(SSchema) * (TSDB_MAX_TAGS + TSDB_MAX_COLUMNS + 16), + .maxRowSize = sizeof(SSuperTableObj) + sizeof(SSchema) * (TSDB_MAX_TAGS + TSDB_MAX_COLUMNS + 16) + TSDB_TABLE_ID_LEN, .refCountPos = (int8_t *)(&tObj.refCount) - (int8_t *)&tObj, - .keyType = SDB_KEY_STRING, + .keyType = SDB_KEY_VAR_STRING, .insertFp = mgmtSuperTableActionInsert, .deleteFp = mgmtSuperTableActionDelete, .updateFp = mgmtSuperTableActionUpdate, @@ -720,14 +751,14 @@ static void mgmtProcessTableMetaMsg(SQueuedMsg *pMsg) { static void mgmtProcessCreateSuperTableMsg(SQueuedMsg *pMsg) { SCMCreateTableMsg *pCreate = pMsg->pCont; - SSuperTableObj *pStable = (SSuperTableObj *)calloc(1, sizeof(SSuperTableObj)); + SSuperTableObj *pStable = calloc(1, sizeof(SSuperTableObj)); if (pStable == NULL) { mError("table:%s, failed to create, no enough memory", pCreate->tableId); mgmtSendSimpleResp(pMsg->thandle, TSDB_CODE_SERV_OUT_OF_MEMORY); return; } - strcpy(pStable->info.tableId, pCreate->tableId); + pStable->info.tableId = strdup(pCreate->tableId); pStable->info.type = TSDB_SUPER_TABLE; pStable->createdTime = taosGetTimestampMs(); pStable->uid = (((uint64_t) pStable->createdTime) << 16) + (sdbGetVersion() & ((1ul << 16) - 1ul)); @@ -1358,7 +1389,7 @@ static void *mgmtBuildCreateChildTableMsg(SCMCreateTableMsg *pMsg, SChildTableOb } static SChildTableObj* mgmtDoCreateChildTable(SCMCreateTableMsg *pCreate, SVgObj *pVgroup, int32_t tid) { - SChildTableObj *pTable = (SChildTableObj *) calloc(1, sizeof(SChildTableObj)); + SChildTableObj *pTable = calloc(1, sizeof(SChildTableObj)); if (pTable == NULL) { mError("table:%s, failed to alloc memory", pCreate->tableId); terrno = TSDB_CODE_SERV_OUT_OF_MEMORY; @@ -1371,10 +1402,10 @@ static SChildTableObj* mgmtDoCreateChildTable(SCMCreateTableMsg *pCreate, SVgObj pTable->info.type = TSDB_NORMAL_TABLE; } - strcpy(pTable->info.tableId, pCreate->tableId); - pTable->createdTime = taosGetTimestampMs(); - pTable->sid = tid; - pTable->vgId = pVgroup->vgId; + pTable->info.tableId = strdup(pCreate->tableId); + pTable->createdTime = taosGetTimestampMs(); + pTable->sid = tid; + pTable->vgId = pVgroup->vgId; if (pTable->info.type == TSDB_CHILD_TABLE) { char *pTagData = (char *) pCreate->schema; // it is a tag key diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index aaea50267d..5ecad18443 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -80,7 +80,7 @@ STable *tsdbDecodeTable(void *cont, int contLen) { T_READ_MEMBER(ptr, int8_t, pTable->type); int len = *(int *)ptr; ptr = (char *)ptr + sizeof(int); - pTable->name = calloc(1, len + VARSTR_HEADER_SIZE); + pTable->name = calloc(1, len + VARSTR_HEADER_SIZE + 1); if (pTable->name == NULL) return NULL; varDataSetLen(pTable->name, len); From 27f5a1eaf62008b29da8bd58229d78b51cac3f15 Mon Sep 17 00:00:00 2001 From: Jeff Tao Date: Sat, 16 May 2020 08:56:14 +0000 Subject: [PATCH 092/126] add more debug info --- src/vnode/src/vnodeMain.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/vnode/src/vnodeMain.c b/src/vnode/src/vnodeMain.c index 0f92be0967..6dabc98ae8 100644 --- a/src/vnode/src/vnodeMain.c +++ b/src/vnode/src/vnodeMain.c @@ -429,7 +429,7 @@ static void vnodeNotifyRole(void *ahandle, int8_t role) { static void vnodeNotifyFileSynced(void *ahandle, uint64_t fversion) { SVnodeObj *pVnode = ahandle; - vTrace("vgId:%d, data file is synced", pVnode->vgId); + vTrace("vgId:%d, data file is synced, fversion:%" PRId64 "", pVnode->vgId, fversion); pVnode->fversion = fversion; pVnode->version = fversion; From 5a70c0e07d1a86f230b98eab90b0a8bcb7af366a Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Sat, 16 May 2020 18:14:39 +0800 Subject: [PATCH 093/126] [TD-339] split dnodeMain.c into dnodeMain.c and dnodeSystem.c --- src/dnode/inc/dnodeMain.h | 30 +++++++++ src/dnode/src/dnodeMain.c | 104 +------------------------------- src/dnode/src/dnodeSystem.c | 117 ++++++++++++++++++++++++++++++++++++ 3 files changed, 149 insertions(+), 102 deletions(-) create mode 100644 src/dnode/inc/dnodeMain.h create mode 100644 src/dnode/src/dnodeSystem.c diff --git a/src/dnode/inc/dnodeMain.h b/src/dnode/inc/dnodeMain.h new file mode 100644 index 0000000000..df7698ffc3 --- /dev/null +++ b/src/dnode/inc/dnodeMain.h @@ -0,0 +1,30 @@ +/* + * Copyright (c) 2019 TAOS Data, Inc. + * + * This program is free software: you can use, redistribute, and/or modify + * it under the terms of the GNU Affero General Public License, version 3 + * or later ("AGPL"), as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see . + */ + +#ifndef TDENGINE_DNODE_MAIN_H +#define TDENGINE_DNODE_MAIN_H + +#ifdef __cplusplus +extern "C" { +#endif + +int32_t dnodeInitSystem(); +void dnodeCleanUpSystem(); + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/src/dnode/src/dnodeMain.c b/src/dnode/src/dnodeMain.c index 7949a62966..2f693c61fb 100644 --- a/src/dnode/src/dnodeMain.c +++ b/src/dnode/src/dnodeMain.c @@ -16,8 +16,6 @@ #define _DEFAULT_SOURCE #include "os.h" #include "taos.h" -#include "tglobal.h" -#include "trpc.h" #include "tutil.h" #include "tconfig.h" #include "tglobal.h" @@ -29,112 +27,14 @@ #include "dnodeVRead.h" #include "dnodeShell.h" #include "dnodeVWrite.h" -#include "tgrant.h" -static int32_t dnodeInitSystem(); static int32_t dnodeInitStorage(); -extern void grantParseParameter(); static void dnodeCleanupStorage(); -static void dnodeCleanUpSystem(); static void dnodeSetRunStatus(SDnodeRunStatus status); -static void signal_handler(int32_t signum, siginfo_t *sigInfo, void *context); static void dnodeCheckDataDirOpenned(char *dir); static SDnodeRunStatus tsDnodeRunStatus = TSDB_DNODE_RUN_STATUS_STOPPED; -int32_t main(int32_t argc, char *argv[]) { - // Set global configuration file - for (int32_t i = 1; i < argc; ++i) { - if (strcmp(argv[i], "-c") == 0) { - if (i < argc - 1) { - strcpy(configDir, argv[++i]); - } else { - printf("'-c' requires a parameter, default:%s\n", configDir); - exit(EXIT_FAILURE); - } - } else if (strcmp(argv[i], "-V") == 0) { -#ifdef _SYNC - char *versionStr = "enterprise"; -#else - char *versionStr = "community"; -#endif - printf("%s version: %s compatible_version: %s\n", versionStr, version, compatible_version); - printf("gitinfo: %s\n", gitinfo); - printf("gitinfoI: %s\n", gitinfoOfInternal); - printf("buildinfo: %s\n", buildinfo); - exit(EXIT_SUCCESS); - } else if (strcmp(argv[i], "-k") == 0) { - grantParseParameter(); - exit(EXIT_SUCCESS); - } -#ifdef TAOS_MEM_CHECK - else if (strcmp(argv[i], "--alloc-random-fail") == 0) { - if ((i < argc - 1) && (argv[i + 1][0] != '-')) { - taosSetAllocMode(TAOS_ALLOC_MODE_RANDOM_FAIL, argv[++i], true); - } else { - taosSetAllocMode(TAOS_ALLOC_MODE_RANDOM_FAIL, NULL, true); - } - } else if (strcmp(argv[i], "--detect-mem-leak") == 0) { - if ((i < argc - 1) && (argv[i + 1][0] != '-')) { - taosSetAllocMode(TAOS_ALLOC_MODE_DETECT_LEAK, argv[++i], true); - } else { - taosSetAllocMode(TAOS_ALLOC_MODE_DETECT_LEAK, NULL, true); - } - } -#endif - } - - /* Set termination handler. */ - struct sigaction act = {{0}}; - act.sa_flags = SA_SIGINFO; - act.sa_sigaction = signal_handler; - sigaction(SIGTERM, &act, NULL); - sigaction(SIGHUP, &act, NULL); - sigaction(SIGINT, &act, NULL); - sigaction(SIGUSR1, &act, NULL); - sigaction(SIGUSR2, &act, NULL); - - // Open /var/log/syslog file to record information. - openlog("TDengine:", LOG_PID | LOG_CONS | LOG_NDELAY, LOG_LOCAL1); - syslog(LOG_INFO, "Starting TDengine service..."); - - // Initialize the system - if (dnodeInitSystem() < 0) { - syslog(LOG_ERR, "Error initialize TDengine system"); - closelog(); - - dnodeCleanUpSystem(); - exit(EXIT_FAILURE); - } - - syslog(LOG_INFO, "Started TDengine service successfully."); - - while (1) { - sleep(1000); - } -} - -static void signal_handler(int32_t signum, siginfo_t *sigInfo, void *context) { - if (signum == SIGUSR1) { - taosCfgDynamicOptions("debugFlag 135"); - return; - } - if (signum == SIGUSR2) { - taosCfgDynamicOptions("resetlog"); - return; - } - syslog(LOG_INFO, "Shut down signal is %d", signum); - syslog(LOG_INFO, "Shutting down TDengine service..."); - // clean the system. - dPrint("shut down signal is %d, sender PID:%d", signum, sigInfo->si_pid); - dnodeCleanUpSystem(); - // close the syslog - syslog(LOG_INFO, "Shut down TDengine service successfully"); - dPrint("TDengine is shut down!"); - closelog(); - exit(EXIT_SUCCESS); -} - -static int32_t dnodeInitSystem() { +int32_t dnodeInitSystem() { dnodeSetRunStatus(TSDB_DNODE_RUN_STATUS_INITIALIZE); tscEmbedded = 1; taosResolveCRC(); @@ -180,7 +80,7 @@ static int32_t dnodeInitSystem() { return 0; } -static void dnodeCleanUpSystem() { +void dnodeCleanUpSystem() { if (dnodeGetRunStatus() != TSDB_DNODE_RUN_STATUS_STOPPED) { dnodeSetRunStatus(TSDB_DNODE_RUN_STATUS_STOPPED); dnodeCleanupShell(); diff --git a/src/dnode/src/dnodeSystem.c b/src/dnode/src/dnodeSystem.c new file mode 100644 index 0000000000..683328db29 --- /dev/null +++ b/src/dnode/src/dnodeSystem.c @@ -0,0 +1,117 @@ +/* + * Copyright (c) 2019 TAOS Data, Inc. + * + * This program is free software: you can use, redistribute, and/or modify + * it under the terms of the GNU Affero General Public License, version 3 + * or later ("AGPL"), as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see . + */ + +#define _DEFAULT_SOURCE +#include "os.h" +#include "tgrant.h" +#include "tutil.h" +#include "tglobal.h" +#include "dnodeInt.h" +#include "dnodeMain.h" + +static void signal_handler(int32_t signum, siginfo_t *sigInfo, void *context); + +int32_t main(int32_t argc, char *argv[]) { + // Set global configuration file + for (int32_t i = 1; i < argc; ++i) { + if (strcmp(argv[i], "-c") == 0) { + if (i < argc - 1) { + strcpy(configDir, argv[++i]); + } else { + printf("'-c' requires a parameter, default:%s\n", configDir); + exit(EXIT_FAILURE); + } + } else if (strcmp(argv[i], "-V") == 0) { +#ifdef _SYNC + char *versionStr = "enterprise"; +#else + char *versionStr = "community"; +#endif + printf("%s version: %s compatible_version: %s\n", versionStr, version, compatible_version); + printf("gitinfo: %s\n", gitinfo); + printf("gitinfoI: %s\n", gitinfoOfInternal); + printf("buildinfo: %s\n", buildinfo); + exit(EXIT_SUCCESS); + } else if (strcmp(argv[i], "-k") == 0) { + grantParseParameter(); + exit(EXIT_SUCCESS); + } +#ifdef TAOS_MEM_CHECK + else if (strcmp(argv[i], "--alloc-random-fail") == 0) { + if ((i < argc - 1) && (argv[i + 1][0] != '-')) { + taosSetAllocMode(TAOS_ALLOC_MODE_RANDOM_FAIL, argv[++i], true); + } else { + taosSetAllocMode(TAOS_ALLOC_MODE_RANDOM_FAIL, NULL, true); + } + } else if (strcmp(argv[i], "--detect-mem-leak") == 0) { + if ((i < argc - 1) && (argv[i + 1][0] != '-')) { + taosSetAllocMode(TAOS_ALLOC_MODE_DETECT_LEAK, argv[++i], true); + } else { + taosSetAllocMode(TAOS_ALLOC_MODE_DETECT_LEAK, NULL, true); + } + } +#endif + } + + /* Set termination handler. */ + struct sigaction act = {{0}}; + act.sa_flags = SA_SIGINFO; + act.sa_sigaction = signal_handler; + sigaction(SIGTERM, &act, NULL); + sigaction(SIGHUP, &act, NULL); + sigaction(SIGINT, &act, NULL); + sigaction(SIGUSR1, &act, NULL); + sigaction(SIGUSR2, &act, NULL); + + // Open /var/log/syslog file to record information. + openlog("TDengine:", LOG_PID | LOG_CONS | LOG_NDELAY, LOG_LOCAL1); + syslog(LOG_INFO, "Starting TDengine service..."); + + // Initialize the system + if (dnodeInitSystem() < 0) { + syslog(LOG_ERR, "Error initialize TDengine system"); + closelog(); + + dnodeCleanUpSystem(); + exit(EXIT_FAILURE); + } + + syslog(LOG_INFO, "Started TDengine service successfully."); + + while (1) { + sleep(1000); + } +} + +static void signal_handler(int32_t signum, siginfo_t *sigInfo, void *context) { + if (signum == SIGUSR1) { + taosCfgDynamicOptions("debugFlag 135"); + return; + } + if (signum == SIGUSR2) { + taosCfgDynamicOptions("resetlog"); + return; + } + syslog(LOG_INFO, "Shut down signal is %d", signum); + syslog(LOG_INFO, "Shutting down TDengine service..."); + // clean the system. + dPrint("shut down signal is %d, sender PID:%d", signum, sigInfo->si_pid); + dnodeCleanUpSystem(); + // close the syslog + syslog(LOG_INFO, "Shut down TDengine service successfully"); + dPrint("TDengine is shut down!"); + closelog(); + exit(EXIT_SUCCESS); +} From a3fb2a11a366ee9620a9a0d2ad018c82d1d3a644 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Sun, 17 May 2020 12:34:03 +0800 Subject: [PATCH 094/126] fix warning for gcc 9. --- src/mnode/src/mgmtTable.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index 28b3c6e3dd..5579327117 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -1686,7 +1686,7 @@ static int32_t mgmtDoGetChildTableMeta(SQueuedMsg *pMsg, STableMetaMsg *pMeta) { pMeta->sid = htonl(pTable->sid); pMeta->precision = pDb->cfg.precision; pMeta->tableType = pTable->info.type; - strncpy(pMeta->tableId, pTable->info.tableId, tListLen(pTable->info.tableId)); + strncpy(pMeta->tableId, pTable->info.tableId, strlen(pTable->info.tableId)); if (pTable->info.type == TSDB_CHILD_TABLE) { pMeta->sversion = htons(pTable->superTable->sversion); From 8de5e86d76b28d9b8f80e2c63bc1421d51c5f8eb Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Sun, 17 May 2020 12:35:42 +0800 Subject: [PATCH 095/126] sleep more to wait dnode start for valgrind env. --- tests/pytest/util/dnodes.py | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/tests/pytest/util/dnodes.py b/tests/pytest/util/dnodes.py index 9f7466a7e7..b1872d0e20 100644 --- a/tests/pytest/util/dnodes.py +++ b/tests/pytest/util/dnodes.py @@ -223,8 +223,8 @@ class TDDnode: self.running = 1 tdLog.debug("dnode:%d is running with %s " % (self.index, cmd)) - tdLog.debug("wait 4 seconds for the dnode:%d to start." % (self.index)) - time.sleep(4) + tdLog.debug("wait 5 seconds for the dnode:%d to start." % (self.index)) + time.sleep(5) def stop(self): if self.valgrind == 0: From 71931eb1837492eca8c8712694b2642f1b49d222 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Sun, 17 May 2020 16:06:14 +0800 Subject: [PATCH 096/126] add tablename-boundary.py --- tests/pytest/insert/bool.py | 8 +++++ tests/pytest/table/tablename-boundary.py | 46 ++++++++++++++++++++++++ 2 files changed, 54 insertions(+) create mode 100644 tests/pytest/table/tablename-boundary.py diff --git a/tests/pytest/insert/bool.py b/tests/pytest/insert/bool.py index 062563f4ab..c175afd8b5 100644 --- a/tests/pytest/insert/bool.py +++ b/tests/pytest/insert/bool.py @@ -58,6 +58,14 @@ class TDTestCase: tdSql.query('select * from tb order by ts desc') tdLog.info('tdSql.checkRow(6)') tdSql.checkRows(6) + tdLog.info('=============== step7') + tdLog.info("insert into tb values (now+6m, true)") + tdSql.execute("insert into tb values (now+5m, true)") + tdLog.info('select * from tb order by ts desc') + tdSql.query('select * from tb order by ts desc') + tdLog.info('tdSql.checkRow(7)') + tdSql.checkRows(7) +# convert end # convert end def stop(self): diff --git a/tests/pytest/table/tablename-boundary.py b/tests/pytest/table/tablename-boundary.py new file mode 100644 index 0000000000..335073065c --- /dev/null +++ b/tests/pytest/table/tablename-boundary.py @@ -0,0 +1,46 @@ +# -*- coding: utf-8 -*- + +import sys +import string +import random +import subprocess +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + getTableNameLen = "grep -w '#define TSDB_TABLE_NAME_LEN' ../../src/inc/taosdef.h|awk '{print $3}'" + tableNameMaxLen = int( + subprocess.check_output( + getTableNameLen, shell=True)) + tdLog.info("table name max length is %d" % tableNameMaxLen) + chars = string.ascii_uppercase + string.ascii_lowercase + tb_name = ''.join(random.choices(chars, k=tableNameMaxLen)) + tdLog.info('tb_name length %d' % len(tb_name)) + tdLog.info('create table %s (ts timestamp, value int)' % tb_name) + tdSql.error( + 'create table %s (ts timestamp, speed binary(4089))' % + tb_name) + + tb_name = ''.join(random.choices(chars, k=191)) + tdLog.info('tb_name length %d' % len(tb_name)) + tdLog.info('create table %s (ts timestamp, value int)' % tb_name) + tdSql.execute( + 'create table %s (ts timestamp, speed binary(4089))' % + tb_name) + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) From 7f4742ba97273d01d287772ec385053677aefd01 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Sun, 17 May 2020 19:11:14 +0800 Subject: [PATCH 097/126] refine killing exist daemon. --- tests/pytest/fulltest.sh | 1 + tests/pytest/smoketest.sh | 2 ++ tests/pytest/util/dnodes.py | 41 ++++++++++++++++------------------- tests/pytest/valgrind-test.sh | 2 ++ 4 files changed, 24 insertions(+), 22 deletions(-) diff --git a/tests/pytest/fulltest.sh b/tests/pytest/fulltest.sh index ec772fd4d1..8634a523f3 100755 --- a/tests/pytest/fulltest.sh +++ b/tests/pytest/fulltest.sh @@ -12,6 +12,7 @@ python3 ./test.py $1 -f insert/binary.py python3 ./test.py $1 -f insert/nchar.py python3 ./test.py $1 -f insert/nchar-boundary.py python3 ./test.py $1 -f insert/nchar-unicode.py +python3 ./test.py $1 -f insert/multi.py python3 ./test.py $1 -f table/column_name.py python3 ./test.py $1 -f table/column_num.py diff --git a/tests/pytest/smoketest.sh b/tests/pytest/smoketest.sh index c0878354e0..6314b3f83b 100755 --- a/tests/pytest/smoketest.sh +++ b/tests/pytest/smoketest.sh @@ -21,6 +21,8 @@ python3 ./test.py $1 -f insert/date.py python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f insert/nchar.py python3 ./test.py $1 -s && sleep 1 +python3 ./test.py $1 -f insert/multi.py +python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f table/column_name.py python3 ./test.py $1 -s && sleep 1 diff --git a/tests/pytest/util/dnodes.py b/tests/pytest/util/dnodes.py index b1872d0e20..727016adb3 100644 --- a/tests/pytest/util/dnodes.py +++ b/tests/pytest/util/dnodes.py @@ -233,16 +233,14 @@ class TDDnode: toBeKilled = "valgrind.bin" if self.running != 0: - killCmd = "ps -ef|grep -w %s| grep '%s' | grep -v grep | awk '{print $2}' | xargs kill -INT" % ( - toBeKilled, self.cfgDir) - psCmd = "ps -ef|grep -w %s| grep -v grep | awk '{print $2}'" % toBeKilled - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") while(processID): + killCmd = "kill -INT %s" % processID os.system(killCmd) time.sleep(1) - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") self.running = 0 tdLog.debug("dnode:%d is stopped by kill -INT" % (self.index)) @@ -254,15 +252,14 @@ class TDDnode: toBeKilled = "valgrind.bin" if self.running != 0: - killCmd = "ps -ef|grep -w %s| grep '%s' | grep -v grep | awk '{print $2}' | xargs kill -KILL" % ( - toBeKilled, self.cfgDir) psCmd = "ps -ef|grep -w %s| grep -v grep | awk '{print $2}'" % toBeKilled - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") while(processID): + killCmd = "kill -KILL %s" % processID os.system(killCmd) time.sleep(1) - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") self.running = 0 tdLog.debug("dnode:%d is stopped by kill -KILL" % (self.index)) @@ -307,21 +304,21 @@ class TDDnodes: self.dnodes.append(TDDnode(10)) def init(self, path): - killCmd = "ps -ef|grep -w taosd | grep -v grep | awk '{print $2}' | xargs kill -KILL" psCmd = "ps -ef|grep -w taosd| grep -v grep | awk '{print $2}'" - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") while(processID): + killCmd = "kill -KILL %s" % processID os.system(killCmd) time.sleep(1) - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") - killCmd = "ps -ef|grep -w valgrind.bin| grep -v grep | awk '{print $2}' | xargs kill -KILL" psCmd = "ps -ef|grep -w valgrind.bin| grep -v grep | awk '{print $2}'" - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") while(processID): + killCmd = "kill -KILL %s" % processID os.system(killCmd) time.sleep(1) - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") binPath = os.path.dirname(os.path.realpath(__file__)) binPath = binPath + "/../../../debug/" @@ -407,27 +404,27 @@ class TDDnodes: self.dnodes[i].stop() psCmd = "ps -ef | grep -w taosd | grep 'root' | grep -v grep | awk '{print $2}'" - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") if processID: cmd = "sudo systemctl stop taosd" os.system(cmd) # if os.system(cmd) != 0 : # tdLog.exit(cmd) - killCmd = "ps -ef|grep -w taosd| grep -v grep | awk '{print $2}' | xargs kill -KILL" psCmd = "ps -ef|grep -w taosd| grep -v grep | awk '{print $2}'" - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") while(processID): + killCmd = "kill -KILL %s" % processID os.system(killCmd) time.sleep(1) - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") - killCmd = "ps -ef|grep -w valgrind.bin| grep -v grep | awk '{print $2}' | xargs kill -KILL" psCmd = "ps -ef|grep -w valgrind.bin| grep -v grep | awk '{print $2}'" - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") while(processID): + killCmd = "kill -KILL %s" % processID os.system(killCmd) time.sleep(1) - processID = subprocess.check_output(psCmd, shell=True) + processID = subprocess.check_output(psCmd, shell=True).decode("utf-8") # if os.system(cmd) != 0 : # tdLog.exit(cmd) diff --git a/tests/pytest/valgrind-test.sh b/tests/pytest/valgrind-test.sh index 77c2b321df..6c531f7cac 100755 --- a/tests/pytest/valgrind-test.sh +++ b/tests/pytest/valgrind-test.sh @@ -21,6 +21,8 @@ python3 ./test.py $1 -f insert/date.py python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f insert/nchar.py python3 ./test.py $1 -s && sleep 1 +python3 ./test.py $1 -f insert/multi.py +python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f table/column_name.py python3 ./test.py $1 -s && sleep 1 From 094d21c9abdd4dc54a10097c13c3324399e07166 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Sun, 17 May 2020 19:17:45 +0800 Subject: [PATCH 098/126] make valgrind.sh take -g as default. --- .travis.yml | 2 +- tests/pytest/valgrind-test.sh | 64 +++++++++++++++++------------------ 2 files changed, 33 insertions(+), 33 deletions(-) diff --git a/.travis.yml b/.travis.yml index da0c47ea56..9bc576dcf9 100644 --- a/.travis.yml +++ b/.travis.yml @@ -50,7 +50,7 @@ matrix: ./test-all.sh $TRAVIS_EVENT_TYPE || travis_terminate $? cd ${TRAVIS_BUILD_DIR}/tests/pytest - ./valgrind-test.sh -g 2>&1 > mem-error-out.txt + ./valgrind-test.sh 2>&1 > mem-error-out.txt sleep 1 # Color setting diff --git a/tests/pytest/valgrind-test.sh b/tests/pytest/valgrind-test.sh index 6c531f7cac..0b5dfc0fa3 100755 --- a/tests/pytest/valgrind-test.sh +++ b/tests/pytest/valgrind-test.sh @@ -1,35 +1,35 @@ #!/bin/bash -python3 ./test.py $1 -f insert/basic.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/int.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/float.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/bigint.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/bool.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/double.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/smallint.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/tinyint.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/binary.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/date.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/nchar.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f insert/multi.py -python3 ./test.py $1 -s && sleep 1 +python3 ./test.py -g -f insert/basic.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/int.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/float.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/bigint.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/bool.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/double.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/smallint.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/tinyint.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/binary.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/date.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/nchar.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f insert/multi.py +python3 ./test.py -g -s && sleep 1 -python3 ./test.py $1 -f table/column_name.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f table/column_num.py -python3 ./test.py $1 -s && sleep 1 -python3 ./test.py $1 -f table/db_table.py -python3 ./test.py $1 -s && sleep 1 +python3 ./test.py -g -f table/column_name.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f table/column_num.py +python3 ./test.py -g -s && sleep 1 +python3 ./test.py -g -f table/db_table.py +python3 ./test.py -g -s && sleep 1 -python3 ./test.py $1 -f import_merge/importDataLastSub.py -python3 ./test.py $1 -s && sleep 1 +python3 ./test.py -g -f import_merge/importDataLastSub.py +python3 ./test.py -g -s && sleep 1 From 95d7105e15c720f062b26e1881e1aa6badb4de93 Mon Sep 17 00:00:00 2001 From: Jeff Tao Date: Sun, 17 May 2020 14:36:35 +0000 Subject: [PATCH 099/126] tune the debug info --- src/client/src/tscServer.c | 2 +- src/dnode/src/dnodeVRead.c | 3 +- src/dnode/src/dnodeVWrite.c | 1 + src/inc/trpc.h | 1 + src/mnode/src/mgmtShell.c | 2 + src/rpc/inc/rpcHead.h | 1 + src/rpc/src/rpcCache.c | 10 +-- src/rpc/src/rpcMain.c | 124 ++++++++++++++++++------------------ src/rpc/src/rpcUdp.c | 2 +- 9 files changed, 76 insertions(+), 70 deletions(-) diff --git a/src/client/src/tscServer.c b/src/client/src/tscServer.c index bc717ed88c..110377d112 100644 --- a/src/client/src/tscServer.c +++ b/src/client/src/tscServer.c @@ -235,7 +235,7 @@ void tscProcessMsgFromServer(SRpcMsg *rpcMsg, SRpcIpSet *pIpSet) { SSqlRes *pRes = &pSql->res; SSqlCmd *pCmd = &pSql->cmd; STscObj *pObj = pSql->pTscObj; - tscTrace("%p msg:%p is received from server", pSql, rpcMsg->pCont); + tscTrace("%p msg:%s is received from server", pSql, taosMsg[rpcMsg->msgType]); if (pSql->freed || pObj->signature != pObj) { tscTrace("%p sql is already released or DB connection is closed, freed:%d pObj:%p signature:%p", pSql, pSql->freed, diff --git a/src/dnode/src/dnodeVRead.c b/src/dnode/src/dnodeVRead.c index aaf71838bf..aa8cd99785 100644 --- a/src/dnode/src/dnodeVRead.c +++ b/src/dnode/src/dnodeVRead.c @@ -92,8 +92,6 @@ void dnodeDispatchToVnodeReadQueue(SRpcMsg *pMsg) { char *pCont = (char *) pMsg->pCont; void *pVnode; - dTrace("dnode %s msg incoming, thandle:%p", taosMsg[pMsg->msgType], pMsg->handle); - while (leftLen > 0) { SMsgHead *pHead = (SMsgHead *) pCont; pHead->vgId = htonl(pHead->vgId); @@ -214,6 +212,7 @@ static void *dnodeProcessReadQueue(void *param) { continue; } + dTrace("%p, msg:%s will be processed", pReadMsg->rpcMsg.ahandle, taosMsg[pReadMsg->rpcMsg.msgType]); int32_t code = vnodeProcessRead(pVnode, pReadMsg->rpcMsg.msgType, pReadMsg->pCont, pReadMsg->contLen, &pReadMsg->rspRet); dnodeSendRpcReadRsp(pVnode, pReadMsg, code); taosFreeQitem(pReadMsg); diff --git a/src/dnode/src/dnodeVWrite.c b/src/dnode/src/dnodeVWrite.c index 5de4c16c50..879082f223 100644 --- a/src/dnode/src/dnodeVWrite.c +++ b/src/dnode/src/dnodeVWrite.c @@ -200,6 +200,7 @@ static void *dnodeProcessWriteQueue(void *param) { pHead->msgType = pWrite->rpcMsg.msgType; pHead->version = 0; pHead->len = pWrite->contLen; + dTrace("%p, msg:%s will be processed", pWrite->rpcMsg.ahandle, taosMsg[pWrite->rpcMsg.msgType]); } else { pHead = (SWalHead *)item; } diff --git a/src/inc/trpc.h b/src/inc/trpc.h index eff210433f..16223b813a 100644 --- a/src/inc/trpc.h +++ b/src/inc/trpc.h @@ -48,6 +48,7 @@ typedef struct { int contLen; int32_t code; void *handle; + void *ahandle; //app handle set by client, for debug purpose } SRpcMsg; typedef struct { diff --git a/src/mnode/src/mgmtShell.c b/src/mnode/src/mgmtShell.c index 804572b9ff..d8bcf67242 100644 --- a/src/mnode/src/mgmtShell.c +++ b/src/mnode/src/mgmtShell.c @@ -124,6 +124,8 @@ void mgmtDealyedAddToShellQueue(SQueuedMsg *queuedMsg) { void mgmtProcessMsgFromShell(SRpcMsg *rpcMsg) { + mTrace("%p, msg:%s will be processed", rpcMsg->ahandle, taosMsg[rpcMsg->msgType]); + if (rpcMsg->pCont == NULL) { mgmtSendSimpleResp(rpcMsg->handle, TSDB_CODE_INVALID_MSG_LEN); return; diff --git a/src/rpc/inc/rpcHead.h b/src/rpc/inc/rpcHead.h index 8b5410a596..520edadc7d 100644 --- a/src/rpc/inc/rpcHead.h +++ b/src/rpc/inc/rpcHead.h @@ -49,6 +49,7 @@ typedef struct { char encrypt:3; // encrypt algorithm, 0: no encryption uint16_t tranId; // transcation ID uint32_t linkUid; // for unique connection ID assigned by client + uint64_t ahandle; // ahandle assigned by client uint32_t sourceId; // source ID, an index for connection list uint32_t destId; // destination ID, an index for connection list uint32_t destIp; // destination IP address, for NAT scenario diff --git a/src/rpc/src/rpcCache.c b/src/rpc/src/rpcCache.c index edbb9b3e12..7a96571ab9 100644 --- a/src/rpc/src/rpcCache.c +++ b/src/rpc/src/rpcCache.c @@ -146,7 +146,7 @@ void rpcAddConnIntoCache(void *handle, void *data, char *fqdn, uint16_t port, in rpcUnlockCache(pCache->lockedBy+hash); pCache->total++; - tTrace("%p %s:%hu:%d:%d:%p added into cache, connections:%d", data, fqdn, port, connType, hash, pNode, pCache->count[hash]); + // tTrace("%p %s:%hu:%d:%d:%p added into cache, connections:%d", data, fqdn, port, connType, hash, pNode, pCache->count[hash]); return; } @@ -200,9 +200,9 @@ void *rpcGetConnFromCache(void *handle, char *fqdn, uint16_t port, int8_t connTy rpcUnlockCache(pCache->lockedBy+hash); if (pData) { - tTrace("%p %s:%hu:%d:%d:%p retrieved from cache, connections:%d", pData, fqdn, port, connType, hash, pNode, pCache->count[hash]); + //tTrace("%p %s:%hu:%d:%d:%p retrieved from cache, connections:%d", pData, fqdn, port, connType, hash, pNode, pCache->count[hash]); } else { - tTrace("%s:%hu:%d:%d failed to retrieve conn from cache, connections:%d", fqdn, port, connType, hash, pCache->count[hash]); + //tTrace("%s:%hu:%d:%d failed to retrieve conn from cache, connections:%d", fqdn, port, connType, hash, pCache->count[hash]); } return pData; @@ -240,8 +240,8 @@ static void rpcRemoveExpiredNodes(SConnCache *pCache, SConnHash *pNode, int hash pNext = pNode->next; pCache->total--; pCache->count[hash]--; - tTrace("%p %s:%hu:%d:%d:%p removed from cache, connections:%d", pNode->data, pNode->fqdn, pNode->port, pNode->connType, hash, pNode, - pCache->count[hash]); + //tTrace("%p %s:%hu:%d:%d:%p removed from cache, connections:%d", pNode->data, pNode->fqdn, pNode->port, pNode->connType, hash, pNode, + // pCache->count[hash]); taosMemPoolFree(pCache->connHashMemPool, (char *)pNode); pNode = pNext; } diff --git a/src/rpc/src/rpcMain.c b/src/rpc/src/rpcMain.c index 7e80f0d282..60fafb44bd 100644 --- a/src/rpc/src/rpcMain.c +++ b/src/rpc/src/rpcMain.c @@ -87,6 +87,7 @@ typedef struct { } SRpcReqContext; typedef struct SRpcConn { + char info[50];// debug info: label + pConn + ahandle int sid; // session ID uint32_t ownId; // own link ID uint32_t peerId; // peer link ID @@ -275,7 +276,7 @@ void *rpcOpen(const SRpcInit *pInit) { return NULL; } - tTrace("%s RPC is openned, numOfThreads:%d", pRpc->label, pRpc->numOfThreads); + tTrace("%s rpc is openned, threads:%d sessions:%d", pRpc->label, pRpc->numOfThreads, pInit->sessions); return pRpc; } @@ -299,7 +300,7 @@ void rpcClose(void *param) { tfree(pRpc->connList); pthread_mutex_destroy(&pRpc->mutex); - tTrace("%s RPC is closed", pRpc->label); + tTrace("%s rpc is closed", pRpc->label); tfree(pRpc); } @@ -374,8 +375,6 @@ void rpcSendRequest(void *shandle, const SRpcIpSet *pIpSet, const SRpcMsg *pMsg) void rpcSendResponse(const SRpcMsg *pRsp) { int msgLen = 0; SRpcConn *pConn = (SRpcConn *)pRsp->handle; - SRpcInfo *pRpc = pConn->pRpc; - SRpcMsg rpcMsg = *pRsp; SRpcMsg *pMsg = &rpcMsg; @@ -393,7 +392,7 @@ void rpcSendResponse(const SRpcMsg *pRsp) { rpcLockConn(pConn); if ( pConn->inType == 0 || pConn->user[0] == 0 ) { - tTrace("%s %p, connection is already released, rsp wont be sent", pRpc->label, pConn); + tTrace("%s, connection is already released, rsp wont be sent", pConn->info); rpcUnlockConn(pConn); return; } @@ -409,7 +408,8 @@ void rpcSendResponse(const SRpcMsg *pRsp) { pHead->linkUid = pConn->linkUid; pHead->port = htons(pConn->localPort); pHead->code = htonl(pMsg->code); - + pHead->ahandle = (uint64_t) pConn->ahandle; + // set pConn parameters pConn->inType = 0; @@ -491,6 +491,7 @@ static SRpcConn *rpcOpenConn(SRpcInfo *pRpc, char *peerFqdn, uint16_t peerPort, uint32_t peerIp = taosGetIpFromFqdn(peerFqdn); if (peerIp == -1) { tError("%s, failed to resolve FQDN:%s", pRpc->label, peerFqdn); + terrno = TSDB_CODE_APP_ERROR; return NULL; } @@ -506,11 +507,7 @@ static SRpcConn *rpcOpenConn(SRpcInfo *pRpc, char *peerFqdn, uint16_t peerPort, if (taosOpenConn[connType]) { void *shandle = (connType & RPC_CONN_TCP)? pRpc->tcphandle:pRpc->udphandle; pConn->chandle = (*taosOpenConn[connType])(shandle, pConn, pConn->peerIp, pConn->peerPort); - if (pConn->chandle) { - tTrace("%s %p, rpc connection is set up, sid:%d id:%s %s:%hu connType:%d", pRpc->label, - pConn, pConn->sid, pRpc->user, peerFqdn, pConn->peerPort, pConn->connType); - } else { - tError("%s %p, failed to set up connection to %s:%hu", pRpc->label, pConn, peerFqdn, pConn->peerPort); + if (pConn->chandle == NULL) { terrno = TSDB_CODE_NETWORK_UNAVAIL; rpcCloseConn(pConn); pConn = NULL; @@ -557,7 +554,7 @@ static void rpcCloseConn(void *thandle) { taosFreeId(pRpc->idPool, pConn->sid); pConn->pContext = NULL; - tTrace("%s %p, rpc connection is closed", pRpc->label, pConn); + tTrace("%s, rpc connection is closed", pConn->info); rpcUnlockConn(pConn); } @@ -619,7 +616,6 @@ static SRpcConn *rpcAllocateServerConn(SRpcInfo *pRpc, SRecvInfo *pRecv) { } if (terrno != 0) { - tWarn("%s %p, user not there or server not ready", pRpc->label, pConn); taosFreeId(pRpc->idPool, sid); // sid shall be released pConn = NULL; } @@ -634,8 +630,6 @@ static SRpcConn *rpcAllocateServerConn(SRpcInfo *pRpc, SRecvInfo *pRecv) { } taosHashPut(pRpc->hash, hashstr, size, (char *)&pConn, POINTER_BYTES); - tTrace("%s %p, rpc connection is allocated, sid:%d id:%s port:%u", - pRpc->label, pConn, sid, pConn->user, pConn->localPort); } return pConn; @@ -660,7 +654,6 @@ static SRpcConn *rpcGetConnObj(SRpcInfo *pRpc, int sid, SRecvInfo *pRecv) { if (pConn) { if (pConn->linkUid != pHead->linkUid) { - tTrace("%s %p, linkUid:0x%x not matched, received:0x%x", pRpc->label, pConn, pConn->linkUid, pHead->linkUid); terrno = TSDB_CODE_MISMATCHED_METER_ID; pConn = NULL; } @@ -677,21 +670,25 @@ static SRpcConn *rpcSetupConnToServer(SRpcReqContext *pContext) { pConn = rpcGetConnFromCache(pRpc->pCache, pIpSet->fqdn[pIpSet->inUse], pIpSet->port[pIpSet->inUse], pContext->connType); if ( pConn == NULL || pConn->user[0] == 0) { pConn = rpcOpenConn(pRpc, pIpSet->fqdn[pIpSet->inUse], pIpSet->port[pIpSet->inUse], pContext->connType); + } + + if (pConn) { + pConn->ahandle = pContext->ahandle; + sprintf(pConn->info, "%s %p %p", pRpc->label, pConn, pConn->ahandle); } else { - tTrace("%s %p, connection is retrieved from cache", pRpc->label, pConn); + tError("%s %p, failed to set up connection(%s)", pRpc->label, pContext->ahandle, tstrerror(terrno)); } return pConn; } static int rpcProcessReqHead(SRpcConn *pConn, SRpcHead *pHead) { - SRpcInfo *pRpc= pConn->pRpc; if (pConn->peerId == 0) { pConn->peerId = pHead->sourceId; } else { if (pConn->peerId != pHead->sourceId) { - tTrace("%s %p, source Id is changed, old:0x%08x new:0x%08x", pRpc->label, pConn, + tTrace("%s, source Id is changed, old:0x%08x new:0x%08x", pConn->info, pConn->peerId, pHead->sourceId); return TSDB_CODE_INVALID_VALUE; } @@ -700,17 +697,16 @@ static int rpcProcessReqHead(SRpcConn *pConn, SRpcHead *pHead) { if (pConn->inTranId == pHead->tranId) { if (pConn->inType == pHead->msgType) { if (pHead->code == 0) { - tTrace("%s %p, %s is retransmitted", pRpc->label, pConn, taosMsg[pHead->msgType]); + tTrace("%s, %s is retransmitted", pConn->info, taosMsg[pHead->msgType]); rpcSendQuickRsp(pConn, TSDB_CODE_ACTION_IN_PROGRESS); } else { // do nothing, it is heart beat from client } } else if (pConn->inType == 0) { - tTrace("%s %p, %s is already processed, tranId:%d", pRpc->label, pConn, - taosMsg[pHead->msgType], pConn->inTranId); + tTrace("%s, %s is already processed, tranId:%d", pConn->info, taosMsg[pHead->msgType], pConn->inTranId); rpcSendMsgToPeer(pConn, pConn->pRspMsg, pConn->rspMsgLen); // resend the response } else { - tTrace("%s %p, mismatched message %s and tranId", pRpc->label, pConn, taosMsg[pHead->msgType]); + tTrace("%s, mismatched message %s and tranId", pConn->info, taosMsg[pHead->msgType]); } // do not reply any message @@ -718,7 +714,7 @@ static int rpcProcessReqHead(SRpcConn *pConn, SRpcHead *pHead) { } if (pConn->inType != 0) { - tTrace("%s %p, last session is not finished, inTranId:%d tranId:%d", pRpc->label, pConn, + tTrace("%s, last session is not finished, inTranId:%d tranId:%d", pConn->info, pConn->inTranId, pHead->tranId); return TSDB_CODE_LAST_SESSION_NOT_FINISHED; } @@ -750,7 +746,7 @@ static int rpcProcessRspHead(SRpcConn *pConn, SRpcHead *pHead) { if (pHead->code == TSDB_CODE_ACTION_IN_PROGRESS) { if (pConn->tretry <= tsRpcMaxRetry) { - tTrace("%s %p, peer is still processing the transaction", pRpc->label, pConn); + tTrace("%s, peer is still processing the transaction", pConn->info); pConn->tretry++; rpcSendReqHead(pConn); taosTmrReset(rpcProcessRetryTimer, tsRpcTimer, pConn, pRpc->tmrCtrl, &pConn->pTimer); @@ -789,7 +785,15 @@ static SRpcConn *rpcProcessMsgHead(SRpcInfo *pRpc, SRecvInfo *pRecv) { } pConn = rpcGetConnObj(pRpc, sid, pRecv); - if (pConn == NULL) return NULL; + if (pConn == NULL) { + tError("%s %p, failed to get connection obj(%s)", pRpc->label, pHead->ahandle, tstrerror(terrno)); + return NULL; + } else { + if (rpcIsReq(pHead->msgType)) { + pConn->ahandle = (void *)pHead->ahandle; + sprintf(pConn->info, "%s %p %p", pRpc->label, pConn, pConn->ahandle); + } + } rpcLockConn(pConn); sid = pConn->sid; @@ -826,7 +830,7 @@ static SRpcConn *rpcProcessMsgHead(SRpcInfo *pRpc, SRecvInfo *pRecv) { static void rpcProcessBrokenLink(SRpcConn *pConn) { SRpcInfo *pRpc = pConn->pRpc; - tTrace("%s %p, link is broken", pRpc->label, pConn); + tTrace("%s, link is broken", pConn->info); // pConn->chandle = NULL; if (pConn->outType) { @@ -837,7 +841,7 @@ static void rpcProcessBrokenLink(SRpcConn *pConn) { if (pConn->inType) { // if there are pending request, notify the app - tTrace("%s %p, connection is gone, notify the app", pRpc->label, pConn); + tTrace("%s, connection is gone, notify the app", pConn->info); /* SRpcMsg rpcMsg; rpcMsg.pCont = NULL; @@ -872,17 +876,17 @@ static void *rpcProcessMsgFromPeer(SRecvInfo *pRecv) { pConn = rpcProcessMsgHead(pRpc, pRecv); if (pHead->msgType < TSDB_MSG_TYPE_CM_HEARTBEAT || (rpcDebugFlag & 16)) { - tTrace("%s %p, %s received from 0x%x:%hu, parse code:0x%x len:%d sig:0x%08x:0x%08x:%d code:0x%x", - pRpc->label, pConn, taosMsg[pHead->msgType], pRecv->ip, pRecv->port, terrno, + tTrace("%s %p %p, %s received from 0x%x:%hu, parse code:0x%x len:%d sig:0x%08x:0x%08x:%d code:0x%x", + pRpc->label, pConn, (void *)pHead->ahandle, taosMsg[pHead->msgType], pRecv->ip, pRecv->port, terrno, pRecv->msgLen, pHead->sourceId, pHead->destId, pHead->tranId, pHead->code); } int32_t code = terrno; if (code != TSDB_CODE_ALREADY_PROCESSED) { if (code != 0) { // parsing error - if ( rpcIsReq(pHead->msgType) ) { + if (rpcIsReq(pHead->msgType)) { rpcSendErrorMsgToPeer(pRecv, code); - tTrace("%s %p, %s is sent with error code:%x", pRpc->label, pConn, taosMsg[pHead->msgType+1], code); + tTrace("%s %p %p, %s is sent with error code:%x", pRpc->label, pConn, (void *)pHead->ahandle, taosMsg[pHead->msgType+1], code); } } else { // parsing OK rpcProcessIncomingMsg(pConn, pHead); @@ -924,6 +928,7 @@ static void rpcProcessIncomingMsg(SRpcConn *pConn, SRpcHead *pHead) { rpcMsg.pCont = pHead->content; rpcMsg.msgType = pHead->msgType; rpcMsg.code = pHead->code; + rpcMsg.ahandle = pConn->ahandle; if ( rpcIsReq(pHead->msgType) ) { rpcMsg.handle = pConn; @@ -948,14 +953,14 @@ static void rpcProcessIncomingMsg(SRpcConn *pConn, SRpcHead *pHead) { pContext->redirect++; if (pContext->redirect > TSDB_MAX_REPLICA) { pHead->code = TSDB_CODE_NETWORK_UNAVAIL; - tWarn("%s %p, too many redirects, quit", pRpc->label, pConn); + tWarn("%s, too many redirects, quit", pConn->info); } } if (pHead->code == TSDB_CODE_REDIRECT) { pContext->numOfTry = 0; memcpy(&pContext->ipSet, pHead->content, sizeof(pContext->ipSet)); - tTrace("%s %p, redirect is received, numOfIps:%d", pRpc->label, pConn, pContext->ipSet.numOfIps); + tTrace("%s, redirect is received, numOfIps:%d", pConn->info, pContext->ipSet.numOfIps); for (int i=0; iipSet.numOfIps; ++i) pContext->ipSet.port[i] = htons(pContext->ipSet.port[i]); rpcSendReqToServer(pRpc, pContext); @@ -1061,6 +1066,7 @@ static void rpcSendReqToServer(SRpcInfo *pRpc, SRpcReqContext *pContext) { return; } + pConn->ahandle = pContext->ahandle; rpcLockConn(pConn); // set the message header @@ -1074,6 +1080,7 @@ static void rpcSendReqToServer(SRpcInfo *pRpc, SRpcReqContext *pContext) { pHead->destId = pConn->peerId; pHead->port = 0; pHead->linkUid = pConn->linkUid; + pHead->ahandle = (uint64_t)pConn->ahandle; if (!pConn->secured) memcpy(pHead->user, pConn->user, tListLen(pHead->user)); // set the connection parameters @@ -1091,29 +1098,27 @@ static void rpcSendReqToServer(SRpcInfo *pRpc, SRpcReqContext *pContext) { static void rpcSendMsgToPeer(SRpcConn *pConn, void *msg, int msgLen) { int writtenLen = 0; - SRpcInfo *pRpc = pConn->pRpc; SRpcHead *pHead = (SRpcHead *)msg; msgLen = rpcAddAuthPart(pConn, msg, msgLen); if ( rpcIsReq(pHead->msgType)) { if (pHead->msgType < TSDB_MSG_TYPE_CM_HEARTBEAT || (rpcDebugFlag & 16)) - tTrace("%s %p, %s is sent to %s:%hu, len:%d sig:0x%08x:0x%08x:%d", - pRpc->label, pConn, taosMsg[pHead->msgType], pConn->peerFqdn, - pConn->peerPort, msgLen, pHead->sourceId, pHead->destId, pHead->tranId); + tTrace("%s, %s is sent to %s:%hu, len:%d sig:0x%08x:0x%08x:%d", + pConn->info, taosMsg[pHead->msgType], pConn->peerFqdn, pConn->peerPort, + msgLen, pHead->sourceId, pHead->destId, pHead->tranId); } else { if (pHead->code == 0) pConn->secured = 1; // for success response, set link as secured if (pHead->msgType < TSDB_MSG_TYPE_CM_HEARTBEAT || (rpcDebugFlag & 16)) - tTrace( "%s %p, %s is sent to 0x%x:%hu, code:0x%x len:%d sig:0x%08x:0x%08x:%d", - pRpc->label, pConn, taosMsg[pHead->msgType], pConn->peerIp, pConn->peerPort, + tTrace("%s, %s is sent to 0x%x:%hu, code:0x%x len:%d sig:0x%08x:0x%08x:%d", + pConn->info, taosMsg[pHead->msgType], pConn->peerIp, pConn->peerPort, htonl(pHead->code), msgLen, pHead->sourceId, pHead->destId, pHead->tranId); } writtenLen = (*taosSendData[pConn->connType])(pConn->peerIp, pConn->peerPort, pHead, msgLen, pConn->chandle); if (writtenLen != msgLen) { - tError("%s %p, failed to send, dataLen:%d writtenLen:%d, reason:%s", pRpc->label, pConn, - msgLen, writtenLen, strerror(errno)); + tError("%s, failed to send, msgLen:%d written:%d, reason:%s", pConn->info, msgLen, writtenLen, strerror(errno)); } tDump(msg, msgLen); @@ -1128,7 +1133,7 @@ static void rpcProcessConnError(void *param, void *id) { return; } - tTrace("%s connection error happens", pRpc->label); + tTrace("%s %p, connection error happens", pRpc->label, pContext->ahandle); if (pContext->numOfTry >= pContext->ipSet.numOfIps) { rpcMsg.msgType = pContext->msgType+1; @@ -1154,23 +1159,21 @@ static void rpcProcessRetryTimer(void *param, void *tmrId) { rpcLockConn(pConn); if (pConn->outType && pConn->user[0]) { - tTrace("%s %p, expected %s is not received", pRpc->label, pConn, taosMsg[(int)pConn->outType + 1]); + tTrace("%s, expected %s is not received", pConn->info, taosMsg[(int)pConn->outType + 1]); pConn->pTimer = NULL; pConn->retry++; if (pConn->retry < 4) { - tTrace("%s %p, re-send msg:%s to %s:%hu", pRpc->label, pConn, - taosMsg[pConn->outType], pConn->peerFqdn, pConn->peerPort); + tTrace("%s, re-send msg:%s to %s:%hu", pConn->info, taosMsg[pConn->outType], pConn->peerFqdn, pConn->peerPort); rpcSendMsgToPeer(pConn, pConn->pReqMsg, pConn->reqMsgLen); taosTmrReset(rpcProcessRetryTimer, tsRpcTimer, pConn, pRpc->tmrCtrl, &pConn->pTimer); } else { // close the connection - tTrace("%s %p, failed to send msg:%s to %s:%hu", pRpc->label, pConn, - taosMsg[pConn->outType], pConn->peerFqdn, pConn->peerPort); + tTrace("%s, failed to send msg:%s to %s:%hu", pConn->info, taosMsg[pConn->outType], pConn->peerFqdn, pConn->peerPort); reportDisc = 1; } } else { - tTrace("%s %p, retry timer not processed", pRpc->label, pConn); + tTrace("%s, retry timer not processed", pConn->info); } rpcUnlockConn(pConn); @@ -1187,10 +1190,10 @@ static void rpcProcessIdleTimer(void *param, void *tmrId) { SRpcInfo *pRpc = pConn->pRpc; if (pConn->user[0]) { - tTrace("%s %p, close the connection since no activity", pRpc->label, pConn); + tTrace("%s, close the connection since no activity", pConn->info); if (pConn->inType && pRpc->cfp) { // if there are pending request, notify the app - tTrace("%s %p, notify the app, connection is gone", pRpc->label, pConn); + tTrace("%s, notify the app, connection is gone", pConn->info); /* SRpcMsg rpcMsg; rpcMsg.pCont = NULL; @@ -1203,7 +1206,7 @@ static void rpcProcessIdleTimer(void *param, void *tmrId) { } rpcCloseConn(pConn); } else { - tTrace("%s %p, idle timer:%p not processed", pRpc->label, pConn, tmrId); + tTrace("%s, idle timer:%p not processed", pConn->info, tmrId); } } @@ -1214,11 +1217,11 @@ static void rpcProcessProgressTimer(void *param, void *tmrId) { rpcLockConn(pConn); if (pConn->inType && pConn->user[0]) { - tTrace("%s %p, progress timer expired, send progress", pRpc->label, pConn); + tTrace("%s, progress timer expired, send progress", pConn->info); rpcSendQuickRsp(pConn, TSDB_CODE_ACTION_IN_PROGRESS); taosTmrReset(rpcProcessProgressTimer, tsRpcTimer/2, pConn, pRpc->tmrCtrl, &pConn->pTimer); } else { - tTrace("%s %p, progress timer:%p not processed", pRpc->label, pConn, tmrId); + tTrace("%s, progress timer:%p not processed", pConn->info, tmrId); } rpcUnlockConn(pConn); @@ -1252,7 +1255,7 @@ static int32_t rpcCompressRpcMsg(char* pCont, int32_t contLen) { memcpy(pCont + overhead, buf, compLen); pHead->comp = 1; - tTrace("compress rpc msg, before:%d, after:%d", contLen, compLen); + //tTrace("compress rpc msg, before:%d, after:%d", contLen, compLen); finalLen = compLen + overhead; } else { finalLen = contLen; @@ -1286,7 +1289,7 @@ static SRpcHead *rpcDecompressRpcMsg(SRpcHead *pHead) { pNewHead->msgLen = rpcMsgLenFromCont(origLen); rpcFreeMsg(pHead); // free the compressed message buffer pHead = pNewHead; - tTrace("decompress rpc msg, compLen:%d, after:%d", compLen, contLen); + //tTrace("decompress rpc msg, compLen:%d, after:%d", compLen, contLen); } else { tError("failed to allocate memory to decompress msg, contLen:%d", contLen); } @@ -1343,7 +1346,6 @@ static int rpcAddAuthPart(SRpcConn *pConn, char *msg, int msgLen) { static int rpcCheckAuthentication(SRpcConn *pConn, char *msg, int msgLen) { SRpcHead *pHead = (SRpcHead *)msg; - SRpcInfo *pRpc = pConn->pRpc; int code = 0; if ((pConn->secured && pHead->spi == 0) || (pHead->spi == 0 && pConn->spi == 0)){ @@ -1371,20 +1373,20 @@ static int rpcCheckAuthentication(SRpcConn *pConn, char *msg, int msgLen) { delta = (int32_t)htonl(pDigest->timeStamp); delta -= (int32_t)taosGetTimestampSec(); if (abs(delta) > 900) { - tWarn("%s %p, time diff:%d is too big, msg discarded", pRpc->label, pConn, delta); + tWarn("%s, time diff:%d is too big, msg discarded", pConn->info, delta); code = TSDB_CODE_INVALID_TIME_STAMP; } else { if (rpcAuthenticateMsg(pHead, msgLen-TSDB_AUTH_LEN, pDigest->auth, pConn->secret) < 0) { - tError("%s %p, authentication failed, msg discarded", pRpc->label, pConn); + tError("%s, authentication failed, msg discarded", pConn->info); code = TSDB_CODE_AUTH_FAILURE; } else { pHead->msgLen = (int32_t)htonl((uint32_t)pHead->msgLen) - sizeof(SRpcDigest); if ( !rpcIsReq(pHead->msgType) ) pConn->secured = 1; // link is secured for client - tTrace("%s %p, message is authenticated", pRpc->label, pConn); + //tTrace("%s, message is authenticated", pConn->info); } } } else { - tTrace("%s %p, auth spi:%d not matched with received:%d", pRpc->label, pConn, pConn->spi, pHead->spi); + tError("%s, auth spi:%d not matched with received:%d", pConn->info, pConn->spi, pHead->spi); code = TSDB_CODE_AUTH_FAILURE; } diff --git a/src/rpc/src/rpcUdp.c b/src/rpc/src/rpcUdp.c index c551f6b1db..677187e3b9 100644 --- a/src/rpc/src/rpcUdp.c +++ b/src/rpc/src/rpcUdp.c @@ -218,7 +218,7 @@ static void *taosRecvUdpData(void *param) { while (1) { dataLen = recvfrom(pConn->fd, pConn->buffer, RPC_MAX_UDP_SIZE, 0, (struct sockaddr *)&sourceAdd, &addLen); port = ntohs(sourceAdd.sin_port); - tTrace("%s msg is recv from 0x%x:%hu len:%d", pConn->label, sourceAdd.sin_addr.s_addr, port, dataLen); + //tTrace("%s msg is recv from 0x%x:%hu len:%d", pConn->label, sourceAdd.sin_addr.s_addr, port, dataLen); if (dataLen < sizeof(SRpcHead)) { tError("%s recvfrom failed, reason:%s\n", pConn->label, strerror(errno)); From 538538205acc44c671351d06bd4a6962edbb473e Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Sun, 17 May 2020 22:49:22 +0800 Subject: [PATCH 100/126] TD-355 --- src/mnode/inc/mgmtDef.h | 1 + src/mnode/src/mgmtTable.c | 5 +++-- 2 files changed, 4 insertions(+), 2 deletions(-) diff --git a/src/mnode/inc/mgmtDef.h b/src/mnode/inc/mgmtDef.h index 894ee87099..7c1fd6c5ab 100644 --- a/src/mnode/inc/mgmtDef.h +++ b/src/mnode/inc/mgmtDef.h @@ -77,6 +77,7 @@ typedef struct SSuperTableObj { uint64_t uid; int64_t createdTime; int32_t sversion; + int32_t tversion; int32_t numOfColumns; int32_t numOfTags; int8_t reserved[15]; diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index 28b3c6e3dd..ce4cdfbcec 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -763,6 +763,7 @@ static void mgmtProcessCreateSuperTableMsg(SQueuedMsg *pMsg) { pStable->createdTime = taosGetTimestampMs(); pStable->uid = (((uint64_t) pStable->createdTime) << 16) + (sdbGetVersion() & ((1ul << 16) - 1ul)); pStable->sversion = 0; + pStable->tversion = 0; pStable->numOfColumns = htons(pCreate->numOfColumns); pStable->numOfTags = htons(pCreate->numOfTags); @@ -882,7 +883,7 @@ static int32_t mgmtAddSuperTableTag(SSuperTableObj *pStable, SSchema schema[], i } pStable->numOfTags += ntags; - pStable->sversion++; + pStable->tversion++; SSdbOper oper = { .type = SDB_OPER_GLOBAL, @@ -909,7 +910,7 @@ static int32_t mgmtDropSuperTableTag(SSuperTableObj *pStable, char *tagName) { memmove(pStable->schema + pStable->numOfColumns + col, pStable->schema + pStable->numOfColumns + col + 1, sizeof(SSchema) * (pStable->numOfTags - col - 1)); pStable->numOfTags--; - pStable->sversion++; + pStable->tversion++; SSdbOper oper = { .type = SDB_OPER_GLOBAL, From bab5f8209e529d390c97e5240bfdeb2fb1d77200 Mon Sep 17 00:00:00 2001 From: Jeff Tao Date: Sun, 17 May 2020 15:20:30 +0000 Subject: [PATCH 101/126] tune the debug info --- src/client/src/tscServer.c | 13 +++-- src/common/inc/qsqltype.h | 111 +++++++++++++++++++++++++++++++++++++ src/common/src/sqlcmdstr.c | 18 ++++++ src/query/inc/qsqltype.h | 96 -------------------------------- src/rpc/src/rpcMain.c | 2 +- 5 files changed, 137 insertions(+), 103 deletions(-) create mode 100644 src/common/inc/qsqltype.h create mode 100644 src/common/src/sqlcmdstr.c delete mode 100644 src/query/inc/qsqltype.h diff --git a/src/client/src/tscServer.c b/src/client/src/tscServer.c index 110377d112..6cfcc134e5 100644 --- a/src/client/src/tscServer.c +++ b/src/client/src/tscServer.c @@ -27,6 +27,7 @@ #include "ttimer.h" #include "tutil.h" #include "tscLog.h" +#include "qsqltype.h" #define TSC_MGMT_VNODE 999 @@ -207,7 +208,7 @@ int tscSendMsgToServer(SSqlObj *pSql) { memcpy(pMsg, pSql->cmd.payload, pSql->cmd.payloadLen); } - tscTrace("%p msg:%s is sent to server", pSql, taosMsg[pSql->cmd.msgType]); + // tscTrace("%p msg:%s is sent to server", pSql, taosMsg[pSql->cmd.msgType]); SRpcMsg rpcMsg = { .msgType = pSql->cmd.msgType, @@ -235,7 +236,7 @@ void tscProcessMsgFromServer(SRpcMsg *rpcMsg, SRpcIpSet *pIpSet) { SSqlRes *pRes = &pSql->res; SSqlCmd *pCmd = &pSql->cmd; STscObj *pObj = pSql->pTscObj; - tscTrace("%p msg:%s is received from server", pSql, taosMsg[rpcMsg->msgType]); + // tscTrace("%p msg:%s is received from server", pSql, taosMsg[rpcMsg->msgType]); if (pSql->freed || pObj->signature != pObj) { tscTrace("%p sql is already released or DB connection is closed, freed:%d pObj:%p signature:%p", pSql, pSql->freed, @@ -340,10 +341,10 @@ void tscProcessMsgFromServer(SRpcMsg *rpcMsg, SRpcIpSet *pIpSet) { pMsg->numOfFailedBlocks = htonl(pMsg->numOfFailedBlocks); pRes->numOfRows += pMsg->affectedRows; - tscTrace("%p cmd:%d code:%s, inserted rows:%d, rsp len:%d", pSql, pCmd->command, tstrerror(pRes->code), - pMsg->affectedRows, pRes->rspLen); + tscTrace("%p SQL cmd:%s, code:%s inserted rows:%d rspLen:%d", pSql, sqlCmd[pCmd->command], + tstrerror(pRes->code), pMsg->affectedRows, pRes->rspLen); } else { - tscTrace("%p cmd:%d code:%s rsp len:%d", pSql, pCmd->command, tstrerror(pRes->code), pRes->rspLen); + tscTrace("%p SQL cmd:%s, code:%s rspLen:%d", pSql, sqlCmd[pCmd->command], tstrerror(pRes->code), pRes->rspLen); } } @@ -426,7 +427,7 @@ int tscProcessSql(SSqlObj *pSql) { assert((pQueryInfo->numOfTables == 0 && pQueryInfo->command == TSDB_SQL_HB) || pQueryInfo->numOfTables > 0); } - tscTrace("%p SQL cmd:%d will be processed, name:%s, type:%d", pSql, pCmd->command, name, type); + tscTrace("%p SQL cmd:%s will be processed, name:%s, type:%d", pSql, sqlCmd[pCmd->command], name, type); if (pCmd->command < TSDB_SQL_MGMT) { // the pTableMetaInfo cannot be NULL if (pTableMetaInfo == NULL) { pSql->res.code = TSDB_CODE_OTHERS; diff --git a/src/common/inc/qsqltype.h b/src/common/inc/qsqltype.h new file mode 100644 index 0000000000..d1e5bcaa52 --- /dev/null +++ b/src/common/inc/qsqltype.h @@ -0,0 +1,111 @@ +/* + * Copyright (c) 2019 TAOS Data, Inc. + * + * This program is free software: you can use, redistribute, and/or modify + * it under the terms of the GNU Affero General Public License, version 3 + * or later ("AGPL"), as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see . + */ + +#ifndef TDENGINE_QSQLCMD_H +#define TDENGINE_QSQLCMD_H + +#ifdef __cplusplus +extern "C" { +#endif + +// sql type + +#ifdef TSDB_SQL_C +#define TSDB_DEFINE_SQL_TYPE( name, msg ) msg, +char *sqlCmd[] = { + "null", +#else +#define TSDB_DEFINE_SQL_TYPE( name, msg ) name, +enum { + TSDB_SQL_NULL = 0, +#endif + + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_SELECT, "select" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_FETCH, "fetch" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_INSERT, "insert" ) + + // the SQL below is for mgmt node + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_MGMT, "mgmt" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CREATE_DB, "create-db" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CREATE_TABLE, "create-table" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_DROP_DB, "drop-db" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_DROP_TABLE, "drop-table" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CREATE_ACCT, "create-acct" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CREATE_USER, "create-user" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_DROP_ACCT, "drop-acct" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_DROP_USER, "drop-user" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_ALTER_USER, "alter-user" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_ALTER_ACCT, "alter-acct" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_ALTER_TABLE, "alter-table" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_ALTER_DB, "alter-db" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CREATE_MNODE, "create-mnode" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_DROP_MNODE, "drop-mnode" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CREATE_DNODE, "create-dnode" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_DROP_DNODE, "drop-dnode" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CFG_DNODE, "cfg-dnode" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CFG_MNODE, "cfg-mnode" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_SHOW, "show" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_RETRIEVE, "retrieve" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_KILL_QUERY, "kill-query" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_KILL_STREAM, "kill-stream" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_KILL_CONNECTION, "kill-connection" ) + + // SQL below is for read operation + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_READ, "read" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CONNECT, "connect" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_USE_DB, "use-db" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_META, "meta" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_STABLEVGROUP, "stable-vgroup" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_MULTI_META, "multi-meta" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_HB, "heart-beat" ) + + // SQL below for client local + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_LOCAL, "local" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_DESCRIBE_TABLE, "describe-table" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_RETRIEVE_LOCALMERGE, "retrieve-localmerge" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_TABLE_JOIN_RETRIEVE, "join-retrieve" ) + + /* + * build empty result instead of accessing dnode to fetch result + * reset the client cache + */ + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_RETRIEVE_EMPTY_RESULT, "retrieve-empty-result" ) + + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_RESET_CACHE, "reset-cache" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_SERV_STATUS, "serv-status" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CURRENT_DB, "current-db" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_SERV_VERSION, "serv-version" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CLI_VERSION, "cli-version" ) + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CURRENT_USER, "current-user ") + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_CFG_LOCAL, "cfg-local" ) + + TSDB_DEFINE_SQL_TYPE( TSDB_SQL_MAX, "max" ) +}; + +// create table operation type +enum TSQL_TYPE { + TSQL_CREATE_TABLE = 0x1, + TSQL_CREATE_STABLE = 0x2, + TSQL_CREATE_TABLE_FROM_STABLE = 0x3, + TSQL_CREATE_STREAM = 0x4, +}; + +extern char *sqlCmd[]; + +#ifdef __cplusplus +} +#endif + +#endif // TDENGINE_QSQLCMD_H diff --git a/src/common/src/sqlcmdstr.c b/src/common/src/sqlcmdstr.c new file mode 100644 index 0000000000..8584ba7976 --- /dev/null +++ b/src/common/src/sqlcmdstr.c @@ -0,0 +1,18 @@ +/* + * Copyright (c) 2019 TAOS Data, Inc. + * + * This program is free software: you can use, redistribute, and/or modify + * it under the terms of the GNU Affero General Public License, version 3 + * or later ("AGPL"), as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. + * + * You should have received a copy of the GNU Affero General Public License + * along with this program. If not, see . + */ + +#define TSDB_SQL_C + +#include "qsqltype.h" diff --git a/src/query/inc/qsqltype.h b/src/query/inc/qsqltype.h deleted file mode 100644 index 4087be49ee..0000000000 --- a/src/query/inc/qsqltype.h +++ /dev/null @@ -1,96 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#ifndef TDENGINE_QSQLCMD_H -#define TDENGINE_QSQLCMD_H - -#ifdef __cplusplus -extern "C" { -#endif - -enum _sql_type { - TSDB_SQL_SELECT = 1, - TSDB_SQL_FETCH, - TSDB_SQL_INSERT, - - TSDB_SQL_MGMT, // the SQL below is for mgmt node - TSDB_SQL_CREATE_DB, - TSDB_SQL_CREATE_TABLE, - TSDB_SQL_DROP_DB, - TSDB_SQL_DROP_TABLE, - TSDB_SQL_CREATE_ACCT, - TSDB_SQL_CREATE_USER, // 10 - TSDB_SQL_DROP_ACCT, - TSDB_SQL_DROP_USER, - TSDB_SQL_ALTER_USER, - TSDB_SQL_ALTER_ACCT, - TSDB_SQL_ALTER_TABLE, - TSDB_SQL_ALTER_DB, - TSDB_SQL_CREATE_MNODE, - TSDB_SQL_DROP_MNODE, - TSDB_SQL_CREATE_DNODE, - TSDB_SQL_DROP_DNODE, // 20 - TSDB_SQL_CFG_DNODE, - TSDB_SQL_CFG_MNODE, - TSDB_SQL_SHOW, - TSDB_SQL_RETRIEVE, - TSDB_SQL_KILL_QUERY, - TSDB_SQL_KILL_STREAM, - TSDB_SQL_KILL_CONNECTION, - - TSDB_SQL_READ, // SQL below is for read operation - TSDB_SQL_CONNECT, - TSDB_SQL_USE_DB, // 30 - TSDB_SQL_META, - TSDB_SQL_STABLEVGROUP, - TSDB_SQL_MULTI_META, - TSDB_SQL_HB, - - TSDB_SQL_LOCAL, // SQL below for client local - TSDB_SQL_DESCRIBE_TABLE, - TSDB_SQL_RETRIEVE_LOCALMERGE, - TSDB_SQL_TABLE_JOIN_RETRIEVE, - - /* - * build empty result instead of accessing dnode to fetch result - * reset the client cache - */ - TSDB_SQL_RETRIEVE_EMPTY_RESULT, - - TSDB_SQL_RESET_CACHE, // 40 - TSDB_SQL_SERV_STATUS, - TSDB_SQL_CURRENT_DB, - TSDB_SQL_SERV_VERSION, - TSDB_SQL_CLI_VERSION, - TSDB_SQL_CURRENT_USER, - TSDB_SQL_CFG_LOCAL, - - TSDB_SQL_MAX // 47 -}; - - -// create table operation type -enum TSQL_TYPE { - TSQL_CREATE_TABLE = 0x1, - TSQL_CREATE_STABLE = 0x2, - TSQL_CREATE_TABLE_FROM_STABLE = 0x3, - TSQL_CREATE_STREAM = 0x4, -}; - -#ifdef __cplusplus -} -#endif - -#endif // TDENGINE_QSQLCMD_H diff --git a/src/rpc/src/rpcMain.c b/src/rpc/src/rpcMain.c index 118f57d89c..445e542387 100644 --- a/src/rpc/src/rpcMain.c +++ b/src/rpc/src/rpcMain.c @@ -1116,7 +1116,7 @@ static void rpcSendMsgToPeer(SRpcConn *pConn, void *msg, int msgLen) { htonl(pHead->code), msgLen, pHead->sourceId, pHead->destId, pHead->tranId); } - tTrace("connection type is: %d", pConn->connType); + //tTrace("connection type is: %d", pConn->connType); writtenLen = (*taosSendData[pConn->connType])(pConn->peerIp, pConn->peerPort, pHead, msgLen, pConn->chandle); if (writtenLen != msgLen) { From 055aed43e1389a934feebaeec4aae9bf19890e71 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Mon, 18 May 2020 01:40:08 +0000 Subject: [PATCH 102/126] TD-185 --- src/tsdb/inc/tsdbMain.h | 29 +++++--- src/tsdb/src/tsdbFile.c | 38 +--------- src/tsdb/src/tsdbMain.c | 10 ++- src/tsdb/src/tsdbMeta.c | 1 - src/tsdb/src/tsdbRWHelper.c | 136 ++++++++++++++++++++++++++++++++---- src/util/inc/tcoding.h | 10 +++ 6 files changed, 162 insertions(+), 62 deletions(-) diff --git a/src/tsdb/inc/tsdbMain.h b/src/tsdb/inc/tsdbMain.h index 0a1444c2f0..1885b57bc0 100644 --- a/src/tsdb/inc/tsdbMain.h +++ b/src/tsdb/inc/tsdbMain.h @@ -210,12 +210,17 @@ typedef enum { extern const char *tsdbFileSuffix[]; typedef struct { - int64_t size; // total size of the file - int64_t tombSize; // unused file size - int32_t totalBlocks; - int32_t totalSubBlocks; + uint32_t offset; + uint32_t len; + uint64_t size; // total size of the file + uint64_t tombSize; // unused file size + uint32_t totalBlocks; + uint32_t totalSubBlocks; } SFileInfo; +void *tsdbEncodeSFileInfo(void *buf, const SFileInfo *pInfo); +void *tsdbDecodeSFileInfo(void *buf, SFileInfo *pInfo); + typedef struct { int fd; char fname[128]; @@ -242,8 +247,7 @@ typedef struct { STsdbFileH *tsdbInitFileH(char *dataDir, STsdbCfg *pCfg); void tsdbCloseFileH(STsdbFileH *pFileH); -int tsdbCreateFile(char *dataDir, int fileId, const char *suffix, int maxTables, SFile *pFile, int writeHeader, - int toClose); +int tsdbCreateFile(char *dataDir, int fileId, const char *suffix, SFile *pFile); SFileGroup *tsdbCreateFGroup(STsdbFileH *pFileH, char *dataDir, int fid, int maxTables); int tsdbOpenFile(SFile *pFile, int oflag); int tsdbCloseFile(SFile *pFile); @@ -266,15 +270,18 @@ void tsdbSeekFileGroupIter(SFileGroupIter *pIter, int fid); SFileGroup *tsdbGetFileGroupNext(SFileGroupIter *pIter); typedef struct { - int32_t len; - int32_t offset; - int32_t padding; // For padding purpose - int32_t hasLast : 1; - int32_t numOfBlocks : 31; + uint32_t len; + uint32_t offset; + uint32_t padding; // For padding purpose + uint32_t hasLast : 2; + uint32_t numOfBlocks : 30; int64_t uid; TSKEY maxKey; } SCompIdx; /* sizeof(SCompIdx) = 28 */ +void *tsdbEncodeSCompIdx(void *buf, SCompIdx *pIdx); +void *tsdbDecodeSCompIdx(void *buf, SCompIdx *pIdx); + /** * if numOfSubBlocks == 0, then the SCompBlock is a sub-block * if numOfSubBlocks >= 1, then the SCompBlock is a super-block diff --git a/src/tsdb/src/tsdbFile.c b/src/tsdb/src/tsdbFile.c index ad98bb7b20..c9db9344c9 100644 --- a/src/tsdb/src/tsdbFile.c +++ b/src/tsdb/src/tsdbFile.c @@ -38,7 +38,6 @@ const char *tsdbFileSuffix[] = { static int compFGroupKey(const void *key, const void *fgroup); static int compFGroup(const void *arg1, const void *arg2); static int tsdbWriteFileHead(SFile *pFile); -static int tsdbWriteHeadFileIdx(SFile *pFile, int maxTables); static int tsdbOpenFGroup(STsdbFileH *pFileH, char *dataDir, int fid); STsdbFileH *tsdbInitFileH(char *dataDir, STsdbCfg *pCfg) { @@ -121,8 +120,7 @@ SFileGroup *tsdbCreateFGroup(STsdbFileH *pFileH, char *dataDir, int fid, int max if (pGroup == NULL) { // if not exists, create one pFGroup->fileId = fid; for (int type = TSDB_FILE_TYPE_HEAD; type < TSDB_FILE_TYPE_MAX; type++) { - if (tsdbCreateFile(dataDir, fid, tsdbFileSuffix[type], maxTables, &(pFGroup->files[type]), - type == TSDB_FILE_TYPE_HEAD ? 1 : 0, 1) < 0) + if (tsdbCreateFile(dataDir, fid, tsdbFileSuffix[type], &(pFGroup->files[type])) < 0) goto _err; } @@ -298,29 +296,6 @@ static int tsdbWriteFileHead(SFile *pFile) { return 0; } -static int tsdbWriteHeadFileIdx(SFile *pFile, int maxTables) { - int size = sizeof(SCompIdx) * maxTables + sizeof(TSCKSUM); - void *buf = calloc(1, size); - if (buf == NULL) return -1; - - if (lseek(pFile->fd, TSDB_FILE_HEAD_SIZE, SEEK_SET) < 0) { - free(buf); - return -1; - } - - taosCalcChecksumAppend(0, (uint8_t *)buf, size); - - if (write(pFile->fd, buf, size) < 0) { - free(buf); - return -1; - } - - pFile->info.size += size; - - free(buf); - return 0; -} - int tsdbGetFileName(char *dataDir, int fileId, const char *suffix, char *fname) { if (dataDir == NULL || fname == NULL) return -1; @@ -354,7 +329,7 @@ SFileGroup * tsdbOpenFilesForCommit(STsdbFileH *pFileH, int fid) { return pGroup; } -int tsdbCreateFile(char *dataDir, int fileId, const char *suffix, int maxTables, SFile *pFile, int writeHeader, int toClose) { +int tsdbCreateFile(char *dataDir, int fileId, const char *suffix, SFile *pFile) { memset((void *)pFile, 0, sizeof(SFile)); pFile->fd = -1; @@ -370,19 +345,12 @@ int tsdbCreateFile(char *dataDir, int fileId, const char *suffix, int maxTables, return -1; } - if (writeHeader) { - if (tsdbWriteHeadFileIdx(pFile, maxTables) < 0) { - tsdbCloseFile(pFile); - return -1; - } - } - if (tsdbWriteFileHead(pFile) < 0) { tsdbCloseFile(pFile); return -1; } - if (toClose) tsdbCloseFile(pFile); + tsdbCloseFile(pFile); return 0; } diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index c63de165d3..7254318d74 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -1148,8 +1148,16 @@ static void tsdbAlterKeep(STsdbRepo *pRepo, int32_t keep) { } static void tsdbAlterMaxTables(STsdbRepo *pRepo, int32_t maxTables) { - // TODO int oldMaxTables = pRepo->config.maxTables; + if (oldMaxTables < pRepo->config.maxTables) { + // TODO + } + + STsdbMeta *pMeta = pRepo->tsdbMeta; + + pMeta->maxTables = maxTables; + pMeta->tables = realloc(pMeta->tables, maxTables * sizeof(STable *)); + tsdbTrace("vgId:%d, tsdb maxTables is changed from %d to %d!", pRepo->config.tsdbId, oldMaxTables, maxTables); } diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index aaea50267d..1b161a4ad7 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -154,7 +154,6 @@ STsdbMeta *tsdbInitMeta(char *rootDir, int32_t maxTables) { STsdbMeta *pMeta = (STsdbMeta *)malloc(sizeof(STsdbMeta)); if (pMeta == NULL) return NULL; - pMeta->maxTables = maxTables; pMeta->nTables = 0; pMeta->superList = NULL; pMeta->tables = (STable **)calloc(maxTables, sizeof(STable *)); diff --git a/src/tsdb/src/tsdbRWHelper.c b/src/tsdb/src/tsdbRWHelper.c index 829d7ab3fd..350fde412c 100644 --- a/src/tsdb/src/tsdbRWHelper.c +++ b/src/tsdb/src/tsdbRWHelper.c @@ -18,6 +18,7 @@ #include "tchecksum.h" #include "tscompression.h" #include "talgo.h" +#include "tcoding.h" // Local function definitions // static int tsdbCheckHelperCfg(SHelperCfg *pCfg); @@ -211,13 +212,15 @@ int tsdbSetAndOpenHelperFile(SRWHelper *pHelper, SFileGroup *pGroup) { // Create and open .h if (tsdbOpenFile(&(pHelper->files.nHeadF), O_WRONLY | O_CREAT) < 0) return -1; - size_t tsize = TSDB_FILE_HEAD_SIZE + sizeof(SCompIdx) * pHelper->config.maxTables + sizeof(TSCKSUM); - if (tsendfile(pHelper->files.nHeadF.fd, pHelper->files.headF.fd, NULL, tsize) < tsize) goto _err; + // size_t tsize = TSDB_FILE_HEAD_SIZE + sizeof(SCompIdx) * pHelper->config.maxTables + sizeof(TSCKSUM); + if (tsendfile(pHelper->files.nHeadF.fd, pHelper->files.headF.fd, NULL, TSDB_FILE_HEAD_SIZE) < TSDB_FILE_HEAD_SIZE) + goto _err; // Create and open .l file if should if (tsdbShouldCreateNewLast(pHelper)) { if (tsdbOpenFile(&(pHelper->files.nLastF), O_WRONLY | O_CREAT) < 0) goto _err; - if (tsendfile(pHelper->files.nLastF.fd, pHelper->files.lastF.fd, NULL, TSDB_FILE_HEAD_SIZE) < TSDB_FILE_HEAD_SIZE) goto _err; + if (tsendfile(pHelper->files.nLastF.fd, pHelper->files.lastF.fd, NULL, TSDB_FILE_HEAD_SIZE) < TSDB_FILE_HEAD_SIZE) + goto _err; } } else { if (tsdbOpenFile(&(pHelper->files.dataF), O_RDONLY) < 0) goto _err; @@ -426,13 +429,26 @@ int tsdbWriteCompInfo(SRWHelper *pHelper) { int tsdbWriteCompIdx(SRWHelper *pHelper) { ASSERT(TSDB_HELPER_TYPE(pHelper) == TSDB_WRITE_HELPER); - if (lseek(pHelper->files.nHeadF.fd, TSDB_FILE_HEAD_SIZE, SEEK_SET) < 0) return -1; + off_t offset = lseek(pHelper->files.nHeadF.fd, 0, SEEK_END); + if (offset < 0) return -1; - ASSERT(tsizeof(pHelper->pCompIdx) == sizeof(SCompIdx) * pHelper->config.maxTables + sizeof(TSCKSUM)); - taosCalcChecksumAppend(0, (uint8_t *)pHelper->pCompIdx, tsizeof(pHelper->pCompIdx)); + SFile *pFile = &(pHelper->files.nHeadF); + pFile->info.offset = offset; - if (twrite(pHelper->files.nHeadF.fd, (void *)pHelper->pCompIdx, tsizeof(pHelper->pCompIdx)) < tsizeof(pHelper->pCompIdx)) - return -1; + void *buf = pHelper->blockBuffer; + for (uint32_t i = 0; i < pHelper->config.maxTables; i++) { + SCompIdx *pCompIdx = pHelper->pCompIdx + i; + if (pCompIdx->offset > 0) { + buf = taosEncodeVariant32(buf, i); + buf = tsdbEncodeSCompIdx(buf, pCompIdx); + } + } + + int tsize = (char *)buf - (char *)pHelper->blockBuffer + sizeof(TSCKSUM); + taosCalcChecksumAppend(0, (uint8_t *)pHelper->blockBuffer, tsize); + + if (twrite(pHelper->files.nHeadF.fd, (void *)pHelper->blockBuffer, tsize) < tsize) return -1; + pFile->info.len = tsize; return 0; } @@ -441,14 +457,34 @@ int tsdbLoadCompIdx(SRWHelper *pHelper, void *target) { if (!helperHasState(pHelper, TSDB_HELPER_IDX_LOAD)) { // If not load from file, just load it in object - int fd = pHelper->files.headF.fd; + SFile *pFile = &(pHelper->files.headF); + int fd = pFile->fd; - if (lseek(fd, TSDB_FILE_HEAD_SIZE, SEEK_SET) < 0) return -1; - if (tread(fd, (void *)(pHelper->pCompIdx), tsizeof((void *)pHelper->pCompIdx)) < tsizeof(pHelper->pCompIdx)) return -1; - if (!taosCheckChecksumWhole((uint8_t *)(pHelper->pCompIdx), tsizeof((void *)pHelper->pCompIdx))) { - // TODO: File is broken, try to deal with it - return -1; + memset(pHelper->pCompIdx, 0, tsizeof(pHelper->pCompIdx)); + if (pFile->info.offset > 0) { + ASSERT(pFile->info.offset > TSDB_FILE_HEAD_SIZE); + + if (lseek(fd, pFile->info.offset, SEEK_SET) < 0) return -1; + if (tread(fd, (void *)(pHelper->blockBuffer), pFile->info.len) < pFile->info.len) + return -1; + if (!taosCheckChecksumWhole((uint8_t *)(pHelper->blockBuffer), pFile->info.len)) { + // TODO: File is broken, try to deal with it + return -1; + } + + // Decode it + void *ptr = pHelper->blockBuffer; + while ((char *)ptr - (char *)pHelper->blockBuffer >= pFile->info.len - sizeof(TSCKSUM)) { + uint32_t tid = 0; + if ((ptr = taosDecodeVariant32(ptr, &tid)) == NULL) return -1; + ASSERT(tid > 0 && tid < pHelper->config.maxTables); + + if ((ptr = tsdbDecodeSCompIdx(ptr, pHelper->pCompIdx + tid)) == NULL) return -1; + + ASSERT((char *)ptr - (char *)pHelper->blockBuffer <= pFile->info.len - sizeof(TSCKSUM)); + } } + } helperSetState(pHelper, TSDB_HELPER_IDX_LOAD); @@ -1168,4 +1204,76 @@ static int tsdbGetRowsInRange(SDataCols *pDataCols, TSKEY minKey, TSKEY maxKey) if ((TSKEY *)ptr2 - (TSKEY *)ptr1 < 0) return 0; return ((TSKEY *)ptr2 - (TSKEY *)ptr1) + 1; +} + +void *tsdbEncodeSCompIdx(void *buf, SCompIdx *pIdx) { + buf = taosEncodeVariant32(buf, pIdx->len); + buf = taosEncodeVariant32(buf, pIdx->offset); + buf = taosEncodeFixed8(buf, pIdx->hasLast); + buf = taosEncodeVariant32(buf, pIdx->numOfBlocks); + buf = taosEncodeFixed64(buf, pIdx->uid); + buf = taosEncodeFixed64(buf, pIdx->maxKey); + + return buf; +} + +void *tsdbDecodeSCompIdx(void *buf, SCompIdx *pIdx) { + uint8_t hasLast = 0; + uint32_t numOfBlocks = 0; + uint64_t value = 0; + + if ((buf = taosDecodeVariant32(buf, &(pIdx->len))) == NULL) return NULL; + if ((buf = taosDecodeVariant32(buf, &(pIdx->offset))) == NULL) return NULL; + if ((buf = taosDecodeFixed8(buf, &(hasLast))) == NULL) return NULL; + pIdx->hasLast = hasLast; + if ((buf = taosDecodeVariant32(buf, &(numOfBlocks))) == NULL) return NULL; + pIdx->numOfBlocks = numOfBlocks; + if ((buf = taosDecodeFixed64(buf, &value)) == NULL) return NULL; + pIdx->uid = (int64_t)value; + if ((buf = taosDecodeFixed64(buf, &value)) == NULL) return NULL; + pIdx->maxKey = (TSKEY)value; + + return buf; +} + +int tsdbUpdateFileHeader(SFile *pFile, uint32_t version) { + char buf[TSDB_FILE_HEAD_SIZE] = "\0"; + + void *pBuf = (void *)buf; + pBuf = taosEncodeFixed32(pBuf, version); + pBuf = tsdbEncodeSFileInfo(pBuf, &(pFile->info)); + int tsize = (char *)pBuf - buf + sizeof(TSCKSUM); + + ASSERT(tsize <= TSDB_FILE_HEAD_SIZE); + + taosCalcChecksumAppend(0, (uint8_t *)buf, tsize); + + if (lseek(pFile->fd, 0, SEEK_SET) < 0) return -1; + if (twrite(pFile->fd, (void *)buf, TSDB_FILE_HEAD_SIZE) < TSDB_FILE_HEAD_SIZE) return -1; + + return 0; +} + + + +void *tsdbEncodeSFileInfo(void *buf, const SFileInfo *pInfo) { + buf = taosEncodeFixed32(buf, pInfo->offset); + buf = taosEncodeFixed32(buf, pInfo->len); + buf = taosEncodeFixed64(buf, pInfo->size); + buf = taosEncodeFixed64(buf, pInfo->tombSize); + buf = taosEncodeFixed32(buf, pInfo->totalBlocks); + buf = taosEncodeFixed32(buf, pInfo->totalSubBlocks); + + return buf; +} + +void *tsdbDecodeSFileInfo(void *buf, SFileInfo *pInfo) { + buf = taosDecodeFixed32(buf, &(pInfo->offset)); + buf = taosDecodeFixed32(buf, &(pInfo->len)); + buf = taosDecodeFixed64(buf, &(pInfo->size)); + buf = taosDecodeFixed64(buf, &(pInfo->tombSize)); + buf = taosDecodeFixed32(buf, &(pInfo->totalBlocks)); + buf = taosDecodeFixed32(buf, &(pInfo->totalSubBlocks)); + + return buf; } \ No newline at end of file diff --git a/src/util/inc/tcoding.h b/src/util/inc/tcoding.h index 9f64f127e1..b4f7f596c5 100644 --- a/src/util/inc/tcoding.h +++ b/src/util/inc/tcoding.h @@ -29,6 +29,11 @@ extern "C" { static const int32_t TNUMBER = 1; #define IS_LITTLE_ENDIAN() (*(uint8_t *)(&TNUMBER) != 0) +static FORCE_INLINE void *taosEncodeFixed8(void *buf, uint8_t value) { + ((uint8_t *)buf)[0] = value; + return POINTER_SHIFT(buf, sizeof(value)); +} + static FORCE_INLINE void *taosEncodeFixed16(void *buf, uint16_t value) { if (IS_LITTLE_ENDIAN()) { memcpy(buf, &value, sizeof(value)); @@ -70,6 +75,11 @@ static FORCE_INLINE void *taosEncodeFixed64(void *buf, uint64_t value) { return POINTER_SHIFT(buf, sizeof(value)); } +static FORCE_INLINE void *taosDecodeFixed8(void *buf, uint8_t *value) { + *value = ((uint8_t *)buf)[0]; + return POINTER_SHIFT(buf, sizeof(*value)); +} + static FORCE_INLINE void *taosDecodeFixed16(void *buf, uint16_t *value) { if (IS_LITTLE_ENDIAN()) { memcpy(value, buf, sizeof(*value)); From 936d9a330de2cbdacdd23467e41a6eecd25374d6 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 10:23:39 +0800 Subject: [PATCH 103/126] [TD-332] fix duplicate type in shell/taosdemo/taosdump --- src/kit/shell/inc/shell.h | 23 +++++++++-------- src/kit/shell/src/shellEngine.c | 4 +-- src/kit/shell/src/shellImport.c | 4 +-- src/kit/shell/src/shellLinux.c | 4 +-- src/kit/shell/src/shellMain.c | 2 +- src/kit/taosdemo/taosdemo.c | 8 +++--- src/kit/taosdump/taosdump.c | 44 ++++++++++++++++----------------- 7 files changed, 44 insertions(+), 45 deletions(-) diff --git a/src/kit/shell/inc/shell.h b/src/kit/shell/inc/shell.h index 381c6f1dbf..549b0ef977 100644 --- a/src/kit/shell/inc/shell.h +++ b/src/kit/shell/inc/shell.h @@ -41,14 +41,13 @@ // dynamic config timestamp width according to maximum time precision extern int32_t TIMESTAMP_OUTPUT_LENGTH; -typedef struct History History; -struct History { +typedef struct SShellHistory { char* hist[MAX_HISTORY_SIZE]; int hstart; int hend; -}; +} SShellHistory; -struct arguments { +typedef struct SShellArguments { char* host; char* password; char* user; @@ -62,11 +61,11 @@ struct arguments { char* commands; int abort; int port; -}; +} SShellArguments; /**************** Function declarations ****************/ -extern void shellParseArgument(int argc, char* argv[], struct arguments* arguments); -extern TAOS* shellInit(struct arguments* args); +extern void shellParseArgument(int argc, char* argv[], SShellArguments* arguments); +extern TAOS* shellInit(SShellArguments* args); extern void* shellLoopQuery(void* arg); extern void taos_error(TAOS* con); extern int regex_match(const char* s, const char* reg, int cflags); @@ -76,7 +75,7 @@ void shellRunCommandOnServer(TAOS* con, char command[]); void read_history(); void write_history(); void source_file(TAOS* con, char* fptr); -void source_dir(TAOS* con, struct arguments* args); +void source_dir(TAOS* con, SShellArguments* args); void get_history_path(char* history); void cleanup_handler(void* arg); void exitShell(); @@ -89,12 +88,12 @@ int isCommentLine(char *line); extern char PROMPT_HEADER[]; extern char CONTINUE_PROMPT[]; extern int prompt_size; -extern History history; +extern SShellHistory history; extern struct termios oldtio; extern void set_terminal_mode(); extern int get_old_terminal_mode(struct termios* tio); -extern void reset_terminal_mode(); -extern struct arguments args; -extern TAOS_RES* result; +extern void reset_terminal_mode(); +extern SShellArguments args; +extern TAOS_RES* result; #endif diff --git a/src/kit/shell/src/shellEngine.c b/src/kit/shell/src/shellEngine.c index 69475371dc..dbb05f6a35 100644 --- a/src/kit/shell/src/shellEngine.c +++ b/src/kit/shell/src/shellEngine.c @@ -33,12 +33,12 @@ char PROMPT_HEADER[] = "taos> "; char CONTINUE_PROMPT[] = " -> "; int prompt_size = 6; TAOS_RES *result = NULL; -History history; +SShellHistory history; /* * FUNCTION: Initialize the shell. */ -TAOS *shellInit(struct arguments *args) { +TAOS *shellInit(SShellArguments *args) { printf("\n"); printf(CLIENT_VERSION, tsOsName, taos_get_client_info()); fflush(stdout); diff --git a/src/kit/shell/src/shellImport.c b/src/kit/shell/src/shellImport.c index b29b96379b..2cbd07db4b 100644 --- a/src/kit/shell/src/shellImport.c +++ b/src/kit/shell/src/shellImport.c @@ -221,7 +221,7 @@ void* shellImportThreadFp(void *arg) return NULL; } -static void shellRunImportThreads(struct arguments* args) +static void shellRunImportThreads(SShellArguments* args) { pthread_attr_t thattr; ShellThreadObj *threadObj = (ShellThreadObj *)calloc(args->threadNum, sizeof(ShellThreadObj)); @@ -254,7 +254,7 @@ static void shellRunImportThreads(struct arguments* args) free(threadObj); } -void source_dir(TAOS* con, struct arguments* args) { +void source_dir(TAOS* con, SShellArguments* args) { shellGetDirectoryFileList(args->dir); int64_t start = taosGetTimestampMs(); diff --git a/src/kit/shell/src/shellLinux.c b/src/kit/shell/src/shellLinux.c index f5a1145cf8..da2bd94814 100644 --- a/src/kit/shell/src/shellLinux.c +++ b/src/kit/shell/src/shellLinux.c @@ -50,7 +50,7 @@ static struct argp_option options[] = { static error_t parse_opt(int key, char *arg, struct argp_state *state) { /* Get the input argument from argp_parse, which we know is a pointer to our arguments structure. */ - struct arguments *arguments = state->input; + SShellArguments *arguments = state->input; wordexp_t full_path; switch (key) { @@ -129,7 +129,7 @@ static error_t parse_opt(int key, char *arg, struct argp_state *state) { /* Our argp parser. */ static struct argp argp = {options, parse_opt, args_doc, doc}; -void shellParseArgument(int argc, char *argv[], struct arguments *arguments) { +void shellParseArgument(int argc, char *argv[], SShellArguments *arguments) { static char verType[32] = {0}; sprintf(verType, "version: %s\n", version); diff --git a/src/kit/shell/src/shellMain.c b/src/kit/shell/src/shellMain.c index b39fba285f..f8010b84cd 100644 --- a/src/kit/shell/src/shellMain.c +++ b/src/kit/shell/src/shellMain.c @@ -62,7 +62,7 @@ int checkVersion() { } // Global configurations -struct arguments args = { +SShellArguments args = { .host = NULL, .password = NULL, .user = NULL, diff --git a/src/kit/taosdemo/taosdemo.c b/src/kit/taosdemo/taosdemo.c index 33b76cea2d..3cacafa505 100644 --- a/src/kit/taosdemo/taosdemo.c +++ b/src/kit/taosdemo/taosdemo.c @@ -67,7 +67,7 @@ static struct argp_option options[] = { {0}}; /* Used by main to communicate with parse_opt. */ -struct arguments { +typedef struct DemoArguments { char *host; uint16_t port; char *user; @@ -87,13 +87,13 @@ struct arguments { int num_of_DPT; int abort; char **arg_list; -}; +} SDemoArguments; /* Parse a single option. */ static error_t parse_opt(int key, char *arg, struct argp_state *state) { /* Get the input argument from argp_parse, which we know is a pointer to our arguments structure. */ - struct arguments *arguments = state->input; + SDemoArguments *arguments = state->input; wordexp_t full_path; char **sptr; switch (key) { @@ -269,7 +269,7 @@ double getCurrentTime(); void callBack(void *param, TAOS_RES *res, int code); int main(int argc, char *argv[]) { - struct arguments arguments = {NULL, // host + SDemoArguments arguments = {NULL, // host 0, // port "root", // user "taosdata", // password diff --git a/src/kit/taosdump/taosdump.c b/src/kit/taosdump/taosdump.c index ed98a9b92c..adba091136 100644 --- a/src/kit/taosdump/taosdump.c +++ b/src/kit/taosdump/taosdump.c @@ -168,7 +168,7 @@ static struct argp_option options[] = { {0}}; /* Used by main to communicate with parse_opt. */ -struct arguments { +typedef struct SDumpArguments { // connection option char *host; char *user; @@ -193,13 +193,13 @@ struct arguments { char **arg_list; int arg_list_len; bool isDumpIn; -}; +} SDumpArguments; /* Parse a single option. */ static error_t parse_opt(int key, char *arg, struct argp_state *state) { /* Get the input argument from argp_parse, which we know is a pointer to our arguments structure. */ - struct arguments *arguments = state->input; + SDumpArguments *arguments = state->input; wordexp_t full_path; switch (key) { @@ -296,31 +296,31 @@ char *command = NULL; char *lcommand = NULL; char *buffer = NULL; -int taosDumpOut(struct arguments *arguments); +int taosDumpOut(SDumpArguments *arguments); -int taosDumpIn(struct arguments *arguments); +int taosDumpIn(SDumpArguments *arguments); void taosDumpCreateDbClause(SDbInfo *dbInfo, bool isDumpProperty, FILE *fp); -int taosDumpDb(SDbInfo *dbInfo, struct arguments *arguments, FILE *fp); +int taosDumpDb(SDbInfo *dbInfo, SDumpArguments *arguments, FILE *fp); -void taosDumpCreateTableClause(STableDef *tableDes, int numOfCols, struct arguments *arguments, FILE *fp); +void taosDumpCreateTableClause(STableDef *tableDes, int numOfCols, SDumpArguments *arguments, FILE *fp); -void taosDumpCreateMTableClause(STableDef *tableDes, char *metric, int numOfCols, struct arguments *arguments, +void taosDumpCreateMTableClause(STableDef *tableDes, char *metric, int numOfCols, SDumpArguments *arguments, FILE *fp); -int32_t taosDumpTable(char *table, char *metric, struct arguments *arguments, FILE *fp); +int32_t taosDumpTable(char *table, char *metric, SDumpArguments *arguments, FILE *fp); -int32_t taosDumpMetric(char *metric, struct arguments *arguments, FILE *fp); +int32_t taosDumpMetric(char *metric, SDumpArguments *arguments, FILE *fp); -int taosDumpTableData(FILE *fp, char *tbname, struct arguments *arguments); +int taosDumpTableData(FILE *fp, char *tbname, SDumpArguments *arguments); -int taosCheckParam(struct arguments *arguments); +int taosCheckParam(SDumpArguments *arguments); void taosFreeDbInfos(); int main(int argc, char *argv[]) { - struct arguments arguments = { + SDumpArguments arguments = { // connection option NULL, "root", "taosdata", 0, // output file @@ -424,7 +424,7 @@ int taosGetTableRecordInfo(char *table, STableRecordInfo *pTableRecordInfo) { return -1; } -int taosDumpOut(struct arguments *arguments) { +int taosDumpOut(SDumpArguments *arguments) { TAOS_ROW row; char *temp = NULL; FILE *fp = NULL; @@ -602,7 +602,7 @@ void taosDumpCreateDbClause(SDbInfo *dbInfo, bool isDumpProperty, FILE *fp) { fprintf(fp, "%s\n\n", buffer); } -int taosDumpDb(SDbInfo *dbInfo, struct arguments *arguments, FILE *fp) { +int taosDumpDb(SDbInfo *dbInfo, SDumpArguments *arguments, FILE *fp) { TAOS_ROW row; int fd = -1; STableRecord tableRecord; @@ -660,7 +660,7 @@ int taosDumpDb(SDbInfo *dbInfo, struct arguments *arguments, FILE *fp) { return 0; } -void taosDumpCreateTableClause(STableDef *tableDes, int numOfCols, struct arguments *arguments, FILE *fp) { +void taosDumpCreateTableClause(STableDef *tableDes, int numOfCols, SDumpArguments *arguments, FILE *fp) { char *pstr = NULL; pstr = buffer; int counter = 0; @@ -703,7 +703,7 @@ void taosDumpCreateTableClause(STableDef *tableDes, int numOfCols, struct argume fprintf(fp, "%s\n\n", buffer); } -void taosDumpCreateMTableClause(STableDef *tableDes, char *metric, int numOfCols, struct arguments *arguments, +void taosDumpCreateMTableClause(STableDef *tableDes, char *metric, int numOfCols, SDumpArguments *arguments, FILE *fp) { char *pstr = NULL; pstr = buffer; @@ -786,7 +786,7 @@ int taosGetTableDes(char *table, STableDef *tableDes) { return count; } -int32_t taosDumpTable(char *table, char *metric, struct arguments *arguments, FILE *fp) { +int32_t taosDumpTable(char *table, char *metric, SDumpArguments *arguments, FILE *fp) { int count = 0; STableDef *tableDes = (STableDef *)calloc(1, sizeof(STableDef) + sizeof(SColDes) * TSDB_MAX_COLUMNS); @@ -828,7 +828,7 @@ int32_t taosDumpTable(char *table, char *metric, struct arguments *arguments, FI return taosDumpTableData(fp, table, arguments); } -int32_t taosDumpMetric(char *metric, struct arguments *arguments, FILE *fp) { +int32_t taosDumpMetric(char *metric, SDumpArguments *arguments, FILE *fp) { TAOS_ROW row = NULL; int fd = -1; STableRecord tableRecord; @@ -877,7 +877,7 @@ int32_t taosDumpMetric(char *metric, struct arguments *arguments, FILE *fp) { return 0; } -int taosDumpTableData(FILE *fp, char *tbname, struct arguments *arguments) { +int taosDumpTableData(FILE *fp, char *tbname, SDumpArguments *arguments) { /* char temp[MAX_COMMAND_SIZE] = "\0"; */ int count = 0; char *pstr = NULL; @@ -987,7 +987,7 @@ int taosDumpTableData(FILE *fp, char *tbname, struct arguments *arguments) { return 0; } -int taosCheckParam(struct arguments *arguments) { +int taosCheckParam(SDumpArguments *arguments) { if (arguments->all_databases && arguments->databases) { fprintf(stderr, "conflict option --all-databases and --databases\n"); return -1; @@ -1072,7 +1072,7 @@ void taosReplaceCtrlChar(char *str) { *pstr = '\0'; } -int taosDumpIn(struct arguments *arguments) { +int taosDumpIn(SDumpArguments *arguments) { assert(arguments->isDumpIn); int tsize = 0; From 836d59398470e187c604b6bff3319f56bc09ccda Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 10:39:10 +0800 Subject: [PATCH 104/126] [TD-332] fix duplicate type in tsdb --- src/tsdb/inc/tsdbMain.h | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/src/tsdb/inc/tsdbMain.h b/src/tsdb/inc/tsdbMain.h index 0a1444c2f0..c5a6ed54c3 100644 --- a/src/tsdb/inc/tsdbMain.h +++ b/src/tsdb/inc/tsdbMain.h @@ -214,12 +214,12 @@ typedef struct { int64_t tombSize; // unused file size int32_t totalBlocks; int32_t totalSubBlocks; -} SFileInfo; +} STsdbFileInfo; typedef struct { int fd; char fname[128]; - SFileInfo info; + STsdbFileInfo info; } SFile; #define TSDB_IS_FILE_OPENED(f) ((f)->fd != -1) @@ -350,7 +350,7 @@ SFileGroup *tsdbSearchFGroup(STsdbFileH *pFileH, int fid); void tsdbGetKeyRangeOfFileId(int32_t daysPerFile, int8_t precision, int32_t fileId, TSKEY *minKey, TSKEY *maxKey); // TSDB repository definition -typedef struct _tsdb_repo { +typedef struct STsdbRepo { char *rootDir; // TSDB configuration STsdbCfg config; From 8b098e37c033c8e967ce88e141e691881b98ace5 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 11:09:16 +0800 Subject: [PATCH 105/126] [TD-319] change the length of fqdn from 72 to 256 --- src/inc/taosdef.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/inc/taosdef.h b/src/inc/taosdef.h index 61e82720b1..71c2b15ab9 100644 --- a/src/inc/taosdef.h +++ b/src/inc/taosdef.h @@ -218,7 +218,7 @@ void tsDataSwap(void *pLeft, void *pRight, int32_t type, int32_t size); #define TSDB_LOCALE_LEN 64 #define TSDB_TIMEZONE_LEN 64 -#define TSDB_FQDN_LEN 72 +#define TSDB_FQDN_LEN 256 #define TSDB_IPv4ADDR_LEN 16 #define TSDB_FILENAME_LEN 128 #define TSDB_METER_VNODE_BITS 20 From 916a7f292fa4370bfd64ff057085e187004354f2 Mon Sep 17 00:00:00 2001 From: Jeff Tao Date: Mon, 18 May 2020 03:21:44 +0000 Subject: [PATCH 106/126] [TD-319] put protection on host name length --- src/client/inc/tscUtil.h | 1 + src/client/src/tscServer.c | 30 +++++------------------------- src/client/src/tscSql.c | 28 +++++++--------------------- src/client/src/tscSystem.c | 13 +++++-------- src/client/src/tscUtil.c | 21 +++++++++++++++++++++ src/common/inc/tglobal.h | 2 +- src/common/src/tglobal.c | 4 ++-- src/inc/taoserror.h | 1 + 8 files changed, 43 insertions(+), 57 deletions(-) diff --git a/src/client/inc/tscUtil.h b/src/client/inc/tscUtil.h index dbbec01329..715d76e072 100644 --- a/src/client/inc/tscUtil.h +++ b/src/client/inc/tscUtil.h @@ -264,6 +264,7 @@ bool hasMoreVnodesToTry(SSqlObj *pSql); void tscTryQueryNextVnode(SSqlObj *pSql, __async_cb_func_t fp); void tscAsyncQuerySingleRowForNextVnode(void *param, TAOS_RES *tres, int numOfRows); void tscTryQueryNextClause(SSqlObj* pSql, void (*queryFp)()); +int tscSetMgmtIpListFromCfg(const char *first, const char *second); void* malloc_throw(size_t size); void* calloc_throw(size_t nmemb, size_t size); diff --git a/src/client/src/tscServer.c b/src/client/src/tscServer.c index 110377d112..91a54eb27e 100644 --- a/src/client/src/tscServer.c +++ b/src/client/src/tscServer.c @@ -67,7 +67,7 @@ void tscPrintMgmtIp() { } } -void tscSetMgmtIpListFromCluster(SRpcIpSet *pIpList) { +void tscSetMgmtIpList(SRpcIpSet *pIpList) { tscMgmtIpSet.numOfIps = pIpList->numOfIps; tscMgmtIpSet.inUse = pIpList->inUse; for (int32_t i = 0; i < tscMgmtIpSet.numOfIps; ++i) { @@ -75,16 +75,6 @@ void tscSetMgmtIpListFromCluster(SRpcIpSet *pIpList) { } } -void tscSetMgmtIpListFromEdge() { - if (tscMgmtIpSet.numOfIps != 1) { - tscMgmtIpSet.numOfIps = 1; - tscMgmtIpSet.inUse = 0; - taosGetFqdnPortFromEp(tsFirst, tscMgmtIpSet.fqdn[0], &tscMgmtIpSet.port[0]); - tscTrace("edge mgmt IP list:"); - tscPrintMgmtIp(); - } -} - void tscUpdateIpSet(void *ahandle, SRpcIpSet *pIpSet) { tscMgmtIpSet = *pIpSet; tscTrace("mgmt IP list is changed for ufp is called, numOfIps:%d inUse:%d", tscMgmtIpSet.numOfIps, tscMgmtIpSet.inUse); @@ -93,18 +83,6 @@ void tscUpdateIpSet(void *ahandle, SRpcIpSet *pIpSet) { } } -void tscSetMgmtIpList(SRpcIpSet *pIpList) { - /* - * The iplist returned by the cluster edition is the current management nodes - * and the iplist returned by the edge edition is empty - */ - if (pIpList->numOfIps != 0) { - tscSetMgmtIpListFromCluster(pIpList); - } else { - tscSetMgmtIpListFromEdge(); - } -} - /* * For each management node, try twice at least in case of poor network situation. * If the client start to connect to a non-management node from the client, and the first retry may fail due to @@ -132,7 +110,8 @@ void tscProcessHeartBeatRsp(void *param, TAOS_RES *tres, int code) { if (code == 0) { SCMHeartBeatRsp *pRsp = (SCMHeartBeatRsp *)pRes->pRsp; SRpcIpSet * pIpList = &pRsp->ipList; - tscSetMgmtIpList(pIpList); + if (pIpList->numOfIps > 0) + tscSetMgmtIpList(pIpList); if (pRsp->killConnection) { tscKillConnection(pObj); @@ -2224,7 +2203,8 @@ int tscProcessConnectRsp(SSqlObj *pSql) { assert(len <= tListLen(pObj->db)); strncpy(pObj->db, temp, tListLen(pObj->db)); - tscSetMgmtIpList(&pConnect->ipList); + if (pConnect->ipList.numOfIps > 0) + tscSetMgmtIpList(&pConnect->ipList); strcpy(pObj->sversion, pConnect->serverVersion); pObj->writeAuth = pConnect->writeAuth; diff --git a/src/client/src/tscSql.c b/src/client/src/tscSql.c index 87292f4fe6..d8ec104a50 100644 --- a/src/client/src/tscSql.c +++ b/src/client/src/tscSql.c @@ -65,32 +65,18 @@ STscObj *taosConnectImpl(const char *ip, const char *user, const char *pass, con terrno = TSDB_CODE_INVALID_PASS; return NULL; } - + + if (ip) { + if (tscSetMgmtIpListFromCfg(ip, NULL) < 0) return NULL; + if (port) tscMgmtIpSet.port[0] = port; + } + void *pDnodeConn = NULL; if (tscInitRpc(user, pass, &pDnodeConn) != 0) { terrno = TSDB_CODE_NETWORK_UNAVAIL; return NULL; } - - tscMgmtIpSet.numOfIps = 0; - - if (ip && ip[0]) { - tscMgmtIpSet.inUse = 0; - tscMgmtIpSet.numOfIps = 1; - strcpy(tscMgmtIpSet.fqdn[0], ip); - tscMgmtIpSet.port[0] = port? port: tsDnodeShellPort; - } else { - if (tsFirst[0] != 0) { - taosGetFqdnPortFromEp(tsFirst, tscMgmtIpSet.fqdn[tscMgmtIpSet.numOfIps], &tscMgmtIpSet.port[tscMgmtIpSet.numOfIps]); - tscMgmtIpSet.numOfIps++; - } - - if (tsSecond[0] != 0) { - taosGetFqdnPortFromEp(tsSecond, tscMgmtIpSet.fqdn[tscMgmtIpSet.numOfIps], &tscMgmtIpSet.port[tscMgmtIpSet.numOfIps]); - tscMgmtIpSet.numOfIps++; - } - } - + STscObj *pObj = (STscObj *)calloc(1, sizeof(STscObj)); if (NULL == pObj) { terrno = TSDB_CODE_CLI_OUT_OF_MEMORY; diff --git a/src/client/src/tscSystem.c b/src/client/src/tscSystem.c index 5d8652a631..5d56fef1e9 100644 --- a/src/client/src/tscSystem.c +++ b/src/client/src/tscSystem.c @@ -23,6 +23,7 @@ #include "tutil.h" #include "tsched.h" #include "tscLog.h" +#include "tscUtil.h" #include "tsclient.h" #include "tglobal.h" #include "tconfig.h" @@ -114,14 +115,10 @@ void taos_init_imp() { taosInitNote(tsNumOfLogLines / 10, 1, (char*)"tsc_note"); } - tscMgmtIpSet.inUse = 0; - tscMgmtIpSet.numOfIps = 1; - taosGetFqdnPortFromEp(tsFirst, tscMgmtIpSet.fqdn[0], &tscMgmtIpSet.port[0]); - - if (tsSecond[0] && strcmp(tsSecond, tsFirst) != 0) { - tscMgmtIpSet.numOfIps = 2; - taosGetFqdnPortFromEp(tsSecond, tscMgmtIpSet.fqdn[1], &tscMgmtIpSet.port[1]); - } + if (tscSetMgmtIpListFromCfg(tsFirst, tsSecond) < 0) { + tscError("failed to init mgmt IP list"); + return; + } tscInitMsgsFp(); int queueSize = tsMaxVnodeConnections + tsMaxMeterConnections + tsMaxMgmtConnections + tsMaxMgmtConnections; diff --git a/src/client/src/tscUtil.c b/src/client/src/tscUtil.c index 1d1e06d3a9..40d058d189 100644 --- a/src/client/src/tscUtil.c +++ b/src/client/src/tscUtil.c @@ -2163,3 +2163,24 @@ char* strdup_throw(const char* str) { } return p; } + +int tscSetMgmtIpListFromCfg(const char *first, const char *second) { + tscMgmtIpSet.numOfIps = 0; + tscMgmtIpSet.inUse = 0; + + if (first && first[0] != 0) { + if (strlen(first) >= TSDB_FQDN_LEN) return TSDB_CODE_INVALID_FQDN; + taosGetFqdnPortFromEp(first, tscMgmtIpSet.fqdn[tscMgmtIpSet.numOfIps], &tscMgmtIpSet.port[tscMgmtIpSet.numOfIps]); + tscMgmtIpSet.numOfIps++; + } + + if (second && second[0] != 0) { + if (strlen(second) >= TSDB_FQDN_LEN) return TSDB_CODE_INVALID_FQDN; + taosGetFqdnPortFromEp(second, tscMgmtIpSet.fqdn[tscMgmtIpSet.numOfIps], &tscMgmtIpSet.port[tscMgmtIpSet.numOfIps]); + tscMgmtIpSet.numOfIps++; + } + + if ( tscMgmtIpSet.numOfIps == 0) return TSDB_CODE_INVALID_FQDN; + + return 0; +} diff --git a/src/common/inc/tglobal.h b/src/common/inc/tglobal.h index b077f40945..da8f3cd1e1 100644 --- a/src/common/inc/tglobal.h +++ b/src/common/inc/tglobal.h @@ -175,7 +175,7 @@ void taosInitGlobalCfg(); bool taosCheckGlobalCfg(); void taosSetAllDebugFlag(); bool taosCfgDynamicOptions(char *msg); -int taosGetFqdnPortFromEp(char *ep, char *fqdn, uint16_t *port); +int taosGetFqdnPortFromEp(const char *ep, char *fqdn, uint16_t *port); #ifdef __cplusplus } diff --git a/src/common/src/tglobal.c b/src/common/src/tglobal.c index 90637265b3..18d8c9ebe2 100644 --- a/src/common/src/tglobal.c +++ b/src/common/src/tglobal.c @@ -61,7 +61,7 @@ int32_t tscEmbedded = 0; */ int64_t tsMsPerDay[] = {86400000L, 86400000000L}; -char tsFirst[TSDB_FQDN_LEN] = {0}; +char tsFirst[TSDB_FQDN_LEN] = {0}; char tsSecond[TSDB_FQDN_LEN] = {0}; char tsArbitrator[TSDB_FQDN_LEN] = {0}; char tsLocalEp[TSDB_FQDN_LEN] = {0}; // Local End Point, hostname:port @@ -1252,7 +1252,7 @@ bool taosCheckGlobalCfg() { return true; } -int taosGetFqdnPortFromEp(char *ep, char *fqdn, uint16_t *port) { +int taosGetFqdnPortFromEp(const char *ep, char *fqdn, uint16_t *port) { *port = 0; strcpy(fqdn, ep); diff --git a/src/inc/taoserror.h b/src/inc/taoserror.h index f9bc1404fe..1390d66113 100644 --- a/src/inc/taoserror.h +++ b/src/inc/taoserror.h @@ -170,6 +170,7 @@ TAOS_DEFINE_ERROR(TSDB_CODE_INVALID_QHANDLE, 0, 459, "invalid handle" TAOS_DEFINE_ERROR(TSDB_CODE_QUERY_CANCELLED, 0, 460, "query cancelled") TAOS_DEFINE_ERROR(TSDB_CODE_INVALID_IE, 0, 461, "invalid ie") TAOS_DEFINE_ERROR(TSDB_CODE_INVALID_VALUE, 0, 462, "invalid value") +TAOS_DEFINE_ERROR(TSDB_CODE_INVALID_FQDN, 0, 463, "invalid FQDN") // others TAOS_DEFINE_ERROR(TSDB_CODE_INVALID_FILE_FORMAT, 0, 500, "invalid file format") From 3c09bc1e088457c583b37d67c597ce2a0a72be8c Mon Sep 17 00:00:00 2001 From: Jeff Tao Date: Mon, 18 May 2020 03:32:25 +0000 Subject: [PATCH 107/126] add the error code --- src/client/src/tscUtil.c | 15 ++++++++++++--- 1 file changed, 12 insertions(+), 3 deletions(-) diff --git a/src/client/src/tscUtil.c b/src/client/src/tscUtil.c index 40d058d189..4667606aa8 100644 --- a/src/client/src/tscUtil.c +++ b/src/client/src/tscUtil.c @@ -2169,18 +2169,27 @@ int tscSetMgmtIpListFromCfg(const char *first, const char *second) { tscMgmtIpSet.inUse = 0; if (first && first[0] != 0) { - if (strlen(first) >= TSDB_FQDN_LEN) return TSDB_CODE_INVALID_FQDN; + if (strlen(first) >= TSDB_FQDN_LEN) { + terrno = TSDB_CODE_INVALID_FQDN; + return -1; + } taosGetFqdnPortFromEp(first, tscMgmtIpSet.fqdn[tscMgmtIpSet.numOfIps], &tscMgmtIpSet.port[tscMgmtIpSet.numOfIps]); tscMgmtIpSet.numOfIps++; } if (second && second[0] != 0) { - if (strlen(second) >= TSDB_FQDN_LEN) return TSDB_CODE_INVALID_FQDN; + if (strlen(second) >= TSDB_FQDN_LEN) { + terrno = TSDB_CODE_INVALID_FQDN; + return -1; + } taosGetFqdnPortFromEp(second, tscMgmtIpSet.fqdn[tscMgmtIpSet.numOfIps], &tscMgmtIpSet.port[tscMgmtIpSet.numOfIps]); tscMgmtIpSet.numOfIps++; } - if ( tscMgmtIpSet.numOfIps == 0) return TSDB_CODE_INVALID_FQDN; + if ( tscMgmtIpSet.numOfIps == 0) { + terrno = TSDB_CODE_INVALID_FQDN; + return -1; + } return 0; } From 6715fb725524457a563d5d901578cc68050f3443 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 11:33:33 +0800 Subject: [PATCH 108/126] [TD-319] revert codes --- src/inc/taosdef.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/inc/taosdef.h b/src/inc/taosdef.h index 71c2b15ab9..61e82720b1 100644 --- a/src/inc/taosdef.h +++ b/src/inc/taosdef.h @@ -218,7 +218,7 @@ void tsDataSwap(void *pLeft, void *pRight, int32_t type, int32_t size); #define TSDB_LOCALE_LEN 64 #define TSDB_TIMEZONE_LEN 64 -#define TSDB_FQDN_LEN 256 +#define TSDB_FQDN_LEN 72 #define TSDB_IPv4ADDR_LEN 16 #define TSDB_FILENAME_LEN 128 #define TSDB_METER_VNODE_BITS 20 From d18d4df151cea74ece01ecf571e9da3fd9d3623d Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 13:15:21 +0800 Subject: [PATCH 109/126] [TD-319] fixed crash while fqdn length changed --- src/inc/taosdef.h | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/src/inc/taosdef.h b/src/inc/taosdef.h index 61e82720b1..ba015d7bbf 100644 --- a/src/inc/taosdef.h +++ b/src/inc/taosdef.h @@ -218,7 +218,7 @@ void tsDataSwap(void *pLeft, void *pRight, int32_t type, int32_t size); #define TSDB_LOCALE_LEN 64 #define TSDB_TIMEZONE_LEN 64 -#define TSDB_FQDN_LEN 72 +#define TSDB_FQDN_LEN 256 #define TSDB_IPv4ADDR_LEN 16 #define TSDB_FILENAME_LEN 128 #define TSDB_METER_VNODE_BITS 20 @@ -234,7 +234,7 @@ void tsDataSwap(void *pLeft, void *pRight, int32_t type, int32_t size); #define TSDB_DEFAULT_PKT_SIZE 65480 //same as RPC_MAX_UDP_SIZE #define TSDB_PAYLOAD_SIZE (TSDB_DEFAULT_PKT_SIZE - 100) -#define TSDB_DEFAULT_PAYLOAD_SIZE 1024 // default payload size +#define TSDB_DEFAULT_PAYLOAD_SIZE 2048 // default payload size #define TSDB_EXTRA_PAYLOAD_SIZE 128 // extra bytes for auth #define TSDB_CQ_SQL_SIZE 1024 #define TSDB_MAX_VNODES 256 From 1c0cb588ca6c98108a6722561b830ac66d674b04 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Mon, 18 May 2020 05:41:49 +0000 Subject: [PATCH 110/126] change uid from int64_t to uint64_t in tsdb --- src/inc/tsdb.h | 12 ++++++------ src/tsdb/inc/tsdbMain.h | 24 ++++++++++++------------ src/tsdb/src/tsdbMain.c | 6 +++--- src/tsdb/src/tsdbMeta.c | 6 +++--- src/tsdb/src/tsdbMetaFile.c | 12 ++++++------ src/tsdb/src/tsdbRead.c | 7 ++++--- src/tsdb/tests/tsdbTests.cpp | 2 +- 7 files changed, 35 insertions(+), 34 deletions(-) diff --git a/src/inc/tsdb.h b/src/inc/tsdb.h index 0b19155626..050b65153e 100644 --- a/src/inc/tsdb.h +++ b/src/inc/tsdb.h @@ -77,8 +77,8 @@ int32_t tsdbConfigRepo(TsdbRepoT *repo, STsdbCfg *pCfg); // --------- TSDB TABLE DEFINITION typedef struct { - int64_t uid; // the unique table ID - int32_t tid; // the table ID in the repository. + uint64_t uid; // the unique table ID + int32_t tid; // the table ID in the repository. } STableId; // --------- TSDB TABLE configuration @@ -88,14 +88,14 @@ typedef struct { STableId tableId; int32_t sversion; char * sname; // super table name - int64_t superUid; + uint64_t superUid; STSchema * schema; STSchema * tagSchema; SDataRow tagValues; } STableCfg; -int tsdbInitTableCfg(STableCfg *config, ETableType type, int64_t uid, int32_t tid); -int tsdbTableSetSuperUid(STableCfg *config, int64_t uid); +int tsdbInitTableCfg(STableCfg *config, ETableType type, uint64_t uid, int32_t tid); +int tsdbTableSetSuperUid(STableCfg *config, uint64_t uid); int tsdbTableSetSchema(STableCfg *config, STSchema *pSchema, bool dup); int tsdbTableSetTagSchema(STableCfg *config, STSchema *pSchema, bool dup); int tsdbTableSetTagValue(STableCfg *config, SDataRow row, bool dup); @@ -109,7 +109,7 @@ char* tsdbGetTableName(TsdbRepoT *repo, const STableId* id, int16_t* bytes); int tsdbCreateTable(TsdbRepoT *repo, STableCfg *pCfg); int tsdbDropTable(TsdbRepoT *pRepo, STableId tableId); int tsdbAlterTable(TsdbRepoT *repo, STableCfg *pCfg); -TSKEY tsdbGetTableLastKey(TsdbRepoT *repo, int64_t uid); +TSKEY tsdbGetTableLastKey(TsdbRepoT *repo, uint64_t uid); uint32_t tsdbGetFileInfo(TsdbRepoT *repo, char *name, uint32_t *index, int32_t *size); diff --git a/src/tsdb/inc/tsdbMain.h b/src/tsdb/inc/tsdbMain.h index bd68bd6151..e7537f6969 100644 --- a/src/tsdb/inc/tsdbMain.h +++ b/src/tsdb/inc/tsdbMain.h @@ -63,9 +63,9 @@ typedef struct { } SMetaFile; SMetaFile *tsdbInitMetaFile(char *rootDir, int32_t maxTables, iterFunc iFunc, afterFunc aFunc, void *appH); -int32_t tsdbInsertMetaRecord(SMetaFile *mfh, int64_t uid, void *cont, int32_t contLen); -int32_t tsdbDeleteMetaRecord(SMetaFile *mfh, int64_t uid); -int32_t tsdbUpdateMetaRecord(SMetaFile *mfh, int64_t uid, void *cont, int32_t contLen); +int32_t tsdbInsertMetaRecord(SMetaFile *mfh, uint64_t uid, void *cont, int32_t contLen); +int32_t tsdbDeleteMetaRecord(SMetaFile *mfh, uint64_t uid); +int32_t tsdbUpdateMetaRecord(SMetaFile *mfh, uint64_t uid, void *cont, int32_t contLen); void tsdbCloseMetaFile(SMetaFile *mfh); // ------------------------------ TSDB META INTERFACES ------------------------------ @@ -82,7 +82,7 @@ typedef struct { typedef struct STable { int8_t type; STableId tableId; - int64_t superUid; // Super table UID + uint64_t superUid; // Super table UID int32_t sversion; STSchema * schema; STSchema * tagSchema; @@ -153,7 +153,7 @@ STsdbMeta *tsdbGetMeta(TsdbRepoT *pRepo); STable *tsdbIsValidTableToInsert(STsdbMeta *pMeta, STableId tableId); // int32_t tsdbInsertRowToTableImpl(SSkipListNode *pNode, STable *pTable); -STable *tsdbGetTableByUid(STsdbMeta *pMeta, int64_t uid); +STable *tsdbGetTableByUid(STsdbMeta *pMeta, uint64_t uid); char *getTSTupleKey(const void * data); typedef struct { @@ -275,8 +275,8 @@ typedef struct { uint32_t padding; // For padding purpose uint32_t hasLast : 2; uint32_t numOfBlocks : 30; - int64_t uid; - TSKEY maxKey; + uint64_t uid; + TSKEY maxKey; } SCompIdx; /* sizeof(SCompIdx) = 28 */ void *tsdbEncodeSCompIdx(void *buf, SCompIdx *pIdx); @@ -311,7 +311,7 @@ typedef struct { typedef struct { int32_t delimiter; // For recovery usage int32_t checksum; // TODO: decide if checksum logic in this file or make it one API - int64_t uid; + uint64_t uid; SCompBlock blocks[]; } SCompInfo; @@ -345,7 +345,7 @@ typedef struct { typedef struct { int32_t delimiter; // For recovery usage int32_t numOfCols; // For recovery usage - int64_t uid; // For recovery usage + uint64_t uid; // For recovery usage SCompCol cols[]; } SCompData; @@ -441,9 +441,9 @@ typedef struct { } SHelperFile; typedef struct { - int64_t uid; - int32_t tid; - int32_t sversion; + uint64_t uid; + int32_t tid; + int32_t sversion; } SHelperTable; typedef struct { diff --git a/src/tsdb/src/tsdbMain.c b/src/tsdb/src/tsdbMain.c index 7254318d74..36cb937d33 100644 --- a/src/tsdb/src/tsdbMain.c +++ b/src/tsdb/src/tsdbMain.c @@ -392,7 +392,7 @@ int tsdbAlterTable(TsdbRepoT *pRepo, STableCfg *pCfg) { return 0; } -TSKEY tsdbGetTableLastKey(TsdbRepoT *repo, int64_t uid) { +TSKEY tsdbGetTableLastKey(TsdbRepoT *repo, uint64_t uid) { STsdbRepo *pRepo = (STsdbRepo *)repo; STable *pTable = tsdbGetTableByUid(pRepo->tsdbMeta, uid); @@ -430,7 +430,7 @@ int32_t tsdbInsertData(TsdbRepoT *repo, SSubmitMsg *pMsg, SShellSubmitRspMsg * p /** * Initialize a table configuration */ -int tsdbInitTableCfg(STableCfg *config, ETableType type, int64_t uid, int32_t tid) { +int tsdbInitTableCfg(STableCfg *config, ETableType type, uint64_t uid, int32_t tid) { if (config == NULL) return -1; if (type != TSDB_NORMAL_TABLE && type != TSDB_CHILD_TABLE) return -1; @@ -447,7 +447,7 @@ int tsdbInitTableCfg(STableCfg *config, ETableType type, int64_t uid, int32_t ti /** * Set the super table UID of the created table */ -int tsdbTableSetSuperUid(STableCfg *config, int64_t uid) { +int tsdbTableSetSuperUid(STableCfg *config, uint64_t uid) { if (config->type != TSDB_CHILD_TABLE) return -1; if (uid == TSDB_INVALID_SUPER_TABLE_ID) return -1; diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index f502c1babd..0a0a975fec 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -87,9 +87,9 @@ STable *tsdbDecodeTable(void *cont, int contLen) { memcpy(pTable->name->data, ptr, len); ptr = (char *)ptr + len; - T_READ_MEMBER(ptr, int64_t, pTable->tableId.uid); + T_READ_MEMBER(ptr, uint64_t, pTable->tableId.uid); T_READ_MEMBER(ptr, int32_t, pTable->tableId.tid); - T_READ_MEMBER(ptr, int64_t, pTable->superUid); + T_READ_MEMBER(ptr, uint64_t, pTable->superUid); T_READ_MEMBER(ptr, int32_t, pTable->sversion); if (pTable->type == TSDB_SUPER_TABLE) { @@ -455,7 +455,7 @@ static int32_t tsdbCheckTableCfg(STableCfg *pCfg) { return 0; } -STable *tsdbGetTableByUid(STsdbMeta *pMeta, int64_t uid) { +STable *tsdbGetTableByUid(STsdbMeta *pMeta, uint64_t uid) { void *ptr = taosHashGet(pMeta->map, (char *)(&uid), sizeof(uid)); if (ptr == NULL) return NULL; diff --git a/src/tsdb/src/tsdbMetaFile.c b/src/tsdb/src/tsdbMetaFile.c index f9d10ec579..19fcae94e3 100644 --- a/src/tsdb/src/tsdbMetaFile.c +++ b/src/tsdb/src/tsdbMetaFile.c @@ -23,9 +23,9 @@ #define TSDB_META_FILE_HEADER_SIZE 512 typedef struct { - int32_t offset; - int32_t size; - int64_t uid; + int32_t offset; + int32_t size; + uint64_t uid; } SRecordInfo; // static int32_t tsdbGetMetaFileName(char *rootDir, char *fname); @@ -76,7 +76,7 @@ SMetaFile *tsdbInitMetaFile(char *rootDir, int32_t maxTables, iterFunc iFunc, af return mfh; } -int32_t tsdbInsertMetaRecord(SMetaFile *mfh, int64_t uid, void *cont, int32_t contLen) { +int32_t tsdbInsertMetaRecord(SMetaFile *mfh, uint64_t uid, void *cont, int32_t contLen) { if (taosHashGet(mfh->map, (char *)(&uid), sizeof(uid)) != NULL) { return -1; } @@ -112,7 +112,7 @@ int32_t tsdbInsertMetaRecord(SMetaFile *mfh, int64_t uid, void *cont, int32_t co return 0; } -int32_t tsdbDeleteMetaRecord(SMetaFile *mfh, int64_t uid) { +int32_t tsdbDeleteMetaRecord(SMetaFile *mfh, uint64_t uid) { char *ptr = taosHashGet(mfh->map, (char *)(&uid), sizeof(uid)); if (ptr == NULL) return -1; @@ -139,7 +139,7 @@ int32_t tsdbDeleteMetaRecord(SMetaFile *mfh, int64_t uid) { return 0; } -int32_t tsdbUpdateMetaRecord(SMetaFile *mfh, int64_t uid, void *cont, int32_t contLen) { +int32_t tsdbUpdateMetaRecord(SMetaFile *mfh, uint64_t uid, void *cont, int32_t contLen) { char *ptr = taosHashGet(mfh->map, (char *)(&uid), sizeof(uid)); if (ptr == NULL) return -1; diff --git a/src/tsdb/src/tsdbRead.c b/src/tsdb/src/tsdbRead.c index a5cba70219..d6a070589d 100644 --- a/src/tsdb/src/tsdbRead.c +++ b/src/tsdb/src/tsdbRead.c @@ -1516,8 +1516,9 @@ static int32_t doQueryTableList(STable* pSTable, SArray* pRes, tExprNode* pExpr) return TSDB_CODE_SUCCESS; } -int32_t tsdbQuerySTableByTagCond(TsdbRepoT *tsdb, int64_t uid, const char *pTagCond, size_t len, int16_t tagNameRelType, - const char* tbnameCond, STableGroupInfo *pGroupInfo, SColIndex *pColIndex, int32_t numOfCols) { +int32_t tsdbQuerySTableByTagCond(TsdbRepoT* tsdb, uint64_t uid, const char* pTagCond, size_t len, + int16_t tagNameRelType, const char* tbnameCond, STableGroupInfo* pGroupInfo, + SColIndex* pColIndex, int32_t numOfCols) { STable* pTable = tsdbGetTableByUid(tsdbGetMeta(tsdb), uid); if (pTable == NULL) { uError("%p failed to get stable, uid:%" PRIu64, tsdb, uid); @@ -1589,7 +1590,7 @@ int32_t tsdbQuerySTableByTagCond(TsdbRepoT *tsdb, int64_t uid, const char *pTagC return ret; } -int32_t tsdbGetOneTableGroup(TsdbRepoT* tsdb, int64_t uid, STableGroupInfo* pGroupInfo) { +int32_t tsdbGetOneTableGroup(TsdbRepoT* tsdb, uint64_t uid, STableGroupInfo* pGroupInfo) { STable* pTable = tsdbGetTableByUid(tsdbGetMeta(tsdb), uid); if (pTable == NULL) { return TSDB_CODE_INVALID_TABLE_ID; diff --git a/src/tsdb/tests/tsdbTests.cpp b/src/tsdb/tests/tsdbTests.cpp index c7ed6fcae1..e26caa4ae7 100644 --- a/src/tsdb/tests/tsdbTests.cpp +++ b/src/tsdb/tests/tsdbTests.cpp @@ -16,7 +16,7 @@ typedef struct { TsdbRepoT *pRepo; bool isAscend; int tid; - int64_t uid; + uint64_t uid; int sversion; TSKEY startTime; TSKEY interval; From e9f50a0ade23bdb8f6723997d03e9ad0cdb7869a Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 13:43:37 +0800 Subject: [PATCH 111/126] [TD-359] change table uid from int64_t to uint64_t --- src/inc/taosmsg.h | 26 +++++++++++++------------- 1 file changed, 13 insertions(+), 13 deletions(-) diff --git a/src/inc/taosmsg.h b/src/inc/taosmsg.h index e58bcf5237..728e733f84 100644 --- a/src/inc/taosmsg.h +++ b/src/inc/taosmsg.h @@ -187,13 +187,13 @@ typedef struct SMsgHead { // Submit message for one table typedef struct SSubmitBlk { - int64_t uid; // table unique id - int32_t tid; // table id - int32_t padding; // TODO just for padding here - int32_t sversion; // data schema version - int32_t len; // data part length, not including the SSubmitBlk head - int16_t numOfRows; // total number of rows in current submit block - char data[]; + uint64_t uid; // table unique id + int32_t tid; // table id + int32_t padding; // TODO just for padding here + int32_t sversion; // data schema version + int32_t len; // data part length, not including the SSubmitBlk head + int16_t numOfRows; // total number of rows in current submit block + char data[]; } SSubmitBlk; // Submit message for this TSDB @@ -327,9 +327,9 @@ typedef struct { } SMDDropTableMsg; typedef struct { - int32_t contLen; - int32_t vgId; - int64_t uid; + int32_t contLen; + int32_t vgId; + uint64_t uid; char tableId[TSDB_TABLE_ID_LEN + 1]; } SMDDropSTableMsg; @@ -404,9 +404,9 @@ typedef struct SColumnInfo { } SColumnInfo; typedef struct STableIdInfo { - int64_t uid; - int32_t tid; - TSKEY key; // last accessed ts, for subscription + uint64_t uid; + int32_t tid; + TSKEY key; // last accessed ts, for subscription } STableIdInfo; typedef struct STimeWindow { From 50e24fd9d137dcdca9bc735c836db8b2c28f1f9f Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Mon, 18 May 2020 05:43:39 +0000 Subject: [PATCH 112/126] fix compile error --- src/inc/tsdb.h | 8 ++++---- 1 file changed, 4 insertions(+), 4 deletions(-) diff --git a/src/inc/tsdb.h b/src/inc/tsdb.h index 050b65153e..729ed17053 100644 --- a/src/inc/tsdb.h +++ b/src/inc/tsdb.h @@ -278,9 +278,9 @@ SArray *tsdbGetTableList(TsdbQueryHandleT *pQueryHandle); * @param stableid. super table sid * @param pTagCond. tag query condition */ -int32_t tsdbQuerySTableByTagCond(TsdbRepoT *tsdb, int64_t uid, const char *pTagCond, size_t len, - int16_t tagNameRelType, const char* tbnameCond, STableGroupInfo *pGroupList, SColIndex *pColIndex, int32_t numOfCols); - +int32_t tsdbQuerySTableByTagCond(TsdbRepoT *tsdb, uint64_t uid, const char *pTagCond, size_t len, + int16_t tagNameRelType, const char *tbnameCond, STableGroupInfo *pGroupList, + SColIndex *pColIndex, int32_t numOfCols); /** * create the table group result including only one table, used to handle the normal table query @@ -290,7 +290,7 @@ int32_t tsdbQuerySTableByTagCond(TsdbRepoT *tsdb, int64_t uid, const char *pTagC * @param pGroupInfo the generated result * @return */ -int32_t tsdbGetOneTableGroup(TsdbRepoT *tsdb, int64_t uid, STableGroupInfo *pGroupInfo); +int32_t tsdbGetOneTableGroup(TsdbRepoT *tsdb, uint64_t uid, STableGroupInfo *pGroupInfo); /** * clean up the query handle From 520e97be3aeee8ca7feb11d94a5f47acb48e9c26 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Mon, 18 May 2020 08:32:54 +0000 Subject: [PATCH 113/126] fix maxtables problem --- src/tsdb/inc/tsdbMain.h | 3 ++- src/tsdb/src/tsdbFile.c | 31 +++++++++++++------------- src/tsdb/src/tsdbRWHelper.c | 43 +++++++++++++++++++------------------ 3 files changed, 39 insertions(+), 38 deletions(-) diff --git a/src/tsdb/inc/tsdbMain.h b/src/tsdb/inc/tsdbMain.h index e7537f6969..8a0a9e1208 100644 --- a/src/tsdb/inc/tsdbMain.h +++ b/src/tsdb/inc/tsdbMain.h @@ -465,7 +465,7 @@ typedef struct { SCompData *pCompData; SDataCols *pDataCols[2]; - void *blockBuffer; // Buffer to hold the whole data block + void *pBuffer; // Buffer to hold the whole data block void *compBuffer; // Buffer for temperary compress/decompress purpose } SRWHelper; @@ -512,6 +512,7 @@ void tsdbFitRetention(STsdbRepo *pRepo); int tsdbAlterCacheTotalBlocks(STsdbRepo *pRepo, int totalBlocks); void tsdbAdjustCacheBlocks(STsdbCache *pCache); int32_t tsdbGetMetaFileName(char *rootDir, char *fname); +int tsdbUpdateFileHeader(SFile *pFile, uint32_t version); #ifdef __cplusplus } diff --git a/src/tsdb/src/tsdbFile.c b/src/tsdb/src/tsdbFile.c index c9db9344c9..50ef078a0c 100644 --- a/src/tsdb/src/tsdbFile.c +++ b/src/tsdb/src/tsdbFile.c @@ -37,7 +37,6 @@ const char *tsdbFileSuffix[] = { static int compFGroupKey(const void *key, const void *fgroup); static int compFGroup(const void *arg1, const void *arg2); -static int tsdbWriteFileHead(SFile *pFile); static int tsdbOpenFGroup(STsdbFileH *pFileH, char *dataDir, int fid); STsdbFileH *tsdbInitFileH(char *dataDir, STsdbCfg *pCfg) { @@ -83,11 +82,21 @@ void tsdbCloseFileH(STsdbFileH *pFileH) { } static int tsdbInitFile(char *dataDir, int fid, const char *suffix, SFile *pFile) { + uint32_t version; + char buf[512] = "\0"; + tsdbGetFileName(dataDir, fid, suffix, pFile->fname); if (access(pFile->fname, F_OK|R_OK|W_OK) < 0) return -1; pFile->fd = -1; - // TODO: recover the file info - // pFile->info = {0}; + if (tsdbOpenFile(pFile, O_RDONLY) < 0) return -1; + + if (tread(pFile->fd, buf, TSDB_FILE_HEAD_SIZE) < TSDB_FILE_HEAD_SIZE) return -1; + if (!taosCheckChecksumWhole((uint8_t *)buf, TSDB_FILE_HEAD_SIZE)) return -1; + + void *pBuf = buf; + pBuf = taosDecodeFixed32(pBuf, &version); + pBuf = tsdbDecodeSFileInfo(pBuf, &(pFile->info)); + return 0; } @@ -284,18 +293,6 @@ static int compFGroup(const void *arg1, const void *arg2) { return ((SFileGroup *)arg1)->fileId - ((SFileGroup *)arg2)->fileId; } -static int tsdbWriteFileHead(SFile *pFile) { - char head[TSDB_FILE_HEAD_SIZE] = "\0"; - - pFile->info.size += TSDB_FILE_HEAD_SIZE; - - // TODO: write version and File statistic to the head - lseek(pFile->fd, 0, SEEK_SET); - if (write(pFile->fd, head, TSDB_FILE_HEAD_SIZE) < 0) return -1; - - return 0; -} - int tsdbGetFileName(char *dataDir, int fileId, const char *suffix, char *fname) { if (dataDir == NULL || fname == NULL) return -1; @@ -345,7 +342,9 @@ int tsdbCreateFile(char *dataDir, int fileId, const char *suffix, SFile *pFile) return -1; } - if (tsdbWriteFileHead(pFile) < 0) { + pFile->info.size = TSDB_FILE_HEAD_SIZE; + + if (tsdbUpdateFileHeader(pFile, 0) < 0) { tsdbCloseFile(pFile); return -1; } diff --git a/src/tsdb/src/tsdbRWHelper.c b/src/tsdb/src/tsdbRWHelper.c index 4b3c91bb02..79507aa15b 100644 --- a/src/tsdb/src/tsdbRWHelper.c +++ b/src/tsdb/src/tsdbRWHelper.c @@ -132,10 +132,10 @@ static int tsdbInitHelper(SRWHelper *pHelper, STsdbRepo *pRepo, tsdb_rw_helper_t // Init block part if (tsdbInitHelperBlock(pHelper) < 0) goto _err; - pHelper->blockBuffer = + pHelper->pBuffer = tmalloc(sizeof(SCompData) + (sizeof(SCompCol) + sizeof(TSCKSUM) + COMP_OVERFLOW_BYTES) * pHelper->config.maxCols + pHelper->config.maxRowSize * pHelper->config.maxRowsPerFileBlock + sizeof(TSCKSUM)); - if (pHelper->blockBuffer == NULL) goto _err; + if (pHelper->pBuffer == NULL) goto _err; return 0; @@ -155,7 +155,7 @@ int tsdbInitWriteHelper(SRWHelper *pHelper, STsdbRepo *pRepo) { void tsdbDestroyHelper(SRWHelper *pHelper) { if (pHelper) { - tzfree(pHelper->blockBuffer); + tzfree(pHelper->pBuffer); tzfree(pHelper->compBuffer); tsdbDestroyHelperFile(pHelper); tsdbDestroyHelperTable(pHelper); @@ -241,6 +241,7 @@ int tsdbCloseHelperFile(SRWHelper *pHelper, bool hasError) { pHelper->files.headF.fd = -1; } if (pHelper->files.dataF.fd > 0) { + if (!hasError) tsdbUpdateFileHeader(&(pHelper->files.dataF), 0); close(pHelper->files.dataF.fd); pHelper->files.dataF.fd = -1; } @@ -249,6 +250,7 @@ int tsdbCloseHelperFile(SRWHelper *pHelper, bool hasError) { pHelper->files.lastF.fd = -1; } if (pHelper->files.nHeadF.fd > 0) { + if (!hasError) tsdbUpdateFileHeader(&(pHelper->files.nHeadF), 0); close(pHelper->files.nHeadF.fd); pHelper->files.nHeadF.fd = -1; if (hasError) { @@ -260,6 +262,7 @@ int tsdbCloseHelperFile(SRWHelper *pHelper, bool hasError) { } if (pHelper->files.nLastF.fd > 0) { + if (!hasError) tsdbUpdateFileHeader(&(pHelper->files.nLastF), 0); close(pHelper->files.nLastF.fd); pHelper->files.nLastF.fd = -1; if (hasError) { @@ -419,7 +422,7 @@ int tsdbWriteCompInfo(SRWHelper *pHelper) { pIdx->offset = lseek(pHelper->files.nHeadF.fd, 0, SEEK_END); pIdx->uid = pHelper->tableInfo.uid; if (pIdx->offset < 0) return -1; - ASSERT(pIdx->offset >= tsizeof(pHelper->pCompIdx)); + ASSERT(pIdx->offset >= TSDB_FILE_HEAD_SIZE); if (twrite(pHelper->files.nHeadF.fd, (void *)(pHelper->pCompInfo), pIdx->len) < pIdx->len) return -1; } @@ -435,7 +438,8 @@ int tsdbWriteCompIdx(SRWHelper *pHelper) { SFile *pFile = &(pHelper->files.nHeadF); pFile->info.offset = offset; - void *buf = pHelper->blockBuffer; + // TODO: change the implementation of pHelper->pBuffer + void *buf = pHelper->pBuffer; for (uint32_t i = 0; i < pHelper->config.maxTables; i++) { SCompIdx *pCompIdx = pHelper->pCompIdx + i; if (pCompIdx->offset > 0) { @@ -444,10 +448,10 @@ int tsdbWriteCompIdx(SRWHelper *pHelper) { } } - int tsize = (char *)buf - (char *)pHelper->blockBuffer + sizeof(TSCKSUM); - taosCalcChecksumAppend(0, (uint8_t *)pHelper->blockBuffer, tsize); + int tsize = (char *)buf - (char *)pHelper->pBuffer + sizeof(TSCKSUM); + taosCalcChecksumAppend(0, (uint8_t *)pHelper->pBuffer, tsize); - if (twrite(pHelper->files.nHeadF.fd, (void *)pHelper->blockBuffer, tsize) < tsize) return -1; + if (twrite(pHelper->files.nHeadF.fd, (void *)pHelper->pBuffer, tsize) < tsize) return -1; pFile->info.len = tsize; return 0; } @@ -465,23 +469,23 @@ int tsdbLoadCompIdx(SRWHelper *pHelper, void *target) { ASSERT(pFile->info.offset > TSDB_FILE_HEAD_SIZE); if (lseek(fd, pFile->info.offset, SEEK_SET) < 0) return -1; - if (tread(fd, (void *)(pHelper->blockBuffer), pFile->info.len) < pFile->info.len) + if (tread(fd, (void *)(pHelper->pBuffer), pFile->info.len) < pFile->info.len) return -1; - if (!taosCheckChecksumWhole((uint8_t *)(pHelper->blockBuffer), pFile->info.len)) { + if (!taosCheckChecksumWhole((uint8_t *)(pHelper->pBuffer), pFile->info.len)) { // TODO: File is broken, try to deal with it return -1; } // Decode it - void *ptr = pHelper->blockBuffer; - while ((char *)ptr - (char *)pHelper->blockBuffer >= pFile->info.len - sizeof(TSCKSUM)) { + void *ptr = pHelper->pBuffer; + while ((char *)ptr - (char *)pHelper->pBuffer >= pFile->info.len - sizeof(TSCKSUM)) { uint32_t tid = 0; if ((ptr = taosDecodeVariant32(ptr, &tid)) == NULL) return -1; ASSERT(tid > 0 && tid < pHelper->config.maxTables); if ((ptr = tsdbDecodeSCompIdx(ptr, pHelper->pCompIdx + tid)) == NULL) return -1; - ASSERT((char *)ptr - (char *)pHelper->blockBuffer <= pFile->info.len - sizeof(TSCKSUM)); + ASSERT((char *)ptr - (char *)pHelper->pBuffer <= pFile->info.len - sizeof(TSCKSUM)); } } @@ -626,9 +630,9 @@ static int tsdbCheckAndDecodeColumnData(SDataCol *pDataCol, char *content, int32 static int tsdbLoadBlockDataImpl(SRWHelper *pHelper, SCompBlock *pCompBlock, SDataCols *pDataCols) { ASSERT(pCompBlock->numOfSubBlocks <= 1); - ASSERT(tsizeof(pHelper->blockBuffer) >= pCompBlock->len); + ASSERT(tsizeof(pHelper->pBuffer) >= pCompBlock->len); - SCompData *pCompData = (SCompData *)pHelper->blockBuffer; + SCompData *pCompData = (SCompData *)pHelper->pBuffer; int fd = (pCompBlock->last) ? pHelper->files.lastF.fd : pHelper->files.dataF.fd; if (lseek(fd, pCompBlock->offset, SEEK_SET) < 0) goto _err; @@ -721,7 +725,7 @@ static int tsdbWriteBlockToFile(SRWHelper *pHelper, SFile *pFile, SDataCols *pDa ASSERT(rowsToWrite > 0 && rowsToWrite <= pDataCols->numOfPoints && rowsToWrite <= pHelper->config.maxRowsPerFileBlock); - SCompData *pCompData = (SCompData *)(pHelper->blockBuffer); + SCompData *pCompData = (SCompData *)(pHelper->pBuffer); int64_t offset = 0; offset = lseek(pFile->fd, 0, SEEK_END); @@ -776,7 +780,7 @@ static int tsdbWriteBlockToFile(SRWHelper *pHelper, SFile *pFile, SDataCols *pDa } pCompCol->len = (*(tDataTypeDesc[pDataCol->type].compFunc))( - (char *)pDataCol->pData, tlen, rowsToWrite, tptr, tsizeof(pHelper->blockBuffer) - lsize, + (char *)pDataCol->pData, tlen, rowsToWrite, tptr, tsizeof(pHelper->pBuffer) - lsize, pHelper->config.compress, pHelper->compBuffer, tsizeof(pHelper->compBuffer)); } else { pCompCol->len = tlen; @@ -1242,11 +1246,8 @@ int tsdbUpdateFileHeader(SFile *pFile, uint32_t version) { void *pBuf = (void *)buf; pBuf = taosEncodeFixed32(pBuf, version); pBuf = tsdbEncodeSFileInfo(pBuf, &(pFile->info)); - int tsize = (char *)pBuf - buf + sizeof(TSCKSUM); - ASSERT(tsize <= TSDB_FILE_HEAD_SIZE); - - taosCalcChecksumAppend(0, (uint8_t *)buf, tsize); + taosCalcChecksumAppend(0, (uint8_t *)buf, TSDB_FILE_HEAD_SIZE); if (lseek(pFile->fd, 0, SEEK_SET) < 0) return -1; if (twrite(pFile->fd, (void *)buf, TSDB_FILE_HEAD_SIZE) < TSDB_FILE_HEAD_SIZE) return -1; From 26614ff964163602c033f50bc4053bb27a0b863d Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Mon, 18 May 2020 08:53:33 +0000 Subject: [PATCH 114/126] fix coredump --- src/tsdb/src/tsdbFile.c | 2 ++ 1 file changed, 2 insertions(+) diff --git a/src/tsdb/src/tsdbFile.c b/src/tsdb/src/tsdbFile.c index 50ef078a0c..dcea2737ff 100644 --- a/src/tsdb/src/tsdbFile.c +++ b/src/tsdb/src/tsdbFile.c @@ -97,6 +97,8 @@ static int tsdbInitFile(char *dataDir, int fid, const char *suffix, SFile *pFile pBuf = taosDecodeFixed32(pBuf, &version); pBuf = tsdbDecodeSFileInfo(pBuf, &(pFile->info)); + tsdbCloseFile(pFile); + return 0; } From 17139e19f54244c87fc23322df99b1b0bd64cae4 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Mon, 18 May 2020 09:37:02 +0000 Subject: [PATCH 115/126] fix read error --- src/tsdb/src/tsdbRWHelper.c | 4 +++- 1 file changed, 3 insertions(+), 1 deletion(-) diff --git a/src/tsdb/src/tsdbRWHelper.c b/src/tsdb/src/tsdbRWHelper.c index 79507aa15b..c5ef00c233 100644 --- a/src/tsdb/src/tsdbRWHelper.c +++ b/src/tsdb/src/tsdbRWHelper.c @@ -478,7 +478,7 @@ int tsdbLoadCompIdx(SRWHelper *pHelper, void *target) { // Decode it void *ptr = pHelper->pBuffer; - while ((char *)ptr - (char *)pHelper->pBuffer >= pFile->info.len - sizeof(TSCKSUM)) { + while (((char *)ptr - (char *)pHelper->pBuffer) < (pFile->info.len - sizeof(TSCKSUM))) { uint32_t tid = 0; if ((ptr = taosDecodeVariant32(ptr, &tid)) == NULL) return -1; ASSERT(tid > 0 && tid < pHelper->config.maxTables); @@ -487,6 +487,8 @@ int tsdbLoadCompIdx(SRWHelper *pHelper, void *target) { ASSERT((char *)ptr - (char *)pHelper->pBuffer <= pFile->info.len - sizeof(TSCKSUM)); } + + ASSERT(((char *)ptr - (char *)pHelper->pBuffer) == (pFile->info.len - sizeof(TSCKSUM))); } } From 738733e157378ffcf81512d438618477af00e555 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 17:43:50 +0800 Subject: [PATCH 116/126] [TD-355] add tversion to super table --- src/inc/taosmsg.h | 2 ++ src/mnode/src/mgmtTable.c | 5 +++++ 2 files changed, 7 insertions(+) diff --git a/src/inc/taosmsg.h b/src/inc/taosmsg.h index 728e733f84..27862ef489 100644 --- a/src/inc/taosmsg.h +++ b/src/inc/taosmsg.h @@ -236,6 +236,7 @@ typedef struct { int16_t numOfTags; int32_t sid; int32_t sversion; + int32_t tversion; int32_t tagDataLen; int32_t sqlDataLen; uint64_t uid; @@ -632,6 +633,7 @@ typedef struct STableMetaMsg { uint8_t tableType; int16_t numOfColumns; int16_t sversion; + int16_t tversion; int32_t sid; uint64_t uid; SCMVgroupInfo vgroup; diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index 637201fdfb..9e1384b08a 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -1236,6 +1236,7 @@ static void mgmtGetSuperTableMeta(SQueuedMsg *pMsg) { STableMetaMsg *pMeta = rpcMallocCont(sizeof(STableMetaMsg) + sizeof(SSchema) * (TSDB_MAX_TAGS + TSDB_MAX_COLUMNS + 16)); pMeta->uid = htobe64(pTable->uid); pMeta->sversion = htons(pTable->sversion); + pMeta->tversion = htons(pTable->tversion); pMeta->precision = pMsg->pDb->cfg.precision; pMeta->numOfTags = (uint8_t)pTable->numOfTags; pMeta->numOfColumns = htons((int16_t)pTable->numOfColumns); @@ -1359,12 +1360,14 @@ static void *mgmtBuildCreateChildTableMsg(SCMCreateTableMsg *pMsg, SChildTableOb pCreate->numOfColumns = htons(pTable->superTable->numOfColumns); pCreate->numOfTags = htons(pTable->superTable->numOfTags); pCreate->sversion = htonl(pTable->superTable->sversion); + pCreate->tversion = htonl(pTable->superTable->tversion); pCreate->tagDataLen = htonl(tagDataLen); pCreate->superTableUid = htobe64(pTable->superTable->uid); } else { pCreate->numOfColumns = htons(pTable->numOfColumns); pCreate->numOfTags = 0; pCreate->sversion = htonl(pTable->sversion); + pCreate->tversion = 0; pCreate->tagDataLen = 0; pCreate->superTableUid = 0; } @@ -1691,11 +1694,13 @@ static int32_t mgmtDoGetChildTableMeta(SQueuedMsg *pMsg, STableMetaMsg *pMeta) { if (pTable->info.type == TSDB_CHILD_TABLE) { pMeta->sversion = htons(pTable->superTable->sversion); + pMeta->tversion = htons(pTable->superTable->tversion); pMeta->numOfTags = (int8_t)pTable->superTable->numOfTags; pMeta->numOfColumns = htons((int16_t)pTable->superTable->numOfColumns); pMeta->contLen = sizeof(STableMetaMsg) + mgmtSetSchemaFromSuperTable(pMeta->schema, pTable->superTable); } else { pMeta->sversion = htons(pTable->sversion); + pMeta->tversion = 0; pMeta->numOfTags = 0; pMeta->numOfColumns = htons((int16_t)pTable->numOfColumns); pMeta->contLen = sizeof(STableMetaMsg) + mgmtSetSchemaFromNormalTable(pMeta->schema, pTable); From 9b792a8d31e77992daa9d4193bf6fec4a98bea1b Mon Sep 17 00:00:00 2001 From: Bomin Zhang Date: Mon, 18 May 2020 18:23:16 +0800 Subject: [PATCH 117/126] fix failed cases --- src/client/src/tscParseInsert.c | 4 +++- src/client/src/tscServer.c | 20 +++++++++++--------- src/mnode/src/mgmtTable.c | 7 ++++++- 3 files changed, 20 insertions(+), 11 deletions(-) diff --git a/src/client/src/tscParseInsert.c b/src/client/src/tscParseInsert.c index 7e67ff82e9..36b1ab5993 100644 --- a/src/client/src/tscParseInsert.c +++ b/src/client/src/tscParseInsert.c @@ -1016,7 +1016,9 @@ int doParseInsertSql(SSqlObj *pSql, char *str) { pTableMetaInfo = tscGetMetaInfo(pQueryInfo, 0); } - if ((code = tscAllocPayload(pCmd, TSDB_PAYLOAD_SIZE)) != TSDB_CODE_SUCCESS) { + // TODO: 2048 is added because TSDB_MAX_TAGS_LEN now is 65536 + // but TSDB_PAYLOAD_SIZE is 65380 + if ((code = tscAllocPayload(pCmd, TSDB_PAYLOAD_SIZE + 2048)) != TSDB_CODE_SUCCESS) { return code; } diff --git a/src/client/src/tscServer.c b/src/client/src/tscServer.c index bc717ed88c..28c5ae9ca0 100644 --- a/src/client/src/tscServer.c +++ b/src/client/src/tscServer.c @@ -1487,15 +1487,16 @@ int tscBuildTableMetaMsg(SSqlObj *pSql, SSqlInfo *pInfo) { char * pMsg; int msgLen = 0; - char *tmpData = 0; - if (pSql->cmd.allocSize > 0) { - tmpData = calloc(1, pSql->cmd.allocSize); + char *tmpData = NULL; + uint32_t len = pSql->cmd.payloadLen; + if (len > 0) { + tmpData = calloc(1, len); if (NULL == tmpData) { return TSDB_CODE_CLI_OUT_OF_MEMORY; } // STagData is in binary format, strncpy is not available - memcpy(tmpData, pSql->cmd.payload, pSql->cmd.allocSize); + memcpy(tmpData, pSql->cmd.payload, len); } SSqlCmd * pCmd = &pSql->cmd; @@ -1509,9 +1510,9 @@ int tscBuildTableMetaMsg(SSqlObj *pSql, SSqlInfo *pInfo) { pMsg = (char*)pInfoMsg + sizeof(SCMTableInfoMsg); - if (pSql->cmd.autoCreated) { - memcpy(pInfoMsg->tags, tmpData, sizeof(STagData)); - pMsg += sizeof(STagData); + if (pSql->cmd.autoCreated && len > 0) { + memcpy(pInfoMsg->tags, tmpData, len); + pMsg += len; } pCmd->payloadLen = pMsg - (char*)pInfoMsg;; @@ -2394,7 +2395,7 @@ static int32_t getTableMetaFromMgmt(SSqlObj *pSql, STableMetaInfo *pTableMetaInf tscGetQueryInfoDetailSafely(&pNew->cmd, 0, &pNewQueryInfo); pNew->cmd.autoCreated = pSql->cmd.autoCreated; // create table if not exists - if (TSDB_CODE_SUCCESS != tscAllocPayload(&pNew->cmd, TSDB_DEFAULT_PAYLOAD_SIZE)) { + if (TSDB_CODE_SUCCESS != tscAllocPayload(&pNew->cmd, TSDB_DEFAULT_PAYLOAD_SIZE + pSql->cmd.payloadLen)) { tscError("%p malloc failed for payload to get table meta", pSql); free(pNew); @@ -2405,7 +2406,8 @@ static int32_t getTableMetaFromMgmt(SSqlObj *pSql, STableMetaInfo *pTableMetaInf assert(pNew->cmd.numOfClause == 1 && pNewQueryInfo->numOfTables == 1); strncpy(pNewMeterMetaInfo->name, pTableMetaInfo->name, tListLen(pNewMeterMetaInfo->name)); - memcpy(pNew->cmd.payload, pSql->cmd.payload, TSDB_DEFAULT_PAYLOAD_SIZE); // tag information if table does not exists. + memcpy(pNew->cmd.payload, pSql->cmd.payload, pSql->cmd.payloadLen); // tag information if table does not exists. + pNew->cmd.payloadLen = pSql->cmd.payloadLen; tscTrace("%p new pSqlObj:%p to get tableMeta, auto create:%d", pSql, pNew, pNew->cmd.autoCreated); pNew->fp = tscTableMetaCallBack; diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index 28b3c6e3dd..50f24eef9f 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -1736,7 +1736,12 @@ static void mgmtAutoCreateChildTable(SQueuedMsg *pMsg) { pCreateMsg->igExists = 1; pCreateMsg->getMeta = 1; pCreateMsg->contLen = htonl(contLen); - memcpy(pCreateMsg->schema, pInfo->tags, sizeof(STagData)); + + contLen = sizeof(STagData); + if (contLen > pMsg->contLen - sizeof(SCMTableInfoMsg)) { + contLen = pMsg->contLen - sizeof(SCMTableInfoMsg); + } + memcpy(pCreateMsg->schema, pInfo->tags, contLen); SQueuedMsg *newMsg = mgmtCloneQueuedMsg(pMsg); pMsg->pCont = newMsg->pCont; From 5b439a51223891b3e9a81c0239f2353042cd78f1 Mon Sep 17 00:00:00 2001 From: Shuduo Sang Date: Mon, 18 May 2020 18:21:41 +0800 Subject: [PATCH 118/126] add tag_lite/filter.py [TD-351] --- tests/pytest/fulltest.sh | 3 + tests/pytest/random-test/random-test.py | 145 +++++++++++++ tests/pytest/smoketest.sh | 7 + tests/pytest/tag_lite/filter.py | 270 ++++++++++++++++++++++++ tests/pytest/util/sql.py | 46 ++-- tests/pytest/valgrind-test.sh | 7 + 6 files changed, 455 insertions(+), 23 deletions(-) create mode 100644 tests/pytest/random-test/random-test.py create mode 100644 tests/pytest/tag_lite/filter.py diff --git a/tests/pytest/fulltest.sh b/tests/pytest/fulltest.sh index 8634a523f3..efd9f7ce52 100755 --- a/tests/pytest/fulltest.sh +++ b/tests/pytest/fulltest.sh @@ -19,6 +19,8 @@ python3 ./test.py $1 -f table/column_num.py python3 ./test.py $1 -f table/db_table.py python3 ./test.py $1 -f table/tablename-boundary.py +# tag +python3 ./test.py $1 -f tag_lite/filter.py python3 ./test.py $1 -f tag_lite/create-tags-boundary.py python3 ./test.py $1 -f dbmgmt/database-name-boundary.py @@ -96,3 +98,4 @@ python3 ./test.py $1 -f user/pass_len.py # table #python3 ./test.py $1 -f table/del_stable.py + diff --git a/tests/pytest/random-test/random-test.py b/tests/pytest/random-test/random-test.py new file mode 100644 index 0000000000..a3f4c00ea5 --- /dev/null +++ b/tests/pytest/random-test/random-test.py @@ -0,0 +1,145 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +import random +from util.log import * +from util.cases import * +from util.sql import * +from util.dnodes import * + + +class Test: + def __init__(self): + self.current_tb = "" + self.last_tb = "" + self.written = 0 + + def create_table(self): + tdLog.info("create a table") + self.current_tb = "tb%d" % int(round(time.time() * 1000)) + tdLog.info("current table %s" % self.current_tb) + + if (self.current_tb == self.last_tb): + return + else: + tdSql.execute( + 'create table %s (ts timestamp, speed int)' % + self.current_tb) + self.last_tb = self.current_tb + self.written = 0 + + def insert_data(self): + tdLog.info("will insert data to table") + if (self.current_tb == ""): + tdLog.info("no table, create first") + self.create_table() + + tdLog.info("insert data to table") + insertRows = 10 + tdLog.info("insert %d rows to %s" % (insertRows, self.last_tb)) + for i in range(0, insertRows): + ret = tdSql.execute( + 'insert into %s values (now + %dm, %d)' % + (self.last_tb, i, i)) + self.written = self.written + 1 + + tdLog.info("insert earlier data") + tdSql.execute('insert into %s values (now - 5m , 10)' % self.last_tb) + self.written = self.written + 1 + tdSql.execute('insert into %s values (now - 6m , 10)' % self.last_tb) + self.written = self.written + 1 + tdSql.execute('insert into %s values (now - 7m , 10)' % self.last_tb) + self.written = self.written + 1 + tdSql.execute('insert into %s values (now - 8m , 10)' % self.last_tb) + self.written = self.written + 1 + + def query_data(self): + if (self.written > 0): + tdLog.info("query data from table") + tdSql.query("select * from %s" % self.last_tb) + tdSql.checkRows(self.written) + + def create_stable(self): + tdLog.info("create a super table") + + def restart_database(self): + tdLog.info("restart databae") + tdDnodes.stop(1) + tdDnodes.start(1) + tdLog.sleep(5) + + def force_restart(self): + tdLog.info("force restart database") + tdDnodes.forcestop(1) + tdDnodes.start(1) + tdLog.sleep(5) + + def drop_table(self): + if (self.current_tb != ""): + tdLog.info("drop current tb %s" % self.current_tb) + tdSql.execute("drop table %s" % self.current_tb) + self.current_tb = "" + self.last_tb = "" + self.written = 0 + + def reset_query_cache(self): + tdLog.info("reset query cache") + tdSql.execute("reset query cache") + tdLog.sleep(1) + + def reset_database(self): + tdLog.info("reset database") + tdDnodes.forcestop(1) + tdDnodes.deploy(1) + self.current_tb = "" + self.last_tb = "" + self.written = 0 + tdDnodes.start(1) + tdSql.prepare() + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + test = Test() + + switch = { + 1: test.create_table, + 2: test.insert_data, + 3: test.query_data, + 4: test.create_stable, + 5: test.restart_database, + 6: test.force_restart, + 7: test.drop_table, + 8: test.reset_query_cache, + 9: test.reset_database, + } + + for x in range(1, 100): + r = random.randint(1, 9) + tdLog.notice("iteration %d run func %d" % (x, r)) + switch.get(r, lambda: "ERROR")() + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/smoketest.sh b/tests/pytest/smoketest.sh index 6314b3f83b..5f48789d45 100755 --- a/tests/pytest/smoketest.sh +++ b/tests/pytest/smoketest.sh @@ -1,4 +1,5 @@ #!/bin/bash +# insert python3 ./test.py $1 -f insert/basic.py python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f insert/int.py @@ -24,6 +25,7 @@ python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f insert/multi.py python3 ./test.py $1 -s && sleep 1 +# table python3 ./test.py $1 -f table/column_name.py python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f table/column_num.py @@ -31,6 +33,7 @@ python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f table/db_table.py python3 ./test.py $1 -s && sleep 1 +# import python3 ./test.py $1 -f import_merge/importDataLastSub.py python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f import_merge/importHead.py @@ -43,3 +46,7 @@ python3 ./test.py $1 -f import_merge/importTail.py python3 ./test.py $1 -s && sleep 1 python3 ./test.py $1 -f import_merge/importTRestart.py python3 ./test.py $1 -s && sleep 1 + +#tag +python3 ./test.py $1 -f tag_lite/filter.py +python3 ./test.py $1 -s && sleep 1 diff --git a/tests/pytest/tag_lite/filter.py b/tests/pytest/tag_lite/filter.py new file mode 100644 index 0000000000..7d160a1b61 --- /dev/null +++ b/tests/pytest/tag_lite/filter.py @@ -0,0 +1,270 @@ +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- + +import sys +from util.log import * +from util.cases import * +from util.sql import * + + +class TDTestCase: + def init(self, conn): + tdLog.debug("start to execute %s" % __file__) + tdSql.init(conn.cursor()) + + def run(self): + tdSql.prepare() + + #TSIM: system sh/stop_dnodes.sh + #TSIM: system sh/deploy.sh -n dnode1 -i 1 + #TSIM: system sh/exec.sh -n dnode1 -s start + #TSIM: + #TSIM: sleep 3000 + #TSIM: sql connect + #TSIM: + #TSIM: print ======================== dnode1 start + tdLog.info('======================== dnode1 start') + #TSIM: + dbPrefix = "ta_fi_db" + tbPrefix = "ta_fi_tb" + mtPrefix = "ta_fi_mt" + #TSIM: $tbNum = 10 + rowNum = 20 + #TSIM: $totalNum = 200 + #TSIM: + #TSIM: print =============== step1 + tdLog.info('=============== step1') + i = 0 + #TSIM: $db = $dbPrefix . $i + mt = "%s%d" % (mtPrefix, i) + #TSIM: + #TSIM: sql create database $db + #TSIM: sql use $db + #TSIM: sql create table $mt (ts timestamp, tbcol int) TAGS(tgcol binary(10)) + tdLog.info("create table %s (ts timestamp, tbcol int) TAGS(tgcol binary(10))" % mt) + tdSql.execute('create table %s (ts timestamp, tbcol int) TAGS(tgcol binary(10))' % mt) + #TSIM: + i = 0 + while (i < 5): + tb = "tbPrefix%d" % i + tdLog.info("create table %s using %s tags( '0' )" % (tb, mt)) + tdSql.execute("create table %s using %s tags( '0' )" % (tb, mt)) + + x = 0 + while (x < rowNum): + ms = "%dm" % x + tdLog.info("insert into %s values (now + %s , %d)" % (tb, ms, x)) + tdSql.execute("insert into %s values (now + %s , %d)" % (tb, ms, x)) + x = x + 1 + i = i + 1 + + while (i < 10): + tb = "%s%d" % (tbPrefix , i) + #TSIM: sql create table $tb using $mt tags( '1' ) + tdLog.info("create table %s using %s tags( '1' )" % (tb, mt)) + tdSql.execute("create table %s using %s tags( '1' )" % (tb, mt)) + x = 0 + while (x < rowNum): + ms = "%dm" % x + #TSIM: sql insert into $tb values (now + $ms , $x ) + tdLog.info("insert into %s values (now + %s, %d )" % (tb, ms, x)) + tdSql.execute("insert into %s values (now + %s, %d )" % (tb, ms, x)) + x = x + 1 + i = i + 1 + #TSIM: + #TSIM: print =============== step2 + tdLog.info('=============== step2') + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt where tgcol = '1' + tdLog.info("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where tgcol = '1'" % mt) + tdSql.query("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where tgcol = '1'" % mt) + #TSIM: print $data00 $data01 $data02 $data03 $data04 $data05 $data06 + tdLog.info("%s %s %s %s %s %s %s" % (tdSql.getData(0, 0), tdSql.getData(0, 1), tdSql.getData(0, 2), tdSql.getData(0, 3), tdSql.getData(0, 4), tdSql.getData(0, 5), tdSql.getData(0, 6))) + #TSIM: if $data00 != 100 then + tdLog.info('tdSql.checkData(0, 0, 100)') + tdSql.checkData(0, 0, 100) + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt where tg = '1' -x step2 + tdLog.info("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where tg = '1' -x step2" % mt) + tdSql.error("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where tg = '1'" % mt) + #TSIM: return -1 + #TSIM: step2: + #TSIM: + #TSIM: print =============== step3 + tdLog.info('=============== step3') + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt where noexist = '1' -x step3 + tdLog.info("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where noexist = '1' -x step3" % mt) + tdSql.error("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where noexist = '1'" % mt) + #TSIM: return -1 + #TSIM: step3: + #TSIM: + #TSIM: print =============== step4 + tdLog.info('=============== step4') + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt where tbcol = '1' + tdLog.info("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where tbcol = '1'" % mt) + tdSql.query("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s where tbcol = '1'" % mt) + #TSIM: if $rows != 1 then + tdLog.info('tdSql.checkRow(1)') + tdSql.checkRows(1) + #TSIM: return -1 + #TSIM: endi + #TSIM: if $data00 != 10 then + tdLog.info('tdSql.checkData(0, 0, 10)') + tdSql.checkData(0, 0, 10) + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: print =============== step5 + tdLog.info('=============== step5') + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt + tdLog.info("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s" % mt) + tdSql.query("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s" % mt) + #TSIM: print $data00 $data01 $data02 $data03 $data04 $data05 $data06 + tdLog.info("%s %s %s %s %s %s %s" % (tdSql.getData(0,0), tdSql.getData(0,1), tdSql.getData(0,2), tdSql.getData(0, 3), tdSql.getData(0, 4), tdSql.getData(0,5 ), tdSql.getData(0, 6))) + #TSIM: if $data00 != 200 then + tdLog.info('tdSql.checkData(0, 0, 200)') + tdSql.checkData(0, 0, 200) + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: print =============== step6 + tdLog.info('=============== step6') + #TSIM: sql select count(tbcol), avg(cc), sum(xx), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt -x step6 + tdLog.info("select count(tbcol), avg(cc), sum(xx), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s -x step6" % mt) + tdSql.error("select count(tbcol), avg(cc), sum(xx), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s" % mt) + #TSIM: return -1 + #TSIM: step6: + #TSIM: + #TSIM: print =============== step7 + tdLog.info('=============== step7') + #TSIM: sql select count(tgcol), avg(tgcol), sum(tgcol), min(tgcol), max(tgcol), first(tgcol), last(tgcol) from $mt -x step7 + tdLog.info("select count(tgcol), avg(tgcol), sum(tgcol), min(tgcol), max(tgcol), first(tgcol), last(tgcol) from %s -x step7" % mt) + tdSql.error("select count(tgcol), avg(tgcol), sum(tgcol), min(tgcol), max(tgcol), first(tgcol), last(tgcol) from %s" % mt) + #TSIM: return -1 + #TSIM: step7: + #TSIM: + #TSIM: print =============== step8 + tdLog.info('=============== step8') + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt group by tbcol + tdLog.info("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s by tbcol" % mt) + tdSql.query("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s group by tbcol" % mt) + #TSIM: + #TSIM: print =============== step9 + tdLog.info('=============== step9') + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt group by noexist -x step9 + tdLog.info("select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s group by noexist -x step9" % mt) + tdSql.error('select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s group by noexist ' % mt) + #TSIM: return -1 + #TSIM: step9: + #TSIM: + #TSIM: print =============== step10 + tdLog.info('=============== step10') + #TSIM: sql select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from $mt group by tgcol + tdLog.info('select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s group by tgcol' % mt) + tdSql.query('select count(tbcol), avg(tbcol), sum(tbcol), min(tbcol), max(tbcol), first(tbcol), last(tbcol) from %s group by tgcol' % mt) + #TSIM: print $data00 $data01 $data02 $data03 $data04 $data05 $data06 + tdLog.info('$data00 $data01 $data02 $data03 $data04 $data05 $data06') + #TSIM: if $data00 != 100 then + tdLog.info('tdSql.checkData(0, 0, 100)') + tdSql.checkData(0, 0, 100) + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: print =============== step11 + tdLog.info('=============== step11') + #TSIM: sql select count(tbcol) as c from $mt group by tbcol + tdLog.info('select count(tbcol) as c from %s group by tbcol' % mt) + tdSql.query('select count(tbcol) as c from %s group by tbcol' % mt) + #TSIM: + #TSIM: print =============== step12 + tdLog.info('=============== step12') + #TSIM: sql select count(tbcol) as c from $mt group by noexist -x step12 + tdLog.info('select count(tbcol) as c from %s group by noexist -x step12' % mt) + tdSql.error('select count(tbcol) as c from %s group by noexist2' % mt) + #TSIM: return -1 + #TSIM: step12: + #TSIM: + #TSIM: print =============== step13 + tdLog.info('=============== step13') + #TSIM: sql select count(tbcol) as c from $mt group by tgcol + tdLog.info('select count(tbcol) as c from %s group by tgcol' % mt) + tdSql.query('select count(tbcol) as c from %s group by tgcol' % mt) + #TSIM: print $data00 + tdLog.info('$data00') + #TSIM: if $data00 != 100 then + tdLog.info('tdSql.checkData(0, 0, 100)') + tdSql.checkData(0, 0, 100) + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: print =============== step14 + tdLog.info('=============== step14') + #TSIM: sql select count(tbcol) as c from $mt where ts > 1000 group by tgcol + tdLog.info('select count(tbcol) as c from %s where ts > 1000 group by tgcol' % mt) + tdSql.query('select count(tbcol) as c from %s where ts > 1000 group by tgcol' % mt) + #TSIM: print $data00 $data01 $data02 $data03 $data04 $data05 $data06 +# tdLog.info("%s %s %s %s %s %s %s" % (tdSql.getData(0, 0), tdSql.getData(0, 1), tdSql.getData(0, 2), tdSql.getData(0, 3), tdSql.getData(0, 4), tdSql.getData(0, 5), tdSql.getData(0, 6))) + #TSIM: if $data00 != 100 then + tdLog.info('tdSql.checkData(0, 0, 100)') + tdSql.checkData(0, 0, 100) + #TSIM: print expect 100, actual $data00 + tdLog.info('expect 100, actual $data00') + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: print =============== step15 + tdLog.info('=============== step15') + #TSIM: sql select count(tbcol) as c from $mt where noexist < 1 group by tgcol -x step15 + tdLog.info('select count(tbcol) as c from %s where noexist < 1 group by tgcol -x step15' % mt) + tdSql.error('select count(tbcol) as c from %s where noexist < 1 group by tgcol5' % mt) + #TSIM: return -1 + #TSIM: step15: + #TSIM: + #TSIM: print =============== step16 + tdLog.info('=============== step16') + #TSIM: sql select count(tbcol) as c from $mt where tgcol = '1' group by tgcol + tdLog.info("select count(tbcol) as c from %s where tgcol = '1' group by tgcol" % mt) + tdSql.query("select count(tbcol) as c from %s where tgcol = '1' group by tgcol" % mt) + #TSIM: print $data00 $data01 $data02 $data03 $data04 $data05 $data06 +# tdLog.info("%s %s %s %s %s %s %s" % (tdSql.getData(0, 0), tdSql.getData(0, 1), tdSql.getData(0, 2), tdSql.getData(0, 3), tdSql.getData(0, 4), tdSql.getData(0, 5), tdSql.getData(0, 6))) + #TSIM: if $data00 != 100 then + tdLog.info('tdSql.checkData(0, 0, 100)') + tdSql.checkData(0, 0, 100) + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: print =============== clear + tdLog.info('=============== clear') + #TSIM: sql drop database $db + tdLog.info('drop database db') + tdSql.execute('drop database db') + #TSIM: sql show databases + tdLog.info('show databases') + tdSql.query('show databases') + #TSIM: if $rows != 0 then + tdLog.info('tdSql.checkRow(0)') + tdSql.checkRows(0) + #TSIM: return -1 + #TSIM: endi + #TSIM: + #TSIM: system sh/exec.sh -n dnode1 -s stop -x SIGINT +# convert end + + def stop(self): + tdSql.close() + tdLog.success("%s successfully executed" % __file__) + + +tdCases.addWindows(__file__, TDTestCase()) +tdCases.addLinux(__file__, TDTestCase()) diff --git a/tests/pytest/util/sql.py b/tests/pytest/util/sql.py index 75f3bd9044..1cc0eddbfc 100644 --- a/tests/pytest/util/sql.py +++ b/tests/pytest/util/sql.py @@ -49,10 +49,10 @@ class TDSql: callerModule = inspect.getmodule(frame[0]) callerFilename = callerModule.__file__ tdLog.exit( - "%s failed: sql:%.40s, expect error not occured" % + "%s failed: sql:%s, expect error not occured" % (callerFilename, sql)) else: - tdLog.info("sql:%.40s, expect error occured" % (sql)) + tdLog.info("sql:%s, expect error occured" % (sql)) def query(self, sql): self.sql = sql @@ -72,9 +72,9 @@ class TDSql: callerModule = inspect.getmodule(frame[0]) callerFilename = callerModule.__file__ tdLog.exit( - "%s failed: sql:%.40s, queryRows:%d != expect:%d" % + "%s failed: sql:%s, queryRows:%d != expect:%d" % (callerFilename, self.sql, self.queryRows, expectRows)) - tdLog.info("sql:%.40s, queryRows:%d == expect:%d" % + tdLog.info("sql:%s, queryRows:%d == expect:%d" % (self.sql, self.queryRows, expectRows)) def checkData(self, row, col, data): @@ -84,35 +84,35 @@ class TDSql: if row < 0: tdLog.exit( - "%s failed: sql:%.40s, row:%d is smaller than zero" % + "%s failed: sql:%s, row:%d is smaller than zero" % (callerFilename, self.sql, row)) if col < 0: tdLog.exit( - "%s failed: sql:%.40s, col:%d is smaller than zero" % + "%s failed: sql:%s, col:%d is smaller than zero" % (callerFilename, self.sql, col)) - if row >= self.queryRows: + if row > self.queryRows: tdLog.exit( - "%s failed: sql:%.40s, row:%d is larger than queryRows:%d" % + "%s failed: sql:%s, row:%d is larger than queryRows:%d" % (callerFilename, self.sql, row, self.queryRows)) - if col >= self.queryCols: + if col > self.queryCols: tdLog.exit( - "%s failed: sql:%.40s, col:%d is larger than queryRows:%d" % + "%s failed: sql:%s, col:%d is larger than queryCols:%d" % (callerFilename, self.sql, col, self.queryCols)) if self.queryResult[row][col] != data: - tdLog.exit("%s failed: sql:%.40s row:%d col:%d data:%s != expect:%s" % ( + tdLog.exit("%s failed: sql:%s row:%d col:%d data:%s != expect:%s" % ( callerFilename, self.sql, row, col, self.queryResult[row][col], data)) if data is None: - tdLog.info("sql:%.40s, row:%d col:%d data:%s == expect:%s" % + tdLog.info("sql:%s, row:%d col:%d data:%s == expect:%s" % (self.sql, row, col, self.queryResult[row][col], data)) elif isinstance(data, str): - tdLog.info("sql:%.40s, row:%d col:%d data:%s == expect:%s" % + tdLog.info("sql:%s, row:%d col:%d data:%s == expect:%s" % (self.sql, row, col, self.queryResult[row][col], data)) elif isinstance(data, datetime.date): - tdLog.info("sql:%.40s, row:%d col:%d data:%s == expect:%s" % + tdLog.info("sql:%s, row:%d col:%d data:%s == expect:%s" % (self.sql, row, col, self.queryResult[row][col], data)) else: - tdLog.info("sql:%.40s, row:%d col:%d data:%s == expect:%d" % + tdLog.info("sql:%s, row:%d col:%d data:%s == expect:%d" % (self.sql, row, col, self.queryResult[row][col], data)) def getData(self, row, col): @@ -122,19 +122,19 @@ class TDSql: if row < 0: tdLog.exit( - "%s failed: sql:%.40s, row:%d is smaller than zero" % + "%s failed: sql:%s, row:%d is smaller than zero" % (callerFilename, self.sql, row)) if col < 0: tdLog.exit( - "%s failed: sql:%.40s, col:%d is smaller than zero" % + "%s failed: sql:%s, col:%d is smaller than zero" % (callerFilename, self.sql, col)) - if row >= self.queryRows: + if row > self.queryRows: tdLog.exit( - "%s failed: sql:%.40s, row:%d is larger than queryRows:%d" % + "%s failed: sql:%s, row:%d is larger than queryRows:%d" % (callerFilename, self.sql, row, self.queryRows)) - if col >= self.queryCols: + if col > self.queryCols: tdLog.exit( - "%s failed: sql:%.40s, col:%d is larger than queryRows:%d" % + "%s failed: sql:%s, col:%d is larger than queryCols:%d" % (callerFilename, self.sql, col, self.queryCols)) return self.queryResult[row][col] @@ -157,9 +157,9 @@ class TDSql: callerModule = inspect.getmodule(frame[0]) callerFilename = callerModule.__file__ - tdLog.exit("%s failed: sql:%.40s, affectedRows:%d != expect:%d" % ( + tdLog.exit("%s failed: sql:%s, affectedRows:%d != expect:%d" % ( callerFilename, self.sql, self.affectedRows, expectAffectedRows)) - tdLog.info("sql:%.40s, affectedRows:%d == expect:%d" % + tdLog.info("sql:%s, affectedRows:%d == expect:%d" % (self.sql, self.affectedRows, expectAffectedRows)) diff --git a/tests/pytest/valgrind-test.sh b/tests/pytest/valgrind-test.sh index 0b5dfc0fa3..55bb03c966 100755 --- a/tests/pytest/valgrind-test.sh +++ b/tests/pytest/valgrind-test.sh @@ -1,4 +1,5 @@ #!/bin/bash +# insert python3 ./test.py -g -f insert/basic.py python3 ./test.py -g -s && sleep 1 python3 ./test.py -g -f insert/int.py @@ -24,6 +25,7 @@ python3 ./test.py -g -s && sleep 1 python3 ./test.py -g -f insert/multi.py python3 ./test.py -g -s && sleep 1 +# table python3 ./test.py -g -f table/column_name.py python3 ./test.py -g -s && sleep 1 python3 ./test.py -g -f table/column_num.py @@ -31,5 +33,10 @@ python3 ./test.py -g -s && sleep 1 python3 ./test.py -g -f table/db_table.py python3 ./test.py -g -s && sleep 1 +# import python3 ./test.py -g -f import_merge/importDataLastSub.py python3 ./test.py -g -s && sleep 1 + +#tag +python3 ./test.py $1 -f tag_lite/filter.py +python3 ./test.py $1 -s && sleep 1 From 62c1f2f7b565542965834adc7f47df6576f21d50 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Mon, 18 May 2020 11:15:04 +0000 Subject: [PATCH 119/126] TD-308 --- src/tsdb/src/tsdbMeta.c | 7 ++----- 1 file changed, 2 insertions(+), 5 deletions(-) diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index 0a0a975fec..5516231483 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -508,10 +508,7 @@ static int tsdbRemoveTableFromMeta(STsdbMeta *pMeta, STable *pTable) { ASSERT(tTable != NULL && tTable->type == TSDB_CHILD_TABLE); - pMeta->tables[tTable->tableId.tid] = NULL; - taosHashRemove(pMeta->map, (char *)(&(pTable->tableId.uid)), sizeof(pTable->tableId.uid)); - pMeta->nTables--; - tsdbFreeTable(tTable); + tsdbRemoveTableFromMeta(pMeta, tTable); } tSkipListDestroyIter(pIter); @@ -534,8 +531,8 @@ static int tsdbRemoveTableFromMeta(STsdbMeta *pMeta, STable *pTable) { pMeta->nTables--; } - tsdbFreeTable(pTable); taosHashRemove(pMeta->map, (char *)(&(pTable->tableId.uid)), sizeof(pTable->tableId.uid)); + tsdbFreeTable(pTable); return 0; } From 499170d3cf48661ea60ab478326e6264d55e9a81 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 19:23:42 +0800 Subject: [PATCH 120/126] [TD-361] fix bug in show vgroups --- src/mnode/inc/mgmtDef.h | 1 - src/mnode/inc/mgmtVgroup.h | 5 ----- src/mnode/src/mgmtVgroup.c | 15 ++------------ tests/script/unique/big/maxvnodes.sim | 28 ++++++++++----------------- 4 files changed, 12 insertions(+), 37 deletions(-) diff --git a/src/mnode/inc/mgmtDef.h b/src/mnode/inc/mgmtDef.h index 7c1fd6c5ab..f0d694db2a 100644 --- a/src/mnode/inc/mgmtDef.h +++ b/src/mnode/inc/mgmtDef.h @@ -123,7 +123,6 @@ typedef struct SVgObj { int32_t numOfVnodes; int32_t lbDnodeId; int32_t lbTime; - int8_t status; int8_t inUse; int8_t reserved[13]; int8_t updateEnd[1]; diff --git a/src/mnode/inc/mgmtVgroup.h b/src/mnode/inc/mgmtVgroup.h index 7acf7112a4..ce4cfed532 100644 --- a/src/mnode/inc/mgmtVgroup.h +++ b/src/mnode/inc/mgmtVgroup.h @@ -22,11 +22,6 @@ extern "C" { #include "mgmtDef.h" -enum _TSDB_VG_STATUS { - TSDB_VG_STATUS_READY, - TSDB_VG_STATUS_UPDATE -}; - int32_t mgmtInitVgroups(); void mgmtCleanUpVgroups(); SVgObj *mgmtGetVgroup(int32_t vgId); diff --git a/src/mnode/src/mgmtVgroup.c b/src/mnode/src/mgmtVgroup.c index 1416ed5f58..ef5582f395 100644 --- a/src/mnode/src/mgmtVgroup.c +++ b/src/mnode/src/mgmtVgroup.c @@ -371,12 +371,6 @@ int32_t mgmtGetVgroupMeta(STableMetaMsg *pMeta, SShowObj *pShow, void *pConn) { pSchema[cols].bytes = htons(pShow->bytes[cols]); cols++; - pShow->bytes[cols] = 9 + VARSTR_HEADER_SIZE; - pSchema[cols].type = TSDB_DATA_TYPE_BINARY; - strcpy(pSchema[cols].name, "vgroup_status"); - pSchema[cols].bytes = htons(pShow->bytes[cols]); - cols++; - int32_t maxReplica = 0; SVgObj *pVgroup = NULL; STableObj *pTable = NULL; @@ -471,11 +465,6 @@ int32_t mgmtRetrieveVgroups(SShowObj *pShow, char *data, int32_t rows, void *pCo *(int32_t *) pWrite = pVgroup->numOfTables; cols++; - pWrite = data + pShow->offset[cols] * rows + pShow->bytes[cols] * numOfRows; - char* status = pVgroup->status? "updating" : "ready"; - STR_TO_VARSTR(pWrite, status); - cols++; - for (int32_t i = 0; i < maxReplica; ++i) { pWrite = data + pShow->offset[cols] * rows + pShow->bytes[cols] * numOfRows; *(int16_t *) pWrite = pVgroup->vnodeGid[i].dnodeId; @@ -489,8 +478,8 @@ int32_t mgmtRetrieveVgroups(SShowObj *pShow, char *data, int32_t rows, void *pCo cols++; pWrite = data + pShow->offset[cols] * rows + pShow->bytes[cols] * numOfRows; - status = mgmtGetMnodeRoleStr(pVgroup->vnodeGid[i].role); - STR_TO_VARSTR(pWrite, status); + char *role = mgmtGetMnodeRoleStr(pVgroup->vnodeGid[i].role); + STR_TO_VARSTR(pWrite, role); cols++; } else { pWrite = data + pShow->offset[cols] * rows + pShow->bytes[cols] * numOfRows; diff --git a/tests/script/unique/big/maxvnodes.sim b/tests/script/unique/big/maxvnodes.sim index 3015d07b6d..2b56f51e59 100644 --- a/tests/script/unique/big/maxvnodes.sim +++ b/tests/script/unique/big/maxvnodes.sim @@ -1,19 +1,18 @@ system sh/stop_dnodes.sh $totalVnodes = 100 -$minVnodes = 48 -$maxVnodes = 52 +$minVnodes = 50 +$maxVnodes = 50 $maxTables = 4 $totalRows = $totalVnodes * $maxTables system sh/deploy.sh -n dnode1 -i 1 -system sh/cfg.sh -n dnode1 -c walLevel -v 0 -system sh/cfg.sh -n dnode1 -c maxtablesPerVnode -v $maxTables +system sh/cfg.sh -n dnode1 -c walLevel -v 2 system sh/cfg.sh -n dnode1 -c numOfTotalVnodes -v $totalVnodes -system sh/cfg.sh -n dnode1 -c maxVnodeConnections -v 100000 -system sh/cfg.sh -n dnode1 -c maxMeterConnections -v 100000 -system sh/cfg.sh -n dnode1 -c maxShellConns -v 100000 -system sh/cfg.sh -n dnode1 -c maxMgmtConnections -v 100000 +system sh/deploy.sh -n dnode2 -i 2 +system sh/cfg.sh -n dnode2 -c walLevel -v 2 +system sh/cfg.sh -n dnode2 -c numOfTotalVnodes -v $totalVnodes + print ========== prepare data system sh/exec_up.sh -n dnode1 -s start @@ -44,16 +43,7 @@ if $data00 != $totalRows then return -1 endi -system sh/deploy.sh -n dnode2 -i 2 -system sh/cfg.sh -n dnode2 -c walLevel -v 0 -system sh/cfg.sh -n dnode2 -c maxtablesPerVnode -v 100 -system sh/cfg.sh -n dnode2 -c numOfTotalVnodes -v 256 -system sh/cfg.sh -n dnode2 -c maxVnodeConnections -v 100000 -system sh/cfg.sh -n dnode2 -c maxMeterConnections -v 100000 -system sh/cfg.sh -n dnode2 -c maxShellConns -v 100000 -system sh/cfg.sh -n dnode2 -c maxMgmtConnections -v 100000 - -print ========== step2 +print ========== step3 sql create dnode $hostname2 system sh/exec_up.sh -n dnode2 -s start @@ -86,6 +76,8 @@ if $data00 != $totalRows then return -1 endi +return + system sh/exec_up.sh -n dnode1 -s stop -x SIGINT system sh/exec_up.sh -n dnode2 -s stop -x SIGINT system sh/exec_up.sh -n dnode3 -s stop -x SIGINT From 908aa37a416a2d5d87d843144b18dff7030e1a14 Mon Sep 17 00:00:00 2001 From: Jeff Tao Date: Mon, 18 May 2020 14:15:21 +0000 Subject: [PATCH 121/126] add new macro TSDB_EP_LEN --- src/client/src/tscUtil.c | 4 +- src/common/src/tglobal.c | 14 +- src/dnode/src/dnodeMgmt.c | 2 +- src/inc/taosdef.h | 3 +- src/inc/taosmsg.h | 10 +- src/mnode/inc/mgmtDef.h | 2 +- src/plugins/monitor/src/monitorMain.c | 2 +- src/rpc/inc/rpcHaship.h | 33 ---- src/rpc/src/rpcHaship.c | 167 ------------------ src/rpc/src/rpcUdp.c | 234 +++----------------------- 10 files changed, 43 insertions(+), 428 deletions(-) delete mode 100644 src/rpc/inc/rpcHaship.h delete mode 100644 src/rpc/src/rpcHaship.c diff --git a/src/client/src/tscUtil.c b/src/client/src/tscUtil.c index 4667606aa8..8570c2b304 100644 --- a/src/client/src/tscUtil.c +++ b/src/client/src/tscUtil.c @@ -2169,7 +2169,7 @@ int tscSetMgmtIpListFromCfg(const char *first, const char *second) { tscMgmtIpSet.inUse = 0; if (first && first[0] != 0) { - if (strlen(first) >= TSDB_FQDN_LEN) { + if (strlen(first) >= TSDB_EP_LEN) { terrno = TSDB_CODE_INVALID_FQDN; return -1; } @@ -2178,7 +2178,7 @@ int tscSetMgmtIpListFromCfg(const char *first, const char *second) { } if (second && second[0] != 0) { - if (strlen(second) >= TSDB_FQDN_LEN) { + if (strlen(second) >= TSDB_EP_LEN) { terrno = TSDB_CODE_INVALID_FQDN; return -1; } diff --git a/src/common/src/tglobal.c b/src/common/src/tglobal.c index 18d8c9ebe2..324edb422b 100644 --- a/src/common/src/tglobal.c +++ b/src/common/src/tglobal.c @@ -61,10 +61,10 @@ int32_t tscEmbedded = 0; */ int64_t tsMsPerDay[] = {86400000L, 86400000000L}; -char tsFirst[TSDB_FQDN_LEN] = {0}; -char tsSecond[TSDB_FQDN_LEN] = {0}; -char tsArbitrator[TSDB_FQDN_LEN] = {0}; -char tsLocalEp[TSDB_FQDN_LEN] = {0}; // Local End Point, hostname:port +char tsFirst[TSDB_EP_LEN] = {0}; +char tsSecond[TSDB_EP_LEN] = {0}; +char tsArbitrator[TSDB_EP_LEN] = {0}; +char tsLocalEp[TSDB_EP_LEN] = {0}; // Local End Point, hostname:port uint16_t tsServerPort = 6030; uint16_t tsDnodeShellPort = 6030; // udp[6035-6039] tcp[6035] uint16_t tsDnodeDnodePort = 6035; // udp/tcp @@ -284,7 +284,7 @@ static void doInitGlobalConfig() { cfg.cfgType = TSDB_CFG_CTYPE_B_CONFIG | TSDB_CFG_CTYPE_B_CLIENT; cfg.minValue = 0; cfg.maxValue = 0; - cfg.ptrLength = TSDB_FQDN_LEN; + cfg.ptrLength = TSDB_EP_LEN; cfg.unitType = TAOS_CFG_UTYPE_NONE; taosInitConfigOption(cfg); @@ -294,7 +294,7 @@ static void doInitGlobalConfig() { cfg.cfgType = TSDB_CFG_CTYPE_B_CONFIG | TSDB_CFG_CTYPE_B_CLIENT; cfg.minValue = 0; cfg.maxValue = 0; - cfg.ptrLength = TSDB_FQDN_LEN; + cfg.ptrLength = TSDB_EP_LEN; cfg.unitType = TAOS_CFG_UTYPE_NONE; taosInitConfigOption(cfg); @@ -356,7 +356,7 @@ static void doInitGlobalConfig() { cfg.cfgType = TSDB_CFG_CTYPE_B_CONFIG | TSDB_CFG_CTYPE_B_CLIENT; cfg.minValue = 0; cfg.maxValue = 0; - cfg.ptrLength = TSDB_FQDN_LEN; + cfg.ptrLength = TSDB_EP_LEN; cfg.unitType = TAOS_CFG_UTYPE_NONE; taosInitConfigOption(cfg); diff --git a/src/dnode/src/dnodeMgmt.c b/src/dnode/src/dnodeMgmt.c index 81d426b496..4b28992aa4 100644 --- a/src/dnode/src/dnodeMgmt.c +++ b/src/dnode/src/dnodeMgmt.c @@ -411,7 +411,7 @@ static bool dnodeReadMnodeInfos() { dError("failed to read mnode mgmtIpList.json, nodeName not found"); goto PARSE_OVER; } - strncpy(tsMnodeInfos.nodeInfos[i].nodeEp, nodeEp->valuestring, TSDB_FQDN_LEN); + strncpy(tsMnodeInfos.nodeInfos[i].nodeEp, nodeEp->valuestring, TSDB_EP_LEN); } ret = true; diff --git a/src/inc/taosdef.h b/src/inc/taosdef.h index ba015d7bbf..2393654f79 100644 --- a/src/inc/taosdef.h +++ b/src/inc/taosdef.h @@ -218,7 +218,8 @@ void tsDataSwap(void *pLeft, void *pRight, int32_t type, int32_t size); #define TSDB_LOCALE_LEN 64 #define TSDB_TIMEZONE_LEN 64 -#define TSDB_FQDN_LEN 256 +#define TSDB_FQDN_LEN 128 +#define TSDB_EP_LEN (TSDB_FQDN_LEN+6) #define TSDB_IPv4ADDR_LEN 16 #define TSDB_FILENAME_LEN 128 #define TSDB_METER_VNODE_BITS 20 diff --git a/src/inc/taosmsg.h b/src/inc/taosmsg.h index 27862ef489..3aa75523ea 100644 --- a/src/inc/taosmsg.h +++ b/src/inc/taosmsg.h @@ -530,7 +530,7 @@ typedef struct { typedef struct { int32_t nodeId; - char nodeEp[TSDB_FQDN_LEN]; + char nodeEp[TSDB_EP_LEN]; } SDMMnodeInfo; typedef struct { @@ -542,7 +542,7 @@ typedef struct { typedef struct { uint32_t version; int32_t dnodeId; - char dnodeEp[TSDB_FQDN_LEN]; + char dnodeEp[TSDB_EP_LEN]; uint32_t moduleStatus; uint32_t lastReboot; // time stamp for last reboot uint16_t numOfTotalVnodes; // from config file @@ -584,7 +584,7 @@ typedef struct { typedef struct { int32_t nodeId; - char nodeEp[TSDB_FQDN_LEN]; + char nodeEp[TSDB_EP_LEN]; } SMDVnodeDesc; typedef struct { @@ -669,7 +669,7 @@ typedef struct SCMShowRsp { } SCMShowRsp; typedef struct { - char ep[TSDB_FQDN_LEN]; // end point, hostname:port + char ep[TSDB_EP_LEN]; // end point, hostname:port } SCMCreateDnodeMsg, SCMDropDnodeMsg; typedef struct { @@ -684,7 +684,7 @@ typedef struct { } SDMConfigVnodeMsg; typedef struct { - char ep[TSDB_FQDN_LEN]; // end point, hostname:port + char ep[TSDB_EP_LEN]; // end point, hostname:port char config[64]; } SMDCfgDnodeMsg, SCMCfgDnodeMsg; diff --git a/src/mnode/inc/mgmtDef.h b/src/mnode/inc/mgmtDef.h index f0d694db2a..fac342901a 100644 --- a/src/mnode/inc/mgmtDef.h +++ b/src/mnode/inc/mgmtDef.h @@ -33,7 +33,7 @@ typedef struct SDnodeObj { int32_t dnodeId; uint16_t dnodePort; char dnodeFqdn[TSDB_FQDN_LEN + 1]; - char dnodeEp[TSDB_FQDN_LEN + 1]; + char dnodeEp[TSDB_EP_LEN + 1]; int64_t createdTime; uint32_t lastAccess; int32_t openVnodes; diff --git a/src/plugins/monitor/src/monitorMain.c b/src/plugins/monitor/src/monitorMain.c index ae8038e444..72efd5b552 100644 --- a/src/plugins/monitor/src/monitorMain.c +++ b/src/plugins/monitor/src/monitorMain.c @@ -68,7 +68,7 @@ typedef enum { typedef struct { void * conn; void * timer; - char ep[TSDB_FQDN_LEN]; + char ep[TSDB_EP_LEN]; int8_t cmdIndex; int8_t state; char sql[SQL_LENGTH]; diff --git a/src/rpc/inc/rpcHaship.h b/src/rpc/inc/rpcHaship.h deleted file mode 100644 index d3ed48997a..0000000000 --- a/src/rpc/inc/rpcHaship.h +++ /dev/null @@ -1,33 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#ifndef _rpc_hash_ip_header_ -#define _rpc_hash_ip_header_ - -#ifdef __cplusplus -extern "C" { -#endif - -void *rpcOpenIpHash(int maxSessions); -void rpcCloseIpHash(void *handle); -void *rpcAddIpHash(void *handle, void *pData, uint32_t ip, uint16_t port); -void rpcDeleteIpHash(void *handle, uint32_t ip, uint16_t port); -void *rpcGetIpHash(void *handle, uint32_t ip, uint16_t port); - -#ifdef __cplusplus -} -#endif - -#endif diff --git a/src/rpc/src/rpcHaship.c b/src/rpc/src/rpcHaship.c deleted file mode 100644 index 0183c87f70..0000000000 --- a/src/rpc/src/rpcHaship.c +++ /dev/null @@ -1,167 +0,0 @@ -/* - * Copyright (c) 2019 TAOS Data, Inc. - * - * This program is free software: you can use, redistribute, and/or modify - * it under the terms of the GNU Affero General Public License, version 3 - * or later ("AGPL"), as published by the Free Software Foundation. - * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. - * - * You should have received a copy of the GNU Affero General Public License - * along with this program. If not, see . - */ - -#include "os.h" -#include "tmempool.h" -#include "rpcLog.h" - -typedef struct SIpHash { - uint32_t ip; - uint16_t port; - int hash; - struct SIpHash *prev; - struct SIpHash *next; - void *data; -} SIpHash; - -typedef struct { - SIpHash **ipHashList; - mpool_h ipHashMemPool; - int maxSessions; -} SHashObj; - -int rpcHashIp(void *handle, uint32_t ip, uint16_t port) { - SHashObj *pObj = (SHashObj *)handle; - int hash = 0; - - hash = (int)(ip >> 16); - hash += (unsigned short)(ip & 0xFFFF); - hash += port; - - hash = hash % pObj->maxSessions; - - return hash; -} - -void *rpcAddIpHash(void *handle, void *data, uint32_t ip, uint16_t port) { - int hash; - SIpHash *pNode; - SHashObj *pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = rpcHashIp(pObj, ip, port); - pNode = (SIpHash *)taosMemPoolMalloc(pObj->ipHashMemPool); - pNode->ip = ip; - pNode->port = port; - pNode->data = data; - pNode->prev = 0; - pNode->next = pObj->ipHashList[hash]; - pNode->hash = hash; - - if (pObj->ipHashList[hash] != 0) (pObj->ipHashList[hash])->prev = pNode; - pObj->ipHashList[hash] = pNode; - - return pObj; -} - -void rpcDeleteIpHash(void *handle, uint32_t ip, uint16_t port) { - int hash; - SIpHash *pNode; - SHashObj *pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - hash = rpcHashIp(pObj, ip, port); - - pNode = pObj->ipHashList[hash]; - while (pNode) { - if (pNode->ip == ip && pNode->port == port) break; - - pNode = pNode->next; - } - - if (pNode) { - if (pNode->prev) { - pNode->prev->next = pNode->next; - } else { - pObj->ipHashList[hash] = pNode->next; - } - - if (pNode->next) { - pNode->next->prev = pNode->prev; - } - - taosMemPoolFree(pObj->ipHashMemPool, (char *)pNode); - } -} - -void *rpcGetIpHash(void *handle, uint32_t ip, uint16_t port) { - int hash; - SIpHash *pNode; - SHashObj *pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return NULL; - - hash = rpcHashIp(pObj, ip, port); - pNode = pObj->ipHashList[hash]; - - while (pNode) { - if (pNode->ip == ip && pNode->port == port) { - break; - } - pNode = pNode->next; - } - - if (pNode) { - return pNode->data; - } - return NULL; -} - -void *rpcOpenIpHash(int maxSessions) { - SIpHash **ipHashList; - mpool_h ipHashMemPool; - SHashObj *pObj; - - ipHashMemPool = taosMemPoolInit(maxSessions, sizeof(SIpHash)); - if (ipHashMemPool == 0) return NULL; - - ipHashList = calloc(sizeof(SIpHash *), (size_t)maxSessions); - if (ipHashList == 0) { - taosMemPoolCleanUp(ipHashMemPool); - return NULL; - } - - pObj = malloc(sizeof(SHashObj)); - if (pObj == NULL) { - taosMemPoolCleanUp(ipHashMemPool); - free(ipHashList); - return NULL; - } - - pObj->maxSessions = maxSessions; - pObj->ipHashMemPool = ipHashMemPool; - pObj->ipHashList = ipHashList; - - return pObj; -} - -void rpcCloseIpHash(void *handle) { - SHashObj *pObj; - - pObj = (SHashObj *)handle; - if (pObj == NULL || pObj->maxSessions == 0) return; - - if (pObj->ipHashMemPool) taosMemPoolCleanUp(pObj->ipHashMemPool); - - if (pObj->ipHashList) free(pObj->ipHashList); - - memset(pObj, 0, sizeof(SHashObj)); - free(pObj); -} diff --git a/src/rpc/src/rpcUdp.c b/src/rpc/src/rpcUdp.c index 677187e3b9..3a40f27e26 100644 --- a/src/rpc/src/rpcUdp.c +++ b/src/rpc/src/rpcUdp.c @@ -19,7 +19,6 @@ #include "ttimer.h" #include "tutil.h" #include "rpcLog.h" -#include "rpcHaship.h" #include "rpcUdp.h" #include "rpcHead.h" @@ -28,8 +27,6 @@ #define RPC_UDP_BUF_TIME 5 // mseconds #define RPC_MAX_UDP_SIZE 65480 -int tsUdpDelay = 0; - typedef struct { void *signature; int index; @@ -38,8 +35,6 @@ typedef struct { uint16_t localPort; // local port char label[12]; // copy from udpConnSet; pthread_t thread; - pthread_mutex_t mutex; - void *tmrCtrl; // copy from UdpConnSet; void *hash; void *shandle; // handle passed by upper layer during server initialization void *pSet; @@ -55,26 +50,11 @@ typedef struct { void *shandle; // handle passed by upper layer during server initialization int threads; char label[12]; - void *tmrCtrl; void *(*fp)(SRecvInfo *pPacket); SUdpConn udpConn[]; } SUdpConnSet; -typedef struct { - void *signature; - uint32_t ip; // dest IP - uint16_t port; // dest Port - SUdpConn *pConn; - struct sockaddr_in destAdd; - void *msgHdr; - int totalLen; - void *timer; - int emptyNum; -} SUdpBuf; - static void *taosRecvUdpData(void *param); -static SUdpBuf *taosCreateUdpBuf(SUdpConn *pConn, uint32_t ip, uint16_t port); -static void taosProcessUdpBufTimer(void *param, void *tmrId); void *taosInitUdpConnection(uint32_t ip, uint16_t port, char *label, int threads, void *fp, void *shandle) { SUdpConn *pConn; @@ -94,16 +74,6 @@ void *taosInitUdpConnection(uint32_t ip, uint16_t port, char *label, int threads pSet->fp = fp; strcpy(pSet->label, label); - if ( tsUdpDelay ) { - char udplabel[12]; - sprintf(udplabel, "%s.b", label); - pSet->tmrCtrl = taosTmrInit(RPC_MAX_UDP_CONNS * threads, 5, 5000, udplabel); - if (pSet->tmrCtrl == NULL) { - tError("%s failed to initialize tmrCtrl") taosCleanUpUdpConnection(pSet); - return NULL; - } - } - uint16_t ownPort; for (int i = 0; i < threads; ++i) { pConn = pSet->udpConn + i; @@ -135,11 +105,6 @@ void *taosInitUdpConnection(uint32_t ip, uint16_t port, char *label, int threads pConn->index = i; pConn->pSet = pSet; pConn->signature = pConn; - if (tsUdpDelay) { - pConn->hash = rpcOpenIpHash(RPC_MAX_UDP_CONNS); - pthread_mutex_init(&pConn->mutex, NULL); - pConn->tmrCtrl = pSet->tmrCtrl; - } pthread_attr_t thAttr; pthread_attr_init(&thAttr); @@ -173,10 +138,6 @@ void taosCleanUpUdpConnection(void *handle) { free(pConn->buffer); pthread_cancel(pConn->thread); taosCloseSocket(pConn->fd); - if (pConn->hash) { - rpcCloseIpHash(pConn->hash); - pthread_mutex_destroy(&pConn->mutex); - } } for (int i = 0; i < pSet->threads; ++i) { @@ -185,7 +146,6 @@ void taosCleanUpUdpConnection(void *handle) { tTrace("chandle:%p is closed", pConn); } - taosTmrCleanUp(pSet->tmrCtrl); tfree(pSet); } @@ -205,64 +165,42 @@ void *taosOpenUdpConnection(void *shandle, void *thandle, uint32_t ip, uint16_t static void *taosRecvUdpData(void *param) { SUdpConn *pConn = param; struct sockaddr_in sourceAdd; - int dataLen; + ssize_t dataLen; unsigned int addLen; uint16_t port; - int minSize = sizeof(SRpcHead); SRecvInfo recvInfo; memset(&sourceAdd, 0, sizeof(sourceAdd)); addLen = sizeof(sourceAdd); tTrace("%s UDP thread is created, index:%d", pConn->label, pConn->index); + char *msg = pConn->buffer; while (1) { dataLen = recvfrom(pConn->fd, pConn->buffer, RPC_MAX_UDP_SIZE, 0, (struct sockaddr *)&sourceAdd, &addLen); port = ntohs(sourceAdd.sin_port); - //tTrace("%s msg is recv from 0x%x:%hu len:%d", pConn->label, sourceAdd.sin_addr.s_addr, port, dataLen); if (dataLen < sizeof(SRpcHead)) { tError("%s recvfrom failed, reason:%s\n", pConn->label, strerror(errno)); continue; } - int processedLen = 0, leftLen = 0; - int msgLen = 0; - int count = 0; - char *msg = pConn->buffer; - while (processedLen < dataLen) { - leftLen = dataLen - processedLen; - SRpcHead *pHead = (SRpcHead *)msg; - msgLen = htonl((uint32_t)pHead->msgLen); - if (leftLen < minSize || msgLen > leftLen || msgLen < minSize) { - tError("%s msg is messed up, dataLen:%d processedLen:%d count:%d msgLen:%d", pConn->label, dataLen, - processedLen, count, msgLen); - break; - } - - char *tmsg = malloc((size_t)msgLen + tsRpcOverhead); - if (NULL == tmsg) { - tError("%s failed to allocate memory, size:%d", pConn->label, msgLen); - break; - } - - tmsg += tsRpcOverhead; // overhead for SRpcReqContext - memcpy(tmsg, msg, (size_t)msgLen); - recvInfo.msg = tmsg; - recvInfo.msgLen = msgLen; - recvInfo.ip = sourceAdd.sin_addr.s_addr; - recvInfo.port = port; - recvInfo.shandle = pConn->shandle; - recvInfo.thandle = NULL; - recvInfo.chandle = pConn; - recvInfo.connType = 0; - (*(pConn->processData))(&recvInfo); - - processedLen += msgLen; - msg += msgLen; - count++; + char *tmsg = malloc(dataLen + tsRpcOverhead); + if (NULL == tmsg) { + tError("%s failed to allocate memory, size:%d", pConn->label, dataLen); + continue; } - // tTrace("%s %d UDP packets are received together", pConn->label, count); + tmsg += tsRpcOverhead; // overhead for SRpcReqContext + memcpy(tmsg, msg, dataLen); + recvInfo.msg = tmsg; + recvInfo.msgLen = dataLen; + recvInfo.ip = sourceAdd.sin_addr.s_addr; + recvInfo.port = port; + recvInfo.shandle = pConn->shandle; + recvInfo.thandle = NULL; + recvInfo.chandle = pConn; + recvInfo.connType = 0; + (*(pConn->processData))(&recvInfo); } return NULL; @@ -270,141 +208,17 @@ static void *taosRecvUdpData(void *param) { int taosSendUdpData(uint32_t ip, uint16_t port, void *data, int dataLen, void *chandle) { SUdpConn *pConn = (SUdpConn *)chandle; - SUdpBuf *pBuf; if (pConn == NULL || pConn->signature != pConn) return -1; - if (pConn->hash == NULL) { - struct sockaddr_in destAdd; - memset(&destAdd, 0, sizeof(destAdd)); - destAdd.sin_family = AF_INET; - destAdd.sin_addr.s_addr = ip; - destAdd.sin_port = htons(port); + struct sockaddr_in destAdd; + memset(&destAdd, 0, sizeof(destAdd)); + destAdd.sin_family = AF_INET; + destAdd.sin_addr.s_addr = ip; + destAdd.sin_port = htons(port); - //tTrace("%s msg is sent to 0x%x:%hu len:%d ret:%d localPort:%hu chandle:0x%x", pConn->label, destAdd.sin_addr.s_addr, - // port, dataLen, ret, pConn->localPort, chandle); - int ret = (int)sendto(pConn->fd, data, (size_t)dataLen, 0, (struct sockaddr *)&destAdd, sizeof(destAdd)); + int ret = (int)sendto(pConn->fd, data, (size_t)dataLen, 0, (struct sockaddr *)&destAdd, sizeof(destAdd)); - return ret; - } - - pthread_mutex_lock(&pConn->mutex); - - pBuf = (SUdpBuf *)rpcGetIpHash(pConn->hash, ip, port); - if (pBuf == NULL) { - pBuf = taosCreateUdpBuf(pConn, ip, port); - rpcAddIpHash(pConn->hash, pBuf, ip, port); - } - - if ((pBuf->totalLen + dataLen > RPC_MAX_UDP_SIZE) || (taosMsgHdrSize(pBuf->msgHdr) >= RPC_MAX_UDP_PKTS)) { - taosTmrReset(taosProcessUdpBufTimer, RPC_UDP_BUF_TIME, pBuf, pConn->tmrCtrl, &pBuf->timer); - - taosSendMsgHdr(pBuf->msgHdr, pConn->fd); - pBuf->totalLen = 0; - } - - taosSetMsgHdrData(pBuf->msgHdr, data, dataLen); - - pBuf->totalLen += dataLen; - - pthread_mutex_unlock(&pConn->mutex); - - return dataLen; + return ret; } -void taosFreeMsgHdr(void *hdr) { - struct msghdr *msgHdr = (struct msghdr *)hdr; - free(msgHdr->msg_iov); -} - -int taosMsgHdrSize(void *hdr) { - struct msghdr *msgHdr = (struct msghdr *)hdr; - return (int)msgHdr->msg_iovlen; -} - -void taosSendMsgHdr(void *hdr, int fd) { - struct msghdr *msgHdr = (struct msghdr *)hdr; - sendmsg(fd, msgHdr, 0); - msgHdr->msg_iovlen = 0; -} - -void taosInitMsgHdr(void **hdr, void *dest, int maxPkts) { - struct msghdr *msgHdr = (struct msghdr *)malloc(sizeof(struct msghdr)); - memset(msgHdr, 0, sizeof(struct msghdr)); - *hdr = msgHdr; - struct sockaddr_in *destAdd = (struct sockaddr_in *)dest; - - msgHdr->msg_name = destAdd; - msgHdr->msg_namelen = sizeof(struct sockaddr_in); - int size = (int)sizeof(struct iovec) * maxPkts; - msgHdr->msg_iov = (struct iovec *)malloc((size_t)size); - memset(msgHdr->msg_iov, 0, (size_t)size); -} - -void taosSetMsgHdrData(void *hdr, char *data, int dataLen) { - struct msghdr *msgHdr = (struct msghdr *)hdr; - msgHdr->msg_iov[msgHdr->msg_iovlen].iov_base = data; - msgHdr->msg_iov[msgHdr->msg_iovlen].iov_len = (size_t)dataLen; - msgHdr->msg_iovlen++; -} - -void taosRemoveUdpBuf(SUdpBuf *pBuf) { - taosTmrStopA(&pBuf->timer); - rpcDeleteIpHash(pBuf->pConn->hash, pBuf->ip, pBuf->port); - - // tTrace("%s UDP buffer to:0x%lld:%d is removed", pBuf->pConn->label, - // pBuf->ip, pBuf->port); - - pBuf->signature = NULL; - taosFreeMsgHdr(pBuf->msgHdr); - free(pBuf); -} - -void taosProcessUdpBufTimer(void *param, void *tmrId) { - SUdpBuf *pBuf = (SUdpBuf *)param; - if (pBuf->signature != param) return; - if (pBuf->timer != tmrId) return; - - SUdpConn *pConn = pBuf->pConn; - - pthread_mutex_lock(&pConn->mutex); - - if (taosMsgHdrSize(pBuf->msgHdr) > 0) { - taosSendMsgHdr(pBuf->msgHdr, pConn->fd); - pBuf->totalLen = 0; - pBuf->emptyNum = 0; - } else { - pBuf->emptyNum++; - if (pBuf->emptyNum > 200) { - taosRemoveUdpBuf(pBuf); - pBuf = NULL; - } - } - - pthread_mutex_unlock(&pConn->mutex); - - if (pBuf) taosTmrReset(taosProcessUdpBufTimer, RPC_UDP_BUF_TIME, pBuf, pConn->tmrCtrl, &pBuf->timer); -} - -static SUdpBuf *taosCreateUdpBuf(SUdpConn *pConn, uint32_t ip, uint16_t port) { - SUdpBuf *pBuf = (SUdpBuf *)malloc(sizeof(SUdpBuf)); - memset(pBuf, 0, sizeof(SUdpBuf)); - - pBuf->ip = ip; - pBuf->port = port; - pBuf->pConn = pConn; - - pBuf->destAdd.sin_family = AF_INET; - pBuf->destAdd.sin_addr.s_addr = ip; - pBuf->destAdd.sin_port = (uint16_t)htons(port); - taosInitMsgHdr(&(pBuf->msgHdr), &(pBuf->destAdd), RPC_MAX_UDP_PKTS); - pBuf->signature = pBuf; - taosTmrReset(taosProcessUdpBufTimer, RPC_UDP_BUF_TIME, pBuf, pConn->tmrCtrl, &pBuf->timer); - - // tTrace("%s UDP buffer to:0x%lld:%d is created", pBuf->pConn->label, - // pBuf->ip, pBuf->port); - - return pBuf; -} - - From 6b2702d2e71dcf7eb832be1eac389a1bdfd3ffb1 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 22:23:33 +0800 Subject: [PATCH 122/126] scrpits --- tests/script/general/db/basic4.sim | 6 ------ tests/script/sh/deploy.sh | 8 ++++---- 2 files changed, 4 insertions(+), 10 deletions(-) diff --git a/tests/script/general/db/basic4.sim b/tests/script/general/db/basic4.sim index 8494b0358a..a0a9aaa627 100644 --- a/tests/script/general/db/basic4.sim +++ b/tests/script/general/db/basic4.sim @@ -43,9 +43,6 @@ endi if $data01 != 4 then return -1 endi -if $data02 != ready then - return -1 -endi print =============== drop table sql drop table d1.t1 @@ -82,9 +79,6 @@ endi if $data01 != 3 then return -1 endi -if $data02 != ready then - return -1 -endi print =============== drop all table sql drop table d1.t2 diff --git a/tests/script/sh/deploy.sh b/tests/script/sh/deploy.sh index bc18479896..bd85ce9704 100755 --- a/tests/script/sh/deploy.sh +++ b/tests/script/sh/deploy.sh @@ -96,10 +96,10 @@ echo "second ${HOSTNAME}:7200" >> $TAOS_CFG echo "serverPort ${NODE}" >> $TAOS_CFG echo "dataDir $DATA_DIR" >> $TAOS_CFG echo "logDir $LOG_DIR" >> $TAOS_CFG -echo "dDebugFlag 199" >> $TAOS_CFG -echo "mDebugFlag 199" >> $TAOS_CFG -echo "sdbDebugFlag 199" >> $TAOS_CFG -echo "rpcDebugFlag 151" >> $TAOS_CFG +echo "dDebugFlag 135" >> $TAOS_CFG +echo "mDebugFlag 135" >> $TAOS_CFG +echo "sdbDebugFlag 135" >> $TAOS_CFG +echo "rpcDebugFlag 135" >> $TAOS_CFG echo "tmrDebugFlag 131" >> $TAOS_CFG echo "cDebugFlag 135" >> $TAOS_CFG echo "httpDebugFlag 135" >> $TAOS_CFG From 6a3043753d040c5221e7981842074eb28518e9b0 Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 15:34:19 +0000 Subject: [PATCH 123/126] [TD-362] fix crash while auto create table --- src/mnode/src/mgmtTable.c | 7 ++++++- tests/script/general/db/basic5.sim | 3 --- 2 files changed, 6 insertions(+), 4 deletions(-) diff --git a/src/mnode/src/mgmtTable.c b/src/mnode/src/mgmtTable.c index de8f2f0ab0..3043306978 100644 --- a/src/mnode/src/mgmtTable.c +++ b/src/mnode/src/mgmtTable.c @@ -1415,7 +1415,7 @@ static SChildTableObj* mgmtDoCreateChildTable(SCMCreateTableMsg *pCreate, SVgObj char *pTagData = (char *) pCreate->schema; // it is a tag key SSuperTableObj *pSuperTable = mgmtGetSuperTable(pTagData); if (pSuperTable == NULL) { - mError("table:%s, corresponding super table does not exist", pCreate->tableId); + mError("table:%s, corresponding super table:%s does not exist", pCreate->tableId, pTagData); free(pTable); terrno = TSDB_CODE_INVALID_TABLE; return NULL; @@ -1505,6 +1505,11 @@ static void mgmtProcessCreateChildTableMsg(SQueuedMsg *pMsg) { } pMsg->pTable = (STableObj *)mgmtDoCreateChildTable(pCreate, pVgroup, sid); + if (pMsg->pTable == NULL) { + mgmtSendSimpleResp(pMsg->thandle, terrno); + return; + } + mgmtIncTableRef(pMsg->pTable); } } else { diff --git a/tests/script/general/db/basic5.sim b/tests/script/general/db/basic5.sim index 3c59144387..82b9bf9bf4 100644 --- a/tests/script/general/db/basic5.sim +++ b/tests/script/general/db/basic5.sim @@ -43,9 +43,6 @@ endi if $data01 != 4 then return -1 endi -if $data02 != ready then - return -1 -endi print =============== drop database sql drop database d1 From 34b252501a7dc191f71b7af595fa2e5c84db51ee Mon Sep 17 00:00:00 2001 From: Shengliang Guan Date: Mon, 18 May 2020 15:42:36 +0000 Subject: [PATCH 124/126] scripts --- tests/script/general/table/column_value.sim | 7 +++---- 1 file changed, 3 insertions(+), 4 deletions(-) diff --git a/tests/script/general/table/column_value.sim b/tests/script/general/table/column_value.sim index bd98d3b290..72f5faee63 100644 --- a/tests/script/general/table/column_value.sim +++ b/tests/script/general/table/column_value.sim @@ -34,13 +34,12 @@ if $rows != 0 then endi print =============== step2 -sql create table $tb (ts timestamp, speed bigint, v1 binary(1500), v2 binary(1500), v3 binary(1500), v4 binary(500), v5 binary(500)) -x step2 - return -1 -step2: +sql create table $tb (ts timestamp, speed bigint, v1 binary(1500), v2 binary(1500), v3 binary(1500), v4 binary(500), v5 binary(500)) sql show tables -if $rows != 0 then +if $rows != 1 then return -1 endi +sql drop table $tb print =============== step3 sql create table $tb (ts timestamp, speed float, v1 binary(100), v2 binary(100), v3 binary(100), v4 binary(100), v5 binary(100)) From e1ee02e326428991123ade43b10d85be2f861fe0 Mon Sep 17 00:00:00 2001 From: Steven Li Date: Mon, 18 May 2020 17:43:37 -0700 Subject: [PATCH 125/126] Ready to merge crash_gen into develop branch --- tests/pytest/crash_gen.py | 31 +- tests/pytest/crash_gen_0519.py | 831 +++++++++++++++++++++++++++++++++ tests/pytest/crash_gen_0519.sh | 41 ++ 3 files changed, 899 insertions(+), 4 deletions(-) create mode 100755 tests/pytest/crash_gen_0519.py create mode 100755 tests/pytest/crash_gen_0519.sh diff --git a/tests/pytest/crash_gen.py b/tests/pytest/crash_gen.py index 6a724709e2..44c978957e 100755 --- a/tests/pytest/crash_gen.py +++ b/tests/pytest/crash_gen.py @@ -26,6 +26,7 @@ import threading import random import logging import datetime +import textwrap from typing import List @@ -140,13 +141,13 @@ class WorkerThread: if ( gConfig.per_thread_db_connection ): return self._dbConn.execute(sql) else: - return self._tc.getDbState.getDbConn().execute(sql) + return self._tc.getDbState().getDbConn().execute(sql) def querySql(self, sql): # not "execute", since we are out side the DB context if ( gConfig.per_thread_db_connection ): return self._dbConn.query(sql) else: - return self._tc.getDbState.getDbConn().query(sql) + return self._tc.getDbState().getDbConn().query(sql) class ThreadCoordinator: def __init__(self, pool, wd: WorkDispatcher, dbState): @@ -414,7 +415,18 @@ class DbState(): # self.openDbServerConnection() self._dbConn = DbConn() - self._dbConn.open() + try: + self._dbConn.open() # may throw taos.error.ProgrammingError: disconnected + except taos.error.ProgrammingError as err: + # print("Error type: {}, msg: {}, value: {}".format(type(err), err.msg, err)) + if ( err.msg == 'disconnected' ): # cannot open DB connection + print("Cannot establish DB connection, please re-run script without parameter, and follow the instructions.") + sys.exit() + else: + raise + except: + print("[=]Unexpected exception") + raise self._dbConn.resetDb() # drop and recreate DB self._state = self.STATE_EMPTY # initial state, the result of above @@ -773,7 +785,15 @@ class WorkDispatcher(): def main(): # Super cool Python argument library: https://docs.python.org/3/library/argparse.html - parser = argparse.ArgumentParser(description='TDengine Auto Crash Generator') + parser = argparse.ArgumentParser( + formatter_class=argparse.RawDescriptionHelpFormatter, + description=textwrap.dedent('''\ + TDengine Auto Crash Generator (PLEASE NOTICE the Prerequisites Below) + --------------------------------------------------------------------- + 1. You build TDengine in the top level ./build directory, as described in offical docs + 2. You run the server there before this script: ./build/bin/taosd -c test/cfg + + ''')) parser.add_argument('-p', '--per-thread-db-connection', action='store_true', help='Use a single shared db connection (default: false)') parser.add_argument('-d', '--debug', action='store_true', @@ -785,6 +805,9 @@ def main(): global gConfig gConfig = parser.parse_args() + if len(sys.argv) == 1: + parser.print_help() + sys.exit() global logger logger = logging.getLogger('myApp') diff --git a/tests/pytest/crash_gen_0519.py b/tests/pytest/crash_gen_0519.py new file mode 100755 index 0000000000..44c978957e --- /dev/null +++ b/tests/pytest/crash_gen_0519.py @@ -0,0 +1,831 @@ +#!/usr/bin/python3.7 +################################################################### +# Copyright (c) 2016 by TAOS Technologies, Inc. +# All rights reserved. +# +# This file is proprietary and confidential to TAOS Technologies. +# No part of this file may be reproduced, stored, transmitted, +# disclosed or used in any form or by any means other than as +# expressly provided by the written permission from Jianhui Tao +# +################################################################### + +# -*- coding: utf-8 -*- +from __future__ import annotations # For type hinting before definition, ref: https://stackoverflow.com/questions/33533148/how-do-i-specify-that-the-return-type-of-a-method-is-the-same-as-the-class-itsel + +import sys +# Require Python 3 +if sys.version_info[0] < 3: + raise Exception("Must be using Python 3") + +import getopt +import argparse +import copy + +import threading +import random +import logging +import datetime +import textwrap + +from typing import List + +from util.log import * +from util.dnodes import * +from util.cases import * +from util.sql import * + +import crash_gen +import taos + +# Global variables, tried to keep a small number. +gConfig = None # Command-line/Environment Configurations, will set a bit later +logger = None + +def runThread(wt: WorkerThread): + wt.run() + +class WorkerThread: + def __init__(self, pool: ThreadPool, tid, + tc: ThreadCoordinator, + # te: TaskExecutor, + ): # note: main thread context! + # self._curStep = -1 + self._pool = pool + self._tid = tid + self._tc = tc + # self.threadIdent = threading.get_ident() + self._thread = threading.Thread(target=runThread, args=(self,)) + self._stepGate = threading.Event() + + # Let us have a DB connection of our own + if ( gConfig.per_thread_db_connection ): # type: ignore + self._dbConn = DbConn() + + def logDebug(self, msg): + logger.info(" t[{}] {}".format(self._tid, msg)) + + def logInfo(self, msg): + logger.info(" t[{}] {}".format(self._tid, msg)) + + + def getTaskExecutor(self): + return self._tc.getTaskExecutor() + + def start(self): + self._thread.start() # AFTER the thread is recorded + + def run(self): + # initialization after thread starts, in the thread context + # self.isSleeping = False + logger.info("Starting to run thread: {}".format(self._tid)) + + if ( gConfig.per_thread_db_connection ): # type: ignore + self._dbConn.open() + + self._doTaskLoop() + + # clean up + if ( gConfig.per_thread_db_connection ): # type: ignore + self._dbConn.close() + + def _doTaskLoop(self) : + # while self._curStep < self._pool.maxSteps: + # tc = ThreadCoordinator(None) + while True: + tc = self._tc # Thread Coordinator, the overall master + tc.crossStepBarrier() # shared barrier first, INCLUDING the last one + logger.debug("Thread task loop exited barrier...") + self.crossStepGate() # then per-thread gate, after being tapped + logger.debug("Thread task loop exited step gate...") + if not self._tc.isRunning(): + break + + task = tc.fetchTask() + task.execute(self) + tc.saveExecutedTask(task) + + def verifyThreadSelf(self): # ensure we are called by this own thread + if ( threading.get_ident() != self._thread.ident ): + raise RuntimeError("Unexpectly called from other threads") + + def verifyThreadMain(self): # ensure we are called by the main thread + if ( threading.get_ident() != threading.main_thread().ident ): + raise RuntimeError("Unexpectly called from other threads") + + def verifyThreadAlive(self): + if ( not self._thread.is_alive() ): + raise RuntimeError("Unexpected dead thread") + + # A gate is different from a barrier in that a thread needs to be "tapped" + def crossStepGate(self): + self.verifyThreadAlive() + self.verifyThreadSelf() # only allowed by ourselves + + # Wait again at the "gate", waiting to be "tapped" + # logger.debug("Worker thread {} about to cross the step gate".format(self._tid)) + self._stepGate.wait() + self._stepGate.clear() + + # self._curStep += 1 # off to a new step... + + def tapStepGate(self): # give it a tap, release the thread waiting there + self.verifyThreadAlive() + self.verifyThreadMain() # only allowed for main thread + + logger.debug("Tapping worker thread {}".format(self._tid)) + self._stepGate.set() # wake up! + time.sleep(0) # let the released thread run a bit + + def execSql(self, sql): # not "execute", since we are out side the DB context + if ( gConfig.per_thread_db_connection ): + return self._dbConn.execute(sql) + else: + return self._tc.getDbState().getDbConn().execute(sql) + + def querySql(self, sql): # not "execute", since we are out side the DB context + if ( gConfig.per_thread_db_connection ): + return self._dbConn.query(sql) + else: + return self._tc.getDbState().getDbConn().query(sql) + +class ThreadCoordinator: + def __init__(self, pool, wd: WorkDispatcher, dbState): + self._curStep = -1 # first step is 0 + self._pool = pool + self._wd = wd + self._te = None # prepare for every new step + self._dbState = dbState + self._executedTasks: List[Task] = [] # in a given step + self._lock = threading.RLock() # sync access for a few things + + self._stepBarrier = threading.Barrier(self._pool.numThreads + 1) # one barrier for all threads + + def getTaskExecutor(self): + return self._te + + def getDbState(self) -> DbState : + return self._dbState + + def crossStepBarrier(self): + self._stepBarrier.wait() + + def run(self): + self._pool.createAndStartThreads(self) + + # Coordinate all threads step by step + self._curStep = -1 # not started yet + maxSteps = gConfig.max_steps # type: ignore + while(self._curStep < maxSteps): + print(".", end="", flush=True) + logger.debug("Main thread going to sleep") + + # Now ready to enter a step + self.crossStepBarrier() # let other threads go past the pool barrier, but wait at the thread gate + self._stepBarrier.reset() # Other worker threads should now be at the "gate" + + # At this point, all threads should be pass the overall "barrier" and before the per-thread "gate" + self._dbState.transition(self._executedTasks) # at end of step, transiton the DB state + self.resetExecutedTasks() # clear the tasks after we are done + + # Get ready for next step + logger.info("<-- Step {} finished".format(self._curStep)) + self._curStep += 1 # we are about to get into next step. TODO: race condition here! + logger.debug("\r\n--> Step {} starts with main thread waking up".format(self._curStep)) # Now not all threads had time to go to sleep + + # A new TE for the new step + self._te = TaskExecutor(self._curStep) + + logger.debug("Main thread waking up at step {}, tapping worker threads".format(self._curStep)) # Now not all threads had time to go to sleep + self.tapAllThreads() + + logger.debug("Main thread ready to finish up...") + self.crossStepBarrier() # Cross it one last time, after all threads finish + self._stepBarrier.reset() + logger.debug("Main thread in exclusive zone...") + self._te = None # No more executor, time to end + logger.debug("Main thread tapping all threads one last time...") + self.tapAllThreads() # Let the threads run one last time + logger.debug("Main thread joining all threads") + self._pool.joinAll() # Get all threads to finish + + logger.info("All threads finished") + print("\r\nFinished") + + def tapAllThreads(self): # in a deterministic manner + wakeSeq = [] + for i in range(self._pool.numThreads): # generate a random sequence + if Dice.throw(2) == 1 : + wakeSeq.append(i) + else: + wakeSeq.insert(0, i) + logger.info("Waking up threads: {}".format(str(wakeSeq))) + # TODO: set dice seed to a deterministic value + for i in wakeSeq: + self._pool.threadList[i].tapStepGate() # TODO: maybe a bit too deep?! + time.sleep(0) # yield + + def isRunning(self): + return self._te != None + + def fetchTask(self) -> Task : + if ( not self.isRunning() ): # no task + raise RuntimeError("Cannot fetch task when not running") + # return self._wd.pickTask() + # Alternatively, let's ask the DbState for the appropriate task + dbState = self.getDbState() + tasks = dbState.getTasksAtState() + i = Dice.throw(len(tasks)) + # return copy.copy(tasks[i]) # Needs a fresh copy, to save execution results, etc. + return tasks[i].clone() + + def resetExecutedTasks(self): + self._executedTasks = [] # should be under single thread + + def saveExecutedTask(self, task): + with self._lock: + self._executedTasks.append(task) + +# We define a class to run a number of threads in locking steps. +class ThreadPool: + def __init__(self, dbState, numThreads, maxSteps, funcSequencer): + self.numThreads = numThreads + self.maxSteps = maxSteps + self.funcSequencer = funcSequencer + # Internal class variables + self.dispatcher = WorkDispatcher(dbState) + self.curStep = 0 + self.threadList = [] + # self.stepGate = threading.Condition() # Gate to hold/sync all threads + # self.numWaitingThreads = 0 + + # starting to run all the threads, in locking steps + def createAndStartThreads(self, tc: ThreadCoordinator): + for tid in range(0, self.numThreads): # Create the threads + workerThread = WorkerThread(self, tid, tc) + self.threadList.append(workerThread) + workerThread.start() # start, but should block immediately before step 0 + + def joinAll(self): + for workerThread in self.threadList: + logger.debug("Joining thread...") + workerThread._thread.join() + +# A queue of continguous POSITIVE integers +class LinearQueue(): + def __init__(self): + self.firstIndex = 1 # 1st ever element + self.lastIndex = 0 + self._lock = threading.RLock() # our functions may call each other + self.inUse = set() # the indexes that are in use right now + + def toText(self): + return "[{}..{}], in use: {}".format(self.firstIndex, self.lastIndex, self.inUse) + + # Push (add new element, largest) to the tail, and mark it in use + def push(self): + with self._lock: + # if ( self.isEmpty() ): + # self.lastIndex = self.firstIndex + # return self.firstIndex + # Otherwise we have something + self.lastIndex += 1 + self.allocate(self.lastIndex) + # self.inUse.add(self.lastIndex) # mark it in use immediately + return self.lastIndex + + def pop(self): + with self._lock: + if ( self.isEmpty() ): + # raise RuntimeError("Cannot pop an empty queue") + return False # TODO: None? + + index = self.firstIndex + if ( index in self.inUse ): + return False + + self.firstIndex += 1 + return index + + def isEmpty(self): + return self.firstIndex > self.lastIndex + + def popIfNotEmpty(self): + with self._lock: + if (self.isEmpty()): + return 0 + return self.pop() + + def allocate(self, i): + with self._lock: + # logger.debug("LQ allocating item {}".format(i)) + if ( i in self.inUse ): + raise RuntimeError("Cannot re-use same index in queue: {}".format(i)) + self.inUse.add(i) + + def release(self, i): + with self._lock: + # logger.debug("LQ releasing item {}".format(i)) + self.inUse.remove(i) # KeyError possible, TODO: why? + + def size(self): + return self.lastIndex + 1 - self.firstIndex + + def pickAndAllocate(self): + if ( self.isEmpty() ): + return None + with self._lock: + cnt = 0 # counting the interations + while True: + cnt += 1 + if ( cnt > self.size()*10 ): # 10x iteration already + # raise RuntimeError("Failed to allocate LinearQueue element") + return None + ret = Dice.throwRange(self.firstIndex, self.lastIndex+1) + if ( not ret in self.inUse ): + self.allocate(ret) + return ret + +class DbConn: + def __init__(self): + self._conn = None + self._cursor = None + self.isOpen = False + + def open(self): # Open connection + if ( self.isOpen ): + raise RuntimeError("Cannot re-open an existing DB connection") + + cfgPath = "../../build/test/cfg" + self._conn = taos.connect(host="127.0.0.1", config=cfgPath) # TODO: make configurable + self._cursor = self._conn.cursor() + + # Get the connection/cursor ready + self._cursor.execute('reset query cache') + # self._cursor.execute('use db') + + # Open connection + self._tdSql = TDSql() + self._tdSql.init(self._cursor) + self.isOpen = True + + def resetDb(self): # reset the whole database, etc. + if ( not self.isOpen ): + raise RuntimeError("Cannot reset database until connection is open") + # self._tdSql.prepare() # Recreate database, etc. + + self._cursor.execute('drop database if exists db') + logger.debug("Resetting DB, dropped database") + # self._cursor.execute('create database db') + # self._cursor.execute('use db') + + # tdSql.execute('show databases') + + def close(self): + if ( not self.isOpen ): + raise RuntimeError("Cannot clean up database until connection is open") + self._tdSql.close() + self.isOpen = False + + def execute(self, sql): + if ( not self.isOpen ): + raise RuntimeError("Cannot execute database commands until connection is open") + return self._tdSql.execute(sql) + + def query(self, sql) -> int : # return number of rows retrieved + if ( not self.isOpen ): + raise RuntimeError("Cannot query database until connection is open") + return self._tdSql.query(sql) + + +# State of the database as we believe it to be +class DbState(): + STATE_INVALID = -1 + STATE_EMPTY = 1 # nothing there, no even a DB + STATE_DB_ONLY = 2 # we have a DB, but nothing else + STATE_TABLE_ONLY = 3 # we have a table, but totally empty + STATE_HAS_DATA = 4 # we have some data in the table + + def __init__(self): + self.tableNumQueue = LinearQueue() + self._lastTick = datetime.datetime(2019, 1, 1) # initial date time tick + self._lastInt = 0 # next one is initial integer + self._lock = threading.RLock() + self._state = self.STATE_INVALID + + # self.openDbServerConnection() + self._dbConn = DbConn() + try: + self._dbConn.open() # may throw taos.error.ProgrammingError: disconnected + except taos.error.ProgrammingError as err: + # print("Error type: {}, msg: {}, value: {}".format(type(err), err.msg, err)) + if ( err.msg == 'disconnected' ): # cannot open DB connection + print("Cannot establish DB connection, please re-run script without parameter, and follow the instructions.") + sys.exit() + else: + raise + except: + print("[=]Unexpected exception") + raise + self._dbConn.resetDb() # drop and recreate DB + self._state = self.STATE_EMPTY # initial state, the result of above + + def getDbConn(self): + return self._dbConn + + def pickAndAllocateTable(self): # pick any table, and "use" it + return self.tableNumQueue.pickAndAllocate() + + def addTable(self): + with self._lock: + tIndex = self.tableNumQueue.push() + return tIndex + + def getFixedTableName(self): + return "fixed_table" + + def releaseTable(self, i): # return the table back, so others can use it + self.tableNumQueue.release(i) + + def getNextTick(self): + with self._lock: # prevent duplicate tick + self._lastTick += datetime.timedelta(0, 1) # add one second to it + return self._lastTick + + def getNextInt(self): + with self._lock: + self._lastInt += 1 + return self._lastInt + + def getTableNameToDelete(self): + tblNum = self.tableNumQueue.pop() # TODO: race condition! + if ( not tblNum ): # maybe false + return False + + return "table_{}".format(tblNum) + + def execSql(self, sql): # using the main DB connection + return self._dbConn.execute(sql) + + def cleanUp(self): + self._dbConn.close() + + def getTasksAtState(self): + tasks = [] + tasks.append(ReadFixedDataTask(self)) # always + if ( self._state == self.STATE_EMPTY ): + tasks.append(CreateDbTask(self)) + tasks.append(CreateFixedTableTask(self)) + elif ( self._state == self.STATE_DB_ONLY ): + tasks.append(DropDbTask(self)) + tasks.append(CreateFixedTableTask(self)) + tasks.append(AddFixedDataTask(self)) + elif ( self._state == self.STATE_TABLE_ONLY ): + tasks.append(DropFixedTableTask(self)) + tasks.append(AddFixedDataTask(self)) + elif ( self._state == self.STATE_HAS_DATA ) : # same as above. TODO: adjust + tasks.append(DropFixedTableTask(self)) + tasks.append(AddFixedDataTask(self)) + else: + raise RuntimeError("Unexpected DbState state: {}".format(self._state)) + return tasks + + def transition(self, tasks): + if ( len(tasks) == 0 ): # before 1st step, or otherwise empty + return # do nothing + if ( self._state == self.STATE_EMPTY ): + # self.assertNoSuccess(tasks, ReadFixedDataTask) # some read may be successful, since we might be creating a table + if ( self.hasSuccess(tasks, CreateDbTask) ): + self.assertAtMostOneSuccess(tasks, CreateDbTask) # param is class + self._state = self.STATE_DB_ONLY + if ( self.hasSuccess(tasks, CreateFixedTableTask )): + self._state = self.STATE_TABLE_ONLY + # else: # no successful table creation, not much we can say, as it is step 2 + else: # did not create db + self.assertNoTask(tasks, CreateDbTask) # because we did not have such task + # self.assertNoSuccess(tasks, CreateDbTask) # not necessary, since we just verified no such task + self.assertNoSuccess(tasks, CreateFixedTableTask) + + elif ( self._state == self.STATE_DB_ONLY ): + self.assertAtMostOneSuccess(tasks, DropDbTask) + self.assertIfExistThenSuccess(tasks, DropDbTask) + self.assertAtMostOneSuccess(tasks, CreateFixedTableTask) + # Nothing to be said about adding data task + if ( self.hasSuccess(tasks, DropDbTask) ): # dropped the DB + # self.assertHasTask(tasks, DropDbTask) # implied by hasSuccess + self.assertAtMostOneSuccess(tasks, DropDbTask) + self._state = self.STATE_EMPTY + elif ( self.hasSuccess(tasks, CreateFixedTableTask) ): # did not drop db, create table success + # self.assertHasTask(tasks, CreateFixedTableTask) # tried to create table + self.assertAtMostOneSuccess(tasks, CreateFixedTableTask) # at most 1 attempt is successful + self.assertNoTask(tasks, DropDbTask) # should have have tried + if ( not self.hasSuccess(tasks, AddFixedDataTask) ): # just created table, no data yet + # can't say there's add-data attempts, since they may all fail + self._state = self.STATE_TABLE_ONLY + else: + self._state = self.STATE_HAS_DATA + else: # no success in dropping db tasks, no success in create fixed table, not acceptable + raise RuntimeError("Unexpected no-success scenario") + + elif ( self._state == self.STATE_TABLE_ONLY ): + if ( self.hasSuccess(tasks, DropFixedTableTask) ): + self.assertAtMostOneSuccess(tasks, DropFixedTableTask) + self._state = self.STATE_DB_ONLY + elif ( self.hasSuccess(tasks, AddFixedDataTask) ): # no success dropping the table + self.assertNoTask(tasks, DropFixedTableTask) + self._state = self.STATE_HAS_DATA + else: # did not drop table, did not insert data, that is impossible + raise RuntimeError("Unexpected no-success scenarios") + + elif ( self._state == self.STATE_HAS_DATA ): # Same as above, TODO: adjust + if ( self.hasSuccess(tasks, DropFixedTableTask) ): + self.assertAtMostOneSuccess(tasks, DropFixedTableTask) + self._state = self.STATE_DB_ONLY + elif ( self.hasSuccess(tasks, AddFixedDataTask) ): # no success dropping the table + self.assertNoTask(tasks, DropFixedTableTask) + self._state = self.STATE_HAS_DATA + else: # did not drop table, did not insert data, that is impossible + raise RuntimeError("Unexpected no-success scenarios") + + else: + raise RuntimeError("Unexpected DbState state: {}".format(self._state)) + logger.debug("New DB state is: {}".format(self._state)) + + def assertAtMostOneSuccess(self, tasks, cls): + sCnt = 0 + for task in tasks : + if not isinstance(task, cls): + continue + if task.isSuccess(): + task.logDebug("Task success found") + sCnt += 1 + if ( sCnt >= 2 ): + raise RuntimeError("Unexpected more than 1 success with task: {}".format(cls)) + + def assertIfExistThenSuccess(self, tasks, cls): + sCnt = 0 + exists = False + for task in tasks : + if not isinstance(task, cls): + continue + exists = True # we have a valid instance + if task.isSuccess(): + sCnt += 1 + if ( exists and sCnt <= 0 ): + raise RuntimeError("Unexpected zero success for task: {}".format(cls)) + + def assertNoTask(self, tasks, cls): + for task in tasks : + if isinstance(task, cls): + raise RuntimeError("Unexpected task: {}".format(cls)) + + def assertNoSuccess(self, tasks, cls): + for task in tasks : + if isinstance(task, cls): + if task.isSuccess(): + raise RuntimeError("Unexpected successful task: {}".format(cls)) + + def hasSuccess(self, tasks, cls): + for task in tasks : + if not isinstance(task, cls): + continue + if task.isSuccess(): + return True + return False + +class TaskExecutor(): + def __init__(self, curStep): + self._curStep = curStep + + def getCurStep(self): + return self._curStep + + def execute(self, task: Task, wt: WorkerThread): # execute a task on a thread + task.execute(wt) + + # def logInfo(self, msg): + # logger.info(" T[{}.x]: ".format(self._curStep) + msg) + + # def logDebug(self, msg): + # logger.debug(" T[{}.x]: ".format(self._curStep) + msg) + +class Task(): + taskSn = 100 + + @classmethod + def allocTaskNum(cls): + cls.taskSn += 1 + return cls.taskSn + + def __init__(self, dbState: DbState): + self._dbState = dbState + self._workerThread = None + self._err = None + self._curStep = None + self._numRows = None # Number of rows affected + + # Assign an incremental task serial number + self._taskNum = self.allocTaskNum() + + def isSuccess(self): + return self._err == None + + def clone(self): + newTask = self.__class__(self._dbState) + return newTask + + def logDebug(self, msg): + self._workerThread.logDebug("s[{}.{}] {}".format(self._curStep, self._taskNum, msg)) + + def logInfo(self, msg): + self._workerThread.logInfo("s[{}.{}] {}".format(self._curStep, self._taskNum, msg)) + + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + raise RuntimeError("To be implemeted by child classes, class name: {}".format(self.__class__.__name__)) + + def execute(self, wt: WorkerThread): + wt.verifyThreadSelf() + self._workerThread = wt # type: ignore + + te = wt.getTaskExecutor() + self._curStep = te.getCurStep() + self.logDebug("[-] executing task {}...".format(self.__class__.__name__)) + + self._err = None + try: + self._executeInternal(te, wt) # TODO: no return value? + except taos.error.ProgrammingError as err: + self.logDebug("[=]Taos Execution exception: {0}".format(err)) + self._err = err + except: + self.logDebug("[=]Unexpected exception") + raise + + self.logDebug("[X] task execution completed, {}, status: {}".format(self.__class__.__name__, "Success" if self.isSuccess() else "Failure")) + + def execSql(self, sql): + return self._dbState.execute(sql) + +class CreateDbTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + wt.execSql("create database db") + +class DropDbTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + wt.execSql("drop database db") + +class CreateTableTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tIndex = self._dbState.addTable() + self.logDebug("Creating a table {} ...".format(tIndex)) + wt.execSql("create table db.table_{} (ts timestamp, speed int)".format(tIndex)) + self.logDebug("Table {} created.".format(tIndex)) + self._dbState.releaseTable(tIndex) + +class CreateFixedTableTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tblName = self._dbState.getFixedTableName() + wt.execSql("create table db.{} (ts timestamp, speed int)".format(tblName)) + +class ReadFixedDataTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tblName = self._dbState.getFixedTableName() + self._numRows = wt.querySql("select * from db.{}".format(tblName)) # save the result for later + # tdSql.query(" cars where tbname in ('carzero', 'carone')") + +class DropTableTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tableName = self._dbState.getTableNameToDelete() + if ( not tableName ): # May be "False" + self.logInfo("Cannot generate a table to delete, skipping...") + return + self.logInfo("Dropping a table db.{} ...".format(tableName)) + wt.execSql("drop table db.{}".format(tableName)) + +class DropFixedTableTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + tblName = self._dbState.getFixedTableName() + wt.execSql("drop table db.{}".format(tblName)) + +class AddDataTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + ds = self._dbState + self.logInfo("Adding some data... numQueue={}".format(ds.tableNumQueue.toText())) + tIndex = ds.pickAndAllocateTable() + if ( tIndex == None ): + self.logInfo("No table found to add data, skipping...") + return + sql = "insert into db.table_{} values ('{}', {});".format(tIndex, ds.getNextTick(), ds.getNextInt()) + self.logDebug("Executing SQL: {}".format(sql)) + wt.execSql(sql) + ds.releaseTable(tIndex) + self.logDebug("Finished adding data") + +class AddFixedDataTask(Task): + def _executeInternal(self, te: TaskExecutor, wt: WorkerThread): + ds = self._dbState + sql = "insert into db.table_{} values ('{}', {});".format(ds.getFixedTableName(), ds.getNextTick(), ds.getNextInt()) + wt.execSql(sql) + +# Deterministic random number generator +class Dice(): + seeded = False # static, uninitialized + + @classmethod + def seed(cls, s): # static + if (cls.seeded): + raise RuntimeError("Cannot seed the random generator more than once") + cls.verifyRNG() + random.seed(s) + cls.seeded = True # TODO: protect against multi-threading + + @classmethod + def verifyRNG(cls): # Verify that the RNG is determinstic + random.seed(0) + x1 = random.randrange(0, 1000) + x2 = random.randrange(0, 1000) + x3 = random.randrange(0, 1000) + if ( x1 != 864 or x2!=394 or x3!=776 ): + raise RuntimeError("System RNG is not deterministic") + + @classmethod + def throw(cls, stop): # get 0 to stop-1 + return cls.throwRange(0, stop) + + @classmethod + def throwRange(cls, start, stop): # up to stop-1 + if ( not cls.seeded ): + raise RuntimeError("Cannot throw dice before seeding it") + return random.randrange(start, stop) + + +# Anyone needing to carry out work should simply come here +class WorkDispatcher(): + def __init__(self, dbState): + # self.totalNumMethods = 2 + self.tasks = [ + CreateTableTask(dbState), + DropTableTask(dbState), + AddDataTask(dbState), + ] + + def throwDice(self): + max = len(self.tasks) - 1 + dRes = random.randint(0, max) + # logger.debug("Threw the dice in range [{},{}], and got: {}".format(0,max,dRes)) + return dRes + + def pickTask(self): + dice = self.throwDice() + return self.tasks[dice] + + def doWork(self, workerThread): + task = self.pickTask() + task.execute(workerThread) + +def main(): + # Super cool Python argument library: https://docs.python.org/3/library/argparse.html + parser = argparse.ArgumentParser( + formatter_class=argparse.RawDescriptionHelpFormatter, + description=textwrap.dedent('''\ + TDengine Auto Crash Generator (PLEASE NOTICE the Prerequisites Below) + --------------------------------------------------------------------- + 1. You build TDengine in the top level ./build directory, as described in offical docs + 2. You run the server there before this script: ./build/bin/taosd -c test/cfg + + ''')) + parser.add_argument('-p', '--per-thread-db-connection', action='store_true', + help='Use a single shared db connection (default: false)') + parser.add_argument('-d', '--debug', action='store_true', + help='Turn on DEBUG mode for more logging (default: false)') + parser.add_argument('-s', '--max-steps', action='store', default=100, type=int, + help='Maximum number of steps to run (default: 100)') + parser.add_argument('-t', '--num-threads', action='store', default=10, type=int, + help='Number of threads to run (default: 10)') + + global gConfig + gConfig = parser.parse_args() + if len(sys.argv) == 1: + parser.print_help() + sys.exit() + + global logger + logger = logging.getLogger('myApp') + if ( gConfig.debug ): + logger.setLevel(logging.DEBUG) # default seems to be INFO + ch = logging.StreamHandler() + logger.addHandler(ch) + + dbState = DbState() + Dice.seed(0) # initial seeding of dice + tc = ThreadCoordinator( + ThreadPool(dbState, gConfig.num_threads, gConfig.max_steps, 0), + WorkDispatcher(dbState), + dbState + ) + tc.run() + dbState.cleanUp() + logger.info("Finished running thread pool") + +if __name__ == "__main__": + main() diff --git a/tests/pytest/crash_gen_0519.sh b/tests/pytest/crash_gen_0519.sh new file mode 100755 index 0000000000..3e744d7926 --- /dev/null +++ b/tests/pytest/crash_gen_0519.sh @@ -0,0 +1,41 @@ +#!/bin/bash + +# This is the script for us to try to cause the TDengine server or client to crash +# +# PREPARATION +# +# 1. Build an compile the TDengine source code that comes with this script, in the same directory tree +# 2. Please follow the direction in our README.md, and build TDengine in the build/ directory +# 3. Adjust the configuration file if needed under build/test/cfg/taos.cfg +# 4. Run the TDengine server instance: cd build; ./build/bin/taosd -c test/cfg +# 5. Make sure you have a working Python3 environment: run /usr/bin/python3 --version, and you should get 3.6 or above +# 6. Make sure you have the proper Python packages: # sudo apt install python3-setuptools python3-pip python3-distutils +# +# RUNNING THIS SCRIPT +# +# This script assumes the source code directory is intact, and that the binaries has been built in the +# build/ directory, as such, will will load the Python libraries in the directory tree, and also load +# the TDengine client shared library (so) file, in the build/directory, as evidenced in the env +# variables below. +# +# Running the script is simple, no parameter is needed (for now, but will change in the future). +# +# Happy Crashing... + + +# Due to the heavy path name assumptions/usage, let us require that the user be in the current directory +EXEC_DIR=`dirname "$0"` +if [[ $EXEC_DIR != "." ]] +then + echo "ERROR: Please execute `basename "$0"` in its own directory (for now anyway, pardon the dust)" + exit -1 +fi + +# First we need to set up a path for Python to find our own TAOS modules, so that "import" can work. +export PYTHONPATH=$(pwd)/../../src/connector/python/linux/python3 + +# Then let us set up the library path so that our compiled SO file can be loaded by Python +export LD_LIBRARY_PATH=$LD_LIBRARY_PATH:$(pwd)/../../build/build/lib + +# Now we are all let, and let's see if we can find a crash. Note we pass all params +./crash_gen_0519.py $@ From 5911bf64c33bec340be7323e2c5f503fd9dbba52 Mon Sep 17 00:00:00 2001 From: Hongze Cheng Date: Tue, 19 May 2020 01:50:14 +0000 Subject: [PATCH 126/126] fix clean up coredump --- src/tsdb/src/tsdbMeta.c | 1 + 1 file changed, 1 insertion(+) diff --git a/src/tsdb/src/tsdbMeta.c b/src/tsdb/src/tsdbMeta.c index 5516231483..80bfe58f0a 100644 --- a/src/tsdb/src/tsdbMeta.c +++ b/src/tsdb/src/tsdbMeta.c @@ -154,6 +154,7 @@ STsdbMeta *tsdbInitMeta(char *rootDir, int32_t maxTables) { STsdbMeta *pMeta = (STsdbMeta *)malloc(sizeof(STsdbMeta)); if (pMeta == NULL) return NULL; + pMeta->maxTables = maxTables; pMeta->nTables = 0; pMeta->superList = NULL; pMeta->tables = (STable **)calloc(maxTables, sizeof(STable *));